From 056c88f741acad167af812407525733b379c5ccc Mon Sep 17 00:00:00 2001 From: Albin Ekblom Date: Fri, 9 Jun 2017 20:29:15 +0200 Subject: [PATCH 01/62] Check default app (#1918) * Check .js default app * Cleanup fallback check * Check all keys * Check for empty strings --- app/config/open.js | 76 ++++++++++++++++++++++++++++++++++++---------- 1 file changed, 60 insertions(+), 16 deletions(-) diff --git a/app/config/open.js b/app/config/open.js index 9d7d0aa9..c344390d 100644 --- a/app/config/open.js +++ b/app/config/open.js @@ -4,7 +4,56 @@ const {cfgPath} = require('./paths'); module.exports = () => Promise.resolve(shell.openItem(cfgPath)); if (process.platform === 'win32') { - const exec = require('child_process').exec; + const Registry = require('winreg'); + const {exec} = require('child_process'); + + // Windows opens .js files with WScript.exe by default + // If the user hasn't set up an editor for .js files, we fallback to notepad. + const getFileExtKeys = () => new Promise((resolve, reject) => { + Registry({ + hive: Registry.HKCU, + key: '\\Software\\Microsoft\\Windows\\CurrentVersion\\Explorer\\FileExts\\.js' + }) + .keys((error, keys) => { + if (error) { + reject(error); + } else { + resolve(keys || []); + } + }); + }); + + const hasDefaultSet = async () => { + const keys = await getFileExtKeys(); + + const valueGroups = await Promise.all(keys.map(key => new Promise((resolve, reject) => { + key.values((error, items) => { + if (error) { + reject(error); + } + resolve(items.map(item => item.value || '') || []); + }); + }))); + + const values = valueGroups + .reduce((allValues, groupValues) => ([...allValues, ...groupValues]), []) + .filter(value => value && typeof value === 'string'); + + // No default app set + if (values.length === 0) { + return false; + } + + // WScript is in default apps list + if (values.some(value => value.includes('WScript.exe'))) { + const userDefaults = values.filter(value => value.endsWith('.exe') && !value.includes('WScript.exe')); + + // WScript.exe is overidden + return (userDefaults.length > 0); + } + + return true; + }; // This mimics shell.openItem, true if it worked, false if not. const openNotepad = file => new Promise(resolve => { @@ -13,21 +62,16 @@ if (process.platform === 'win32') { }); }); - // Windows opens .js files with WScript.exe by default - // If the user hasn't set up an editor for .js files, we fallback to notepad. - const canOpenNative = () => new Promise((resolve, reject) => { - exec('ftype JSFile', (error, stdout) => { - if (error) { - reject(error); - } else if (stdout && stdout.includes('WScript.exe')) { - reject(new Error('WScript is the default editor for .js files')); - } else { - resolve(true); + module.exports = () => hasDefaultSet() + .then(yes => { + if (yes) { + return shell.openItem(cfgPath); } + console.warn('No default app set for .js files, using notepad.exe fallback'); + return openNotepad(cfgPath); + }) + .catch(err => { + console.error('Open config with default app error:', err); + return openNotepad(cfgPath); }); - }); - - module.exports = () => canOpenNative() - .then(() => shell.openItem(cfgPath)) - .catch(() => openNotepad(cfgPath)); } From 38db5095d9bb0fdb863351f81584bcb827f8c1ec Mon Sep 17 00:00:00 2001 From: Benjamin Staneck Date: Tue, 13 Jun 2017 00:58:30 +0200 Subject: [PATCH 02/62] Make npm run clean platform agnostic (#1901) * Make npm run clean platform agnostic * Use rimraf-standalone.js instead of a global install --- bin/rimraf-standalone.js | 3716 ++++++++++++++++++++++++++++++++++++++ package.json | 5 +- 2 files changed, 3719 insertions(+), 2 deletions(-) create mode 100644 bin/rimraf-standalone.js diff --git a/bin/rimraf-standalone.js b/bin/rimraf-standalone.js new file mode 100644 index 00000000..2a770410 --- /dev/null +++ b/bin/rimraf-standalone.js @@ -0,0 +1,3716 @@ +function _interopDefault (ex) { return (ex && (typeof ex === 'object') && 'default' in ex) ? ex['default'] : ex; } + +var assert = _interopDefault(require('assert')); +var require$$0 = _interopDefault(require('path')); +var fs = _interopDefault(require('fs')); +var util = _interopDefault(require('util')); +var events = _interopDefault(require('events')); + +// Copyright Joyent, Inc. and other Node contributors. +// +// Permission is hereby granted, free of charge, to any person obtaining a +// copy of this software and associated documentation files (the +// "Software"), to deal in the Software without restriction, including +// without limitation the rights to use, copy, modify, merge, publish, +// distribute, sublicense, and/or sell copies of the Software, and to permit +// persons to whom the Software is furnished to do so, subject to the +// following conditions: +// +// The above copyright notice and this permission notice shall be included +// in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN +// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, +// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE +// USE OR OTHER DEALINGS IN THE SOFTWARE. + +var pathModule = require$$0; +var isWindows$1 = process.platform === 'win32'; +var fs$4 = fs; + +// JavaScript implementation of realpath, ported from node pre-v6 + +var DEBUG = process.env.NODE_DEBUG && /fs/.test(process.env.NODE_DEBUG); + +function rethrow() { + // Only enable in debug mode. A backtrace uses ~1000 bytes of heap space and + // is fairly slow to generate. + var callback; + if (DEBUG) { + var backtrace = new Error; + callback = debugCallback; + } else + callback = missingCallback; + + return callback; + + function debugCallback(err) { + if (err) { + backtrace.message = err.message; + err = backtrace; + missingCallback(err); + } + } + + function missingCallback(err) { + if (err) { + if (process.throwDeprecation) + throw err; // Forgot a callback but don't know where? Use NODE_DEBUG=fs + else if (!process.noDeprecation) { + var msg = 'fs: missing callback ' + (err.stack || err.message); + if (process.traceDeprecation) + console.trace(msg); + else + console.error(msg); + } + } + } +} + +function maybeCallback(cb) { + return typeof cb === 'function' ? cb : rethrow(); +} + +// Regexp that finds the next partion of a (partial) path +// result is [base_with_slash, base], e.g. ['somedir/', 'somedir'] +if (isWindows$1) { + var nextPartRe = /(.*?)(?:[\/\\]+|$)/g; +} else { + var nextPartRe = /(.*?)(?:[\/]+|$)/g; +} + +// Regex to find the device root, including trailing slash. E.g. 'c:\\'. +if (isWindows$1) { + var splitRootRe = /^(?:[a-zA-Z]:|[\\\/]{2}[^\\\/]+[\\\/][^\\\/]+)?[\\\/]*/; +} else { + var splitRootRe = /^[\/]*/; +} + +var realpathSync$1 = function realpathSync(p, cache) { + // make p is absolute + p = pathModule.resolve(p); + + if (cache && Object.prototype.hasOwnProperty.call(cache, p)) { + return cache[p]; + } + + var original = p, + seenLinks = {}, + knownHard = {}; + + // current character position in p + var pos; + // the partial path so far, including a trailing slash if any + var current; + // the partial path without a trailing slash (except when pointing at a root) + var base; + // the partial path scanned in the previous round, with slash + var previous; + + start(); + + function start() { + // Skip over roots + var m = splitRootRe.exec(p); + pos = m[0].length; + current = m[0]; + base = m[0]; + previous = ''; + + // On windows, check that the root exists. On unix there is no need. + if (isWindows$1 && !knownHard[base]) { + fs$4.lstatSync(base); + knownHard[base] = true; + } + } + + // walk down the path, swapping out linked pathparts for their real + // values + // NB: p.length changes. + while (pos < p.length) { + // find the next part + nextPartRe.lastIndex = pos; + var result = nextPartRe.exec(p); + previous = current; + current += result[0]; + base = previous + result[1]; + pos = nextPartRe.lastIndex; + + // continue if not a symlink + if (knownHard[base] || (cache && cache[base] === base)) { + continue; + } + + var resolvedLink; + if (cache && Object.prototype.hasOwnProperty.call(cache, base)) { + // some known symbolic link. no need to stat again. + resolvedLink = cache[base]; + } else { + var stat = fs$4.lstatSync(base); + if (!stat.isSymbolicLink()) { + knownHard[base] = true; + if (cache) cache[base] = base; + continue; + } + + // read the link if it wasn't read before + // dev/ino always return 0 on windows, so skip the check. + var linkTarget = null; + if (!isWindows$1) { + var id = stat.dev.toString(32) + ':' + stat.ino.toString(32); + if (seenLinks.hasOwnProperty(id)) { + linkTarget = seenLinks[id]; + } + } + if (linkTarget === null) { + fs$4.statSync(base); + linkTarget = fs$4.readlinkSync(base); + } + resolvedLink = pathModule.resolve(previous, linkTarget); + // track this, if given a cache. + if (cache) cache[base] = resolvedLink; + if (!isWindows$1) seenLinks[id] = linkTarget; + } + + // resolve the link, then start over + p = pathModule.resolve(resolvedLink, p.slice(pos)); + start(); + } + + if (cache) cache[original] = p; + + return p; +}; + + +var realpath$1 = function realpath(p, cache, cb) { + if (typeof cb !== 'function') { + cb = maybeCallback(cache); + cache = null; + } + + // make p is absolute + p = pathModule.resolve(p); + + if (cache && Object.prototype.hasOwnProperty.call(cache, p)) { + return process.nextTick(cb.bind(null, null, cache[p])); + } + + var original = p, + seenLinks = {}, + knownHard = {}; + + // current character position in p + var pos; + // the partial path so far, including a trailing slash if any + var current; + // the partial path without a trailing slash (except when pointing at a root) + var base; + // the partial path scanned in the previous round, with slash + var previous; + + start(); + + function start() { + // Skip over roots + var m = splitRootRe.exec(p); + pos = m[0].length; + current = m[0]; + base = m[0]; + previous = ''; + + // On windows, check that the root exists. On unix there is no need. + if (isWindows$1 && !knownHard[base]) { + fs$4.lstat(base, function(err) { + if (err) return cb(err); + knownHard[base] = true; + LOOP(); + }); + } else { + process.nextTick(LOOP); + } + } + + // walk down the path, swapping out linked pathparts for their real + // values + function LOOP() { + // stop if scanned past end of path + if (pos >= p.length) { + if (cache) cache[original] = p; + return cb(null, p); + } + + // find the next part + nextPartRe.lastIndex = pos; + var result = nextPartRe.exec(p); + previous = current; + current += result[0]; + base = previous + result[1]; + pos = nextPartRe.lastIndex; + + // continue if not a symlink + if (knownHard[base] || (cache && cache[base] === base)) { + return process.nextTick(LOOP); + } + + if (cache && Object.prototype.hasOwnProperty.call(cache, base)) { + // known symbolic link. no need to stat again. + return gotResolvedLink(cache[base]); + } + + return fs$4.lstat(base, gotStat); + } + + function gotStat(err, stat) { + if (err) return cb(err); + + // if not a symlink, skip to the next path part + if (!stat.isSymbolicLink()) { + knownHard[base] = true; + if (cache) cache[base] = base; + return process.nextTick(LOOP); + } + + // stat & read the link if not read before + // call gotTarget as soon as the link target is known + // dev/ino always return 0 on windows, so skip the check. + if (!isWindows$1) { + var id = stat.dev.toString(32) + ':' + stat.ino.toString(32); + if (seenLinks.hasOwnProperty(id)) { + return gotTarget(null, seenLinks[id], base); + } + } + fs$4.stat(base, function(err) { + if (err) return cb(err); + + fs$4.readlink(base, function(err, target) { + if (!isWindows$1) seenLinks[id] = target; + gotTarget(err, target); + }); + }); + } + + function gotTarget(err, target, base) { + if (err) return cb(err); + + var resolvedLink = pathModule.resolve(previous, target); + if (cache) cache[base] = resolvedLink; + gotResolvedLink(resolvedLink); + } + + function gotResolvedLink(resolvedLink) { + // resolve the link, then start over + p = pathModule.resolve(resolvedLink, p.slice(pos)); + start(); + } +}; + +var old$1 = { + realpathSync: realpathSync$1, + realpath: realpath$1 +}; + +var index = realpath; +realpath.realpath = realpath; +realpath.sync = realpathSync; +realpath.realpathSync = realpathSync; +realpath.monkeypatch = monkeypatch; +realpath.unmonkeypatch = unmonkeypatch; + +var fs$3 = fs; +var origRealpath = fs$3.realpath; +var origRealpathSync = fs$3.realpathSync; + +var version = process.version; +var ok = /^v[0-5]\./.test(version); +var old = old$1; + +function newError (er) { + return er && er.syscall === 'realpath' && ( + er.code === 'ELOOP' || + er.code === 'ENOMEM' || + er.code === 'ENAMETOOLONG' + ) +} + +function realpath (p, cache, cb) { + if (ok) { + return origRealpath(p, cache, cb) + } + + if (typeof cache === 'function') { + cb = cache; + cache = null; + } + origRealpath(p, cache, function (er, result) { + if (newError(er)) { + old.realpath(p, cache, cb); + } else { + cb(er, result); + } + }); +} + +function realpathSync (p, cache) { + if (ok) { + return origRealpathSync(p, cache) + } + + try { + return origRealpathSync(p, cache) + } catch (er) { + if (newError(er)) { + return old.realpathSync(p, cache) + } else { + throw er + } + } +} + +function monkeypatch () { + fs$3.realpath = realpath; + fs$3.realpathSync = realpathSync; +} + +function unmonkeypatch () { + fs$3.realpath = origRealpath; + fs$3.realpathSync = origRealpathSync; +} + +var index$4 = function (xs, fn) { + var res = []; + for (var i = 0; i < xs.length; i++) { + var x = fn(xs[i], i); + if (isArray(x)) res.push.apply(res, x); + else res.push(x); + } + return res; +}; + +var isArray = Array.isArray || function (xs) { + return Object.prototype.toString.call(xs) === '[object Array]'; +}; + +var index$6 = balanced$1; +function balanced$1(a, b, str) { + if (a instanceof RegExp) a = maybeMatch(a, str); + if (b instanceof RegExp) b = maybeMatch(b, str); + + var r = range(a, b, str); + + return r && { + start: r[0], + end: r[1], + pre: str.slice(0, r[0]), + body: str.slice(r[0] + a.length, r[1]), + post: str.slice(r[1] + b.length) + }; +} + +function maybeMatch(reg, str) { + var m = str.match(reg); + return m ? m[0] : null; +} + +balanced$1.range = range; +function range(a, b, str) { + var begs, beg, left, right, result; + var ai = str.indexOf(a); + var bi = str.indexOf(b, ai + 1); + var i = ai; + + if (ai >= 0 && bi > 0) { + begs = []; + left = str.length; + + while (i >= 0 && !result) { + if (i == ai) { + begs.push(i); + ai = str.indexOf(a, i + 1); + } else if (begs.length == 1) { + result = [ begs.pop(), bi ]; + } else { + beg = begs.pop(); + if (beg < left) { + left = beg; + right = bi; + } + + bi = str.indexOf(b, i + 1); + } + + i = ai < bi && ai >= 0 ? ai : bi; + } + + if (begs.length) { + result = [ left, right ]; + } + } + + return result; +} + +var concatMap = index$4; +var balanced = index$6; + +var index$2 = expandTop; + +var escSlash = '\0SLASH'+Math.random()+'\0'; +var escOpen = '\0OPEN'+Math.random()+'\0'; +var escClose = '\0CLOSE'+Math.random()+'\0'; +var escComma = '\0COMMA'+Math.random()+'\0'; +var escPeriod = '\0PERIOD'+Math.random()+'\0'; + +function numeric(str) { + return parseInt(str, 10) == str + ? parseInt(str, 10) + : str.charCodeAt(0); +} + +function escapeBraces(str) { + return str.split('\\\\').join(escSlash) + .split('\\{').join(escOpen) + .split('\\}').join(escClose) + .split('\\,').join(escComma) + .split('\\.').join(escPeriod); +} + +function unescapeBraces(str) { + return str.split(escSlash).join('\\') + .split(escOpen).join('{') + .split(escClose).join('}') + .split(escComma).join(',') + .split(escPeriod).join('.'); +} + + +// Basically just str.split(","), but handling cases +// where we have nested braced sections, which should be +// treated as individual members, like {a,{b,c},d} +function parseCommaParts(str) { + if (!str) + return ['']; + + var parts = []; + var m = balanced('{', '}', str); + + if (!m) + return str.split(','); + + var pre = m.pre; + var body = m.body; + var post = m.post; + var p = pre.split(','); + + p[p.length-1] += '{' + body + '}'; + var postParts = parseCommaParts(post); + if (post.length) { + p[p.length-1] += postParts.shift(); + p.push.apply(p, postParts); + } + + parts.push.apply(parts, p); + + return parts; +} + +function expandTop(str) { + if (!str) + return []; + + // I don't know why Bash 4.3 does this, but it does. + // Anything starting with {} will have the first two bytes preserved + // but *only* at the top level, so {},a}b will not expand to anything, + // but a{},b}c will be expanded to [a}c,abc]. + // One could argue that this is a bug in Bash, but since the goal of + // this module is to match Bash's rules, we escape a leading {} + if (str.substr(0, 2) === '{}') { + str = '\\{\\}' + str.substr(2); + } + + return expand$1(escapeBraces(str), true).map(unescapeBraces); +} + +function embrace(str) { + return '{' + str + '}'; +} +function isPadded(el) { + return /^-?0\d/.test(el); +} + +function lte(i, y) { + return i <= y; +} +function gte(i, y) { + return i >= y; +} + +function expand$1(str, isTop) { + var expansions = []; + + var m = balanced('{', '}', str); + if (!m || /\$$/.test(m.pre)) return [str]; + + var isNumericSequence = /^-?\d+\.\.-?\d+(?:\.\.-?\d+)?$/.test(m.body); + var isAlphaSequence = /^[a-zA-Z]\.\.[a-zA-Z](?:\.\.-?\d+)?$/.test(m.body); + var isSequence = isNumericSequence || isAlphaSequence; + var isOptions = /^(.*,)+(.+)?$/.test(m.body); + if (!isSequence && !isOptions) { + // {a},b} + if (m.post.match(/,.*\}/)) { + str = m.pre + '{' + m.body + escClose + m.post; + return expand$1(str); + } + return [str]; + } + + var n; + if (isSequence) { + n = m.body.split(/\.\./); + } else { + n = parseCommaParts(m.body); + if (n.length === 1) { + // x{{a,b}}y ==> x{a}y x{b}y + n = expand$1(n[0], false).map(embrace); + if (n.length === 1) { + var post = m.post.length + ? expand$1(m.post, false) + : ['']; + return post.map(function(p) { + return m.pre + n[0] + p; + }); + } + } + } + + // at this point, n is the parts, and we know it's not a comma set + // with a single entry. + + // no need to expand pre, since it is guaranteed to be free of brace-sets + var pre = m.pre; + var post = m.post.length + ? expand$1(m.post, false) + : ['']; + + var N; + + if (isSequence) { + var x = numeric(n[0]); + var y = numeric(n[1]); + var width = Math.max(n[0].length, n[1].length); + var incr = n.length == 3 + ? Math.abs(numeric(n[2])) + : 1; + var test = lte; + var reverse = y < x; + if (reverse) { + incr *= -1; + test = gte; + } + var pad = n.some(isPadded); + + N = []; + + for (var i = x; test(i, y); i += incr) { + var c; + if (isAlphaSequence) { + c = String.fromCharCode(i); + if (c === '\\') + c = ''; + } else { + c = String(i); + if (pad) { + var need = width - c.length; + if (need > 0) { + var z = new Array(need + 1).join('0'); + if (i < 0) + c = '-' + z + c.slice(1); + else + c = z + c; + } + } + } + N.push(c); + } + } else { + N = concatMap(n, function(el) { return expand$1(el, false) }); + } + + for (var j = 0; j < N.length; j++) { + for (var k = 0; k < post.length; k++) { + var expansion = pre + N[j] + post[k]; + if (!isTop || isSequence || expansion) + expansions.push(expansion); + } + } + + return expansions; +} + +var minimatch_1 = minimatch$1; +minimatch$1.Minimatch = Minimatch$1; + +var path$2 = { sep: '/' }; +try { + path$2 = require$$0; +} catch (er) {} + +var GLOBSTAR = minimatch$1.GLOBSTAR = Minimatch$1.GLOBSTAR = {}; +var expand = index$2; + +var plTypes = { + '!': { open: '(?:(?!(?:', close: '))[^/]*?)'}, + '?': { open: '(?:', close: ')?' }, + '+': { open: '(?:', close: ')+' }, + '*': { open: '(?:', close: ')*' }, + '@': { open: '(?:', close: ')' } +}; + +// any single thing other than / +// don't need to escape / when using new RegExp() +var qmark = '[^/]'; + +// * => any number of characters +var star = qmark + '*?'; + +// ** when dots are allowed. Anything goes, except .. and . +// not (^ or / followed by one or two dots followed by $ or /), +// followed by anything, any number of times. +var twoStarDot = '(?:(?!(?:\\\/|^)(?:\\.{1,2})($|\\\/)).)*?'; + +// not a ^ or / followed by a dot, +// followed by anything, any number of times. +var twoStarNoDot = '(?:(?!(?:\\\/|^)\\.).)*?'; + +// characters that need to be escaped in RegExp. +var reSpecials = charSet('().*{}+?[]^$\\!'); + +// "abc" -> { a:true, b:true, c:true } +function charSet (s) { + return s.split('').reduce(function (set, c) { + set[c] = true; + return set + }, {}) +} + +// normalizes slashes. +var slashSplit = /\/+/; + +minimatch$1.filter = filter; +function filter (pattern, options) { + options = options || {}; + return function (p, i, list) { + return minimatch$1(p, pattern, options) + } +} + +function ext (a, b) { + a = a || {}; + b = b || {}; + var t = {}; + Object.keys(b).forEach(function (k) { + t[k] = b[k]; + }); + Object.keys(a).forEach(function (k) { + t[k] = a[k]; + }); + return t +} + +minimatch$1.defaults = function (def) { + if (!def || !Object.keys(def).length) return minimatch$1 + + var orig = minimatch$1; + + var m = function minimatch (p, pattern, options) { + return orig.minimatch(p, pattern, ext(def, options)) + }; + + m.Minimatch = function Minimatch (pattern, options) { + return new orig.Minimatch(pattern, ext(def, options)) + }; + + return m +}; + +Minimatch$1.defaults = function (def) { + if (!def || !Object.keys(def).length) return Minimatch$1 + return minimatch$1.defaults(def).Minimatch +}; + +function minimatch$1 (p, pattern, options) { + if (typeof pattern !== 'string') { + throw new TypeError('glob pattern string required') + } + + if (!options) options = {}; + + // shortcut: comments match nothing. + if (!options.nocomment && pattern.charAt(0) === '#') { + return false + } + + // "" only matches "" + if (pattern.trim() === '') return p === '' + + return new Minimatch$1(pattern, options).match(p) +} + +function Minimatch$1 (pattern, options) { + if (!(this instanceof Minimatch$1)) { + return new Minimatch$1(pattern, options) + } + + if (typeof pattern !== 'string') { + throw new TypeError('glob pattern string required') + } + + if (!options) options = {}; + pattern = pattern.trim(); + + // windows support: need to use /, not \ + if (path$2.sep !== '/') { + pattern = pattern.split(path$2.sep).join('/'); + } + + this.options = options; + this.set = []; + this.pattern = pattern; + this.regexp = null; + this.negate = false; + this.comment = false; + this.empty = false; + + // make the set of regexps etc. + this.make(); +} + +Minimatch$1.prototype.debug = function () {}; + +Minimatch$1.prototype.make = make; +function make () { + // don't do it more than once. + if (this._made) return + + var pattern = this.pattern; + var options = this.options; + + // empty patterns and comments match nothing. + if (!options.nocomment && pattern.charAt(0) === '#') { + this.comment = true; + return + } + if (!pattern) { + this.empty = true; + return + } + + // step 1: figure out negation, etc. + this.parseNegate(); + + // step 2: expand braces + var set = this.globSet = this.braceExpand(); + + if (options.debug) this.debug = console.error; + + this.debug(this.pattern, set); + + // step 3: now we have a set, so turn each one into a series of path-portion + // matching patterns. + // These will be regexps, except in the case of "**", which is + // set to the GLOBSTAR object for globstar behavior, + // and will not contain any / characters + set = this.globParts = set.map(function (s) { + return s.split(slashSplit) + }); + + this.debug(this.pattern, set); + + // glob --> regexps + set = set.map(function (s, si, set) { + return s.map(this.parse, this) + }, this); + + this.debug(this.pattern, set); + + // filter out everything that didn't compile properly. + set = set.filter(function (s) { + return s.indexOf(false) === -1 + }); + + this.debug(this.pattern, set); + + this.set = set; +} + +Minimatch$1.prototype.parseNegate = parseNegate; +function parseNegate () { + var pattern = this.pattern; + var negate = false; + var options = this.options; + var negateOffset = 0; + + if (options.nonegate) return + + for (var i = 0, l = pattern.length + ; i < l && pattern.charAt(i) === '!' + ; i++) { + negate = !negate; + negateOffset++; + } + + if (negateOffset) this.pattern = pattern.substr(negateOffset); + this.negate = negate; +} + +// Brace expansion: +// a{b,c}d -> abd acd +// a{b,}c -> abc ac +// a{0..3}d -> a0d a1d a2d a3d +// a{b,c{d,e}f}g -> abg acdfg acefg +// a{b,c}d{e,f}g -> abdeg acdeg abdeg abdfg +// +// Invalid sets are not expanded. +// a{2..}b -> a{2..}b +// a{b}c -> a{b}c +minimatch$1.braceExpand = function (pattern, options) { + return braceExpand(pattern, options) +}; + +Minimatch$1.prototype.braceExpand = braceExpand; + +function braceExpand (pattern, options) { + if (!options) { + if (this instanceof Minimatch$1) { + options = this.options; + } else { + options = {}; + } + } + + pattern = typeof pattern === 'undefined' + ? this.pattern : pattern; + + if (typeof pattern === 'undefined') { + throw new TypeError('undefined pattern') + } + + if (options.nobrace || + !pattern.match(/\{.*\}/)) { + // shortcut. no need to expand. + return [pattern] + } + + return expand(pattern) +} + +// parse a component of the expanded set. +// At this point, no pattern may contain "/" in it +// so we're going to return a 2d array, where each entry is the full +// pattern, split on '/', and then turned into a regular expression. +// A regexp is made at the end which joins each array with an +// escaped /, and another full one which joins each regexp with |. +// +// Following the lead of Bash 4.1, note that "**" only has special meaning +// when it is the *only* thing in a path portion. Otherwise, any series +// of * is equivalent to a single *. Globstar behavior is enabled by +// default, and can be disabled by setting options.noglobstar. +Minimatch$1.prototype.parse = parse; +var SUBPARSE = {}; +function parse (pattern, isSub) { + if (pattern.length > 1024 * 64) { + throw new TypeError('pattern is too long') + } + + var options = this.options; + + // shortcuts + if (!options.noglobstar && pattern === '**') return GLOBSTAR + if (pattern === '') return '' + + var re = ''; + var hasMagic = !!options.nocase; + var escaping = false; + // ? => one single character + var patternListStack = []; + var negativeLists = []; + var stateChar; + var inClass = false; + var reClassStart = -1; + var classStart = -1; + // . and .. never match anything that doesn't start with ., + // even when options.dot is set. + var patternStart = pattern.charAt(0) === '.' ? '' // anything + // not (start or / followed by . or .. followed by / or end) + : options.dot ? '(?!(?:^|\\\/)\\.{1,2}(?:$|\\\/))' + : '(?!\\.)'; + var self = this; + + function clearStateChar () { + if (stateChar) { + // we had some state-tracking character + // that wasn't consumed by this pass. + switch (stateChar) { + case '*': + re += star; + hasMagic = true; + break + case '?': + re += qmark; + hasMagic = true; + break + default: + re += '\\' + stateChar; + break + } + self.debug('clearStateChar %j %j', stateChar, re); + stateChar = false; + } + } + + for (var i = 0, len = pattern.length, c + ; (i < len) && (c = pattern.charAt(i)) + ; i++) { + this.debug('%s\t%s %s %j', pattern, i, re, c); + + // skip over any that are escaped. + if (escaping && reSpecials[c]) { + re += '\\' + c; + escaping = false; + continue + } + + switch (c) { + case '/': + // completely not allowed, even escaped. + // Should already be path-split by now. + return false + + case '\\': + clearStateChar(); + escaping = true; + continue + + // the various stateChar values + // for the "extglob" stuff. + case '?': + case '*': + case '+': + case '@': + case '!': + this.debug('%s\t%s %s %j <-- stateChar', pattern, i, re, c); + + // all of those are literals inside a class, except that + // the glob [!a] means [^a] in regexp + if (inClass) { + this.debug(' in class'); + if (c === '!' && i === classStart + 1) c = '^'; + re += c; + continue + } + + // if we already have a stateChar, then it means + // that there was something like ** or +? in there. + // Handle the stateChar, then proceed with this one. + self.debug('call clearStateChar %j', stateChar); + clearStateChar(); + stateChar = c; + // if extglob is disabled, then +(asdf|foo) isn't a thing. + // just clear the statechar *now*, rather than even diving into + // the patternList stuff. + if (options.noext) clearStateChar(); + continue + + case '(': + if (inClass) { + re += '('; + continue + } + + if (!stateChar) { + re += '\\('; + continue + } + + patternListStack.push({ + type: stateChar, + start: i - 1, + reStart: re.length, + open: plTypes[stateChar].open, + close: plTypes[stateChar].close + }); + // negation is (?:(?!js)[^/]*) + re += stateChar === '!' ? '(?:(?!(?:' : '(?:'; + this.debug('plType %j %j', stateChar, re); + stateChar = false; + continue + + case ')': + if (inClass || !patternListStack.length) { + re += '\\)'; + continue + } + + clearStateChar(); + hasMagic = true; + var pl = patternListStack.pop(); + // negation is (?:(?!js)[^/]*) + // The others are (?:) + re += pl.close; + if (pl.type === '!') { + negativeLists.push(pl); + } + pl.reEnd = re.length; + continue + + case '|': + if (inClass || !patternListStack.length || escaping) { + re += '\\|'; + escaping = false; + continue + } + + clearStateChar(); + re += '|'; + continue + + // these are mostly the same in regexp and glob + case '[': + // swallow any state-tracking char before the [ + clearStateChar(); + + if (inClass) { + re += '\\' + c; + continue + } + + inClass = true; + classStart = i; + reClassStart = re.length; + re += c; + continue + + case ']': + // a right bracket shall lose its special + // meaning and represent itself in + // a bracket expression if it occurs + // first in the list. -- POSIX.2 2.8.3.2 + if (i === classStart + 1 || !inClass) { + re += '\\' + c; + escaping = false; + continue + } + + // handle the case where we left a class open. + // "[z-a]" is valid, equivalent to "\[z-a\]" + if (inClass) { + // split where the last [ was, make sure we don't have + // an invalid re. if so, re-walk the contents of the + // would-be class to re-translate any characters that + // were passed through as-is + // TODO: It would probably be faster to determine this + // without a try/catch and a new RegExp, but it's tricky + // to do safely. For now, this is safe and works. + var cs = pattern.substring(classStart + 1, i); + try { + RegExp('[' + cs + ']'); + } catch (er) { + // not a valid class! + var sp = this.parse(cs, SUBPARSE); + re = re.substr(0, reClassStart) + '\\[' + sp[0] + '\\]'; + hasMagic = hasMagic || sp[1]; + inClass = false; + continue + } + } + + // finish up the class. + hasMagic = true; + inClass = false; + re += c; + continue + + default: + // swallow any state char that wasn't consumed + clearStateChar(); + + if (escaping) { + // no need + escaping = false; + } else if (reSpecials[c] + && !(c === '^' && inClass)) { + re += '\\'; + } + + re += c; + + } // switch + } // for + + // handle the case where we left a class open. + // "[abc" is valid, equivalent to "\[abc" + if (inClass) { + // split where the last [ was, and escape it + // this is a huge pita. We now have to re-walk + // the contents of the would-be class to re-translate + // any characters that were passed through as-is + cs = pattern.substr(classStart + 1); + sp = this.parse(cs, SUBPARSE); + re = re.substr(0, reClassStart) + '\\[' + sp[0]; + hasMagic = hasMagic || sp[1]; + } + + // handle the case where we had a +( thing at the *end* + // of the pattern. + // each pattern list stack adds 3 chars, and we need to go through + // and escape any | chars that were passed through as-is for the regexp. + // Go through and escape them, taking care not to double-escape any + // | chars that were already escaped. + for (pl = patternListStack.pop(); pl; pl = patternListStack.pop()) { + var tail = re.slice(pl.reStart + pl.open.length); + this.debug('setting tail', re, pl); + // maybe some even number of \, then maybe 1 \, followed by a | + tail = tail.replace(/((?:\\{2}){0,64})(\\?)\|/g, function (_, $1, $2) { + if (!$2) { + // the | isn't already escaped, so escape it. + $2 = '\\'; + } + + // need to escape all those slashes *again*, without escaping the + // one that we need for escaping the | character. As it works out, + // escaping an even number of slashes can be done by simply repeating + // it exactly after itself. That's why this trick works. + // + // I am sorry that you have to see this. + return $1 + $1 + $2 + '|' + }); + + this.debug('tail=%j\n %s', tail, tail, pl, re); + var t = pl.type === '*' ? star + : pl.type === '?' ? qmark + : '\\' + pl.type; + + hasMagic = true; + re = re.slice(0, pl.reStart) + t + '\\(' + tail; + } + + // handle trailing things that only matter at the very end. + clearStateChar(); + if (escaping) { + // trailing \\ + re += '\\\\'; + } + + // only need to apply the nodot start if the re starts with + // something that could conceivably capture a dot + var addPatternStart = false; + switch (re.charAt(0)) { + case '.': + case '[': + case '(': addPatternStart = true; + } + + // Hack to work around lack of negative lookbehind in JS + // A pattern like: *.!(x).!(y|z) needs to ensure that a name + // like 'a.xyz.yz' doesn't match. So, the first negative + // lookahead, has to look ALL the way ahead, to the end of + // the pattern. + for (var n = negativeLists.length - 1; n > -1; n--) { + var nl = negativeLists[n]; + + var nlBefore = re.slice(0, nl.reStart); + var nlFirst = re.slice(nl.reStart, nl.reEnd - 8); + var nlLast = re.slice(nl.reEnd - 8, nl.reEnd); + var nlAfter = re.slice(nl.reEnd); + + nlLast += nlAfter; + + // Handle nested stuff like *(*.js|!(*.json)), where open parens + // mean that we should *not* include the ) in the bit that is considered + // "after" the negated section. + var openParensBefore = nlBefore.split('(').length - 1; + var cleanAfter = nlAfter; + for (i = 0; i < openParensBefore; i++) { + cleanAfter = cleanAfter.replace(/\)[+*?]?/, ''); + } + nlAfter = cleanAfter; + + var dollar = ''; + if (nlAfter === '' && isSub !== SUBPARSE) { + dollar = '$'; + } + var newRe = nlBefore + nlFirst + nlAfter + dollar + nlLast; + re = newRe; + } + + // if the re is not "" at this point, then we need to make sure + // it doesn't match against an empty path part. + // Otherwise a/* will match a/, which it should not. + if (re !== '' && hasMagic) { + re = '(?=.)' + re; + } + + if (addPatternStart) { + re = patternStart + re; + } + + // parsing just a piece of a larger pattern. + if (isSub === SUBPARSE) { + return [re, hasMagic] + } + + // skip the regexp for non-magical patterns + // unescape anything in it, though, so that it'll be + // an exact match against a file etc. + if (!hasMagic) { + return globUnescape(pattern) + } + + var flags = options.nocase ? 'i' : ''; + try { + var regExp = new RegExp('^' + re + '$', flags); + } catch (er) { + // If it was an invalid regular expression, then it can't match + // anything. This trick looks for a character after the end of + // the string, which is of course impossible, except in multi-line + // mode, but it's not a /m regex. + return new RegExp('$.') + } + + regExp._glob = pattern; + regExp._src = re; + + return regExp +} + +minimatch$1.makeRe = function (pattern, options) { + return new Minimatch$1(pattern, options || {}).makeRe() +}; + +Minimatch$1.prototype.makeRe = makeRe; +function makeRe () { + if (this.regexp || this.regexp === false) return this.regexp + + // at this point, this.set is a 2d array of partial + // pattern strings, or "**". + // + // It's better to use .match(). This function shouldn't + // be used, really, but it's pretty convenient sometimes, + // when you just want to work with a regex. + var set = this.set; + + if (!set.length) { + this.regexp = false; + return this.regexp + } + var options = this.options; + + var twoStar = options.noglobstar ? star + : options.dot ? twoStarDot + : twoStarNoDot; + var flags = options.nocase ? 'i' : ''; + + var re = set.map(function (pattern) { + return pattern.map(function (p) { + return (p === GLOBSTAR) ? twoStar + : (typeof p === 'string') ? regExpEscape(p) + : p._src + }).join('\\\/') + }).join('|'); + + // must match entire pattern + // ending in a * or ** will make it less strict. + re = '^(?:' + re + ')$'; + + // can match anything, as long as it's not this. + if (this.negate) re = '^(?!' + re + ').*$'; + + try { + this.regexp = new RegExp(re, flags); + } catch (ex) { + this.regexp = false; + } + return this.regexp +} + +minimatch$1.match = function (list, pattern, options) { + options = options || {}; + var mm = new Minimatch$1(pattern, options); + list = list.filter(function (f) { + return mm.match(f) + }); + if (mm.options.nonull && !list.length) { + list.push(pattern); + } + return list +}; + +Minimatch$1.prototype.match = match; +function match (f, partial) { + this.debug('match', f, this.pattern); + // short-circuit in the case of busted things. + // comments, etc. + if (this.comment) return false + if (this.empty) return f === '' + + if (f === '/' && partial) return true + + var options = this.options; + + // windows: need to use /, not \ + if (path$2.sep !== '/') { + f = f.split(path$2.sep).join('/'); + } + + // treat the test path as a set of pathparts. + f = f.split(slashSplit); + this.debug(this.pattern, 'split', f); + + // just ONE of the pattern sets in this.set needs to match + // in order for it to be valid. If negating, then just one + // match means that we have failed. + // Either way, return on the first hit. + + var set = this.set; + this.debug(this.pattern, 'set', set); + + // Find the basename of the path by looking for the last non-empty segment + var filename; + var i; + for (i = f.length - 1; i >= 0; i--) { + filename = f[i]; + if (filename) break + } + + for (i = 0; i < set.length; i++) { + var pattern = set[i]; + var file = f; + if (options.matchBase && pattern.length === 1) { + file = [filename]; + } + var hit = this.matchOne(file, pattern, partial); + if (hit) { + if (options.flipNegate) return true + return !this.negate + } + } + + // didn't get any hits. this is success if it's a negative + // pattern, failure otherwise. + if (options.flipNegate) return false + return this.negate +} + +// set partial to true to test if, for example, +// "/a/b" matches the start of "/*/b/*/d" +// Partial means, if you run out of file before you run +// out of pattern, then that's fine, as long as all +// the parts match. +Minimatch$1.prototype.matchOne = function (file, pattern, partial) { + var options = this.options; + + this.debug('matchOne', + { 'this': this, file: file, pattern: pattern }); + + this.debug('matchOne', file.length, pattern.length); + + for (var fi = 0, + pi = 0, + fl = file.length, + pl = pattern.length + ; (fi < fl) && (pi < pl) + ; fi++, pi++) { + this.debug('matchOne loop'); + var p = pattern[pi]; + var f = file[fi]; + + this.debug(pattern, p, f); + + // should be impossible. + // some invalid regexp stuff in the set. + if (p === false) return false + + if (p === GLOBSTAR) { + this.debug('GLOBSTAR', [pattern, p, f]); + + // "**" + // a/**/b/**/c would match the following: + // a/b/x/y/z/c + // a/x/y/z/b/c + // a/b/x/b/x/c + // a/b/c + // To do this, take the rest of the pattern after + // the **, and see if it would match the file remainder. + // If so, return success. + // If not, the ** "swallows" a segment, and try again. + // This is recursively awful. + // + // a/**/b/**/c matching a/b/x/y/z/c + // - a matches a + // - doublestar + // - matchOne(b/x/y/z/c, b/**/c) + // - b matches b + // - doublestar + // - matchOne(x/y/z/c, c) -> no + // - matchOne(y/z/c, c) -> no + // - matchOne(z/c, c) -> no + // - matchOne(c, c) yes, hit + var fr = fi; + var pr = pi + 1; + if (pr === pl) { + this.debug('** at the end'); + // a ** at the end will just swallow the rest. + // We have found a match. + // however, it will not swallow /.x, unless + // options.dot is set. + // . and .. are *never* matched by **, for explosively + // exponential reasons. + for (; fi < fl; fi++) { + if (file[fi] === '.' || file[fi] === '..' || + (!options.dot && file[fi].charAt(0) === '.')) return false + } + return true + } + + // ok, let's see if we can swallow whatever we can. + while (fr < fl) { + var swallowee = file[fr]; + + this.debug('\nglobstar while', file, fr, pattern, pr, swallowee); + + // XXX remove this slice. Just pass the start index. + if (this.matchOne(file.slice(fr), pattern.slice(pr), partial)) { + this.debug('globstar found match!', fr, fl, swallowee); + // found a match. + return true + } else { + // can't swallow "." or ".." ever. + // can only swallow ".foo" when explicitly asked. + if (swallowee === '.' || swallowee === '..' || + (!options.dot && swallowee.charAt(0) === '.')) { + this.debug('dot detected!', file, fr, pattern, pr); + break + } + + // ** swallows a segment, and continue. + this.debug('globstar swallow a segment, and continue'); + fr++; + } + } + + // no match was found. + // However, in partial mode, we can't say this is necessarily over. + // If there's more *pattern* left, then + if (partial) { + // ran out of file + this.debug('\n>>> no match, partial?', file, fr, pattern, pr); + if (fr === fl) return true + } + return false + } + + // something other than ** + // non-magic patterns just have to match exactly + // patterns with magic have been turned into regexps. + var hit; + if (typeof p === 'string') { + if (options.nocase) { + hit = f.toLowerCase() === p.toLowerCase(); + } else { + hit = f === p; + } + this.debug('string match', p, f, hit); + } else { + hit = f.match(p); + this.debug('pattern match', p, f, hit); + } + + if (!hit) return false + } + + // Note: ending in / means that we'll get a final "" + // at the end of the pattern. This can only match a + // corresponding "" at the end of the file. + // If the file ends in /, then it can only match a + // a pattern that ends in /, unless the pattern just + // doesn't have any more for it. But, a/b/ should *not* + // match "a/b/*", even though "" matches against the + // [^/]*? pattern, except in partial mode, where it might + // simply not be reached yet. + // However, a/b/ should still satisfy a/* + + // now either we fell off the end of the pattern, or we're done. + if (fi === fl && pi === pl) { + // ran out of pattern and filename at the same time. + // an exact hit! + return true + } else if (fi === fl) { + // ran out of file, but still had pattern left. + // this is ok if we're doing the match as part of + // a glob fs traversal. + return partial + } else if (pi === pl) { + // ran out of pattern, still have file left. + // this is only acceptable if we're on the very last + // empty segment of a file with a trailing slash. + // a/* should match a/b/ + var emptyFileEnd = (fi === fl - 1) && (file[fi] === ''); + return emptyFileEnd + } + + // should be unreachable. + throw new Error('wtf?') +}; + +// replace stuff like \* with * +function globUnescape (s) { + return s.replace(/\\(.)/g, '$1') +} + +function regExpEscape (s) { + return s.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, '\\$&') +} + +function createCommonjsModule(fn, module) { + return module = { exports: {} }, fn(module, module.exports), module.exports; +} + +var inherits_browser = createCommonjsModule(function (module) { +if (typeof Object.create === 'function') { + // implementation from standard node.js 'util' module + module.exports = function inherits(ctor, superCtor) { + ctor.super_ = superCtor; + ctor.prototype = Object.create(superCtor.prototype, { + constructor: { + value: ctor, + enumerable: false, + writable: true, + configurable: true + } + }); + }; +} else { + // old school shim for old browsers + module.exports = function inherits(ctor, superCtor) { + ctor.super_ = superCtor; + var TempCtor = function () {}; + TempCtor.prototype = superCtor.prototype; + ctor.prototype = new TempCtor(); + ctor.prototype.constructor = ctor; + }; +} +}); + +var inherits$1 = createCommonjsModule(function (module) { +try { + var util$$1 = util; + if (typeof util$$1.inherits !== 'function') throw ''; + module.exports = util$$1.inherits; +} catch (e) { + module.exports = inherits_browser; +} +}); + +function posix(path) { + return path.charAt(0) === '/'; +} + +function win32(path) { + // https://github.com/nodejs/node/blob/b3fcc245fb25539909ef1d5eaa01dbf92e168633/lib/path.js#L56 + var splitDeviceRe = /^([a-zA-Z]:|[\\\/]{2}[^\\\/]+[\\\/]+[^\\\/]+)?([\\\/])?([\s\S]*?)$/; + var result = splitDeviceRe.exec(path); + var device = result[1] || ''; + var isUnc = Boolean(device && device.charAt(1) !== ':'); + + // UNC paths are always absolute + return Boolean(result[2] || isUnc); +} + +var index$8 = process.platform === 'win32' ? win32 : posix; +var posix_1 = posix; +var win32_1 = win32; + +index$8.posix = posix_1; +index$8.win32 = win32_1; + +var alphasort_1 = alphasort$2; +var alphasorti_1 = alphasorti$2; +var setopts_1 = setopts$2; +var ownProp_1 = ownProp$2; +var makeAbs_1 = makeAbs; +var finish_1 = finish; +var mark_1 = mark; +var isIgnored_1 = isIgnored$2; +var childrenIgnored_1 = childrenIgnored$2; + +function ownProp$2 (obj, field) { + return Object.prototype.hasOwnProperty.call(obj, field) +} + +var path$4 = require$$0; +var minimatch$3 = minimatch_1; +var isAbsolute$2 = index$8; +var Minimatch$3 = minimatch$3.Minimatch; + +function alphasorti$2 (a, b) { + return a.toLowerCase().localeCompare(b.toLowerCase()) +} + +function alphasort$2 (a, b) { + return a.localeCompare(b) +} + +function setupIgnores (self, options) { + self.ignore = options.ignore || []; + + if (!Array.isArray(self.ignore)) + self.ignore = [self.ignore]; + + if (self.ignore.length) { + self.ignore = self.ignore.map(ignoreMap); + } +} + +// ignore patterns are always in dot:true mode. +function ignoreMap (pattern) { + var gmatcher = null; + if (pattern.slice(-3) === '/**') { + var gpattern = pattern.replace(/(\/\*\*)+$/, ''); + gmatcher = new Minimatch$3(gpattern, { dot: true }); + } + + return { + matcher: new Minimatch$3(pattern, { dot: true }), + gmatcher: gmatcher + } +} + +function setopts$2 (self, pattern, options) { + if (!options) + options = {}; + + // base-matching: just use globstar for that. + if (options.matchBase && -1 === pattern.indexOf("/")) { + if (options.noglobstar) { + throw new Error("base matching requires globstar") + } + pattern = "**/" + pattern; + } + + self.silent = !!options.silent; + self.pattern = pattern; + self.strict = options.strict !== false; + self.realpath = !!options.realpath; + self.realpathCache = options.realpathCache || Object.create(null); + self.follow = !!options.follow; + self.dot = !!options.dot; + self.mark = !!options.mark; + self.nodir = !!options.nodir; + if (self.nodir) + self.mark = true; + self.sync = !!options.sync; + self.nounique = !!options.nounique; + self.nonull = !!options.nonull; + self.nosort = !!options.nosort; + self.nocase = !!options.nocase; + self.stat = !!options.stat; + self.noprocess = !!options.noprocess; + self.absolute = !!options.absolute; + + self.maxLength = options.maxLength || Infinity; + self.cache = options.cache || Object.create(null); + self.statCache = options.statCache || Object.create(null); + self.symlinks = options.symlinks || Object.create(null); + + setupIgnores(self, options); + + self.changedCwd = false; + var cwd = process.cwd(); + if (!ownProp$2(options, "cwd")) + self.cwd = cwd; + else { + self.cwd = path$4.resolve(options.cwd); + self.changedCwd = self.cwd !== cwd; + } + + self.root = options.root || path$4.resolve(self.cwd, "/"); + self.root = path$4.resolve(self.root); + if (process.platform === "win32") + self.root = self.root.replace(/\\/g, "/"); + + // TODO: is an absolute `cwd` supposed to be resolved against `root`? + // e.g. { cwd: '/test', root: __dirname } === path.join(__dirname, '/test') + self.cwdAbs = isAbsolute$2(self.cwd) ? self.cwd : makeAbs(self, self.cwd); + if (process.platform === "win32") + self.cwdAbs = self.cwdAbs.replace(/\\/g, "/"); + self.nomount = !!options.nomount; + + // disable comments and negation in Minimatch. + // Note that they are not supported in Glob itself anyway. + options.nonegate = true; + options.nocomment = true; + + self.minimatch = new Minimatch$3(pattern, options); + self.options = self.minimatch.options; +} + +function finish (self) { + var nou = self.nounique; + var all = nou ? [] : Object.create(null); + + for (var i = 0, l = self.matches.length; i < l; i ++) { + var matches = self.matches[i]; + if (!matches || Object.keys(matches).length === 0) { + if (self.nonull) { + // do like the shell, and spit out the literal glob + var literal = self.minimatch.globSet[i]; + if (nou) + all.push(literal); + else + all[literal] = true; + } + } else { + // had matches + var m = Object.keys(matches); + if (nou) + all.push.apply(all, m); + else + m.forEach(function (m) { + all[m] = true; + }); + } + } + + if (!nou) + all = Object.keys(all); + + if (!self.nosort) + all = all.sort(self.nocase ? alphasorti$2 : alphasort$2); + + // at *some* point we statted all of these + if (self.mark) { + for (var i = 0; i < all.length; i++) { + all[i] = self._mark(all[i]); + } + if (self.nodir) { + all = all.filter(function (e) { + var notDir = !(/\/$/.test(e)); + var c = self.cache[e] || self.cache[makeAbs(self, e)]; + if (notDir && c) + notDir = c !== 'DIR' && !Array.isArray(c); + return notDir + }); + } + } + + if (self.ignore.length) + all = all.filter(function(m) { + return !isIgnored$2(self, m) + }); + + self.found = all; +} + +function mark (self, p) { + var abs = makeAbs(self, p); + var c = self.cache[abs]; + var m = p; + if (c) { + var isDir = c === 'DIR' || Array.isArray(c); + var slash = p.slice(-1) === '/'; + + if (isDir && !slash) + m += '/'; + else if (!isDir && slash) + m = m.slice(0, -1); + + if (m !== p) { + var mabs = makeAbs(self, m); + self.statCache[mabs] = self.statCache[abs]; + self.cache[mabs] = self.cache[abs]; + } + } + + return m +} + +// lotta situps... +function makeAbs (self, f) { + var abs = f; + if (f.charAt(0) === '/') { + abs = path$4.join(self.root, f); + } else if (isAbsolute$2(f) || f === '') { + abs = f; + } else if (self.changedCwd) { + abs = path$4.resolve(self.cwd, f); + } else { + abs = path$4.resolve(f); + } + + if (process.platform === 'win32') + abs = abs.replace(/\\/g, '/'); + + return abs +} + + +// Return true, if pattern ends with globstar '**', for the accompanying parent directory. +// Ex:- If node_modules/** is the pattern, add 'node_modules' to ignore list along with it's contents +function isIgnored$2 (self, path) { + if (!self.ignore.length) + return false + + return self.ignore.some(function(item) { + return item.matcher.match(path) || !!(item.gmatcher && item.gmatcher.match(path)) + }) +} + +function childrenIgnored$2 (self, path) { + if (!self.ignore.length) + return false + + return self.ignore.some(function(item) { + return !!(item.gmatcher && item.gmatcher.match(path)) + }) +} + +var common$2 = { + alphasort: alphasort_1, + alphasorti: alphasorti_1, + setopts: setopts_1, + ownProp: ownProp_1, + makeAbs: makeAbs_1, + finish: finish_1, + mark: mark_1, + isIgnored: isIgnored_1, + childrenIgnored: childrenIgnored_1 +}; + +var sync = globSync$1; +globSync$1.GlobSync = GlobSync$1; + +var fs$5 = fs; +var rp$1 = index; +var minimatch$2 = minimatch_1; +var path$3 = require$$0; +var assert$3 = assert; +var isAbsolute$1 = index$8; +var common$1 = common$2; +var setopts$1 = common$1.setopts; +var ownProp$1 = common$1.ownProp; +var childrenIgnored$1 = common$1.childrenIgnored; +var isIgnored$1 = common$1.isIgnored; + +function globSync$1 (pattern, options) { + if (typeof options === 'function' || arguments.length === 3) + throw new TypeError('callback provided to sync glob\n'+ + 'See: https://github.com/isaacs/node-glob/issues/167') + + return new GlobSync$1(pattern, options).found +} + +function GlobSync$1 (pattern, options) { + if (!pattern) + throw new Error('must provide pattern') + + if (typeof options === 'function' || arguments.length === 3) + throw new TypeError('callback provided to sync glob\n'+ + 'See: https://github.com/isaacs/node-glob/issues/167') + + if (!(this instanceof GlobSync$1)) + return new GlobSync$1(pattern, options) + + setopts$1(this, pattern, options); + + if (this.noprocess) + return this + + var n = this.minimatch.set.length; + this.matches = new Array(n); + for (var i = 0; i < n; i ++) { + this._process(this.minimatch.set[i], i, false); + } + this._finish(); +} + +GlobSync$1.prototype._finish = function () { + assert$3(this instanceof GlobSync$1); + if (this.realpath) { + var self = this; + this.matches.forEach(function (matchset, index$$1) { + var set = self.matches[index$$1] = Object.create(null); + for (var p in matchset) { + try { + p = self._makeAbs(p); + var real = rp$1.realpathSync(p, self.realpathCache); + set[real] = true; + } catch (er) { + if (er.syscall === 'stat') + set[self._makeAbs(p)] = true; + else + throw er + } + } + }); + } + common$1.finish(this); +}; + + +GlobSync$1.prototype._process = function (pattern, index$$1, inGlobStar) { + assert$3(this instanceof GlobSync$1); + + // Get the first [n] parts of pattern that are all strings. + var n = 0; + while (typeof pattern[n] === 'string') { + n ++; + } + // now n is the index of the first one that is *not* a string. + + // See if there's anything else + var prefix; + switch (n) { + // if not, then this is rather simple + case pattern.length: + this._processSimple(pattern.join('/'), index$$1); + return + + case 0: + // pattern *starts* with some non-trivial item. + // going to readdir(cwd), but not include the prefix in matches. + prefix = null; + break + + default: + // pattern has some string bits in the front. + // whatever it starts with, whether that's 'absolute' like /foo/bar, + // or 'relative' like '../baz' + prefix = pattern.slice(0, n).join('/'); + break + } + + var remain = pattern.slice(n); + + // get the list of entries. + var read; + if (prefix === null) + read = '.'; + else if (isAbsolute$1(prefix) || isAbsolute$1(pattern.join('/'))) { + if (!prefix || !isAbsolute$1(prefix)) + prefix = '/' + prefix; + read = prefix; + } else + read = prefix; + + var abs = this._makeAbs(read); + + //if ignored, skip processing + if (childrenIgnored$1(this, read)) + return + + var isGlobStar = remain[0] === minimatch$2.GLOBSTAR; + if (isGlobStar) + this._processGlobStar(prefix, read, abs, remain, index$$1, inGlobStar); + else + this._processReaddir(prefix, read, abs, remain, index$$1, inGlobStar); +}; + + +GlobSync$1.prototype._processReaddir = function (prefix, read, abs, remain, index$$1, inGlobStar) { + var entries = this._readdir(abs, inGlobStar); + + // if the abs isn't a dir, then nothing can match! + if (!entries) + return + + // It will only match dot entries if it starts with a dot, or if + // dot is set. Stuff like @(.foo|.bar) isn't allowed. + var pn = remain[0]; + var negate = !!this.minimatch.negate; + var rawGlob = pn._glob; + var dotOk = this.dot || rawGlob.charAt(0) === '.'; + + var matchedEntries = []; + for (var i = 0; i < entries.length; i++) { + var e = entries[i]; + if (e.charAt(0) !== '.' || dotOk) { + var m; + if (negate && !prefix) { + m = !e.match(pn); + } else { + m = e.match(pn); + } + if (m) + matchedEntries.push(e); + } + } + + var len = matchedEntries.length; + // If there are no matched entries, then nothing matches. + if (len === 0) + return + + // if this is the last remaining pattern bit, then no need for + // an additional stat *unless* the user has specified mark or + // stat explicitly. We know they exist, since readdir returned + // them. + + if (remain.length === 1 && !this.mark && !this.stat) { + if (!this.matches[index$$1]) + this.matches[index$$1] = Object.create(null); + + for (var i = 0; i < len; i ++) { + var e = matchedEntries[i]; + if (prefix) { + if (prefix.slice(-1) !== '/') + e = prefix + '/' + e; + else + e = prefix + e; + } + + if (e.charAt(0) === '/' && !this.nomount) { + e = path$3.join(this.root, e); + } + this._emitMatch(index$$1, e); + } + // This was the last one, and no stats were needed + return + } + + // now test all matched entries as stand-ins for that part + // of the pattern. + remain.shift(); + for (var i = 0; i < len; i ++) { + var e = matchedEntries[i]; + var newPattern; + if (prefix) + newPattern = [prefix, e]; + else + newPattern = [e]; + this._process(newPattern.concat(remain), index$$1, inGlobStar); + } +}; + + +GlobSync$1.prototype._emitMatch = function (index$$1, e) { + if (isIgnored$1(this, e)) + return + + var abs = this._makeAbs(e); + + if (this.mark) + e = this._mark(e); + + if (this.absolute) { + e = abs; + } + + if (this.matches[index$$1][e]) + return + + if (this.nodir) { + var c = this.cache[abs]; + if (c === 'DIR' || Array.isArray(c)) + return + } + + this.matches[index$$1][e] = true; + + if (this.stat) + this._stat(e); +}; + + +GlobSync$1.prototype._readdirInGlobStar = function (abs) { + // follow all symlinked directories forever + // just proceed as if this is a non-globstar situation + if (this.follow) + return this._readdir(abs, false) + + var entries; + var lstat; + var stat; + try { + lstat = fs$5.lstatSync(abs); + } catch (er) { + if (er.code === 'ENOENT') { + // lstat failed, doesn't exist + return null + } + } + + var isSym = lstat && lstat.isSymbolicLink(); + this.symlinks[abs] = isSym; + + // If it's not a symlink or a dir, then it's definitely a regular file. + // don't bother doing a readdir in that case. + if (!isSym && lstat && !lstat.isDirectory()) + this.cache[abs] = 'FILE'; + else + entries = this._readdir(abs, false); + + return entries +}; + +GlobSync$1.prototype._readdir = function (abs, inGlobStar) { + var entries; + + if (inGlobStar && !ownProp$1(this.symlinks, abs)) + return this._readdirInGlobStar(abs) + + if (ownProp$1(this.cache, abs)) { + var c = this.cache[abs]; + if (!c || c === 'FILE') + return null + + if (Array.isArray(c)) + return c + } + + try { + return this._readdirEntries(abs, fs$5.readdirSync(abs)) + } catch (er) { + this._readdirError(abs, er); + return null + } +}; + +GlobSync$1.prototype._readdirEntries = function (abs, entries) { + // if we haven't asked to stat everything, then just + // assume that everything in there exists, so we can avoid + // having to stat it a second time. + if (!this.mark && !this.stat) { + for (var i = 0; i < entries.length; i ++) { + var e = entries[i]; + if (abs === '/') + e = abs + e; + else + e = abs + '/' + e; + this.cache[e] = true; + } + } + + this.cache[abs] = entries; + + // mark and cache dir-ness + return entries +}; + +GlobSync$1.prototype._readdirError = function (f, er) { + // handle errors, and cache the information + switch (er.code) { + case 'ENOTSUP': // https://github.com/isaacs/node-glob/issues/205 + case 'ENOTDIR': // totally normal. means it *does* exist. + var abs = this._makeAbs(f); + this.cache[abs] = 'FILE'; + if (abs === this.cwdAbs) { + var error = new Error(er.code + ' invalid cwd ' + this.cwd); + error.path = this.cwd; + error.code = er.code; + throw error + } + break + + case 'ENOENT': // not terribly unusual + case 'ELOOP': + case 'ENAMETOOLONG': + case 'UNKNOWN': + this.cache[this._makeAbs(f)] = false; + break + + default: // some unusual error. Treat as failure. + this.cache[this._makeAbs(f)] = false; + if (this.strict) + throw er + if (!this.silent) + console.error('glob error', er); + break + } +}; + +GlobSync$1.prototype._processGlobStar = function (prefix, read, abs, remain, index$$1, inGlobStar) { + + var entries = this._readdir(abs, inGlobStar); + + // no entries means not a dir, so it can never have matches + // foo.txt/** doesn't match foo.txt + if (!entries) + return + + // test without the globstar, and with every child both below + // and replacing the globstar. + var remainWithoutGlobStar = remain.slice(1); + var gspref = prefix ? [ prefix ] : []; + var noGlobStar = gspref.concat(remainWithoutGlobStar); + + // the noGlobStar pattern exits the inGlobStar state + this._process(noGlobStar, index$$1, false); + + var len = entries.length; + var isSym = this.symlinks[abs]; + + // If it's a symlink, and we're in a globstar, then stop + if (isSym && inGlobStar) + return + + for (var i = 0; i < len; i++) { + var e = entries[i]; + if (e.charAt(0) === '.' && !this.dot) + continue + + // these two cases enter the inGlobStar state + var instead = gspref.concat(entries[i], remainWithoutGlobStar); + this._process(instead, index$$1, true); + + var below = gspref.concat(entries[i], remain); + this._process(below, index$$1, true); + } +}; + +GlobSync$1.prototype._processSimple = function (prefix, index$$1) { + // XXX review this. Shouldn't it be doing the mounting etc + // before doing stat? kinda weird? + var exists = this._stat(prefix); + + if (!this.matches[index$$1]) + this.matches[index$$1] = Object.create(null); + + // If it doesn't exist, then just mark the lack of results + if (!exists) + return + + if (prefix && isAbsolute$1(prefix) && !this.nomount) { + var trail = /[\/\\]$/.test(prefix); + if (prefix.charAt(0) === '/') { + prefix = path$3.join(this.root, prefix); + } else { + prefix = path$3.resolve(this.root, prefix); + if (trail) + prefix += '/'; + } + } + + if (process.platform === 'win32') + prefix = prefix.replace(/\\/g, '/'); + + // Mark this as a match + this._emitMatch(index$$1, prefix); +}; + +// Returns either 'DIR', 'FILE', or false +GlobSync$1.prototype._stat = function (f) { + var abs = this._makeAbs(f); + var needDir = f.slice(-1) === '/'; + + if (f.length > this.maxLength) + return false + + if (!this.stat && ownProp$1(this.cache, abs)) { + var c = this.cache[abs]; + + if (Array.isArray(c)) + c = 'DIR'; + + // It exists, but maybe not how we need it + if (!needDir || c === 'DIR') + return c + + if (needDir && c === 'FILE') + return false + + // otherwise we have to stat, because maybe c=true + // if we know it exists, but not what it is. + } + + var exists; + var stat = this.statCache[abs]; + if (!stat) { + var lstat; + try { + lstat = fs$5.lstatSync(abs); + } catch (er) { + if (er && (er.code === 'ENOENT' || er.code === 'ENOTDIR')) { + this.statCache[abs] = false; + return false + } + } + + if (lstat && lstat.isSymbolicLink()) { + try { + stat = fs$5.statSync(abs); + } catch (er) { + stat = lstat; + } + } else { + stat = lstat; + } + } + + this.statCache[abs] = stat; + + var c = true; + if (stat) + c = stat.isDirectory() ? 'DIR' : 'FILE'; + + this.cache[abs] = this.cache[abs] || c; + + if (needDir && c === 'FILE') + return false + + return c +}; + +GlobSync$1.prototype._mark = function (p) { + return common$1.mark(this, p) +}; + +GlobSync$1.prototype._makeAbs = function (f) { + return common$1.makeAbs(this, f) +}; + +// Returns a wrapper function that returns a wrapped callback +// The wrapper function should do some stuff, and return a +// presumably different callback function. +// This makes sure that own properties are retained, so that +// decorations and such are not lost along the way. +var wrappy_1 = wrappy$1; +function wrappy$1 (fn, cb) { + if (fn && cb) return wrappy$1(fn)(cb) + + if (typeof fn !== 'function') + throw new TypeError('need wrapper function') + + Object.keys(fn).forEach(function (k) { + wrapper[k] = fn[k]; + }); + + return wrapper + + function wrapper() { + var args = new Array(arguments.length); + for (var i = 0; i < args.length; i++) { + args[i] = arguments[i]; + } + var ret = fn.apply(this, args); + var cb = args[args.length-1]; + if (typeof ret === 'function' && ret !== cb) { + Object.keys(cb).forEach(function (k) { + ret[k] = cb[k]; + }); + } + return ret + } +} + +var wrappy$2 = wrappy_1; +var once_1 = wrappy$2(once$2); +var strict = wrappy$2(onceStrict); + +once$2.proto = once$2(function () { + Object.defineProperty(Function.prototype, 'once', { + value: function () { + return once$2(this) + }, + configurable: true + }); + + Object.defineProperty(Function.prototype, 'onceStrict', { + value: function () { + return onceStrict(this) + }, + configurable: true + }); +}); + +function once$2 (fn) { + var f = function () { + if (f.called) return f.value + f.called = true; + return f.value = fn.apply(this, arguments) + }; + f.called = false; + return f +} + +function onceStrict (fn) { + var f = function () { + if (f.called) + throw new Error(f.onceError) + f.called = true; + return f.value = fn.apply(this, arguments) + }; + var name = fn.name || 'Function wrapped with `once`'; + f.onceError = name + " shouldn't be called more than once"; + f.called = false; + return f +} + +once_1.strict = strict; + +var wrappy = wrappy_1; +var reqs = Object.create(null); +var once$1 = once_1; + +var inflight_1 = wrappy(inflight$1); + +function inflight$1 (key, cb) { + if (reqs[key]) { + reqs[key].push(cb); + return null + } else { + reqs[key] = [cb]; + return makeres(key) + } +} + +function makeres (key) { + return once$1(function RES () { + var cbs = reqs[key]; + var len = cbs.length; + var args = slice(arguments); + + // XXX It's somewhat ambiguous whether a new callback added in this + // pass should be queued for later execution if something in the + // list of callbacks throws, or if it should just be discarded. + // However, it's such an edge case that it hardly matters, and either + // choice is likely as surprising as the other. + // As it happens, we do go ahead and schedule it for later execution. + try { + for (var i = 0; i < len; i++) { + cbs[i].apply(null, args); + } + } finally { + if (cbs.length > len) { + // added more in the interim. + // de-zalgo, just in case, but don't call again. + cbs.splice(0, len); + process.nextTick(function () { + RES.apply(null, args); + }); + } else { + delete reqs[key]; + } + } + }) +} + +function slice (args) { + var length = args.length; + var array = []; + + for (var i = 0; i < length; i++) array[i] = args[i]; + return array +} + +// Approach: +// +// 1. Get the minimatch set +// 2. For each pattern in the set, PROCESS(pattern, false) +// 3. Store matches per-set, then uniq them +// +// PROCESS(pattern, inGlobStar) +// Get the first [n] items from pattern that are all strings +// Join these together. This is PREFIX. +// If there is no more remaining, then stat(PREFIX) and +// add to matches if it succeeds. END. +// +// If inGlobStar and PREFIX is symlink and points to dir +// set ENTRIES = [] +// else readdir(PREFIX) as ENTRIES +// If fail, END +// +// with ENTRIES +// If pattern[n] is GLOBSTAR +// // handle the case where the globstar match is empty +// // by pruning it out, and testing the resulting pattern +// PROCESS(pattern[0..n] + pattern[n+1 .. $], false) +// // handle other cases. +// for ENTRY in ENTRIES (not dotfiles) +// // attach globstar + tail onto the entry +// // Mark that this entry is a globstar match +// PROCESS(pattern[0..n] + ENTRY + pattern[n .. $], true) +// +// else // not globstar +// for ENTRY in ENTRIES (not dotfiles, unless pattern[n] is dot) +// Test ENTRY against pattern[n] +// If fails, continue +// If passes, PROCESS(pattern[0..n] + item + pattern[n+1 .. $]) +// +// Caveat: +// Cache all stats and readdirs results to minimize syscall. Since all +// we ever care about is existence and directory-ness, we can just keep +// `true` for files, and [children,...] for directories, or `false` for +// things that don't exist. + +var glob_1 = glob$1; + +var fs$2 = fs; +var rp = index; +var minimatch = minimatch_1; +var inherits = inherits$1; +var EE = events.EventEmitter; +var path$1 = require$$0; +var assert$2 = assert; +var isAbsolute = index$8; +var globSync = sync; +var common = common$2; +var setopts = common.setopts; +var ownProp = common.ownProp; +var inflight = inflight_1; +var childrenIgnored = common.childrenIgnored; +var isIgnored = common.isIgnored; + +var once = once_1; + +function glob$1 (pattern, options, cb) { + if (typeof options === 'function') cb = options, options = {}; + if (!options) options = {}; + + if (options.sync) { + if (cb) + throw new TypeError('callback provided to sync glob') + return globSync(pattern, options) + } + + return new Glob(pattern, options, cb) +} + +glob$1.sync = globSync; +var GlobSync = glob$1.GlobSync = globSync.GlobSync; + +// old api surface +glob$1.glob = glob$1; + +function extend (origin, add) { + if (add === null || typeof add !== 'object') { + return origin + } + + var keys = Object.keys(add); + var i = keys.length; + while (i--) { + origin[keys[i]] = add[keys[i]]; + } + return origin +} + +glob$1.hasMagic = function (pattern, options_) { + var options = extend({}, options_); + options.noprocess = true; + + var g = new Glob(pattern, options); + var set = g.minimatch.set; + + if (!pattern) + return false + + if (set.length > 1) + return true + + for (var j = 0; j < set[0].length; j++) { + if (typeof set[0][j] !== 'string') + return true + } + + return false +}; + +glob$1.Glob = Glob; +inherits(Glob, EE); +function Glob (pattern, options, cb) { + if (typeof options === 'function') { + cb = options; + options = null; + } + + if (options && options.sync) { + if (cb) + throw new TypeError('callback provided to sync glob') + return new GlobSync(pattern, options) + } + + if (!(this instanceof Glob)) + return new Glob(pattern, options, cb) + + setopts(this, pattern, options); + this._didRealPath = false; + + // process each pattern in the minimatch set + var n = this.minimatch.set.length; + + // The matches are stored as {: true,...} so that + // duplicates are automagically pruned. + // Later, we do an Object.keys() on these. + // Keep them as a list so we can fill in when nonull is set. + this.matches = new Array(n); + + if (typeof cb === 'function') { + cb = once(cb); + this.on('error', cb); + this.on('end', function (matches) { + cb(null, matches); + }); + } + + var self = this; + var n = this.minimatch.set.length; + this._processing = 0; + this.matches = new Array(n); + + this._emitQueue = []; + this._processQueue = []; + this.paused = false; + + if (this.noprocess) + return this + + if (n === 0) + return done() + + var sync$$1 = true; + for (var i = 0; i < n; i ++) { + this._process(this.minimatch.set[i], i, false, done); + } + sync$$1 = false; + + function done () { + --self._processing; + if (self._processing <= 0) { + if (sync$$1) { + process.nextTick(function () { + self._finish(); + }); + } else { + self._finish(); + } + } + } +} + +Glob.prototype._finish = function () { + assert$2(this instanceof Glob); + if (this.aborted) + return + + if (this.realpath && !this._didRealpath) + return this._realpath() + + common.finish(this); + this.emit('end', this.found); +}; + +Glob.prototype._realpath = function () { + if (this._didRealpath) + return + + this._didRealpath = true; + + var n = this.matches.length; + if (n === 0) + return this._finish() + + var self = this; + for (var i = 0; i < this.matches.length; i++) + this._realpathSet(i, next); + + function next () { + if (--n === 0) + self._finish(); + } +}; + +Glob.prototype._realpathSet = function (index$$1, cb) { + var matchset = this.matches[index$$1]; + if (!matchset) + return cb() + + var found = Object.keys(matchset); + var self = this; + var n = found.length; + + if (n === 0) + return cb() + + var set = this.matches[index$$1] = Object.create(null); + found.forEach(function (p, i) { + // If there's a problem with the stat, then it means that + // one or more of the links in the realpath couldn't be + // resolved. just return the abs value in that case. + p = self._makeAbs(p); + rp.realpath(p, self.realpathCache, function (er, real) { + if (!er) + set[real] = true; + else if (er.syscall === 'stat') + set[p] = true; + else + self.emit('error', er); // srsly wtf right here + + if (--n === 0) { + self.matches[index$$1] = set; + cb(); + } + }); + }); +}; + +Glob.prototype._mark = function (p) { + return common.mark(this, p) +}; + +Glob.prototype._makeAbs = function (f) { + return common.makeAbs(this, f) +}; + +Glob.prototype.abort = function () { + this.aborted = true; + this.emit('abort'); +}; + +Glob.prototype.pause = function () { + if (!this.paused) { + this.paused = true; + this.emit('pause'); + } +}; + +Glob.prototype.resume = function () { + if (this.paused) { + this.emit('resume'); + this.paused = false; + if (this._emitQueue.length) { + var eq = this._emitQueue.slice(0); + this._emitQueue.length = 0; + for (var i = 0; i < eq.length; i ++) { + var e = eq[i]; + this._emitMatch(e[0], e[1]); + } + } + if (this._processQueue.length) { + var pq = this._processQueue.slice(0); + this._processQueue.length = 0; + for (var i = 0; i < pq.length; i ++) { + var p = pq[i]; + this._processing--; + this._process(p[0], p[1], p[2], p[3]); + } + } + } +}; + +Glob.prototype._process = function (pattern, index$$1, inGlobStar, cb) { + assert$2(this instanceof Glob); + assert$2(typeof cb === 'function'); + + if (this.aborted) + return + + this._processing++; + if (this.paused) { + this._processQueue.push([pattern, index$$1, inGlobStar, cb]); + return + } + + //console.error('PROCESS %d', this._processing, pattern) + + // Get the first [n] parts of pattern that are all strings. + var n = 0; + while (typeof pattern[n] === 'string') { + n ++; + } + // now n is the index of the first one that is *not* a string. + + // see if there's anything else + var prefix; + switch (n) { + // if not, then this is rather simple + case pattern.length: + this._processSimple(pattern.join('/'), index$$1, cb); + return + + case 0: + // pattern *starts* with some non-trivial item. + // going to readdir(cwd), but not include the prefix in matches. + prefix = null; + break + + default: + // pattern has some string bits in the front. + // whatever it starts with, whether that's 'absolute' like /foo/bar, + // or 'relative' like '../baz' + prefix = pattern.slice(0, n).join('/'); + break + } + + var remain = pattern.slice(n); + + // get the list of entries. + var read; + if (prefix === null) + read = '.'; + else if (isAbsolute(prefix) || isAbsolute(pattern.join('/'))) { + if (!prefix || !isAbsolute(prefix)) + prefix = '/' + prefix; + read = prefix; + } else + read = prefix; + + var abs = this._makeAbs(read); + + //if ignored, skip _processing + if (childrenIgnored(this, read)) + return cb() + + var isGlobStar = remain[0] === minimatch.GLOBSTAR; + if (isGlobStar) + this._processGlobStar(prefix, read, abs, remain, index$$1, inGlobStar, cb); + else + this._processReaddir(prefix, read, abs, remain, index$$1, inGlobStar, cb); +}; + +Glob.prototype._processReaddir = function (prefix, read, abs, remain, index$$1, inGlobStar, cb) { + var self = this; + this._readdir(abs, inGlobStar, function (er, entries) { + return self._processReaddir2(prefix, read, abs, remain, index$$1, inGlobStar, entries, cb) + }); +}; + +Glob.prototype._processReaddir2 = function (prefix, read, abs, remain, index$$1, inGlobStar, entries, cb) { + + // if the abs isn't a dir, then nothing can match! + if (!entries) + return cb() + + // It will only match dot entries if it starts with a dot, or if + // dot is set. Stuff like @(.foo|.bar) isn't allowed. + var pn = remain[0]; + var negate = !!this.minimatch.negate; + var rawGlob = pn._glob; + var dotOk = this.dot || rawGlob.charAt(0) === '.'; + + var matchedEntries = []; + for (var i = 0; i < entries.length; i++) { + var e = entries[i]; + if (e.charAt(0) !== '.' || dotOk) { + var m; + if (negate && !prefix) { + m = !e.match(pn); + } else { + m = e.match(pn); + } + if (m) + matchedEntries.push(e); + } + } + + //console.error('prd2', prefix, entries, remain[0]._glob, matchedEntries) + + var len = matchedEntries.length; + // If there are no matched entries, then nothing matches. + if (len === 0) + return cb() + + // if this is the last remaining pattern bit, then no need for + // an additional stat *unless* the user has specified mark or + // stat explicitly. We know they exist, since readdir returned + // them. + + if (remain.length === 1 && !this.mark && !this.stat) { + if (!this.matches[index$$1]) + this.matches[index$$1] = Object.create(null); + + for (var i = 0; i < len; i ++) { + var e = matchedEntries[i]; + if (prefix) { + if (prefix !== '/') + e = prefix + '/' + e; + else + e = prefix + e; + } + + if (e.charAt(0) === '/' && !this.nomount) { + e = path$1.join(this.root, e); + } + this._emitMatch(index$$1, e); + } + // This was the last one, and no stats were needed + return cb() + } + + // now test all matched entries as stand-ins for that part + // of the pattern. + remain.shift(); + for (var i = 0; i < len; i ++) { + var e = matchedEntries[i]; + var newPattern; + if (prefix) { + if (prefix !== '/') + e = prefix + '/' + e; + else + e = prefix + e; + } + this._process([e].concat(remain), index$$1, inGlobStar, cb); + } + cb(); +}; + +Glob.prototype._emitMatch = function (index$$1, e) { + if (this.aborted) + return + + if (isIgnored(this, e)) + return + + if (this.paused) { + this._emitQueue.push([index$$1, e]); + return + } + + var abs = isAbsolute(e) ? e : this._makeAbs(e); + + if (this.mark) + e = this._mark(e); + + if (this.absolute) + e = abs; + + if (this.matches[index$$1][e]) + return + + if (this.nodir) { + var c = this.cache[abs]; + if (c === 'DIR' || Array.isArray(c)) + return + } + + this.matches[index$$1][e] = true; + + var st = this.statCache[abs]; + if (st) + this.emit('stat', e, st); + + this.emit('match', e); +}; + +Glob.prototype._readdirInGlobStar = function (abs, cb) { + if (this.aborted) + return + + // follow all symlinked directories forever + // just proceed as if this is a non-globstar situation + if (this.follow) + return this._readdir(abs, false, cb) + + var lstatkey = 'lstat\0' + abs; + var self = this; + var lstatcb = inflight(lstatkey, lstatcb_); + + if (lstatcb) + fs$2.lstat(abs, lstatcb); + + function lstatcb_ (er, lstat) { + if (er && er.code === 'ENOENT') + return cb() + + var isSym = lstat && lstat.isSymbolicLink(); + self.symlinks[abs] = isSym; + + // If it's not a symlink or a dir, then it's definitely a regular file. + // don't bother doing a readdir in that case. + if (!isSym && lstat && !lstat.isDirectory()) { + self.cache[abs] = 'FILE'; + cb(); + } else + self._readdir(abs, false, cb); + } +}; + +Glob.prototype._readdir = function (abs, inGlobStar, cb) { + if (this.aborted) + return + + cb = inflight('readdir\0'+abs+'\0'+inGlobStar, cb); + if (!cb) + return + + //console.error('RD %j %j', +inGlobStar, abs) + if (inGlobStar && !ownProp(this.symlinks, abs)) + return this._readdirInGlobStar(abs, cb) + + if (ownProp(this.cache, abs)) { + var c = this.cache[abs]; + if (!c || c === 'FILE') + return cb() + + if (Array.isArray(c)) + return cb(null, c) + } + + var self = this; + fs$2.readdir(abs, readdirCb(this, abs, cb)); +}; + +function readdirCb (self, abs, cb) { + return function (er, entries) { + if (er) + self._readdirError(abs, er, cb); + else + self._readdirEntries(abs, entries, cb); + } +} + +Glob.prototype._readdirEntries = function (abs, entries, cb) { + if (this.aborted) + return + + // if we haven't asked to stat everything, then just + // assume that everything in there exists, so we can avoid + // having to stat it a second time. + if (!this.mark && !this.stat) { + for (var i = 0; i < entries.length; i ++) { + var e = entries[i]; + if (abs === '/') + e = abs + e; + else + e = abs + '/' + e; + this.cache[e] = true; + } + } + + this.cache[abs] = entries; + return cb(null, entries) +}; + +Glob.prototype._readdirError = function (f, er, cb) { + if (this.aborted) + return + + // handle errors, and cache the information + switch (er.code) { + case 'ENOTSUP': // https://github.com/isaacs/node-glob/issues/205 + case 'ENOTDIR': // totally normal. means it *does* exist. + var abs = this._makeAbs(f); + this.cache[abs] = 'FILE'; + if (abs === this.cwdAbs) { + var error = new Error(er.code + ' invalid cwd ' + this.cwd); + error.path = this.cwd; + error.code = er.code; + this.emit('error', error); + this.abort(); + } + break + + case 'ENOENT': // not terribly unusual + case 'ELOOP': + case 'ENAMETOOLONG': + case 'UNKNOWN': + this.cache[this._makeAbs(f)] = false; + break + + default: // some unusual error. Treat as failure. + this.cache[this._makeAbs(f)] = false; + if (this.strict) { + this.emit('error', er); + // If the error is handled, then we abort + // if not, we threw out of here + this.abort(); + } + if (!this.silent) + console.error('glob error', er); + break + } + + return cb() +}; + +Glob.prototype._processGlobStar = function (prefix, read, abs, remain, index$$1, inGlobStar, cb) { + var self = this; + this._readdir(abs, inGlobStar, function (er, entries) { + self._processGlobStar2(prefix, read, abs, remain, index$$1, inGlobStar, entries, cb); + }); +}; + + +Glob.prototype._processGlobStar2 = function (prefix, read, abs, remain, index$$1, inGlobStar, entries, cb) { + //console.error('pgs2', prefix, remain[0], entries) + + // no entries means not a dir, so it can never have matches + // foo.txt/** doesn't match foo.txt + if (!entries) + return cb() + + // test without the globstar, and with every child both below + // and replacing the globstar. + var remainWithoutGlobStar = remain.slice(1); + var gspref = prefix ? [ prefix ] : []; + var noGlobStar = gspref.concat(remainWithoutGlobStar); + + // the noGlobStar pattern exits the inGlobStar state + this._process(noGlobStar, index$$1, false, cb); + + var isSym = this.symlinks[abs]; + var len = entries.length; + + // If it's a symlink, and we're in a globstar, then stop + if (isSym && inGlobStar) + return cb() + + for (var i = 0; i < len; i++) { + var e = entries[i]; + if (e.charAt(0) === '.' && !this.dot) + continue + + // these two cases enter the inGlobStar state + var instead = gspref.concat(entries[i], remainWithoutGlobStar); + this._process(instead, index$$1, true, cb); + + var below = gspref.concat(entries[i], remain); + this._process(below, index$$1, true, cb); + } + + cb(); +}; + +Glob.prototype._processSimple = function (prefix, index$$1, cb) { + // XXX review this. Shouldn't it be doing the mounting etc + // before doing stat? kinda weird? + var self = this; + this._stat(prefix, function (er, exists) { + self._processSimple2(prefix, index$$1, er, exists, cb); + }); +}; +Glob.prototype._processSimple2 = function (prefix, index$$1, er, exists, cb) { + + //console.error('ps2', prefix, exists) + + if (!this.matches[index$$1]) + this.matches[index$$1] = Object.create(null); + + // If it doesn't exist, then just mark the lack of results + if (!exists) + return cb() + + if (prefix && isAbsolute(prefix) && !this.nomount) { + var trail = /[\/\\]$/.test(prefix); + if (prefix.charAt(0) === '/') { + prefix = path$1.join(this.root, prefix); + } else { + prefix = path$1.resolve(this.root, prefix); + if (trail) + prefix += '/'; + } + } + + if (process.platform === 'win32') + prefix = prefix.replace(/\\/g, '/'); + + // Mark this as a match + this._emitMatch(index$$1, prefix); + cb(); +}; + +// Returns either 'DIR', 'FILE', or false +Glob.prototype._stat = function (f, cb) { + var abs = this._makeAbs(f); + var needDir = f.slice(-1) === '/'; + + if (f.length > this.maxLength) + return cb() + + if (!this.stat && ownProp(this.cache, abs)) { + var c = this.cache[abs]; + + if (Array.isArray(c)) + c = 'DIR'; + + // It exists, but maybe not how we need it + if (!needDir || c === 'DIR') + return cb(null, c) + + if (needDir && c === 'FILE') + return cb() + + // otherwise we have to stat, because maybe c=true + // if we know it exists, but not what it is. + } + + var exists; + var stat = this.statCache[abs]; + if (stat !== undefined) { + if (stat === false) + return cb(null, stat) + else { + var type = stat.isDirectory() ? 'DIR' : 'FILE'; + if (needDir && type === 'FILE') + return cb() + else + return cb(null, type, stat) + } + } + + var self = this; + var statcb = inflight('stat\0' + abs, lstatcb_); + if (statcb) + fs$2.lstat(abs, statcb); + + function lstatcb_ (er, lstat) { + if (lstat && lstat.isSymbolicLink()) { + // If it's a symlink, then treat it as the target, unless + // the target does not exist, then treat it as a file. + return fs$2.stat(abs, function (er, stat) { + if (er) + self._stat2(f, abs, null, lstat, cb); + else + self._stat2(f, abs, er, stat, cb); + }) + } else { + self._stat2(f, abs, er, lstat, cb); + } + } +}; + +Glob.prototype._stat2 = function (f, abs, er, stat, cb) { + if (er && (er.code === 'ENOENT' || er.code === 'ENOTDIR')) { + this.statCache[abs] = false; + return cb() + } + + var needDir = f.slice(-1) === '/'; + this.statCache[abs] = stat; + + if (abs.slice(-1) === '/' && stat && !stat.isDirectory()) + return cb(null, false, stat) + + var c = true; + if (stat) + c = stat.isDirectory() ? 'DIR' : 'FILE'; + this.cache[abs] = this.cache[abs] || c; + + if (needDir && c === 'FILE') + return cb() + + return cb(null, c, stat) +}; + +var rimraf_1 = rimraf$1; +rimraf$1.sync = rimrafSync; + +var assert$1 = assert; +var path = require$$0; +var fs$1 = fs; +var glob = glob_1; + +var defaultGlobOpts = { + nosort: true, + silent: true +}; + +// for EMFILE handling +var timeout = 0; + +var isWindows = (process.platform === "win32"); + +function defaults (options) { + var methods = [ + 'unlink', + 'chmod', + 'stat', + 'lstat', + 'rmdir', + 'readdir' + ]; + methods.forEach(function(m) { + options[m] = options[m] || fs$1[m]; + m = m + 'Sync'; + options[m] = options[m] || fs$1[m]; + }); + + options.maxBusyTries = options.maxBusyTries || 3; + options.emfileWait = options.emfileWait || 1000; + if (options.glob === false) { + options.disableGlob = true; + } + options.disableGlob = options.disableGlob || false; + options.glob = options.glob || defaultGlobOpts; +} + +function rimraf$1 (p, options, cb) { + if (typeof options === 'function') { + cb = options; + options = {}; + } + + assert$1(p, 'rimraf: missing path'); + assert$1.equal(typeof p, 'string', 'rimraf: path should be a string'); + assert$1.equal(typeof cb, 'function', 'rimraf: callback function required'); + assert$1(options, 'rimraf: invalid options argument provided'); + assert$1.equal(typeof options, 'object', 'rimraf: options should be object'); + + defaults(options); + + var busyTries = 0; + var errState = null; + var n = 0; + + if (options.disableGlob || !glob.hasMagic(p)) + return afterGlob(null, [p]) + + options.lstat(p, function (er, stat) { + if (!er) + return afterGlob(null, [p]) + + glob(p, options.glob, afterGlob); + }); + + function next (er) { + errState = errState || er; + if (--n === 0) + cb(errState); + } + + function afterGlob (er, results) { + if (er) + return cb(er) + + n = results.length; + if (n === 0) + return cb() + + results.forEach(function (p) { + rimraf_(p, options, function CB (er) { + if (er) { + if ((er.code === "EBUSY" || er.code === "ENOTEMPTY" || er.code === "EPERM") && + busyTries < options.maxBusyTries) { + busyTries ++; + var time = busyTries * 100; + // try again, with the same exact callback as this one. + return setTimeout(function () { + rimraf_(p, options, CB); + }, time) + } + + // this one won't happen if graceful-fs is used. + if (er.code === "EMFILE" && timeout < options.emfileWait) { + return setTimeout(function () { + rimraf_(p, options, CB); + }, timeout ++) + } + + // already gone + if (er.code === "ENOENT") er = null; + } + + timeout = 0; + next(er); + }); + }); + } +} + +// Two possible strategies. +// 1. Assume it's a file. unlink it, then do the dir stuff on EPERM or EISDIR +// 2. Assume it's a directory. readdir, then do the file stuff on ENOTDIR +// +// Both result in an extra syscall when you guess wrong. However, there +// are likely far more normal files in the world than directories. This +// is based on the assumption that a the average number of files per +// directory is >= 1. +// +// If anyone ever complains about this, then I guess the strategy could +// be made configurable somehow. But until then, YAGNI. +function rimraf_ (p, options, cb) { + assert$1(p); + assert$1(options); + assert$1(typeof cb === 'function'); + + // sunos lets the root user unlink directories, which is... weird. + // so we have to lstat here and make sure it's not a dir. + options.lstat(p, function (er, st) { + if (er && er.code === "ENOENT") + return cb(null) + + // Windows can EPERM on stat. Life is suffering. + if (er && er.code === "EPERM" && isWindows) + fixWinEPERM(p, options, er, cb); + + if (st && st.isDirectory()) + return rmdir(p, options, er, cb) + + options.unlink(p, function (er) { + if (er) { + if (er.code === "ENOENT") + return cb(null) + if (er.code === "EPERM") + return (isWindows) + ? fixWinEPERM(p, options, er, cb) + : rmdir(p, options, er, cb) + if (er.code === "EISDIR") + return rmdir(p, options, er, cb) + } + return cb(er) + }); + }); +} + +function fixWinEPERM (p, options, er, cb) { + assert$1(p); + assert$1(options); + assert$1(typeof cb === 'function'); + if (er) + assert$1(er instanceof Error); + + options.chmod(p, 666, function (er2) { + if (er2) + cb(er2.code === "ENOENT" ? null : er); + else + options.stat(p, function(er3, stats) { + if (er3) + cb(er3.code === "ENOENT" ? null : er); + else if (stats.isDirectory()) + rmdir(p, options, er, cb); + else + options.unlink(p, cb); + }); + }); +} + +function fixWinEPERMSync (p, options, er) { + assert$1(p); + assert$1(options); + if (er) + assert$1(er instanceof Error); + + try { + options.chmodSync(p, 666); + } catch (er2) { + if (er2.code === "ENOENT") + return + else + throw er + } + + try { + var stats = options.statSync(p); + } catch (er3) { + if (er3.code === "ENOENT") + return + else + throw er + } + + if (stats.isDirectory()) + rmdirSync(p, options, er); + else + options.unlinkSync(p); +} + +function rmdir (p, options, originalEr, cb) { + assert$1(p); + assert$1(options); + if (originalEr) + assert$1(originalEr instanceof Error); + assert$1(typeof cb === 'function'); + + // try to rmdir first, and only readdir on ENOTEMPTY or EEXIST (SunOS) + // if we guessed wrong, and it's not a directory, then + // raise the original error. + options.rmdir(p, function (er) { + if (er && (er.code === "ENOTEMPTY" || er.code === "EEXIST" || er.code === "EPERM")) + rmkids(p, options, cb); + else if (er && er.code === "ENOTDIR") + cb(originalEr); + else + cb(er); + }); +} + +function rmkids(p, options, cb) { + assert$1(p); + assert$1(options); + assert$1(typeof cb === 'function'); + + options.readdir(p, function (er, files) { + if (er) + return cb(er) + var n = files.length; + if (n === 0) + return options.rmdir(p, cb) + var errState; + files.forEach(function (f) { + rimraf$1(path.join(p, f), options, function (er) { + if (errState) + return + if (er) + return cb(errState = er) + if (--n === 0) + options.rmdir(p, cb); + }); + }); + }); +} + +// this looks simpler, and is strictly *faster*, but will +// tie up the JavaScript thread and fail on excessively +// deep directory trees. +function rimrafSync (p, options) { + options = options || {}; + defaults(options); + + assert$1(p, 'rimraf: missing path'); + assert$1.equal(typeof p, 'string', 'rimraf: path should be a string'); + assert$1(options, 'rimraf: missing options'); + assert$1.equal(typeof options, 'object', 'rimraf: options should be object'); + + var results; + + if (options.disableGlob || !glob.hasMagic(p)) { + results = [p]; + } else { + try { + options.lstatSync(p); + results = [p]; + } catch (er) { + results = glob.sync(p, options.glob); + } + } + + if (!results.length) + return + + for (var i = 0; i < results.length; i++) { + var p = results[i]; + + try { + var st = options.lstatSync(p); + } catch (er) { + if (er.code === "ENOENT") + return + + // Windows can EPERM on stat. Life is suffering. + if (er.code === "EPERM" && isWindows) + fixWinEPERMSync(p, options, er); + } + + try { + // sunos lets the root user unlink directories, which is... weird. + if (st && st.isDirectory()) + rmdirSync(p, options, null); + else + options.unlinkSync(p); + } catch (er) { + if (er.code === "ENOENT") + return + if (er.code === "EPERM") + return isWindows ? fixWinEPERMSync(p, options, er) : rmdirSync(p, options, er) + if (er.code !== "EISDIR") + throw er + + rmdirSync(p, options, er); + } + } +} + +function rmdirSync (p, options, originalEr) { + assert$1(p); + assert$1(options); + if (originalEr) + assert$1(originalEr instanceof Error); + + try { + options.rmdirSync(p); + } catch (er) { + if (er.code === "ENOENT") + return + if (er.code === "ENOTDIR") + throw originalEr + if (er.code === "ENOTEMPTY" || er.code === "EEXIST" || er.code === "EPERM") + rmkidsSync(p, options); + } +} + +function rmkidsSync (p, options) { + assert$1(p); + assert$1(options); + options.readdirSync(p).forEach(function (f) { + rimrafSync(path.join(p, f), options); + }); + + // We only end up here once we got ENOTEMPTY at least once, and + // at this point, we are guaranteed to have removed all the kids. + // So, we know that it won't be ENOENT or ENOTDIR or anything else. + // try really hard to delete stuff on windows, because it has a + // PROFOUNDLY annoying habit of not closing handles promptly when + // files are deleted, resulting in spurious ENOTEMPTY errors. + var retries = isWindows ? 100 : 1; + var i = 0; + do { + var threw = true; + try { + var ret = options.rmdirSync(p, options); + threw = false; + return ret + } finally { + if (++i < retries && threw) + continue + } + } while (true) +} + +//removed node + +var rimraf = rimraf_1; + +var help = false; +var dashdash = false; +var noglob = false; +var args = process.argv.slice(2).filter(function(arg) { + if (dashdash) + return !!arg + else if (arg === '--') + dashdash = true; + else if (arg === '--no-glob' || arg === '-G') + noglob = true; + else if (arg === '--glob' || arg === '-g') + noglob = false; + else if (arg.match(/^(-+|\/)(h(elp)?|\?)$/)) + help = true; + else + return !!arg +}); + +if (help || args.length === 0) { + // If they didn't ask for help, then this is not a "success" + var log = help ? console.log : console.error; + log('Usage: rimraf [ ...]'); + log(''); + log(' Deletes all files and folders at "path" recursively.'); + log(''); + log('Options:'); + log(''); + log(' -h, --help Display this usage info'); + log(' -G, --no-glob Do not expand glob patterns in arguments'); + log(' -g, --glob Expand glob patterns in arguments (default)'); + process.exit(help ? 0 : 1); +} else + go(0); + +function go (n) { + if (n >= args.length) + return + var options = {}; + if (noglob) + options = { glob: false }; + rimraf(args[n], options, function (er) { + if (er) + throw er + go(n+1); + }); +} + +var binWithoutHashbang = { + +}; + +module.exports = binWithoutHashbang; diff --git a/package.json b/package.json index ec817395..50632927 100644 --- a/package.json +++ b/package.json @@ -13,7 +13,7 @@ "postinstall": "install-app-deps && npm run rebuild-node-pty", "rebuild-node-pty": "electron-rebuild -f -w app/node_modules/node-pty -m app", "dist": "npm run build && cross-env BABEL_ENV=production babel --out-file app/dist/bundle.js --no-comments --minified app/dist/bundle.js && build", - "clean": "npm cache clear && rm -rf node_modules && rm -rf app/node_modules && rm -rf app/dist" + "clean": "node ./bin/rimraf-standalone.js node_modules && node ./bin/rimraf-standalone.js ./app/node_modules && node ./bin/rimraf-standalone.js ./app/dist" }, "xo": { "extends": "xo-react", @@ -35,7 +35,8 @@ "app/dist/**", "app/static/**", "assets/**", - "website/**" + "website/**", + "bin/**" ] }, "babel": { From 7b403380b0b0ac55533a666c8283909bebbd97bf Mon Sep 17 00:00:00 2001 From: nitsakh Date: Mon, 12 Jun 2017 18:48:56 -0700 Subject: [PATCH 03/62] Addressing issue #1862 by filtering out Boolean values from the plugins list (#1927) * Addressing issue #1862 by filtering out Boolean values from the plugins list in the config. * Updating the PR based on review comments. --- app/config/init.js | 3 +++ 1 file changed, 3 insertions(+) diff --git a/app/config/init.js b/app/config/init.js index d761d558..b62031bf 100644 --- a/app/config/init.js +++ b/app/config/init.js @@ -36,6 +36,9 @@ const _init = function (cfg) { notify('Error reading configuration: `config` key is missing'); return _extractDefault(cfg.defaultCfg); } + // Ignore undefined values in plugin and localPlugins array Issue #1862 + _cfg.plugins = (_cfg.plugins && _cfg.plugins.filter(Boolean)) || []; + _cfg.localPlugins = (_cfg.localPlugins && _cfg.localPlugins.filter(Boolean)) || []; return _cfg; } return _extractDefault(cfg.defaultCfg); From debbfa1553da1409d65f5fd455e0c02602d45549 Mon Sep 17 00:00:00 2001 From: nitsakh Date: Tue, 13 Jun 2017 17:44:33 -0700 Subject: [PATCH 04/62] Addressing `yarn run dist` issues. (#1928) * Addressing `yarn run dist` issues. * Pin node-gyp version * Move node-gyp to devDependencies * Addressing review comments. * Updated yarn.lock. --- package.json | 1 + readme.md | 5 +++++ yarn.lock | 2 +- 3 files changed, 7 insertions(+), 1 deletion(-) diff --git a/package.json b/package.json index 50632927..274a9bc6 100644 --- a/package.json +++ b/package.json @@ -152,6 +152,7 @@ "eslint-config-xo-react": "0.10.0", "eslint-plugin-react": "6.7.1", "husky": "0.13.4", + "node-gyp": "3.6.2", "redux-logger": "3.0.6", "spectron": "3.6.4", "webpack": "2.6.1", diff --git a/readme.md b/readme.md index 9a96ae08..b510ef7f 100644 --- a/readme.md +++ b/readme.md @@ -52,6 +52,11 @@ make sure its build process is working correctly by running `yarn run rebuild-no If you're on macOS, this typically is related to Xcode issues (like not having agreed to the Terms of Service by running `sudo xcodebuild` after a fresh Xcode installation). +### Error with `codesign` on macOS when running `yarn run dist` + +If you have issues in the `codesign` step when running `yarn run dist` on macOS, you can temporarily disable code signing locally by setting +`export CSC_IDENTITY_AUTO_DISCOVERY=false` for the current terminal session. + ## Related Repositories - [Art](https://github.com/zeit/art/tree/master/hyper) diff --git a/yarn.lock b/yarn.lock index 2eb4678c..82bfd9db 100644 --- a/yarn.lock +++ b/yarn.lock @@ -4069,7 +4069,7 @@ node-forge@^0.7.1: version "0.7.1" resolved "https://registry.yarnpkg.com/node-forge/-/node-forge-0.7.1.tgz#9da611ea08982f4b94206b3beb4cc9665f20c300" -node-gyp@^3.6.0: +node-gyp@3.6.2, node-gyp@^3.6.0: version "3.6.2" resolved "https://registry.yarnpkg.com/node-gyp/-/node-gyp-3.6.2.tgz#9bfbe54562286284838e750eac05295853fa1c60" dependencies: From 6d99a6df3132f90d901823e7cb67eac8ad54ace3 Mon Sep 17 00:00:00 2001 From: Albin Ekblom Date: Wed, 14 Jun 2017 04:16:43 +0200 Subject: [PATCH 05/62] Cleanup readme (#1934) * Structure readme * Shrink titles --- readme.md | 6 ++++-- 1 file changed, 4 insertions(+), 2 deletions(-) diff --git a/readme.md b/readme.md index b510ef7f..d5281406 100644 --- a/readme.md +++ b/readme.md @@ -44,7 +44,9 @@ yarn run dist After that, you'll see the binary in the `./dist` folder! -### node-pty issues +#### Known issues that can happen during development + +##### Error building `node-pty` If after building during development you get an alert dialog related to `node-pty` issues, make sure its build process is working correctly by running `yarn run rebuild-node-pty`. @@ -52,7 +54,7 @@ make sure its build process is working correctly by running `yarn run rebuild-no If you're on macOS, this typically is related to Xcode issues (like not having agreed to the Terms of Service by running `sudo xcodebuild` after a fresh Xcode installation). -### Error with `codesign` on macOS when running `yarn run dist` +##### Error with `codesign` on macOS when running `yarn run dist` If you have issues in the `codesign` step when running `yarn run dist` on macOS, you can temporarily disable code signing locally by setting `export CSC_IDENTITY_AUTO_DISCOVERY=false` for the current terminal session. From 0bf10f376856a984117d213008977736b55959e0 Mon Sep 17 00:00:00 2001 From: Albin Ekblom Date: Wed, 14 Jun 2017 18:12:03 +0200 Subject: [PATCH 06/62] Escape parentheses for dropped files/folders (#1935) * Escape parentheses for dropped files/folders Fixes #1933 * Cleanup regex * Wrap dropped path in single-quote * Escape single quote inside single quote * Handle escaping with current shell * Cleanup escape --- app/index.js | 20 ++++++++++++++++---- lib/actions/sessions.js | 5 +++-- lib/index.js | 4 ++-- 3 files changed, 21 insertions(+), 8 deletions(-) diff --git a/app/index.js b/app/index.js index 563578f7..15d80bd5 100644 --- a/app/index.js +++ b/app/index.js @@ -264,8 +264,18 @@ app.on('ready', () => installDevExtensions(isDev).then(() => { session.resize({cols, rows}); }); - rpc.on('data', ({uid, data}) => { - sessions.get(uid).write(data); + rpc.on('data', ({uid, data, escaped}) => { + const session = sessions.get(uid); + + if (escaped) { + const escapedData = session.shell.endsWith('cmd.exe') ? + `"${data}"` : // This is how cmd.exe does it + `'${data.replace(/'/g, `'\\''`)}'`; // Inside a single-quoted string nothing is interpreted + + session.write(escapedData); + } else { + session.write(data); + } }); rpc.on('open external', ({url}) => { @@ -311,8 +321,10 @@ app.on('ready', () => installDevExtensions(isDev).then(() => { const protocol = typeof url === 'string' && parseUrl(url).protocol; if (protocol === 'file:') { event.preventDefault(); - const path = fileUriToPath(url).replace(/ /g, '\\ '); - rpc.emit('session data send', {data: path}); + + const path = fileUriToPath(url); + + rpc.emit('session data send', {data: path, escaped: true}); } else if (protocol === 'http:' || protocol === 'https:') { event.preventDefault(); rpc.emit('session data send', {data: url}); diff --git a/lib/actions/sessions.js b/lib/actions/sessions.js index 07265584..2a26e4b1 100644 --- a/lib/actions/sessions.js +++ b/lib/actions/sessions.js @@ -140,7 +140,7 @@ export function resizeSession(uid, cols, rows) { }; } -export function sendSessionData(uid, data) { +export function sendSessionData(uid, data, escaped) { return function (dispatch, getState) { dispatch({ type: SESSION_USER_DATA, @@ -148,7 +148,8 @@ export function sendSessionData(uid, data) { effect() { // If no uid is passed, data is sent to the active session. const targetUid = uid || getState().sessions.activeUid; - rpc.emit('data', {uid: targetUid, data}); + + rpc.emit('data', {uid: targetUid, data, escaped}); } }); }; diff --git a/lib/index.js b/lib/index.js index 093ace47..d093ed45 100644 --- a/lib/index.js +++ b/lib/index.js @@ -70,8 +70,8 @@ rpc.on('session data', d => { } }); -rpc.on('session data send', ({uid, data}) => { - store_.dispatch(sessionActions.sendSessionData(uid, data)); +rpc.on('session data send', ({uid, data, escaped}) => { + store_.dispatch(sessionActions.sendSessionData(uid, data, escaped)); }); rpc.on('session exit', ({uid}) => { From ab703b5bf2b677e1220af0ba37a7400dec899e0f Mon Sep 17 00:00:00 2001 From: Philippe Potvin Date: Wed, 14 Jun 2017 21:03:41 -0400 Subject: [PATCH 07/62] Add docs for keys modification (#1937) * Add keymaps docs to website * de-beautify --- app/config/config-default.js | 7 ++++++- website/index.html | 19 ++++++++++++++++++- 2 files changed, 24 insertions(+), 2 deletions(-) diff --git a/app/config/config-default.js b/app/config/config-default.js index 7221c0df..8b1db9d0 100644 --- a/app/config/config-default.js +++ b/app/config/config-default.js @@ -116,5 +116,10 @@ module.exports = { // in development, you can create a directory under // `~/.hyper_plugins/local/` and include it here // to load it and avoid it being `npm install`ed - localPlugins: [] + localPlugins: [], + + keymaps: { + // Example + // 'window:devtools': 'cmd+alt+o', + } }; diff --git a/website/index.html b/website/index.html index 871c07a5..f2b5c255 100644 --- a/website/index.html +++ b/website/index.html @@ -677,6 +677,23 @@

You can also take a look at Awesome Hyper for a curated list of plugins and resources.

+ +

Keymaps

+ +

All command keys can be changed. In order to change them, edit + ~/.hyper.js and add your desired change to keymaps. +

+

Then Hyper will change the default with your custom change.

+

Example: 'window:devtools': 'Cmd+Alt+O'

+ 

module.exports = {
+  config: { /*... */ },
+
+  keymaps: {
+    'window:devtools': 'cmd+alt+o'
+  }
+
+};
+

Configuration

@@ -1637,4 +1654,4 @@ exports.mapTermsState = (state, map) => { }); - + \ No newline at end of file From 5ec705000f73dbad5f70b9152708cbeaf4e3c086 Mon Sep 17 00:00:00 2001 From: Andrej Mihaliak Date: Fri, 16 Jun 2017 09:58:49 +0200 Subject: [PATCH 08/62] Set line height same as font size (#1841) fixes cut font on last line --- lib/components/term.js | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/lib/components/term.js b/lib/components/term.js index cb5cb7d7..08a464a0 100644 --- a/lib/components/term.js +++ b/lib/components/term.js @@ -255,7 +255,7 @@ export default class Term extends Component { border-width: 1px !important; } x-row { - line-height: 1.2em; + line-height: 1em; } ${hyperCaret} ${scrollBarCss} From db35faa431fad1fc52afe2c0a58d668e720d44a4 Mon Sep 17 00:00:00 2001 From: CHaBou Date: Mon, 19 Jun 2017 23:02:53 +0200 Subject: [PATCH 09/62] Show plugin (name and version) loaded (#1826) * Print plugin name and version in devtools * Add plugins informations in About dialog --- app/index.js | 5 +++-- app/menus/menu.js | 25 ++++++++++++++++++++++--- app/menus/menus/darwin.js | 7 +++++-- app/menus/menus/help.js | 13 +++---------- app/plugins.js | 11 +++++++++++ lib/utils/plugins.js | 18 +++++++++++++++++- 6 files changed, 61 insertions(+), 18 deletions(-) diff --git a/app/index.js b/app/index.js index 15d80bd5..b97f7f30 100644 --- a/app/index.js +++ b/app/index.js @@ -405,8 +405,9 @@ app.on('ready', () => installDevExtensions(isDev).then(() => { const menu = plugins.decorateMenu( AppMenu(createWindow, () => { plugins.updatePlugins({force: true}); - }) - ); + }, + plugins.getLoadedPluginVersions + )); // If we're on Mac make a Dock Menu if (process.platform === 'darwin') { diff --git a/app/menus/menu.js b/app/menus/menu.js index 463a8d7b..71cde678 100644 --- a/app/menus/menu.js +++ b/app/menus/menu.js @@ -1,4 +1,7 @@ +const {app, dialog} = require('electron'); + const {getKeymaps} = require('../config'); +const {icon} = require('../config/paths'); // menus const viewMenu = require('./menus/view'); @@ -9,16 +12,32 @@ const windowMenu = require('./menus/window'); const helpMenu = require('./menus/help'); const darwinMenu = require('./menus/darwin'); -module.exports = (createWindow, updatePlugins) => { +const appName = app.getName(); +const appVersion = app.getVersion(); + +module.exports = (createWindow, updatePlugins, getLoadedPluginVersions) => { const commands = getKeymaps().commands; + const showAbout = () => { + const loadedPlugins = getLoadedPluginVersions(); + const pluginList = loadedPlugins.length === 0 ? + 'none' : + loadedPlugins.map(plugin => `\n ${plugin.name} (${plugin.version})`); + dialog.showMessageBox({ + title: `About ${appName}`, + message: `${appName} ${appVersion}`, + detail: `Plugins: ${pluginList}\n\nCreated by Guillermo Rauch\nCopyright © 2017 Zeit, Inc.`, + buttons: [], + icon + }); + }; const menu = [ - ...(process.platform === 'darwin' ? [darwinMenu(commands)] : []), + ...(process.platform === 'darwin' ? [darwinMenu(commands, showAbout)] : []), shellMenu(commands, createWindow), editMenu(commands), viewMenu(commands), pluginsMenu(commands, updatePlugins), windowMenu(commands), - helpMenu(commands) + helpMenu(commands, showAbout) ]; return menu; diff --git a/app/menus/menus/darwin.js b/app/menus/menus/darwin.js index 98266ce8..bff2bf0d 100644 --- a/app/menus/menus/darwin.js +++ b/app/menus/menus/darwin.js @@ -3,12 +3,15 @@ const {app} = require('electron'); const {openConfig} = require('../../config'); -module.exports = function (commands) { +module.exports = function (commands, showAbout) { return { label: `${app.getName()}`, submenu: [ { - role: 'about' + label: 'About Hyper', + click() { + showAbout(); + } }, { type: 'separator' diff --git a/app/menus/menus/help.js b/app/menus/menus/help.js index 9bb883c6..6bdc8826 100644 --- a/app/menus/menus/help.js +++ b/app/menus/menus/help.js @@ -1,8 +1,7 @@ const os = require('os'); -const {app, shell, dialog} = require('electron'); -const {icon} = require('../../config/paths'); +const {app, shell} = require('electron'); -module.exports = function () { +module.exports = function (commands, showAbout) { const submenu = [ { label: `${app.getName()} Website`, @@ -31,13 +30,7 @@ module.exports = function () { { role: 'about', click() { - dialog.showMessageBox({ - title: `About ${app.getName()}`, - message: `${app.getName()} ${app.getVersion()}`, - detail: 'Created by Guillermo Rauch', - icon, - buttons: [] - }); + showAbout(); } } ); diff --git a/app/plugins.js b/app/plugins.js index 32926c9c..ec264eb3 100644 --- a/app/plugins.js +++ b/app/plugins.js @@ -161,6 +161,10 @@ function clearCache() { exports.updatePlugins = updatePlugins; +exports.getLoadedPluginVersions = function () { + return modules.map(mod => ({name: mod._name, version: mod._version})); +}; + // we schedule the initial plugins update // a bit after the user launches the terminal // to prevent slowness @@ -309,6 +313,13 @@ function requirePlugins() { // populate the name for internal errors here mod._name = basename(path); + try { + // eslint-disable-next-line import/no-dynamic-require + mod._version = require(resolve(path, 'package.json')).version; + } catch (err) { + console.warn(`No package.json found in ${path}`); + } + console.log(`Plugin ${mod._name} (${mod._version}) loaded.`); return mod; } catch (err) { diff --git a/lib/utils/plugins.js b/lib/utils/plugins.js index f7016ac3..b9912e88 100644 --- a/lib/utils/plugins.js +++ b/lib/utils/plugins.js @@ -73,7 +73,19 @@ const clearModulesCache = () => { } }; -const getPluginName = path => window.require('path').basename(path); +const pathModule = window.require('path'); + +const getPluginName = path => pathModule.basename(path); + +const getPluginVersion = path => { + let version = null; + try { + version = window.require(pathModule.resolve(path, 'package.json')).version; + } catch (err) { + console.warn(`No package.json found in ${path}`); + } + return version; +}; const loadModules = () => { console.log('(re)loading renderer plugins'); @@ -112,6 +124,7 @@ const loadModules = () => { .map(path => { let mod; const pluginName = getPluginName(path); + const pluginVersion = getPluginVersion(path); // window.require allows us to ensure this doesn't get // in the way of our build @@ -126,6 +139,7 @@ const loadModules = () => { for (const i in mod) { if ({}.hasOwnProperty.call(mod, i)) { mod[i]._pluginName = pluginName; + mod[i]._pluginVersion = pluginVersion; } } @@ -209,6 +223,8 @@ const loadModules = () => { mod.onRendererWindow(window); } + console.log(`Plugin ${pluginName} (${pluginVersion}) loaded.`); + return mod; }) .filter(mod => Boolean(mod)); From 221c3ce237556dc9a532f9962a5a9983c6990e66 Mon Sep 17 00:00:00 2001 From: CHaBou Date: Wed, 28 Jun 2017 01:56:21 +0200 Subject: [PATCH 10/62] Add Travis dep for Linux (#1957) `electron-builder` compatibility See https://github.com/electron-userland/electron-builder/wiki/Multi-Platform-Build#to-build-app-in-32-bit-from-a-machine-with-64-bit --- .travis.yml | 2 ++ 1 file changed, 2 insertions(+) diff --git a/.travis.yml b/.travis.yml index 32f23d0a..74ca61c5 100644 --- a/.travis.yml +++ b/.travis.yml @@ -15,6 +15,8 @@ matrix: addons: apt: packages: + - gcc-multilib + - g++-multilib - libgnome-keyring-dev - icnsutils - graphicsmagick From 8a23b18f2dd67b8353ed24e99af922bd07ab3478 Mon Sep 17 00:00:00 2001 From: Leo Lamprecht Date: Thu, 6 Jul 2017 17:18:06 +0200 Subject: [PATCH 11/62] New build badge for AppVeyor --- readme.md | 4 ++-- 1 file changed, 2 insertions(+), 2 deletions(-) diff --git a/readme.md b/readme.md index d5281406..07cd5fbb 100644 --- a/readme.md +++ b/readme.md @@ -1,7 +1,7 @@ ![](https://github.com/zeit/art/blob/525bd1bb39d97dd3b91c976106a6d5cc5766b678/hyper/repo-banner.png) -[![Build Status](https://travis-ci.org/zeit/hyper.svg?branch=master)](https://travis-ci.org/zeit/hyper) -[![Build status](https://ci.appveyor.com/api/projects/status/txg5qb0x35h0h65p/branch/master?svg=true)](https://ci.appveyor.com/project/appveyor-zeit/hyper/branch/master) +[![macOS CI status](https://travis-ci.org/zeit/hyper.svg?branch=master)](https://travis-ci.org/zeit/hyper) +[![Windows CI status](https://ci.appveyor.com/api/projects/status/kqvb4oa772an58sc?svg=true)](https://ci.appveyor.com/project/zeit/hyper) [![Slack Channel](http://zeit-slackin.now.sh/badge.svg)](https://zeit.chat/) [![Changelog #213](https://img.shields.io/badge/changelog-%23213-lightgrey.svg)](https://changelog.com/213) [![XO code style](https://img.shields.io/badge/code_style-XO-5ed9c7.svg)](https://github.com/sindresorhus/xo) From 4fd115bf271816058d1a13a754e0ec120bb747e9 Mon Sep 17 00:00:00 2001 From: Philippe Potvin Date: Wed, 2 Aug 2017 15:20:03 -0400 Subject: [PATCH 12/62] Update window creation (#2028) * add ui/window * move window and optimize code * cleanup --- app/index.js | 267 +++-------------------------------------------- app/ui/window.js | 239 ++++++++++++++++++++++++++++++++++++++++++ 2 files changed, 251 insertions(+), 255 deletions(-) create mode 100644 app/ui/window.js diff --git a/app/index.js b/app/index.js index b97f7f30..f78e0767 100644 --- a/app/index.js +++ b/app/index.js @@ -35,24 +35,14 @@ if (process.platform === 'win32') { } // Native -const {resolve, isAbsolute} = require('path'); -const {homedir} = require('os'); +const {resolve} = require('path'); // Packages -const {parse: parseUrl} = require('url'); -const {app, BrowserWindow, shell, Menu} = require('electron'); +const {app, BrowserWindow, Menu} = require('electron'); const {gitDescribe} = require('git-describe'); -const uuid = require('uuid'); -const fileUriToPath = require('file-uri-to-path'); const isDev = require('electron-is-dev'); -// Ours -const AutoUpdater = require('./auto-updater'); -const toElectronBackgroundColor = require('./utils/to-electron-background-color'); const AppMenu = require('./menus/menu'); -const createRPC = require('./rpc'); -const notify = require('./notify'); -const fetchNotifications = require('./notifications'); const config = require('./config'); app.commandLine.appendSwitch('js-flags', '--harmony-async-await'); @@ -61,7 +51,8 @@ app.commandLine.appendSwitch('js-flags', '--harmony-async-await'); config.setup(); const plugins = require('./plugins'); -const Session = require('./session'); + +const Window = require('./ui/window'); const windowSet = new Set([]); @@ -103,7 +94,7 @@ console.log('electron will open', url); app.on('ready', () => installDevExtensions(isDev).then(() => { function createWindow(fn, options = {}) { - let cfg = plugins.getDecoratedConfig(); + const cfg = plugins.getDecoratedConfig(); const winSet = config.getWin(); let [startX, startY] = winSet.position; @@ -139,247 +130,17 @@ app.on('ready', () => installDevExtensions(isDev).then(() => { } } - const browserDefaults = { - width, - height, - minHeight: 190, - minWidth: 370, - titleBarStyle: 'hidden-inset', // macOS only - title: 'Hyper.app', - backgroundColor: toElectronBackgroundColor(cfg.backgroundColor || '#000'), - // we want to go frameless on windows and linux - frame: process.platform === 'darwin', - transparent: process.platform === 'darwin', - icon: resolve(__dirname, 'static/icon.png'), - // we only want to show when the prompt is ready for user input - // HYPERTERM_DEBUG for backwards compatibility with hyperterm - show: process.env.HYPER_DEBUG || process.env.HYPERTERM_DEBUG || isDev, - x: startX, - y: startY, - acceptFirstMouse: true - }; - const browserOptions = plugins.getDecoratedBrowserOptions(browserDefaults); - - const win = new BrowserWindow(browserOptions); - windowSet.add(win); - - win.loadURL(url); - - const rpc = createRPC(win); - const sessions = new Map(); - - // config changes - const cfgUnsubscribe = config.subscribe(() => { - const cfg_ = plugins.getDecoratedConfig(); - - // notify renderer - win.webContents.send('config change'); - - // notify user that shell changes require new sessions - if (cfg_.shell !== cfg.shell || - JSON.stringify(cfg_.shellArgs) !== JSON.stringify(cfg.shellArgs)) { - notify( - 'Shell configuration changed!', - 'Open a new tab or window to start using the new shell' - ); - } - - // update background color if necessary - cfg = cfg_; - }); - - rpc.on('init', () => { - // we update the backgroundColor once the init is called. - // when we do a win.reload() we need need to reset the backgroundColor - win.setBackgroundColor(toElectronBackgroundColor(cfg.backgroundColor || '#000')); - win.show(); - - // If no callback is passed to createWindow, - // a new session will be created by default. - if (!fn) { - fn = win => win.rpc.emit('termgroup add req'); - } - - // app.windowCallback is the createWindow callback - // that can be set before the 'ready' app event - // and createWindow deifinition. It's executed in place of - // the callback passed as parameter, and deleted right after. - (app.windowCallback || fn)(win); - delete (app.windowCallback); - - fetchNotifications(win); - // auto updates - if (!isDev && process.platform !== 'linux') { - AutoUpdater(win); - } else { - console.log('ignoring auto updates during dev'); - } - }); - - rpc.on('new', ({rows = 40, cols = 100, cwd = process.argv[1] && isAbsolute(process.argv[1]) ? process.argv[1] : homedir(), splitDirection}) => { - const shell = cfg.shell; - const shellArgs = cfg.shellArgs && Array.from(cfg.shellArgs); - - initSession({rows, cols, cwd, shell, shellArgs}, (uid, session) => { - sessions.set(uid, session); - rpc.emit('session add', { - rows, - cols, - uid, - splitDirection, - shell: session.shell, - pid: session.pty.pid - }); - - session.on('data', data => { - rpc.emit('session data', uid + data); - }); - - session.on('exit', () => { - rpc.emit('session exit', {uid}); - sessions.delete(uid); - }); - }); - }); - - rpc.on('exit', ({uid}) => { - const session = sessions.get(uid); - if (session) { - session.exit(); - } else { - console.log('session not found by', uid); - } - }); - - rpc.on('unmaximize', () => { - win.unmaximize(); - }); - - rpc.on('maximize', () => { - win.maximize(); - }); - - rpc.on('resize', ({uid, cols, rows}) => { - const session = sessions.get(uid); - session.resize({cols, rows}); - }); - - rpc.on('data', ({uid, data, escaped}) => { - const session = sessions.get(uid); - - if (escaped) { - const escapedData = session.shell.endsWith('cmd.exe') ? - `"${data}"` : // This is how cmd.exe does it - `'${data.replace(/'/g, `'\\''`)}'`; // Inside a single-quoted string nothing is interpreted - - session.write(escapedData); - } else { - session.write(data); - } - }); - - rpc.on('open external', ({url}) => { - shell.openExternal(url); - }); - - rpc.win.on('move', () => { - rpc.emit('move'); - }); - - rpc.on('open hamburger menu', ({x, y}) => { - Menu.getApplicationMenu().popup(Math.ceil(x), Math.ceil(y)); - }); - - rpc.on('minimize', () => { - win.minimize(); - }); - - rpc.on('close', () => { - win.close(); - }); - - const deleteSessions = () => { - sessions.forEach((session, key) => { - session.removeAllListeners(); - session.destroy(); - sessions.delete(key); - }); - }; - - // we reset the rpc channel only upon - // subsequent refreshes (ie: F5) - let i = 0; - win.webContents.on('did-navigate', () => { - if (i++) { - deleteSessions(); - } - }); - - // If file is dropped onto the terminal window, navigate event is prevented - // and his path is added to active session. - win.webContents.on('will-navigate', (event, url) => { - const protocol = typeof url === 'string' && parseUrl(url).protocol; - if (protocol === 'file:') { - event.preventDefault(); - - const path = fileUriToPath(url); - - rpc.emit('session data send', {data: path, escaped: true}); - } else if (protocol === 'http:' || protocol === 'https:') { - event.preventDefault(); - rpc.emit('session data send', {data: url}); - } - }); - - // expose internals to extension authors - win.rpc = rpc; - win.sessions = sessions; - - const load = () => { - plugins.onWindow(win); - }; - - // load plugins - load(); - - const pluginsUnsubscribe = plugins.subscribe(err => { - if (!err) { - load(); - win.webContents.send('plugins change'); - } - }); - - // Keep track of focus time of every window, to figure out - // which one of the existing window is the last focused. - // Works nicely even if a window is closed and removed. - const updateFocusTime = () => { - win.focusTime = process.uptime(); - }; - win.on('focus', () => { - updateFocusTime(); - }); - // Ensure focusTime is set on window open. The focus event doesn't - // fire from the dock (see bug #583) - updateFocusTime(); + const hwin = new Window({width, height, x: startX, y: startY}, cfg, fn); + windowSet.add(hwin); + hwin.loadURL(url); // the window can be closed by the browser process itself - win.on('close', () => { - config.winRecord(win); - windowSet.delete(win); - rpc.destroy(); - deleteSessions(); - cfgUnsubscribe(); - pluginsUnsubscribe(); + hwin.on('close', () => { + hwin.clean(); + windowSet.delete(this); }); - // Same deal as above, grabbing the window titlebar when the window - // is maximized on Windows results in unmaximize, without hitting any - // app buttons - for (const ev of ['maximize', 'unmaximize', 'minimize', 'restore']) { - win.on(ev, () => rpc.emit('windowGeometry change')); - } - - win.on('closed', () => { + hwin.on('closed', () => { if (process.platform !== 'darwin' && windowSet.size === 0) { app.quit(); } @@ -437,10 +198,6 @@ app.on('ready', () => installDevExtensions(isDev).then(() => { console.error('Error while loading devtools extensions', err); })); -function initSession(opts, fn) { - fn(uuid.v4(), new Session(opts)); -} - app.on('open-file', (event, path) => { const lastWindow = app.getLastFocusedWindow(); const callback = win => win.rpc.emit('open file', {path}); diff --git a/app/ui/window.js b/app/ui/window.js new file mode 100644 index 00000000..6fa8a851 --- /dev/null +++ b/app/ui/window.js @@ -0,0 +1,239 @@ +const {app, BrowserWindow, shell, Menu} = require('electron'); +const {isAbsolute} = require('path'); +const {parse: parseUrl} = require('url'); +const uuid = require('uuid'); +const fileUriToPath = require('file-uri-to-path'); +const isDev = require('electron-is-dev'); +const AutoUpdater = require('../auto-updater'); +const toElectronBackgroundColor = require('../utils/to-electron-background-color'); +const {icon, cfgDir} = require('../config/paths'); +const createRPC = require('../rpc'); +const notify = require('../notify'); +const fetchNotifications = require('../notifications'); +const Session = require('../session'); + +module.exports = class Window extends BrowserWindow { + constructor(options, cfg, fn) { + const opts = Object.assign({ + minWidth: 370, + minHeight: 190, + backgroundColor: toElectronBackgroundColor(cfg.backgroundColor || '#000'), + titleBarStyle: 'hidden-inset', + title: 'Hyper.app', + // we want to go frameless on windows and linux + frame: process.platform === 'darwin', + transparent: process.platform === 'darwin', + icon, + show: process.env.HYPER_DEBUG || process.env.HYPERTERM_DEBUG || isDev, + acceptFirstMouse: true + }, options); + const modOpts = app.plugins.getDecoratedBrowserOptions(opts); + super(modOpts); + const rpc = createRPC(this); + const sessions = new Map(); + + // config changes + const cfgUnsubscribe = app.config.subscribe(() => { + const cfg_ = app.plugins.getDecoratedConfig(); + + // notify renderer + this.webContents.send('config change'); + + // notify user that shell changes require new sessions + if (cfg_.shell !== cfg.shell || + JSON.stringify(cfg_.shellArgs) !== JSON.stringify(cfg.shellArgs)) { + notify( + 'Shell configuration changed!', + 'Open a new tab or window to start using the new shell' + ); + } + + // update background color if necessary + cfg = cfg_; + }); + + rpc.on('init', () => { + this.setBackgroundColor(toElectronBackgroundColor(cfg.backgroundColor || '#000')); + this.show(); + + // If no callback is passed to createWindow, + // a new session will be created by default. + if (!fn) { + fn = win => win.rpc.emit('termgroup add req'); + } + + // app.windowCallback is the createWindow callback + // that can be set before the 'ready' app event + // and createWindow deifinition. It's executed in place of + // the callback passed as parameter, and deleted right after. + (app.windowCallback || fn)(this); + delete (app.windowCallback); + fetchNotifications(this); + // auto updates + if (!isDev && process.platform !== 'linux') { + AutoUpdater(this); + } else { + console.log('ignoring auto updates during dev'); + } + }); + + rpc.on('new', options => { + const opts = Object.assign({ + rows: 40, + cols: 100, + cwd: process.argv[1] && isAbsolute(process.argv[1]) ? process.argv[1] : cfgDir, + splitDirection: undefined, + shell: cfg.shell, + shellArgs: cfg.shellArgs && Array.from(cfg.shellArgs) + }, options); + + const initSession = (opts, fn) => { + fn(uuid.v4(), new Session(opts)); + }; + + initSession(opts, (uid, session) => { + sessions.set(uid, session); + rpc.emit('session add', { + rows: opts.rows, + cols: opts.cols, + uid, + splitDirection: opts.splitDirection, + shell: session.shell, + pid: session.pty.pid + }); + + session.on('data', data => { + rpc.emit('session data', uid + data); + }); + + session.on('exit', () => { + rpc.emit('session exit', {uid}); + }); + }); + }); + rpc.on('exit', ({uid}) => { + const session = sessions.get(uid); + if (session) { + session.exit(); + } else { + console.log('session not found by', uid); + } + }); + rpc.on('unmaximize', () => { + this.unmaximize(); + }); + rpc.on('maximize', () => { + this.maximize(); + }); + rpc.on('minimize', () => { + this.minimize(); + }); + rpc.on('resize', ({uid, cols, rows}) => { + const session = sessions.get(uid); + session.resize({cols, rows}); + }); + rpc.on('data', ({uid, data, escaped}) => { + const session = sessions.get(uid); + + if (escaped) { + const escapedData = session.shell.endsWith('cmd.exe') ? + `"${data}"` : // This is how cmd.exe does it + `'${data.replace(/'/g, `'\\''`)}'`; // Inside a single-quoted string nothing is interpreted + + session.write(escapedData); + } else { + session.write(data); + } + }); + rpc.on('open external', ({url}) => { + shell.openExternal(url); + }); + rpc.on('open hamburger menu', ({x, y}) => { + Menu.getApplicationMenu().popup(Math.ceil(x), Math.ceil(y)); + }); + // Same deal as above, grabbing the window titlebar when the window + // is maximized on Windows results in unmaximize, without hitting any + // app buttons + for (const ev of ['maximize', 'unmaximize', 'minimize', 'restore']) { + this.on(ev, () => rpc.emit('windowGeometry change')); + } + rpc.win.on('move', () => { + rpc.emit('move'); + }); + rpc.on('close', () => { + this.close(); + }); + const deleteSessions = () => { + sessions.forEach((session, key) => { + session.removeAllListeners(); + session.destroy(); + sessions.delete(key); + }); + }; + // we reset the rpc channel only upon + // subsequent refreshes (ie: F5) + let i = 0; + this.webContents.on('did-navigate', () => { + if (i++) { + deleteSessions(); + } + }); + + // If file is dropped onto the terminal window, navigate event is prevented + // and his path is added to active session. + this.webContents.on('will-navigate', (event, url) => { + const protocol = typeof url === 'string' && parseUrl(url).protocol; + if (protocol === 'file:') { + event.preventDefault(); + + const path = fileUriToPath(url); + + rpc.emit('session data send', {data: path, escaped: true}); + } else if (protocol === 'http:' || protocol === 'https:') { + event.preventDefault(); + rpc.emit('session data send', {data: url}); + } + }); + + // expose internals to extension authors + this.rpc = rpc; + this.sessions = sessions; + + const load = () => { + app.plugins.onWindow(this); + }; + + // load plugins + load(); + + const pluginsUnsubscribe = app.plugins.subscribe(err => { + if (!err) { + load(); + this.webContents.send('plugins change'); + } + }); + + // Keep track of focus time of every window, to figure out + // which one of the existing window is the last focused. + // Works nicely even if a window is closed and removed. + const updateFocusTime = () => { + this.focusTime = process.uptime(); + }; + + this.on('focus', () => { + updateFocusTime(); + }); + + // the window can be closed by the browser process itself + this.clean = () => { + app.config.winRecord(this); + rpc.destroy(); + deleteSessions(); + cfgUnsubscribe(); + pluginsUnsubscribe(); + }; + // Ensure focusTime is set on window open. The focus event doesn't + // fire from the dock (see bug #583) + updateFocusTime(); + } +}; From 866b5b82ce398e3671f041d352136fb7fa51e241 Mon Sep 17 00:00:00 2001 From: Leo Lamprecht Date: Fri, 4 Aug 2017 23:52:38 +0200 Subject: [PATCH 13/62] New URL for update server (#2047) --- app/auto-updater.js | 9 +++------ 1 file changed, 3 insertions(+), 6 deletions(-) diff --git a/app/auto-updater.js b/app/auto-updater.js index 215a5bfe..aa77e629 100644 --- a/app/auto-updater.js +++ b/app/auto-updater.js @@ -4,12 +4,9 @@ const ms = require('ms'); const notify = require('./notify'); // eslint-disable-line no-unused-vars const {version} = require('./package'); -// accepted values: `osx`, `win32` -// https://nuts.gitbook.com/update-windows.html -const platform = process.platform === 'darwin' ? - 'osx' : - process.platform; -const FEED_URL = `https://hyper-updates.now.sh/update/${platform}`; +const {platform} = process; +const FEED_URL = `https://releases.hyper.is/update/${platform}`; + let isInit = false; function init() { From 21f4769231941509e5655ba63e37761aed57b743 Mon Sep 17 00:00:00 2001 From: Leo Lamprecht Date: Sat, 5 Aug 2017 00:05:10 +0200 Subject: [PATCH 14/62] New URL for latest Hyper release --- website/index.html | 22 +++++++++++----------- 1 file changed, 11 insertions(+), 11 deletions(-) diff --git a/website/index.html b/website/index.html index f2b5c255..e49a624d 100644 --- a/website/index.html +++ b/website/index.html @@ -606,35 +606,35 @@ macOS (.dmg) - DOWNLOAD + DOWNLOAD Windows (.exe) COMING SOON - DOWNLOAD + DOWNLOAD Debian (.deb) COMING SOON - DOWNLOAD + DOWNLOAD Fedora (.rpm) COMING SOON - DOWNLOAD + DOWNLOAD Other Linux distros (.AppImage) COMING SOON - DOWNLOAD + DOWNLOAD @@ -677,10 +677,10 @@

You can also take a look at Awesome Hyper for a curated list of plugins and resources.

- +

Keymaps

- -

All command keys can be changed. In order to change them, edit + +

All command keys can be changed. In order to change them, edit ~/.hyper.js and add your desired change to keymaps.

Then Hyper will change the default with your custom change.

@@ -693,7 +693,7 @@ } }; - +

Configuration

@@ -1635,7 +1635,7 @@ exports.mapTermsState = (state, map) => { downloadButtonText.innerHTML += ' for Fedora'; document.getElementById('td-fedora').classList.add('highlighted'); } else { - downloadButton.setAttribute('href', 'https://hyper-latest.now.sh/latest/AppImage'); + downloadButton.setAttribute('href', 'https://latest.hyper.is/latest/AppImage'); downloadButtonText.innerHTML += ' for Linux'; document.getElementById('td-appimage').classList.add('highlighted'); } @@ -1654,4 +1654,4 @@ exports.mapTermsState = (state, map) => { }); - \ No newline at end of file + From 3f694130c01aca87462858fcaa3ea129b20885e8 Mon Sep 17 00:00:00 2001 From: Leo Lamprecht Date: Sat, 5 Aug 2017 00:06:36 +0200 Subject: [PATCH 15/62] Alias field added to website --- website/package.json | 3 +++ 1 file changed, 3 insertions(+) diff --git a/website/package.json b/website/package.json index f0fef358..93173844 100644 --- a/website/package.json +++ b/website/package.json @@ -7,5 +7,8 @@ }, "scripts": { "start": "serve . -c 5" + }, + "now": { + "alias": "hyper.is" } } From 2a6d2718162991019ed54329f74d306d99b8b4b4 Mon Sep 17 00:00:00 2001 From: Benjamin Staneck Date: Tue, 8 Aug 2017 02:45:07 +0200 Subject: [PATCH 16/62] Fix travis build by removing extra snap package (#2053) --- .travis.yml | 1 - 1 file changed, 1 deletion(-) diff --git a/.travis.yml b/.travis.yml index 74ca61c5..0f4d53e4 100644 --- a/.travis.yml +++ b/.travis.yml @@ -30,7 +30,6 @@ before_install: - if [[ "$TRAVIS_OS_NAME" == "linux" ]]; then export DISPLAY=:99.0; sh -e /etc/init.d/xvfb start; sleep 3; fi - if [[ "$TRAVIS_OS_NAME" == "osx" ]]; then brew update; fi - if [[ "$TRAVIS_OS_NAME" == "osx" ]]; then brew install yarn; fi - - if [[ "$TRAVIS_OS_NAME" == "linux" ]]; then sudo add-apt-repository ppa:snappy-dev/tools-proposed -y && sudo apt update && sudo apt install snapcraft; fi install: - yarn From c01b4112ea9e469d0446342e654adfe3d4773a7c Mon Sep 17 00:00:00 2001 From: Philippe Potvin Date: Mon, 7 Aug 2017 21:17:09 -0400 Subject: [PATCH 17/62] fix devtools (#2048) * fix devtools * simp --- app/index.js | 2 +- app/ui/window.js | 45 +++++++++++++++++++++++---------------------- 2 files changed, 24 insertions(+), 23 deletions(-) diff --git a/app/index.js b/app/index.js index f78e0767..6b1c2c3f 100644 --- a/app/index.js +++ b/app/index.js @@ -137,7 +137,7 @@ app.on('ready', () => installDevExtensions(isDev).then(() => { // the window can be closed by the browser process itself hwin.on('close', () => { hwin.clean(); - windowSet.delete(this); + windowSet.delete(hwin); }); hwin.on('closed', () => { diff --git a/app/ui/window.js b/app/ui/window.js index 6fa8a851..1d010eda 100644 --- a/app/ui/window.js +++ b/app/ui/window.js @@ -12,7 +12,7 @@ const notify = require('../notify'); const fetchNotifications = require('../notifications'); const Session = require('../session'); -module.exports = class Window extends BrowserWindow { +module.exports = class Window { constructor(options, cfg, fn) { const opts = Object.assign({ minWidth: 370, @@ -27,9 +27,8 @@ module.exports = class Window extends BrowserWindow { show: process.env.HYPER_DEBUG || process.env.HYPERTERM_DEBUG || isDev, acceptFirstMouse: true }, options); - const modOpts = app.plugins.getDecoratedBrowserOptions(opts); - super(modOpts); - const rpc = createRPC(this); + const window = new BrowserWindow(app.plugins.getDecoratedBrowserOptions(opts)); + const rpc = createRPC(window); const sessions = new Map(); // config changes @@ -53,8 +52,8 @@ module.exports = class Window extends BrowserWindow { }); rpc.on('init', () => { - this.setBackgroundColor(toElectronBackgroundColor(cfg.backgroundColor || '#000')); - this.show(); + window.setBackgroundColor(toElectronBackgroundColor(cfg.backgroundColor || '#000')); + window.show(); // If no callback is passed to createWindow, // a new session will be created by default. @@ -66,12 +65,12 @@ module.exports = class Window extends BrowserWindow { // that can be set before the 'ready' app event // and createWindow deifinition. It's executed in place of // the callback passed as parameter, and deleted right after. - (app.windowCallback || fn)(this); + (app.windowCallback || fn)(window); delete (app.windowCallback); - fetchNotifications(this); + fetchNotifications(window); // auto updates if (!isDev && process.platform !== 'linux') { - AutoUpdater(this); + AutoUpdater(window); } else { console.log('ignoring auto updates during dev'); } @@ -120,13 +119,13 @@ module.exports = class Window extends BrowserWindow { } }); rpc.on('unmaximize', () => { - this.unmaximize(); + window.unmaximize(); }); rpc.on('maximize', () => { - this.maximize(); + window.maximize(); }); rpc.on('minimize', () => { - this.minimize(); + window.minimize(); }); rpc.on('resize', ({uid, cols, rows}) => { const session = sessions.get(uid); @@ -155,7 +154,7 @@ module.exports = class Window extends BrowserWindow { // is maximized on Windows results in unmaximize, without hitting any // app buttons for (const ev of ['maximize', 'unmaximize', 'minimize', 'restore']) { - this.on(ev, () => rpc.emit('windowGeometry change')); + window.on(ev, () => rpc.emit('windowGeometry change')); } rpc.win.on('move', () => { rpc.emit('move'); @@ -173,7 +172,7 @@ module.exports = class Window extends BrowserWindow { // we reset the rpc channel only upon // subsequent refreshes (ie: F5) let i = 0; - this.webContents.on('did-navigate', () => { + window.webContents.on('did-navigate', () => { if (i++) { deleteSessions(); } @@ -181,7 +180,7 @@ module.exports = class Window extends BrowserWindow { // If file is dropped onto the terminal window, navigate event is prevented // and his path is added to active session. - this.webContents.on('will-navigate', (event, url) => { + window.webContents.on('will-navigate', (event, url) => { const protocol = typeof url === 'string' && parseUrl(url).protocol; if (protocol === 'file:') { event.preventDefault(); @@ -196,11 +195,11 @@ module.exports = class Window extends BrowserWindow { }); // expose internals to extension authors - this.rpc = rpc; - this.sessions = sessions; + window.rpc = rpc; + window.sessions = sessions; const load = () => { - app.plugins.onWindow(this); + app.plugins.onWindow(window); }; // load plugins @@ -217,16 +216,16 @@ module.exports = class Window extends BrowserWindow { // which one of the existing window is the last focused. // Works nicely even if a window is closed and removed. const updateFocusTime = () => { - this.focusTime = process.uptime(); + window.focusTime = process.uptime(); }; - this.on('focus', () => { + window.on('focus', () => { updateFocusTime(); }); // the window can be closed by the browser process itself - this.clean = () => { - app.config.winRecord(this); + window.clean = () => { + app.config.winRecord(window); rpc.destroy(); deleteSessions(); cfgUnsubscribe(); @@ -235,5 +234,7 @@ module.exports = class Window extends BrowserWindow { // Ensure focusTime is set on window open. The focus event doesn't // fire from the dock (see bug #583) updateFocusTime(); + + return window; } }; From eb85e14cbc63f9d7b82b9da01920d7508d2ac1a2 Mon Sep 17 00:00:00 2001 From: Philippe Potvin Date: Tue, 8 Aug 2017 15:51:26 -0400 Subject: [PATCH 18/62] fix (#2057) --- app/ui/window.js | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/app/ui/window.js b/app/ui/window.js index 1d010eda..a14a034f 100644 --- a/app/ui/window.js +++ b/app/ui/window.js @@ -208,7 +208,7 @@ module.exports = class Window { const pluginsUnsubscribe = app.plugins.subscribe(err => { if (!err) { load(); - this.webContents.send('plugins change'); + window.webContents.send('plugins change'); } }); From 263caa0659c0bb072a8d215cd63bc059936c3fb7 Mon Sep 17 00:00:00 2001 From: Benjamin Staneck Date: Tue, 8 Aug 2017 22:29:54 +0200 Subject: [PATCH 19/62] Dependency updates (#1958) * Dependency updates * update babel-loader, electron-builder, electron-builder-squirrel-windows * update node-pty to 0.6.9 release notes: https://github.com/Tyriar/node-pty/releases * update node-pty to 0.6.10 release notes: https://github.com/Tyriar/node-pty/releases/tag/0.6.10 * update electron-builder * more dependency updates * Update Electron and family Electron release notes: https://github.com/electron/electron/releases/tag/v1.6.12 * Update redux to 3.7.2 * Update webpack to 3.x and enable ModuleConcatenation Basically absorb PR #1967 * Update react and react-dom * also absorb the changes of PR https://github.com/zeit/hyper/pull/2056 --- app/package.json | 2 +- app/yarn.lock | 6 +- package.json | 32 +- webpack.config.js | 6 +- yarn.lock | 780 ++++++++++++++++++++++++++-------------------- 5 files changed, 461 insertions(+), 365 deletions(-) diff --git a/app/package.json b/app/package.json index 3678319a..92cc7cf0 100644 --- a/app/package.json +++ b/app/package.json @@ -23,7 +23,7 @@ "mkdirp": "0.5.1", "ms": "0.7.1", "node-fetch": "1.6.3", - "node-pty": "0.6.6", + "node-pty": "0.6.10", "semver": "5.3.0", "shell-env": "0.2.0", "uuid": "3.0.0", diff --git a/app/yarn.lock b/app/yarn.lock index d5063fbb..27ac42e3 100644 --- a/app/yarn.lock +++ b/app/yarn.lock @@ -263,9 +263,9 @@ node-fetch@1.6.3: encoding "^0.1.11" is-stream "^1.0.1" -node-pty@0.6.6: - version "0.6.6" - resolved "https://registry.yarnpkg.com/node-pty/-/node-pty-0.6.6.tgz#7f507148f917aa809a714c2864d98f0e6d3afcd6" +node-pty@0.6.10: + version "0.6.10" + resolved "https://registry.yarnpkg.com/node-pty/-/node-pty-0.6.10.tgz#b7d355bb2002d16e14c3c353e58c48f7ee131a67" dependencies: nan "2.5.0" diff --git a/package.json b/package.json index 274a9bc6..30c8f50c 100644 --- a/package.json +++ b/package.json @@ -10,7 +10,7 @@ "test:unit": "ava test/unit", "test:unit:watch": "npm run test:unit -- --watch", "prepush": "npm test", - "postinstall": "install-app-deps && npm run rebuild-node-pty", + "postinstall": "electron-builder install-app-deps && npm run rebuild-node-pty", "rebuild-node-pty": "electron-rebuild -f -w app/node_modules/node-pty -m app", "dist": "npm run build && cross-env BABEL_ENV=production babel --out-file app/dist/bundle.js --no-comments --minified app/dist/bundle.js && build", "clean": "node ./bin/rimraf-standalone.js node_modules && node ./bin/rimraf-standalone.js ./app/node_modules && node ./bin/rimraf-standalone.js ./app/dist" @@ -122,40 +122,40 @@ "mousetrap": "1.6.1", "ms": "0.7.2", "php-escape-shell": "1.0.0", - "react": "15.5.4", + "react": "15.6.1", "react-deep-force-update": "2.0.1", - "react-dom": "15.5.4", + "react-dom": "15.6.1", "react-redux": "5.0.5", - "redux": "3.6.0", + "redux": "3.7.2", "redux-thunk": "2.2.0", "reselect": "3.0.1", - "runes": "0.4.0", + "runes": "0.4.2", "seamless-immutable": "6.1.3", - "semver": "5.3.0", + "semver": "5.4.1", "uuid": "3.0.1" }, "devDependencies": { "asar": "0.13.0", "ava": "0.17.0", "babel-cli": "6.24.1", - "babel-core": "6.24.1", - "babel-loader": "7.0.0", - "babel-preset-babili": "0.1.2", + "babel-core": "6.25.0", + "babel-loader": "7.1.1", + "babel-preset-babili": "0.1.4", "babel-preset-react": "6.24.1", "copy-webpack-plugin": "4.0.1", - "cross-env": "5.0.0", - "electron": "1.6.11", - "electron-builder": "18.3.5", - "electron-builder-squirrel-windows": "18.3.0", + "cross-env": "5.0.1", + "electron": "1.6.12", + "electron-builder": "19.19.1", + "electron-builder-squirrel-windows": "19.19.1", "electron-devtools-installer": "2.2.0", - "electron-rebuild": "1.5.11", + "electron-rebuild": "1.6.0", "eslint-config-xo-react": "0.10.0", "eslint-plugin-react": "6.7.1", - "husky": "0.13.4", + "husky": "0.14.3", "node-gyp": "3.6.2", "redux-logger": "3.0.6", "spectron": "3.6.4", - "webpack": "2.6.1", + "webpack": "3.4.1", "xo": "0.17.1" } } diff --git a/webpack.config.js b/webpack.config.js index 7f68c5c6..5edfec2d 100644 --- a/webpack.config.js +++ b/webpack.config.js @@ -7,6 +7,9 @@ const nodeEnv = process.env.NODE_ENV || 'development'; const isProd = nodeEnv === 'production'; module.exports = { + resolve: { + extensions: ['.js', '.jsx'] + }, devtool: isProd ? 'hidden-source-map' : 'cheap-module-source-map', entry: './lib/index.js', output: { @@ -14,7 +17,7 @@ module.exports = { filename: 'bundle.js' }, module: { - loaders: [ + rules: [ { test: /\.(js|jsx)$/, exclude: /node_modules/, @@ -32,6 +35,7 @@ module.exports = { NODE_ENV: JSON.stringify(nodeEnv) } }), + new webpack.optimize.ModuleConcatenationPlugin(), new Copy([ { from: './assets', diff --git a/yarn.lock b/yarn.lock index 82bfd9db..81e206ba 100644 --- a/yarn.lock +++ b/yarn.lock @@ -58,11 +58,11 @@ acorn@^5.0.0, acorn@^5.0.1: version "5.0.3" resolved "https://registry.yarnpkg.com/acorn/-/acorn-5.0.3.tgz#c460df08491463f028ccb82eab3730bf01087b3d" -ajv-keywords@^1.0.0, ajv-keywords@^1.1.1: +ajv-keywords@^1.0.0: version "1.5.1" resolved "https://registry.yarnpkg.com/ajv-keywords/-/ajv-keywords-1.5.1.tgz#314dd0a4b3368fad3dfcdc54ede6171b886daf3c" -ajv-keywords@^2.1.0: +ajv-keywords@^2.0.0, ajv-keywords@^2.1.0: version "2.1.0" resolved "https://registry.yarnpkg.com/ajv-keywords/-/ajv-keywords-2.1.0.tgz#a296e17f7bfae7c1ce4f7e0de53d29cb32162df0" @@ -73,11 +73,13 @@ ajv@^4.7.0, ajv@^4.9.1: co "^4.6.0" json-stable-stringify "^1.0.1" -ajv@^5.1.5: - version "5.1.5" - resolved "https://registry.yarnpkg.com/ajv/-/ajv-5.1.5.tgz#8734931b601f00d4feef7c65738d77d1b65d1f68" +ajv@^5.1.5, ajv@^5.2.2: + version "5.2.2" + resolved "https://registry.yarnpkg.com/ajv/-/ajv-5.2.2.tgz#47c68d69e86f5d953103b0074a9430dc63da5e39" dependencies: co "^4.6.0" + fast-deep-equal "^1.0.0" + json-schema-traverse "^0.3.0" json-stable-stringify "^1.0.1" align-text@^0.1.1, align-text@^0.1.3: @@ -116,14 +118,16 @@ ansi-styles@^2.2.1: version "2.2.1" resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-2.2.1.tgz#b432dd3358b634cf75e1e4664368240533c1ddbe" +ansi-styles@^3.1.0: + version "3.1.0" + resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-3.1.0.tgz#09c202d5c917ec23188caa5c9cb9179cd9547750" + dependencies: + color-convert "^1.0.0" + ansi-styles@~1.0.0: version "1.0.0" resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-1.0.0.tgz#cb102df1c56f5123eab8b67cd7b98027a0279178" -any-promise@^1.0.0, any-promise@^1.3.0: - version "1.3.0" - resolved "https://registry.yarnpkg.com/any-promise/-/any-promise-1.3.0.tgz#abc6afeedcea52e809cdc0376aed3ce39635d17f" - anymatch@^1.3.0: version "1.3.0" resolved "https://registry.yarnpkg.com/anymatch/-/anymatch-1.3.0.tgz#a3e52fa39168c825ff57b0248126ce5a8ff95507" @@ -153,7 +157,21 @@ archiver-utils@^1.3.0: normalize-path "^2.0.0" readable-stream "^2.0.0" -archiver@^1.3.0, archiver@~1.3.0: +archiver@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/archiver/-/archiver-2.0.0.tgz#ffb73ecccd8dd65b0019e1180f78092a053d43c4" + dependencies: + archiver-utils "^1.3.0" + async "^2.0.0" + buffer-crc32 "^0.2.1" + glob "^7.0.0" + lodash "^4.8.0" + readable-stream "^2.0.0" + tar-stream "^1.5.0" + walkdir "^0.0.11" + zip-stream "^1.2.0" + +archiver@~1.3.0: version "1.3.0" resolved "https://registry.yarnpkg.com/archiver/-/archiver-1.3.0.tgz#4f2194d6d8f99df3f531e6881f14f15d55faaf22" dependencies: @@ -224,6 +242,13 @@ asap@^2.0.3, asap@~2.0.3: version "2.0.5" resolved "https://registry.yarnpkg.com/asap/-/asap-2.0.5.tgz#522765b50c3510490e52d7dcfe085ef9ba96958f" +asar-integrity@0.1.1: + version "0.1.1" + resolved "https://registry.yarnpkg.com/asar-integrity/-/asar-integrity-0.1.1.tgz#1a709dd78443707fc260f7ce363d9569983caf76" + dependencies: + bluebird-lst "^1.0.2" + fs-extra-p "^4.3.0" + asar@0.13.0: version "0.13.0" resolved "https://registry.yarnpkg.com/asar/-/asar-0.13.0.tgz#df33dd9d01bff842464d0d9f095740d4a62afb14" @@ -425,20 +450,20 @@ babel-code-frame@^6.16.0, babel-code-frame@^6.22.0: esutils "^2.0.2" js-tokens "^3.0.0" -babel-core@6.24.1, babel-core@^6.17.0, babel-core@^6.24.1: - version "6.24.1" - resolved "https://registry.yarnpkg.com/babel-core/-/babel-core-6.24.1.tgz#8c428564dce1e1f41fb337ec34f4c3b022b5ad83" +babel-core@6.25.0, babel-core@^6.17.0, babel-core@^6.24.1: + version "6.25.0" + resolved "https://registry.yarnpkg.com/babel-core/-/babel-core-6.25.0.tgz#7dd42b0463c742e9d5296deb3ec67a9322dad729" dependencies: babel-code-frame "^6.22.0" - babel-generator "^6.24.1" + babel-generator "^6.25.0" babel-helpers "^6.24.1" babel-messages "^6.23.0" babel-register "^6.24.1" babel-runtime "^6.22.0" - babel-template "^6.24.1" - babel-traverse "^6.24.1" - babel-types "^6.24.1" - babylon "^6.11.0" + babel-template "^6.25.0" + babel-traverse "^6.25.0" + babel-types "^6.25.0" + babylon "^6.17.2" convert-source-map "^1.1.0" debug "^2.1.1" json5 "^0.5.0" @@ -449,13 +474,13 @@ babel-core@6.24.1, babel-core@^6.17.0, babel-core@^6.24.1: slash "^1.0.0" source-map "^0.5.0" -babel-generator@^6.1.0, babel-generator@^6.24.1: - version "6.24.1" - resolved "https://registry.yarnpkg.com/babel-generator/-/babel-generator-6.24.1.tgz#e715f486c58ded25649d888944d52aa07c5d9497" +babel-generator@^6.1.0, babel-generator@^6.25.0: + version "6.25.0" + resolved "https://registry.yarnpkg.com/babel-generator/-/babel-generator-6.25.0.tgz#33a1af70d5f2890aeb465a4a7793c1df6a9ea9fc" dependencies: babel-messages "^6.23.0" babel-runtime "^6.22.0" - babel-types "^6.24.1" + babel-types "^6.25.0" detect-indent "^4.0.0" jsesc "^1.3.0" lodash "^4.2.0" @@ -525,9 +550,9 @@ babel-helper-explode-class@^6.24.1: babel-traverse "^6.24.1" babel-types "^6.24.1" -babel-helper-flip-expressions@^0.1.1: - version "0.1.1" - resolved "https://registry.yarnpkg.com/babel-helper-flip-expressions/-/babel-helper-flip-expressions-0.1.1.tgz#3659b2409a7b78131261302a993088d1c082fab4" +babel-helper-flip-expressions@^0.1.2: + version "0.1.2" + resolved "https://registry.yarnpkg.com/babel-helper-flip-expressions/-/babel-helper-flip-expressions-0.1.2.tgz#77f6652f9de9c42401d827bd46ebd2109e3ef18a" babel-helper-function-name@^6.24.1: version "6.24.1" @@ -616,11 +641,11 @@ babel-helpers@^6.24.1: babel-runtime "^6.22.0" babel-template "^6.24.1" -babel-loader@7.0.0: - version "7.0.0" - resolved "https://registry.yarnpkg.com/babel-loader/-/babel-loader-7.0.0.tgz#2e43a66bee1fff4470533d0402c8a4532fafbaf7" +babel-loader@7.1.1: + version "7.1.1" + resolved "https://registry.yarnpkg.com/babel-loader/-/babel-loader-7.1.1.tgz#b87134c8b12e3e4c2a94e0546085bc680a2b8488" dependencies: - find-cache-dir "^0.1.1" + find-cache-dir "^1.0.0" loader-utils "^1.0.2" mkdirp "^0.5.1" @@ -659,45 +684,45 @@ babel-plugin-espower@^2.3.1: espurify "^1.6.0" estraverse "^4.1.1" -babel-plugin-minify-builtins@^0.1.1: - version "0.1.1" - resolved "https://registry.yarnpkg.com/babel-plugin-minify-builtins/-/babel-plugin-minify-builtins-0.1.1.tgz#b027c62464e58a3eb4b880e4456050f009d9a5bb" +babel-plugin-minify-builtins@^0.1.3: + version "0.1.3" + resolved "https://registry.yarnpkg.com/babel-plugin-minify-builtins/-/babel-plugin-minify-builtins-0.1.3.tgz#4f21a7dcb51f91a04ea71d47ff0e8e3b05fec021" dependencies: babel-helper-evaluate-path "^0.1.0" -babel-plugin-minify-constant-folding@^0.1.1: - version "0.1.1" - resolved "https://registry.yarnpkg.com/babel-plugin-minify-constant-folding/-/babel-plugin-minify-constant-folding-0.1.1.tgz#905fd18b19f1eccbdea251f6f4935edfaee14ab8" +babel-plugin-minify-constant-folding@^0.1.3: + version "0.1.3" + resolved "https://registry.yarnpkg.com/babel-plugin-minify-constant-folding/-/babel-plugin-minify-constant-folding-0.1.3.tgz#57bd172adf8b8d74ad7c99612eb950414ebea3ca" dependencies: babel-helper-evaluate-path "^0.1.0" -babel-plugin-minify-dead-code-elimination@^0.1.6: - version "0.1.6" - resolved "https://registry.yarnpkg.com/babel-plugin-minify-dead-code-elimination/-/babel-plugin-minify-dead-code-elimination-0.1.6.tgz#c5471346fb0a1046863fd765c784cba97d7b22e3" +babel-plugin-minify-dead-code-elimination@^0.1.7: + version "0.1.7" + resolved "https://registry.yarnpkg.com/babel-plugin-minify-dead-code-elimination/-/babel-plugin-minify-dead-code-elimination-0.1.7.tgz#774f536f347b98393a27baa717872968813c342c" dependencies: babel-helper-mark-eval-scopes "^0.1.1" babel-helper-remove-or-void "^0.1.1" lodash.some "^4.6.0" -babel-plugin-minify-flip-comparisons@^0.1.1: - version "0.1.1" - resolved "https://registry.yarnpkg.com/babel-plugin-minify-flip-comparisons/-/babel-plugin-minify-flip-comparisons-0.1.1.tgz#74b8e515c911ba3f5a4933ccf724554320bd5498" +babel-plugin-minify-flip-comparisons@^0.1.2: + version "0.1.2" + resolved "https://registry.yarnpkg.com/babel-plugin-minify-flip-comparisons/-/babel-plugin-minify-flip-comparisons-0.1.2.tgz#e286b40b7599b18dfea195071e4279465cfc1884" dependencies: babel-helper-is-void-0 "^0.1.1" -babel-plugin-minify-guarded-expressions@^0.1.1: - version "0.1.1" - resolved "https://registry.yarnpkg.com/babel-plugin-minify-guarded-expressions/-/babel-plugin-minify-guarded-expressions-0.1.1.tgz#446c124c725c38f93859fed706c9aae1cfabc7ff" - dependencies: - babel-helper-flip-expressions "^0.1.1" - -babel-plugin-minify-infinity@^0.1.1: - version "0.1.1" - resolved "https://registry.yarnpkg.com/babel-plugin-minify-infinity/-/babel-plugin-minify-infinity-0.1.1.tgz#62e91d2ff3c46520d67bc5bdbedfd15eaf3df851" - -babel-plugin-minify-mangle-names@^0.1.2: +babel-plugin-minify-guarded-expressions@^0.1.2: version "0.1.2" - resolved "https://registry.yarnpkg.com/babel-plugin-minify-mangle-names/-/babel-plugin-minify-mangle-names-0.1.2.tgz#0ca139c450a734fde2583e49cb8db453c1753271" + resolved "https://registry.yarnpkg.com/babel-plugin-minify-guarded-expressions/-/babel-plugin-minify-guarded-expressions-0.1.2.tgz#dfc3d473b0362d9605d3ce0ac1e22328c60d1007" + dependencies: + babel-helper-flip-expressions "^0.1.2" + +babel-plugin-minify-infinity@^0.1.2: + version "0.1.2" + resolved "https://registry.yarnpkg.com/babel-plugin-minify-infinity/-/babel-plugin-minify-infinity-0.1.2.tgz#5f1cf67ddedcba13c8a00da832542df0091a1cd4" + +babel-plugin-minify-mangle-names@^0.1.3: + version "0.1.3" + resolved "https://registry.yarnpkg.com/babel-plugin-minify-mangle-names/-/babel-plugin-minify-mangle-names-0.1.3.tgz#bfa24661a6794fb03833587e55828b65449e06fe" dependencies: babel-helper-mark-eval-scopes "^0.1.1" @@ -705,21 +730,21 @@ babel-plugin-minify-numeric-literals@^0.1.1: version "0.1.1" resolved "https://registry.yarnpkg.com/babel-plugin-minify-numeric-literals/-/babel-plugin-minify-numeric-literals-0.1.1.tgz#d4b8b0c925f874714ee33ee4b26678583d7ce7fb" -babel-plugin-minify-replace@^0.1.1: - version "0.1.1" - resolved "https://registry.yarnpkg.com/babel-plugin-minify-replace/-/babel-plugin-minify-replace-0.1.1.tgz#002f6d0156332077cd8ab9b08c1a04e6196bf98d" +babel-plugin-minify-replace@^0.1.2: + version "0.1.2" + resolved "https://registry.yarnpkg.com/babel-plugin-minify-replace/-/babel-plugin-minify-replace-0.1.2.tgz#b90b9e71ab4d3b36325629a91beabe13b0b16ac1" -babel-plugin-minify-simplify@^0.1.1: - version "0.1.1" - resolved "https://registry.yarnpkg.com/babel-plugin-minify-simplify/-/babel-plugin-minify-simplify-0.1.1.tgz#f6aa6b5b6846171eda02c2062f680ddbc3f7937f" +babel-plugin-minify-simplify@^0.1.2: + version "0.1.2" + resolved "https://registry.yarnpkg.com/babel-plugin-minify-simplify/-/babel-plugin-minify-simplify-0.1.2.tgz#a968f1658fdeb2fc759e81fe331d89829df0f6b9" dependencies: - babel-helper-flip-expressions "^0.1.1" + babel-helper-flip-expressions "^0.1.2" babel-helper-is-nodes-equiv "^0.0.1" babel-helper-to-multiple-sequence-expressions "^0.1.1" -babel-plugin-minify-type-constructors@^0.1.1: - version "0.1.1" - resolved "https://registry.yarnpkg.com/babel-plugin-minify-type-constructors/-/babel-plugin-minify-type-constructors-0.1.1.tgz#63c9da537084d76b297e6c4d27c2b781ff0e747f" +babel-plugin-minify-type-constructors@^0.1.2: + version "0.1.2" + resolved "https://registry.yarnpkg.com/babel-plugin-minify-type-constructors/-/babel-plugin-minify-type-constructors-0.1.2.tgz#db53c5b76cb8e2fcd45d862f17104c78761337ee" dependencies: babel-helper-is-void-0 "^0.1.1" @@ -981,17 +1006,17 @@ babel-plugin-transform-flow-strip-types@^6.22.0: babel-plugin-syntax-flow "^6.18.0" babel-runtime "^6.22.0" -babel-plugin-transform-inline-consecutive-adds@^0.1.1: - version "0.1.1" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-inline-consecutive-adds/-/babel-plugin-transform-inline-consecutive-adds-0.1.1.tgz#7104335cf09abee7426f053cdf362d10e0696bfa" +babel-plugin-transform-inline-consecutive-adds@^0.1.2: + version "0.1.2" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-inline-consecutive-adds/-/babel-plugin-transform-inline-consecutive-adds-0.1.2.tgz#5442e9f1c19c78a7899f8a4dee6fd481f61001f5" -babel-plugin-transform-member-expression-literals@^6.8.3: - version "6.8.3" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-member-expression-literals/-/babel-plugin-transform-member-expression-literals-6.8.3.tgz#4eefa7fa1d3a86d05ac220bc3fdf96d5ed1835d6" - -babel-plugin-transform-merge-sibling-variables@^6.8.4: +babel-plugin-transform-member-expression-literals@^6.8.4: version "6.8.4" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-merge-sibling-variables/-/babel-plugin-transform-merge-sibling-variables-6.8.4.tgz#813a433f2d8c6989ee3a9c5e0cb46d3752d367a9" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-member-expression-literals/-/babel-plugin-transform-member-expression-literals-6.8.4.tgz#05679bc40596b91293401959aa1620ab1b2be437" + +babel-plugin-transform-merge-sibling-variables@^6.8.5: + version "6.8.5" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-merge-sibling-variables/-/babel-plugin-transform-merge-sibling-variables-6.8.5.tgz#03abdf107c61241913eb268ddede6d5bc541862c" babel-plugin-transform-minify-booleans@^6.8.2: version "6.8.2" @@ -1004,9 +1029,11 @@ babel-plugin-transform-object-rest-spread@^6.22.0: babel-plugin-syntax-object-rest-spread "^6.8.0" babel-runtime "^6.22.0" -babel-plugin-transform-property-literals@^6.8.3: - version "6.8.3" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-property-literals/-/babel-plugin-transform-property-literals-6.8.3.tgz#0dcd2ecf0486c54c23f84817f911c4ab0e8d4b99" +babel-plugin-transform-property-literals@^6.8.4: + version "6.8.4" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-property-literals/-/babel-plugin-transform-property-literals-6.8.4.tgz#6ad311110b80a192a56efb5ddf4fe3ca6f7a61da" + dependencies: + esutils "^2.0.2" babel-plugin-transform-react-display-name@^6.23.0: version "6.23.0" @@ -1046,17 +1073,17 @@ babel-plugin-transform-regexp-constructors@^0.1.1: version "0.1.1" resolved "https://registry.yarnpkg.com/babel-plugin-transform-regexp-constructors/-/babel-plugin-transform-regexp-constructors-0.1.1.tgz#312ab7487cc88a1c62ee25ea1b6087e89b87799c" -babel-plugin-transform-remove-console@^6.8.3: - version "6.8.3" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-remove-console/-/babel-plugin-transform-remove-console-6.8.3.tgz#313441720324ad20af0fb009fa59e8102364626b" +babel-plugin-transform-remove-console@^6.8.4: + version "6.8.4" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-remove-console/-/babel-plugin-transform-remove-console-6.8.4.tgz#41fddac19a729a4c3dd7ef2964eac07b096f9a8f" -babel-plugin-transform-remove-debugger@^6.8.3: - version "6.8.3" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-remove-debugger/-/babel-plugin-transform-remove-debugger-6.8.3.tgz#5064f2d843b77ce660ebaa7760be30eb925bb93f" +babel-plugin-transform-remove-debugger@^6.8.4: + version "6.8.4" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-remove-debugger/-/babel-plugin-transform-remove-debugger-6.8.4.tgz#f85704a08adaa71b55d77005b5b94e9b9df21f6e" -babel-plugin-transform-remove-undefined@^0.1.1: - version "0.1.1" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-remove-undefined/-/babel-plugin-transform-remove-undefined-0.1.1.tgz#57276fec8723e9f342c9ccb2b7bd6b48e1b1d84f" +babel-plugin-transform-remove-undefined@^0.1.2: + version "0.1.2" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-remove-undefined/-/babel-plugin-transform-remove-undefined-0.1.2.tgz#e1ebf51110f6b1e0665f28382ef73f95e5023652" babel-plugin-transform-runtime@^6.15.0: version "6.23.0" @@ -1064,9 +1091,9 @@ babel-plugin-transform-runtime@^6.15.0: dependencies: babel-runtime "^6.22.0" -babel-plugin-transform-simplify-comparison-operators@^6.8.3: - version "6.8.3" - resolved "https://registry.yarnpkg.com/babel-plugin-transform-simplify-comparison-operators/-/babel-plugin-transform-simplify-comparison-operators-6.8.3.tgz#2e47e11e5f8dc33e97476e0263151d5fd57e1c4c" +babel-plugin-transform-simplify-comparison-operators@^6.8.4: + version "6.8.4" + resolved "https://registry.yarnpkg.com/babel-plugin-transform-simplify-comparison-operators/-/babel-plugin-transform-simplify-comparison-operators-6.8.4.tgz#2aa24a262d664c8cb3e125a306c798d7a2de08d5" babel-plugin-transform-strict-mode@^6.24.1: version "6.24.1" @@ -1087,31 +1114,31 @@ babel-polyfill@^6.23.0: core-js "^2.4.0" regenerator-runtime "^0.10.0" -babel-preset-babili@0.1.2: - version "0.1.2" - resolved "https://registry.yarnpkg.com/babel-preset-babili/-/babel-preset-babili-0.1.2.tgz#bac3e515e556a07e1b342ce6fd87c62527f86a94" +babel-preset-babili@0.1.4: + version "0.1.4" + resolved "https://registry.yarnpkg.com/babel-preset-babili/-/babel-preset-babili-0.1.4.tgz#ad9d6651002f5bc3f07cab300781167f54724bf2" dependencies: - babel-plugin-minify-builtins "^0.1.1" - babel-plugin-minify-constant-folding "^0.1.1" - babel-plugin-minify-dead-code-elimination "^0.1.6" - babel-plugin-minify-flip-comparisons "^0.1.1" - babel-plugin-minify-guarded-expressions "^0.1.1" - babel-plugin-minify-infinity "^0.1.1" - babel-plugin-minify-mangle-names "^0.1.2" + babel-plugin-minify-builtins "^0.1.3" + babel-plugin-minify-constant-folding "^0.1.3" + babel-plugin-minify-dead-code-elimination "^0.1.7" + babel-plugin-minify-flip-comparisons "^0.1.2" + babel-plugin-minify-guarded-expressions "^0.1.2" + babel-plugin-minify-infinity "^0.1.2" + babel-plugin-minify-mangle-names "^0.1.3" babel-plugin-minify-numeric-literals "^0.1.1" - babel-plugin-minify-replace "^0.1.1" - babel-plugin-minify-simplify "^0.1.1" - babel-plugin-minify-type-constructors "^0.1.1" - babel-plugin-transform-inline-consecutive-adds "^0.1.1" - babel-plugin-transform-member-expression-literals "^6.8.3" - babel-plugin-transform-merge-sibling-variables "^6.8.4" + babel-plugin-minify-replace "^0.1.2" + babel-plugin-minify-simplify "^0.1.2" + babel-plugin-minify-type-constructors "^0.1.2" + babel-plugin-transform-inline-consecutive-adds "^0.1.2" + babel-plugin-transform-member-expression-literals "^6.8.4" + babel-plugin-transform-merge-sibling-variables "^6.8.5" babel-plugin-transform-minify-booleans "^6.8.2" - babel-plugin-transform-property-literals "^6.8.3" + babel-plugin-transform-property-literals "^6.8.4" babel-plugin-transform-regexp-constructors "^0.1.1" - babel-plugin-transform-remove-console "^6.8.3" - babel-plugin-transform-remove-debugger "^6.8.3" - babel-plugin-transform-remove-undefined "^0.1.1" - babel-plugin-transform-simplify-comparison-operators "^6.8.3" + babel-plugin-transform-remove-console "^6.8.4" + babel-plugin-transform-remove-debugger "^6.8.4" + babel-plugin-transform-remove-undefined "^0.1.2" + babel-plugin-transform-simplify-comparison-operators "^6.8.4" babel-plugin-transform-undefined-to-void "^6.8.2" lodash.isplainobject "^4.0.6" @@ -1212,40 +1239,40 @@ babel-runtime@^6.11.6, babel-runtime@^6.18.0, babel-runtime@^6.22.0, babel-runti core-js "^2.4.0" regenerator-runtime "^0.10.0" -babel-template@^6.24.1, babel-template@^6.7.0: - version "6.24.1" - resolved "https://registry.yarnpkg.com/babel-template/-/babel-template-6.24.1.tgz#04ae514f1f93b3a2537f2a0f60a5a45fb8308333" +babel-template@^6.24.1, babel-template@^6.25.0, babel-template@^6.7.0: + version "6.25.0" + resolved "https://registry.yarnpkg.com/babel-template/-/babel-template-6.25.0.tgz#665241166b7c2aa4c619d71e192969552b10c071" dependencies: babel-runtime "^6.22.0" - babel-traverse "^6.24.1" - babel-types "^6.24.1" - babylon "^6.11.0" + babel-traverse "^6.25.0" + babel-types "^6.25.0" + babylon "^6.17.2" lodash "^4.2.0" -babel-traverse@^6.24.1: - version "6.24.1" - resolved "https://registry.yarnpkg.com/babel-traverse/-/babel-traverse-6.24.1.tgz#ab36673fd356f9a0948659e7b338d5feadb31695" +babel-traverse@^6.24.1, babel-traverse@^6.25.0: + version "6.25.0" + resolved "https://registry.yarnpkg.com/babel-traverse/-/babel-traverse-6.25.0.tgz#2257497e2fcd19b89edc13c4c91381f9512496f1" dependencies: babel-code-frame "^6.22.0" babel-messages "^6.23.0" babel-runtime "^6.22.0" - babel-types "^6.24.1" - babylon "^6.15.0" + babel-types "^6.25.0" + babylon "^6.17.2" debug "^2.2.0" globals "^9.0.0" invariant "^2.2.0" lodash "^4.2.0" -babel-types@^6.19.0, babel-types@^6.24.1, babel-types@^6.7.2: - version "6.24.1" - resolved "https://registry.yarnpkg.com/babel-types/-/babel-types-6.24.1.tgz#a136879dc15b3606bda0d90c1fc74304c2ff0975" +babel-types@^6.19.0, babel-types@^6.24.1, babel-types@^6.25.0, babel-types@^6.7.2: + version "6.25.0" + resolved "https://registry.yarnpkg.com/babel-types/-/babel-types-6.25.0.tgz#70afb248d5660e5d18f811d91c8303b54134a18e" dependencies: babel-runtime "^6.22.0" esutils "^2.0.2" lodash "^4.2.0" to-fast-properties "^1.0.1" -babylon@^6.1.0, babylon@^6.11.0, babylon@^6.15.0: +babylon@^6.1.0, babylon@^6.17.2: version "6.17.2" resolved "https://registry.yarnpkg.com/babylon/-/babylon-6.17.2.tgz#201d25ef5f892c41bae49488b08db0dd476e9f5c" @@ -1539,7 +1566,15 @@ chalk@^1.0.0, chalk@^1.1.0, chalk@^1.1.1, chalk@^1.1.3: strip-ansi "^3.0.0" supports-color "^2.0.0" -chokidar@^1.4.2, chokidar@^1.4.3, chokidar@^1.6.1: +chalk@^2.0.1: + version "2.0.1" + resolved "https://registry.yarnpkg.com/chalk/-/chalk-2.0.1.tgz#dbec49436d2ae15f536114e76d14656cdbc0f44d" + dependencies: + ansi-styles "^3.1.0" + escape-string-regexp "^1.0.5" + supports-color "^4.0.0" + +chokidar@^1.4.2, chokidar@^1.6.1, chokidar@^1.7.0: version "1.7.0" resolved "https://registry.yarnpkg.com/chokidar/-/chokidar-1.7.0.tgz#798e689778151c8076b4b360e5edd28cda2bb468" dependencies: @@ -1645,7 +1680,7 @@ code-point-at@^1.0.0: version "1.1.0" resolved "https://registry.yarnpkg.com/code-point-at/-/code-point-at-1.1.0.tgz#0d070b4d043a5bea33a2f1a40e2edb3d9a4ccf77" -color-convert@^1.3.0: +color-convert@^1.0.0, color-convert@^1.3.0: version "1.9.0" resolved "https://registry.yarnpkg.com/color-convert/-/color-convert-1.9.0.tgz#1accf97dd739b983bf994d56fec8f95853641b7a" dependencies: @@ -1701,7 +1736,7 @@ compare-version@^0.1.2: version "0.1.2" resolved "https://registry.yarnpkg.com/compare-version/-/compare-version-0.1.2.tgz#0162ec2d9351f5ddd59a9202cba935366a725080" -compress-commons@^1.1.0: +compress-commons@^1.1.0, compress-commons@^1.2.0: version "1.2.0" resolved "https://registry.yarnpkg.com/compress-commons/-/compress-commons-1.2.0.tgz#58587092ef20d37cb58baf000112c9278ff73b9f" dependencies: @@ -1853,9 +1888,17 @@ create-react-class@^15.5.3: loose-envify "^1.3.1" object-assign "^4.1.1" -cross-env@5.0.0: - version "5.0.0" - resolved "https://registry.yarnpkg.com/cross-env/-/cross-env-5.0.0.tgz#565ccae4d09676441a5087f406fe7661a29c931b" +create-react-class@^15.6.0: + version "15.6.0" + resolved "https://registry.yarnpkg.com/create-react-class/-/create-react-class-15.6.0.tgz#ab448497c26566e1e29413e883207d57cfe7bed4" + dependencies: + fbjs "^0.8.9" + loose-envify "^1.3.1" + object-assign "^4.1.1" + +cross-env@5.0.1: + version "5.0.1" + resolved "https://registry.yarnpkg.com/cross-env/-/cross-env-5.0.1.tgz#ff4e72ea43b47da2486b43a7f2043b2609e44913" dependencies: cross-spawn "^5.1.0" is-windows "^1.0.0" @@ -1966,7 +2009,7 @@ debug@2.2.0: dependencies: ms "0.7.1" -debug@2.6.8, debug@^2.1.1, debug@^2.1.3, debug@^2.2.0, debug@^2.5.1, debug@^2.6.1, debug@^2.6.3, debug@^2.6.6: +debug@^2.1.1, debug@^2.1.3, debug@^2.2.0, debug@^2.5.1, debug@^2.6.1, debug@^2.6.3, debug@^2.6.6, debug@^2.6.8: version "2.6.8" resolved "https://registry.yarnpkg.com/debug/-/debug-2.6.8.tgz#e731531ca2ede27d188222427da17821d68ff4fc" dependencies: @@ -2123,78 +2166,76 @@ ejs@~2.5.6: version "2.5.6" resolved "https://registry.yarnpkg.com/ejs/-/ejs-2.5.6.tgz#479636bfa3fe3b1debd52087f0acb204b4f19c88" -electron-builder-core@17.2.0, electron-builder-core@~17.2.0: - version "17.2.0" - resolved "https://registry.yarnpkg.com/electron-builder-core/-/electron-builder-core-17.2.0.tgz#e235d11aae64bffbad36b601ac58173f9377f619" - -electron-builder-http@18.3.0, electron-builder-http@~18.3.0: - version "18.3.0" - resolved "https://registry.yarnpkg.com/electron-builder-http/-/electron-builder-http-18.3.0.tgz#01cf7445996b09475515b55006b6b80d75a0360e" +electron-builder-http@19.19.0, electron-builder-http@~19.19.0: + version "19.19.0" + resolved "https://registry.yarnpkg.com/electron-builder-http/-/electron-builder-http-19.19.0.tgz#20f908fcd1bbe202fd44a9623abd9e4d7bc98825" dependencies: - debug "2.6.8" - fs-extra-p "^4.3.0" - -electron-builder-squirrel-windows@18.3.0: - version "18.3.0" - resolved "https://registry.yarnpkg.com/electron-builder-squirrel-windows/-/electron-builder-squirrel-windows-18.3.0.tgz#3bf920cbd318c47535b5815bcdc8e911ff024f70" - dependencies: - archiver "^1.3.0" bluebird-lst "^1.0.2" - electron-builder-core "~17.2.0" - electron-builder-util "~18.3.0" - fs-extra-p "^4.3.0" + debug "^2.6.8" + fs-extra-p "^4.4.0" -electron-builder-util@18.3.5, electron-builder-util@~18.3.0, electron-builder-util@~18.3.5: - version "18.3.5" - resolved "https://registry.yarnpkg.com/electron-builder-util/-/electron-builder-util-18.3.5.tgz#f0ae9c5c960efbc36da0210c37f999c2aa14cba4" +electron-builder-squirrel-windows@19.19.1: + version "19.19.1" + resolved "https://registry.yarnpkg.com/electron-builder-squirrel-windows/-/electron-builder-squirrel-windows-19.19.1.tgz#28e76eb20af448316c8846542df5bc5e1349a874" + dependencies: + archiver "^2.0.0" + bluebird-lst "^1.0.2" + electron-builder-util "~19.19.0" + fs-extra-p "^4.4.0" + sanitize-filename "^1.6.1" + +electron-builder-util@19.19.0, electron-builder-util@~19.19.0: + version "19.19.0" + resolved "https://registry.yarnpkg.com/electron-builder-util/-/electron-builder-util-19.19.0.tgz#96082aff13bfda8f40a62739f10718c9c42f6d4c" dependencies: "7zip-bin" "^2.1.0" bluebird-lst "^1.0.2" - chalk "^1.1.3" - debug "2.6.8" - electron-builder-http "~18.3.0" - fs-extra-p "^4.3.0" + chalk "^2.0.1" + debug "^2.6.8" + electron-builder-http "~19.19.0" + fcopy-pre-bundled "0.3.4" + fs-extra-p "^4.4.0" ini "^1.3.4" is-ci "^1.0.10" - node-emoji "^1.5.1" + node-emoji "^1.8.1" + semver "^5.4.1" source-map-support "^0.4.15" stat-mode "^0.2.2" tunnel-agent "^0.6.0" -electron-builder@18.3.5: - version "18.3.5" - resolved "https://registry.yarnpkg.com/electron-builder/-/electron-builder-18.3.5.tgz#9781dbdca932d80754e23773213b9c939fe79d6f" +electron-builder@19.19.1: + version "19.19.1" + resolved "https://registry.yarnpkg.com/electron-builder/-/electron-builder-19.19.1.tgz#213ccda0afc1d1c75ba0fc1aa355ea7023d35769" dependencies: "7zip-bin" "^2.1.0" - ajv "^5.1.5" + ajv "^5.2.2" ajv-keywords "^2.1.0" + asar-integrity "0.1.1" bluebird-lst "^1.0.2" - chalk "^1.1.3" + chalk "^2.0.1" chromium-pickle-js "^0.2.0" cuint "^0.2.2" - debug "2.6.8" - electron-builder-core "17.2.0" - electron-builder-http "18.3.0" - electron-builder-util "18.3.5" + debug "^2.6.8" + electron-builder-http "19.19.0" + electron-builder-util "19.19.0" electron-download-tf "4.3.1" - electron-osx-sign "0.4.5" - electron-publish "18.3.5" - fs-extra-p "^4.3.0" - hosted-git-info "^2.4.2" + electron-osx-sign "0.4.6" + electron-publish "19.19.1" + fs-extra-p "^4.4.0" + hosted-git-info "^2.5.0" is-ci "^1.0.10" isbinaryfile "^3.0.2" - js-yaml "^3.8.4" - json5 "^0.5.1" + js-yaml "^3.9.1" minimatch "^3.0.4" - node-forge "^0.7.1" - normalize-package-data "^2.3.8" + normalize-package-data "^2.4.0" parse-color "^1.0.0" plist "^2.1.0" + read-config-file "^0.1.3" sanitize-filename "^1.6.1" - semver "^5.3.0" - update-notifier "^2.1.0" + semver "^5.4.1" + update-notifier "^2.2.0" uuid-1345 "^0.99.6" - yargs "^8.0.1" + yargs "^8.0.2" electron-chromedriver@~1.6.0: version "1.6.0" @@ -2240,9 +2281,9 @@ electron-download@^3.0.1, electron-download@^3.1.0: semver "^5.3.0" sumchecker "^1.2.0" -electron-osx-sign@0.4.5: - version "0.4.5" - resolved "https://registry.yarnpkg.com/electron-osx-sign/-/electron-osx-sign-0.4.5.tgz#59037cae6ac05ba9e802f76d9bb772b31a8c75c7" +electron-osx-sign@0.4.6: + version "0.4.6" + resolved "https://registry.yarnpkg.com/electron-osx-sign/-/electron-osx-sign-0.4.6.tgz#2398e2d7cab5c1d8c3eeabb1cd490376528ec39a" dependencies: bluebird "^3.4.7" compare-version "^0.1.2" @@ -2252,24 +2293,24 @@ electron-osx-sign@0.4.5: plist "^2.0.1" tempfile "^1.1.1" -electron-publish@18.3.5: - version "18.3.5" - resolved "https://registry.yarnpkg.com/electron-publish/-/electron-publish-18.3.5.tgz#2689b387e63d57816e545327adf319a7560e4be9" +electron-publish@19.19.1: + version "19.19.1" + resolved "https://registry.yarnpkg.com/electron-publish/-/electron-publish-19.19.1.tgz#ae53ccf9a90f77184c2add3d74b8b60850378b76" dependencies: bluebird-lst "^1.0.2" - chalk "^1.1.3" - electron-builder-http "~18.3.0" - electron-builder-util "~18.3.5" - fs-extra-p "^4.3.0" + chalk "^2.0.1" + electron-builder-http "~19.19.0" + electron-builder-util "~19.19.0" + fs-extra-p "^4.4.0" mime "^1.3.6" -electron-rebuild@1.5.11: - version "1.5.11" - resolved "https://registry.yarnpkg.com/electron-rebuild/-/electron-rebuild-1.5.11.tgz#6ea660deb546a516e7efaa81cd5985d5664f245c" +electron-rebuild@1.6.0: + version "1.6.0" + resolved "https://registry.yarnpkg.com/electron-rebuild/-/electron-rebuild-1.6.0.tgz#e8d26f4d8e9fe5388df35864b3658e5cfd4dcb7e" dependencies: colors "^1.1.2" debug "^2.6.3" - fs-promise "^2.0.2" + fs-extra "^3.0.1" node-abi "^2.0.0" node-gyp "^3.6.0" ora "^1.2.0" @@ -2277,9 +2318,9 @@ electron-rebuild@1.5.11: spawn-rx "^2.0.10" yargs "^7.0.2" -electron@1.6.11: - version "1.6.11" - resolved "https://registry.yarnpkg.com/electron/-/electron-1.6.11.tgz#be79c0ebdcefedb5bf28117409800fa53baceffa" +electron@1.6.12: + version "1.6.12" + resolved "https://registry.yarnpkg.com/electron/-/electron-1.6.12.tgz#860ddf0c659681f60b815f4b98c077fe1b6f867c" dependencies: "@types/node" "^7.0.18" electron-download "^3.0.1" @@ -2326,14 +2367,14 @@ enhance-visitors@^1.0.0: dependencies: lodash "^4.13.1" -enhanced-resolve@^3.0.0: - version "3.1.0" - resolved "https://registry.yarnpkg.com/enhanced-resolve/-/enhanced-resolve-3.1.0.tgz#9f4b626f577245edcf4b2ad83d86e17f4f421dec" +enhanced-resolve@^3.4.0: + version "3.4.1" + resolved "https://registry.yarnpkg.com/enhanced-resolve/-/enhanced-resolve-3.4.1.tgz#0421e339fd71419b3da13d129b3979040230476e" dependencies: graceful-fs "^4.1.2" memory-fs "^0.4.0" object-assign "^4.0.1" - tapable "^0.2.5" + tapable "^0.2.7" env-paths@^1.0.0: version "1.0.0" @@ -2571,6 +2612,10 @@ esprima@^3.1.1: version "3.1.3" resolved "https://registry.yarnpkg.com/esprima/-/esprima-3.1.3.tgz#fdca51cee6133895e3c88d535ce49dbff62a4633" +esprima@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/esprima/-/esprima-4.0.0.tgz#4499eddcd1110e0b218bacf2fa7f7f59f55ca804" + espurify@^1.5.0, espurify@^1.6.0: version "1.7.0" resolved "https://registry.yarnpkg.com/espurify/-/espurify-1.7.0.tgz#1c5cf6cbccc32e6f639380bd4f991fab9ba9d226" @@ -2689,6 +2734,10 @@ extsprintf@1.0.2: version "1.0.2" resolved "https://registry.yarnpkg.com/extsprintf/-/extsprintf-1.0.2.tgz#e1080e0658e300b06294990cc70e1502235fd550" +fast-deep-equal@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/fast-deep-equal/-/fast-deep-equal-1.0.0.tgz#96256a3bc975595eb36d82e9929d060d893439ff" + fast-levenshtein@~2.0.4: version "2.0.6" resolved "https://registry.yarnpkg.com/fast-levenshtein/-/fast-levenshtein-2.0.6.tgz#3d8a5c66883a16a30ca8643e851f19baa7797917" @@ -2705,6 +2754,10 @@ fbjs@^0.8.9: setimmediate "^1.0.5" ua-parser-js "^0.7.9" +fcopy-pre-bundled@0.3.4: + version "0.3.4" + resolved "https://registry.yarnpkg.com/fcopy-pre-bundled/-/fcopy-pre-bundled-0.3.4.tgz#7ff1a1c339e877baa86b0856bebb33621cd5620b" + fd-slicer@~1.0.1: version "1.0.1" resolved "https://registry.yarnpkg.com/fd-slicer/-/fd-slicer-1.0.1.tgz#8b5bcbd9ec327c5041bf9ab023fd6750f1177e65" @@ -2757,9 +2810,13 @@ find-cache-dir@^0.1.1: mkdirp "^0.5.1" pkg-dir "^1.0.0" -find-parent-dir@^0.3.0: - version "0.3.0" - resolved "https://registry.yarnpkg.com/find-parent-dir/-/find-parent-dir-0.3.0.tgz#33c44b429ab2b2f0646299c5f9f718f376ff8d54" +find-cache-dir@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/find-cache-dir/-/find-cache-dir-1.0.0.tgz#9288e3e9e3cc3748717d39eade17cf71fc30ee6f" + dependencies: + commondir "^1.0.1" + make-dir "^1.0.0" + pkg-dir "^2.0.0" find-up@^1.0.0: version "1.1.2" @@ -2768,7 +2825,7 @@ find-up@^1.0.0: path-exists "^2.0.0" pinkie-promise "^2.0.0" -find-up@^2.0.0: +find-up@^2.0.0, find-up@^2.1.0: version "2.1.0" resolved "https://registry.yarnpkg.com/find-up/-/find-up-2.1.0.tgz#45d1b7e506c717ddd482775a2b77920a3c0c57a7" dependencies: @@ -2816,6 +2873,13 @@ fs-extra-p@^4.3.0: bluebird-lst "^1.0.2" fs-extra "^3.0.1" +fs-extra-p@^4.4.0: + version "4.4.0" + resolved "https://registry.yarnpkg.com/fs-extra-p/-/fs-extra-p-4.4.0.tgz#729c601c4f4c701328921adc7cfe9b236f100660" + dependencies: + bluebird-lst "^1.0.2" + fs-extra "^4.0.0" + fs-extra@0.26.7, fs-extra@^0.26.4: version "0.26.7" resolved "https://registry.yarnpkg.com/fs-extra/-/fs-extra-0.26.7.tgz#9ae1fdd94897798edab76d0918cf42d0c3184fa9" @@ -2836,13 +2900,6 @@ fs-extra@^0.30.0: path-is-absolute "^1.0.0" rimraf "^2.2.8" -fs-extra@^2.0.0: - version "2.1.2" - resolved "https://registry.yarnpkg.com/fs-extra/-/fs-extra-2.1.2.tgz#046c70163cef9aad46b0e4a7fa467fb22d71de35" - dependencies: - graceful-fs "^4.1.2" - jsonfile "^2.1.0" - fs-extra@^3.0.1: version "3.0.1" resolved "https://registry.yarnpkg.com/fs-extra/-/fs-extra-3.0.1.tgz#3794f378c58b342ea7dbbb23095109c4b3b62291" @@ -2851,14 +2908,13 @@ fs-extra@^3.0.1: jsonfile "^3.0.0" universalify "^0.1.0" -fs-promise@^2.0.2: - version "2.0.3" - resolved "https://registry.yarnpkg.com/fs-promise/-/fs-promise-2.0.3.tgz#f64e4f854bcf689aa8bddcba268916db3db46854" +fs-extra@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/fs-extra/-/fs-extra-4.0.0.tgz#414fb4ca2d2170ba0014159d3a8aec3303418d9e" dependencies: - any-promise "^1.3.0" - fs-extra "^2.0.0" - mz "^2.6.0" - thenify-all "^1.6.0" + graceful-fs "^4.1.2" + jsonfile "^3.0.0" + universalify "^0.1.0" fs-readdir-recursive@^1.0.0: version "1.0.0" @@ -3162,12 +3218,16 @@ home-path@^1.0.1: version "1.0.5" resolved "https://registry.yarnpkg.com/home-path/-/home-path-1.0.5.tgz#788b29815b12d53bacf575648476e6f9041d133f" -hosted-git-info@^2.1.4, hosted-git-info@^2.4.2: +hosted-git-info@^2.1.4: version "2.4.2" resolved "https://registry.yarnpkg.com/hosted-git-info/-/hosted-git-info-2.4.2.tgz#0076b9f46a270506ddbaaea56496897460612a67" +hosted-git-info@^2.5.0: + version "2.5.0" + resolved "https://registry.yarnpkg.com/hosted-git-info/-/hosted-git-info-2.5.0.tgz#6d60e34b3abbc8313062c3b798ef8d901a07af3c" + hterm-umdjs@1.1.3: - version "1.1.3+1.58.sha.15ed490" + version "1.1.3" resolved "https://registry.yarnpkg.com/hterm-umdjs/-/hterm-umdjs-1.1.3.tgz#8b57bcaded5ba9541d6c8e32a82b34abb93e885e" http-signature@~1.1.0: @@ -3182,14 +3242,13 @@ https-browserify@0.0.1: version "0.0.1" resolved "https://registry.yarnpkg.com/https-browserify/-/https-browserify-0.0.1.tgz#3f91365cabe60b77ed0ebba24b454e3e09d95a82" -husky@0.13.4: - version "0.13.4" - resolved "https://registry.yarnpkg.com/husky/-/husky-0.13.4.tgz#48785c5028de3452a51c48c12c4f94b2124a1407" +husky@0.14.3: + version "0.14.3" + resolved "https://registry.yarnpkg.com/husky/-/husky-0.14.3.tgz#c69ed74e2d2779769a17ba8399b54ce0b63c12c3" dependencies: - chalk "^1.1.3" - find-parent-dir "^0.3.0" - is-ci "^1.0.9" + is-ci "^1.0.10" normalize-path "^1.0.0" + strip-indent "^2.0.0" hyphenate-style-name@^1.0.1: version "1.0.2" @@ -3211,6 +3270,10 @@ ignore@^3.2.0: version "3.3.3" resolved "https://registry.yarnpkg.com/ignore/-/ignore-3.3.3.tgz#432352e57accd87ab3110e82d3fea0e47812156d" +import-lazy@^2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/import-lazy/-/import-lazy-2.1.0.tgz#05698e3d45c88e8d7e9d92cb0584e77f096f3e43" + imurmurhash@^0.1.4: version "0.1.4" resolved "https://registry.yarnpkg.com/imurmurhash/-/imurmurhash-0.1.4.tgz#9218b9b2b928a238b13dc4fb6b6d576f231453ea" @@ -3325,7 +3388,7 @@ is-builtin-module@^1.0.0: dependencies: builtin-modules "^1.0.0" -is-ci@^1.0.10, is-ci@^1.0.7, is-ci@^1.0.9: +is-ci@^1.0.10, is-ci@^1.0.7: version "1.0.10" resolved "https://registry.yarnpkg.com/is-ci/-/is-ci-1.0.10.tgz#f739336b2632365061a9d48270cd56ae3369318e" dependencies: @@ -3562,13 +3625,27 @@ js-types@^1.0.0: version "1.0.0" resolved "https://registry.yarnpkg.com/js-types/-/js-types-1.0.0.tgz#d242e6494ed572ad3c92809fc8bed7f7687cbf03" -js-yaml@^3.5.1, js-yaml@^3.8.4: +js-yaml@^3.5.1: version "3.8.4" resolved "https://registry.yarnpkg.com/js-yaml/-/js-yaml-3.8.4.tgz#520b4564f86573ba96662af85a8cafa7b4b5a6f6" dependencies: argparse "^1.0.7" esprima "^3.1.1" +js-yaml@^3.9.0: + version "3.9.0" + resolved "https://registry.yarnpkg.com/js-yaml/-/js-yaml-3.9.0.tgz#4ffbbf25c2ac963b8299dc74da7e3740de1c18ce" + dependencies: + argparse "^1.0.7" + esprima "^4.0.0" + +js-yaml@^3.9.1: + version "3.9.1" + resolved "https://registry.yarnpkg.com/js-yaml/-/js-yaml-3.9.1.tgz#08775cebdfdd359209f0d2acd383c8f86a6904a0" + dependencies: + argparse "^1.0.7" + esprima "^4.0.0" + jsbn@~0.1.0: version "0.1.1" resolved "https://registry.yarnpkg.com/jsbn/-/jsbn-0.1.1.tgz#a5e654c2e5a2deb5f201d96cefbca80c0ef2f513" @@ -3589,6 +3666,10 @@ json-loader@0.5.4, json-loader@^0.5.4: version "0.5.4" resolved "https://registry.yarnpkg.com/json-loader/-/json-loader-0.5.4.tgz#8baa1365a632f58a3c46d20175fc6002c96e37de" +json-schema-traverse@^0.3.0: + version "0.3.1" + resolved "https://registry.yarnpkg.com/json-schema-traverse/-/json-schema-traverse-0.3.1.tgz#349a6d44c53a51de89b40805c5d5e59b417d3340" + json-schema@0.2.3: version "0.2.3" resolved "https://registry.yarnpkg.com/json-schema/-/json-schema-0.2.3.tgz#b480c892e59a2f05954ce727bd3f2a4e882f9e13" @@ -3678,10 +3759,6 @@ lazy-req@^1.1.0: version "1.1.0" resolved "https://registry.yarnpkg.com/lazy-req/-/lazy-req-1.1.0.tgz#bdaebead30f8d824039ce0ce149d4daa07ba1fac" -lazy-req@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/lazy-req/-/lazy-req-2.0.0.tgz#c9450a363ecdda2e6f0c70132ad4f37f8f06f2b4" - lazystream@^1.0.0: version "1.0.0" resolved "https://registry.yarnpkg.com/lazystream/-/lazystream-1.0.0.tgz#f6995fe0f820392f61396be89462407bb77168e4" @@ -3724,7 +3801,7 @@ loader-runner@^2.3.0: version "2.3.0" resolved "https://registry.yarnpkg.com/loader-runner/-/loader-runner-2.3.0.tgz#f482aea82d543e07921700d5a46ef26fdac6b8a2" -loader-utils@^0.2.15, loader-utils@^0.2.16: +loader-utils@^0.2.15: version "0.2.17" resolved "https://registry.yarnpkg.com/loader-utils/-/loader-utils-0.2.17.tgz#f86e6374d43205a6e6c60e9196f17c0299bfb348" dependencies: @@ -3733,7 +3810,7 @@ loader-utils@^0.2.15, loader-utils@^0.2.16: json5 "^0.5.0" object-assign "^4.0.1" -loader-utils@^1.0.2: +loader-utils@^1.0.2, loader-utils@^1.1.0: version "1.1.0" resolved "https://registry.yarnpkg.com/loader-utils/-/loader-utils-1.1.0.tgz#c98aef488bcceda2ffb5e2de646d6a754429f5cd" dependencies: @@ -3796,6 +3873,10 @@ lodash.some@^4.6.0: version "4.6.0" resolved "https://registry.yarnpkg.com/lodash.some/-/lodash.some-4.6.0.tgz#1bb9f314ef6b8baded13b549169b2a945eb68e4d" +lodash.toarray@^4.4.0: + version "4.4.0" + resolved "https://registry.yarnpkg.com/lodash.toarray/-/lodash.toarray-4.4.0.tgz#24c4bfcd6b2fba38bfd0594db1179d8e9b656561" + lodash.upperfirst@^4.2.0: version "4.3.1" resolved "https://registry.yarnpkg.com/lodash.upperfirst/-/lodash.upperfirst-4.3.1.tgz#1365edf431480481ef0d1c68957a5ed99d49f7ce" @@ -4026,14 +4107,6 @@ mute-stream@0.0.7: version "0.0.7" resolved "https://registry.yarnpkg.com/mute-stream/-/mute-stream-0.0.7.tgz#3075ce93bc21b8fab43e1bc4da7e8115ed1e7bab" -mz@^2.6.0: - version "2.6.0" - resolved "https://registry.yarnpkg.com/mz/-/mz-2.6.0.tgz#c8b8521d958df0a4f2768025db69c719ee4ef1ce" - dependencies: - any-promise "^1.0.0" - object-assign "^4.0.1" - thenify-all "^1.0.0" - nan@^2.3.0: version "2.6.2" resolved "https://registry.yarnpkg.com/nan/-/nan-2.6.2.tgz#e4ff34e6c95fdfb5aecc08de6596f43605a7db45" @@ -4052,11 +4125,11 @@ node-dir@^0.1.10: dependencies: minimatch "^3.0.2" -node-emoji@^1.5.1: - version "1.5.1" - resolved "https://registry.yarnpkg.com/node-emoji/-/node-emoji-1.5.1.tgz#fd918e412769bf8c448051238233840b2aff16a1" +node-emoji@^1.8.1: + version "1.8.1" + resolved "https://registry.yarnpkg.com/node-emoji/-/node-emoji-1.8.1.tgz#6eec6bfb07421e2148c75c6bba72421f8530a826" dependencies: - string.prototype.codepointat "^0.2.0" + lodash.toarray "^4.4.0" node-fetch@^1.0.1: version "1.7.0" @@ -4065,10 +4138,6 @@ node-fetch@^1.0.1: encoding "^0.1.11" is-stream "^1.0.1" -node-forge@^0.7.1: - version "0.7.1" - resolved "https://registry.yarnpkg.com/node-forge/-/node-forge-0.7.1.tgz#9da611ea08982f4b94206b3beb4cc9665f20c300" - node-gyp@3.6.2, node-gyp@^3.6.0: version "3.6.2" resolved "https://registry.yarnpkg.com/node-gyp/-/node-gyp-3.6.2.tgz#9bfbe54562286284838e750eac05295853fa1c60" @@ -4152,7 +4221,7 @@ nopt@~1.0.10: dependencies: abbrev "1" -normalize-package-data@^2.3.2, normalize-package-data@^2.3.4, normalize-package-data@^2.3.8: +normalize-package-data@^2.3.2, normalize-package-data@^2.3.4: version "2.3.8" resolved "https://registry.yarnpkg.com/normalize-package-data/-/normalize-package-data-2.3.8.tgz#d819eda2a9dedbd1ffa563ea4071d936782295bb" dependencies: @@ -4161,6 +4230,15 @@ normalize-package-data@^2.3.2, normalize-package-data@^2.3.4, normalize-package- semver "2 || 3 || 4 || 5" validate-npm-package-license "^3.0.1" +normalize-package-data@^2.4.0: + version "2.4.0" + resolved "https://registry.yarnpkg.com/normalize-package-data/-/normalize-package-data-2.4.0.tgz#12f95a307d58352075a04907b84ac8be98ac012f" + dependencies: + hosted-git-info "^2.1.4" + is-builtin-module "^1.0.0" + semver "2 || 3 || 4 || 5" + validate-npm-package-license "^3.0.1" + normalize-path@^1.0.0: version "1.0.0" resolved "https://registry.yarnpkg.com/normalize-path/-/normalize-path-1.0.0.tgz#32d0e472f91ff345701c15a8311018d3b0a90379" @@ -4536,6 +4614,12 @@ pkg-dir@^1.0.0: dependencies: find-up "^1.0.0" +pkg-dir@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/pkg-dir/-/pkg-dir-2.0.0.tgz#f6d5d1109e19d63edf428e0bd57e12777615334b" + dependencies: + find-up "^2.1.0" + pkg-up@^1.0.0: version "1.0.0" resolved "https://registry.yarnpkg.com/pkg-up/-/pkg-up-1.0.0.tgz#3e08fb461525c4421624a33b9f7e6d0af5b05a26" @@ -4673,7 +4757,7 @@ promise@^7.1.1: dependencies: asap "~2.0.3" -prop-types@^15.5.10, prop-types@^15.5.7, prop-types@~15.5.7: +prop-types@^15.5.10: version "15.5.10" resolved "https://registry.yarnpkg.com/prop-types/-/prop-types-15.5.10.tgz#2797dfc3126182e3a95e3dfbb2e893ddd7456154" dependencies: @@ -4752,14 +4836,14 @@ react-deep-force-update@2.0.1: version "2.0.1" resolved "https://registry.yarnpkg.com/react-deep-force-update/-/react-deep-force-update-2.0.1.tgz#4f7f6c12c3e7de42f345992a3c518236fa1ecad3" -react-dom@15.5.4: - version "15.5.4" - resolved "https://registry.yarnpkg.com/react-dom/-/react-dom-15.5.4.tgz#ba0c28786fd52ed7e4f2135fe0288d462aef93da" +react-dom@15.6.1: + version "15.6.1" + resolved "https://registry.yarnpkg.com/react-dom/-/react-dom-15.6.1.tgz#2cb0ed4191038e53c209eb3a79a23e2a4cf99470" dependencies: fbjs "^0.8.9" loose-envify "^1.1.0" object-assign "^4.1.0" - prop-types "~15.5.7" + prop-types "^15.5.10" react-redux@5.0.5: version "5.0.5" @@ -4773,14 +4857,15 @@ react-redux@5.0.5: loose-envify "^1.1.0" prop-types "^15.5.10" -react@15.5.4: - version "15.5.4" - resolved "https://registry.yarnpkg.com/react/-/react-15.5.4.tgz#fa83eb01506ab237cdc1c8c3b1cea8de012bf047" +react@15.6.1: + version "15.6.1" + resolved "https://registry.yarnpkg.com/react/-/react-15.6.1.tgz#baa8434ec6780bde997cdc380b79cd33b96393df" dependencies: + create-react-class "^15.6.0" fbjs "^0.8.9" loose-envify "^1.1.0" object-assign "^4.1.0" - prop-types "^15.5.7" + prop-types "^15.5.10" read-all-stream@^3.0.0: version "3.1.0" @@ -4789,6 +4874,15 @@ read-all-stream@^3.0.0: pinkie-promise "^2.0.0" readable-stream "^2.0.0" +read-config-file@^0.1.3: + version "0.1.3" + resolved "https://registry.yarnpkg.com/read-config-file/-/read-config-file-0.1.3.tgz#10f72ad95159864c78def8c749b226f80c998b61" + dependencies: + bluebird-lst "^1.0.2" + fs-extra-p "^4.4.0" + js-yaml "^3.9.0" + json5 "^0.5.1" + read-pkg-up@^1.0.1: version "1.0.1" resolved "https://registry.yarnpkg.com/read-pkg-up/-/read-pkg-up-1.0.1.tgz#9d63c13276c065918d57f002a57f40a1b643fb02" @@ -4880,14 +4974,14 @@ redux-thunk@2.2.0: version "2.2.0" resolved "https://registry.yarnpkg.com/redux-thunk/-/redux-thunk-2.2.0.tgz#e615a16e16b47a19a515766133d1e3e99b7852e5" -redux@3.6.0: - version "3.6.0" - resolved "https://registry.yarnpkg.com/redux/-/redux-3.6.0.tgz#887c2b3d0b9bd86eca2be70571c27654c19e188d" +redux@3.7.2: + version "3.7.2" + resolved "https://registry.yarnpkg.com/redux/-/redux-3.7.2.tgz#06b73123215901d25d065be342eb026bc1c8537b" dependencies: lodash "^4.2.1" lodash-es "^4.2.1" loose-envify "^1.1.0" - symbol-observable "^1.0.2" + symbol-observable "^1.0.3" regenerate@^1.2.1: version "1.3.2" @@ -5088,9 +5182,9 @@ run-async@^2.2.0: dependencies: is-promise "^2.1.0" -runes@0.4.0: - version "0.4.0" - resolved "https://registry.yarnpkg.com/runes/-/runes-0.4.0.tgz#791e605ac73c0c8eff17d631e12c8d8137f35b8a" +runes@0.4.2: + version "0.4.2" + resolved "https://registry.yarnpkg.com/runes/-/runes-0.4.2.tgz#1ddc1ea41de769cb32fc068a64fbbc45cd21052e" rx-lite@^3.1.2: version "3.1.2" @@ -5130,10 +5224,14 @@ semver-diff@^2.0.0: dependencies: semver "^5.0.3" -"semver@2 || 3 || 4 || 5", semver@5.3.0, semver@^5.0.3, semver@^5.1.0, semver@^5.3.0, semver@~5.3.0: +"semver@2 || 3 || 4 || 5", semver@^5.0.3, semver@^5.1.0, semver@^5.3.0, semver@~5.3.0: version "5.3.0" resolved "https://registry.yarnpkg.com/semver/-/semver-5.3.0.tgz#9b2ce5d3de02d17c6012ad326aa6b4d0cf54f94f" +semver@5.4.1, semver@^5.4.1: + version "5.4.1" + resolved "https://registry.yarnpkg.com/semver/-/semver-5.4.1.tgz#e059c09d8571f0540823733433505d3a2f00b18e" + set-blocking@^2.0.0, set-blocking@~2.0.0: version "2.0.0" resolved "https://registry.yarnpkg.com/set-blocking/-/set-blocking-2.0.0.tgz#045f9782d011ae9a6803ddd382b24392b3d890f7" @@ -5204,9 +5302,9 @@ sort-keys@^1.1.1, sort-keys@^1.1.2: dependencies: is-plain-obj "^1.0.0" -source-list-map@^1.1.1: - version "1.1.2" - resolved "https://registry.yarnpkg.com/source-list-map/-/source-list-map-1.1.2.tgz#9889019d1024cce55cdc069498337ef6186a11a1" +source-list-map@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/source-list-map/-/source-list-map-2.0.0.tgz#aaa47403f7b245a92fbc97ea08f250d6087ed085" source-map-resolve@^0.3.0: version "0.3.1" @@ -5338,10 +5436,6 @@ string-width@^2.0.0: is-fullwidth-code-point "^2.0.0" strip-ansi "^3.0.0" -string.prototype.codepointat@^0.2.0: - version "0.2.0" - resolved "https://registry.yarnpkg.com/string.prototype.codepointat/-/string.prototype.codepointat-0.2.0.tgz#6b26e9bd3afcaa7be3b4269b526de1b82000ac78" - string_decoder@^0.10.25, string_decoder@~0.10.x: version "0.10.31" resolved "https://registry.yarnpkg.com/string_decoder/-/string_decoder-0.10.31.tgz#62e203bc41766c6c28c9fc84301dab1c5310fa94" @@ -5394,6 +5488,10 @@ strip-indent@^1.0.1: dependencies: get-stdin "^4.0.1" +strip-indent@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/strip-indent/-/strip-indent-2.0.0.tgz#5ef8db295d01e6ed6cbf7aab96998d7822527b68" + strip-json-comments@~2.0.1: version "2.0.1" resolved "https://registry.yarnpkg.com/strip-json-comments/-/strip-json-comments-2.0.1.tgz#3c531942e908c2697c0ec344858c286c7ca0a60a" @@ -5415,7 +5513,19 @@ supports-color@^2.0.0: version "2.0.0" resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-2.0.0.tgz#535d045ce6b6363fa40117084629995e9df324c7" -supports-color@^3.1.0, supports-color@~3.2.3: +supports-color@^4.0.0: + version "4.2.0" + resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-4.2.0.tgz#ad986dc7eb2315d009b4d77c8169c2231a684037" + dependencies: + has-flag "^2.0.0" + +supports-color@^4.2.1: + version "4.2.1" + resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-4.2.1.tgz#65a4bb2631e90e02420dba5554c375a4754bb836" + dependencies: + has-flag "^2.0.0" + +supports-color@~3.2.3: version "3.2.3" resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-3.2.3.tgz#65ac0504b3954171d8a64946b2ae3cbb8a5f54f6" dependencies: @@ -5425,7 +5535,7 @@ symbol-observable@^0.2.2: version "0.2.4" resolved "https://registry.yarnpkg.com/symbol-observable/-/symbol-observable-0.2.4.tgz#95a83db26186d6af7e7a18dbd9760a2f86d08f40" -symbol-observable@^1.0.1, symbol-observable@^1.0.2: +symbol-observable@^1.0.1, symbol-observable@^1.0.3: version "1.0.4" resolved "https://registry.yarnpkg.com/symbol-observable/-/symbol-observable-1.0.4.tgz#29bf615d4aa7121bdd898b22d4b3f9bc4e2aa03d" @@ -5444,9 +5554,9 @@ table@^3.7.8: slice-ansi "0.0.4" string-width "^2.0.0" -tapable@^0.2.5, tapable@~0.2.5: - version "0.2.6" - resolved "https://registry.yarnpkg.com/tapable/-/tapable-0.2.6.tgz#206be8e188860b514425375e6f1ae89bfb01fd8d" +tapable@^0.2.7: + version "0.2.8" + resolved "https://registry.yarnpkg.com/tapable/-/tapable-0.2.8.tgz#99372a5c999bf2df160afc0d74bed4f47948cd22" tar-pack@^3.4.0: version "3.4.0" @@ -5499,18 +5609,6 @@ the-argv@^1.0.0: version "1.0.0" resolved "https://registry.yarnpkg.com/the-argv/-/the-argv-1.0.0.tgz#0084705005730dd84db755253c931ae398db9522" -thenify-all@^1.0.0, thenify-all@^1.6.0: - version "1.6.0" - resolved "https://registry.yarnpkg.com/thenify-all/-/thenify-all-1.6.0.tgz#1a1918d402d8fc3f98fbf234db0bcc8cc10e9726" - dependencies: - thenify ">= 3.1.0 < 4" - -"thenify@>= 3.1.0 < 4": - version "3.3.0" - resolved "https://registry.yarnpkg.com/thenify/-/thenify-3.3.0.tgz#e69e38a1babe969b0108207978b9f62b88604839" - dependencies: - any-promise "^1.0.0" - throttleit@0.0.2: version "0.0.2" resolved "https://registry.yarnpkg.com/throttleit/-/throttleit-0.0.2.tgz#cfedf88e60c00dd9697b61fdd2a8343a9b680eaf" @@ -5646,9 +5744,9 @@ ua-parser-js@^0.7.9: version "0.7.12" resolved "https://registry.yarnpkg.com/ua-parser-js/-/ua-parser-js-0.7.12.tgz#04c81a99bdd5dc52263ea29d24c6bf8d4818a4bb" -uglify-js@^2.8.27: - version "2.8.27" - resolved "https://registry.yarnpkg.com/uglify-js/-/uglify-js-2.8.27.tgz#47787f912b0f242e5b984343be8e35e95f694c9c" +uglify-js@^2.8.29: + version "2.8.29" + resolved "https://registry.yarnpkg.com/uglify-js/-/uglify-js-2.8.29.tgz#29c5733148057bb4e1f75df35b7a9cb72e6a59dd" dependencies: source-map "~0.5.1" yargs "~3.10.0" @@ -5659,6 +5757,14 @@ uglify-to-browserify@~1.0.0: version "1.0.2" resolved "https://registry.yarnpkg.com/uglify-to-browserify/-/uglify-to-browserify-1.0.2.tgz#6e0924d6bda6b5afe349e39a6d632850a0f882b7" +uglifyjs-webpack-plugin@^0.4.6: + version "0.4.6" + resolved "https://registry.yarnpkg.com/uglifyjs-webpack-plugin/-/uglifyjs-webpack-plugin-0.4.6.tgz#b951f4abb6bd617e66f63eb891498e391763e309" + dependencies: + source-map "^0.5.6" + uglify-js "^2.8.29" + webpack-sources "^1.0.1" + uid-number@^0.0.6: version "0.0.6" resolved "https://registry.yarnpkg.com/uid-number/-/uid-number-0.0.6.tgz#0ea10e8035e8eb5b8e4449f06da1c730663baa81" @@ -5706,16 +5812,16 @@ update-notifier@^1.0.0: semver-diff "^2.0.0" xdg-basedir "^2.0.0" -update-notifier@^2.1.0: - version "2.1.0" - resolved "https://registry.yarnpkg.com/update-notifier/-/update-notifier-2.1.0.tgz#ec0c1e53536b76647a24b77cb83966d9315123d9" +update-notifier@^2.2.0: + version "2.2.0" + resolved "https://registry.yarnpkg.com/update-notifier/-/update-notifier-2.2.0.tgz#1b5837cf90c0736d88627732b661c138f86de72f" dependencies: boxen "^1.0.0" chalk "^1.0.0" configstore "^3.0.0" + import-lazy "^2.1.0" is-npm "^1.0.0" latest-version "^3.0.0" - lazy-req "^2.0.0" semver-diff "^2.0.0" xdg-basedir "^3.0.0" @@ -5807,12 +5913,12 @@ walkdir@^0.0.11: version "0.0.11" resolved "https://registry.yarnpkg.com/walkdir/-/walkdir-0.0.11.tgz#a16d025eb931bd03b52f308caed0f40fcebe9532" -watchpack@^1.3.1: - version "1.3.1" - resolved "https://registry.yarnpkg.com/watchpack/-/watchpack-1.3.1.tgz#7d8693907b28ce6013e7f3610aa2a1acf07dad87" +watchpack@^1.4.0: + version "1.4.0" + resolved "https://registry.yarnpkg.com/watchpack/-/watchpack-1.4.0.tgz#4a1472bcbb952bd0a9bb4036801f954dfb39faac" dependencies: async "^2.1.2" - chokidar "^1.4.3" + chokidar "^1.7.0" graceful-fs "^4.1.2" wdio-dot-reporter@~0.0.8: @@ -5846,38 +5952,39 @@ webdriverio@^4.0.4: wdio-dot-reporter "~0.0.8" wgxpath "~1.0.0" -webpack-sources@^0.2.3: - version "0.2.3" - resolved "https://registry.yarnpkg.com/webpack-sources/-/webpack-sources-0.2.3.tgz#17c62bfaf13c707f9d02c479e0dcdde8380697fb" +webpack-sources@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/webpack-sources/-/webpack-sources-1.0.1.tgz#c7356436a4d13123be2e2426a05d1dad9cbe65cf" dependencies: - source-list-map "^1.1.1" + source-list-map "^2.0.0" source-map "~0.5.3" -webpack@2.6.1: - version "2.6.1" - resolved "https://registry.yarnpkg.com/webpack/-/webpack-2.6.1.tgz#2e0457f0abb1ac5df3ab106c69c672f236785f07" +webpack@3.4.1: + version "3.4.1" + resolved "https://registry.yarnpkg.com/webpack/-/webpack-3.4.1.tgz#4c3f4f3fb318155a4db0cb6a36ff05c5697418f4" dependencies: acorn "^5.0.0" acorn-dynamic-import "^2.0.0" - ajv "^4.7.0" - ajv-keywords "^1.1.1" + ajv "^5.1.5" + ajv-keywords "^2.0.0" async "^2.1.2" - enhanced-resolve "^3.0.0" + enhanced-resolve "^3.4.0" + escope "^3.6.0" interpret "^1.0.0" json-loader "^0.5.4" json5 "^0.5.1" loader-runner "^2.3.0" - loader-utils "^0.2.16" + loader-utils "^1.1.0" memory-fs "~0.4.1" mkdirp "~0.5.0" node-libs-browser "^2.0.0" source-map "^0.5.3" - supports-color "^3.1.0" - tapable "~0.2.5" - uglify-js "^2.8.27" - watchpack "^1.3.1" - webpack-sources "^0.2.3" - yargs "^6.0.0" + supports-color "^4.2.1" + tapable "^0.2.7" + uglifyjs-webpack-plugin "^0.4.6" + watchpack "^1.4.0" + webpack-sources "^1.0.1" + yargs "^8.0.2" wgxpath@~1.0.0: version "1.0.0" @@ -6074,12 +6181,6 @@ yallist@^2.0.0: version "2.1.2" resolved "https://registry.yarnpkg.com/yallist/-/yallist-2.1.2.tgz#1c11f9218f076089a47dd512f93c6699a6a81d52" -yargs-parser@^4.2.0: - version "4.2.1" - resolved "https://registry.yarnpkg.com/yargs-parser/-/yargs-parser-4.2.1.tgz#29cceac0dc4f03c6c87b4a9f217dd18c9f74871c" - dependencies: - camelcase "^3.0.0" - yargs-parser@^5.0.0: version "5.0.0" resolved "https://registry.yarnpkg.com/yargs-parser/-/yargs-parser-5.0.0.tgz#275ecf0d7ffe05c77e64e7c86e4cd94bf0e1228a" @@ -6092,24 +6193,6 @@ yargs-parser@^7.0.0: dependencies: camelcase "^4.1.0" -yargs@^6.0.0: - version "6.6.0" - resolved "https://registry.yarnpkg.com/yargs/-/yargs-6.6.0.tgz#782ec21ef403345f830a808ca3d513af56065208" - dependencies: - camelcase "^3.0.0" - cliui "^3.2.0" - decamelize "^1.1.1" - get-caller-file "^1.0.1" - os-locale "^1.4.0" - read-pkg-up "^1.0.1" - require-directory "^2.1.1" - require-main-filename "^1.0.1" - set-blocking "^2.0.0" - string-width "^1.0.2" - which-module "^1.0.0" - y18n "^3.2.1" - yargs-parser "^4.2.0" - yargs@^7.0.2: version "7.1.0" resolved "https://registry.yarnpkg.com/yargs/-/yargs-7.1.0.tgz#6ba318eb16961727f5d284f8ea003e8d6154d0c8" @@ -6128,9 +6211,9 @@ yargs@^7.0.2: y18n "^3.2.1" yargs-parser "^5.0.0" -yargs@^8.0.1: - version "8.0.1" - resolved "https://registry.yarnpkg.com/yargs/-/yargs-8.0.1.tgz#420ef75e840c1457a80adcca9bc6fa3849de51aa" +yargs@^8.0.2: + version "8.0.2" + resolved "https://registry.yarnpkg.com/yargs/-/yargs-8.0.2.tgz#6299a9055b1cefc969ff7e79c1d918dceb22c360" dependencies: camelcase "^4.1.0" cliui "^3.2.0" @@ -6169,3 +6252,12 @@ zip-stream@^1.1.0: compress-commons "^1.1.0" lodash "^4.8.0" readable-stream "^2.0.0" + +zip-stream@^1.2.0: + version "1.2.0" + resolved "https://registry.yarnpkg.com/zip-stream/-/zip-stream-1.2.0.tgz#a8bc45f4c1b49699c6b90198baacaacdbcd4ba04" + dependencies: + archiver-utils "^1.3.0" + compress-commons "^1.2.0" + lodash "^4.8.0" + readable-stream "^2.0.0" From e175df780a5bc51334b8d1c73cdd426ef9b5ad1e Mon Sep 17 00:00:00 2001 From: Benjamin Staneck Date: Wed, 9 Aug 2017 04:37:05 +0200 Subject: [PATCH 20/62] fix missed this => window (#2058) --- app/ui/window.js | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/app/ui/window.js b/app/ui/window.js index a14a034f..6b5d8c9b 100644 --- a/app/ui/window.js +++ b/app/ui/window.js @@ -36,7 +36,7 @@ module.exports = class Window { const cfg_ = app.plugins.getDecoratedConfig(); // notify renderer - this.webContents.send('config change'); + window.webContents.send('config change'); // notify user that shell changes require new sessions if (cfg_.shell !== cfg.shell || From 1a6135999609539f9695b8c6bb6b5fffcc1d4b6e Mon Sep 17 00:00:00 2001 From: Benjamin Staneck Date: Wed, 9 Aug 2017 04:37:48 +0200 Subject: [PATCH 21/62] Update node to v8 on appveyor and add fast_finish (#2059) By default AppVeyor runs all build jobs. If at least one job has failed the entire build is marked as failed. --- appveyor.yml | 5 ++++- 1 file changed, 4 insertions(+), 1 deletion(-) diff --git a/appveyor.yml b/appveyor.yml index 2cf9aa11..67d2c07c 100644 --- a/appveyor.yml +++ b/appveyor.yml @@ -12,12 +12,15 @@ init: - yarn config set msvs_version 2015 # we need this to build `pty.js` install: - - ps: Install-Product node 6 x64 + - ps: Install-Product node 8 x64 - set CI=true - yarn build: off +matrix: + fast_finish: true + shallow_clone: true test_script: From 4e9bd4d95384f9d689e57bae8a20ec16ad49b714 Mon Sep 17 00:00:00 2001 From: Benjamin Staneck Date: Wed, 9 Aug 2017 08:23:45 +0200 Subject: [PATCH 22/62] and another one (#2063) --- app/ui/window.js | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/app/ui/window.js b/app/ui/window.js index 6b5d8c9b..b46a2b30 100644 --- a/app/ui/window.js +++ b/app/ui/window.js @@ -160,7 +160,7 @@ module.exports = class Window { rpc.emit('move'); }); rpc.on('close', () => { - this.close(); + window.close(); }); const deleteSessions = () => { sessions.forEach((session, key) => { From d9dc415eff89f11cdea0dc4e7450af19ef71f8e5 Mon Sep 17 00:00:00 2001 From: Adam Bosco Date: Thu, 10 Aug 2017 07:45:02 -0700 Subject: [PATCH 23/62] Normalize shell name before selecting URL-matching regex (#2070) --- lib/utils/url-command.js | 3 ++- 1 file changed, 2 insertions(+), 1 deletion(-) diff --git a/lib/utils/url-command.js b/lib/utils/url-command.js index 5af379c8..239648ee 100644 --- a/lib/utils/url-command.js +++ b/lib/utils/url-command.js @@ -1,7 +1,8 @@ +import path from 'path'; import * as regex from './url-regex'; export default function isUrlCommand(shell, data) { - const matcher = regex[shell]; // eslint-disable-line import/namespace + const matcher = regex[path.parse(shell).name]; // eslint-disable-line import/namespace if (undefined === matcher || !data) { return null; } From be8e0cce29c5c7e62af56b2fe1367f0d559685e6 Mon Sep 17 00:00:00 2001 From: Albin Ekblom Date: Sun, 13 Aug 2017 00:23:48 +0200 Subject: [PATCH 24/62] Replace gaze with chokidar for config watcher (#1946) * Replace gaze with chokidar for config watcher * Pin deps --- app/config.js | 29 +- app/package.json | 2 +- app/yarn.lock | 846 ++++++++++++++++++++++++++++++++++++++++++++--- 3 files changed, 826 insertions(+), 51 deletions(-) diff --git a/app/config.js b/app/config.js index c3f4cbe0..6a7c613b 100644 --- a/app/config.js +++ b/app/config.js @@ -1,4 +1,4 @@ -const gaze = require('gaze'); +const chokidar = require('chokidar'); const notify = require('./notify'); const _import = require('./config/import'); const _openConfig = require('./config/open'); @@ -10,20 +10,23 @@ const watchers = []; // https://github.com/zeit/hyper/pull/1772 const watchCfg = process.platform === 'win32' ? {interval: 2000} : {}; let cfg = {}; +let _watcher; const _watch = function () { - gaze(cfgPath, watchCfg, function (err) { - if (err) { - throw err; - } - this.on('changed', () => { - cfg = _import(); - notify('Configuration updated', 'Hyper configuration reloaded!'); - watchers.forEach(fn => fn()); - }); - this.on('error', () => { - // Ignore file watching errors - }); + if (_watcher) { + return _watcher; + } + + _watcher = chokidar.watch(cfgPath, watchCfg); + + _watcher.on('change', () => { + cfg = _import(); + notify('Configuration updated', 'Hyper configuration reloaded!'); + watchers.forEach(fn => fn()); + }); + + _watcher.on('error', error => { + console.error('error watching config', error); }); }; diff --git a/app/package.json b/app/package.json index 92cc7cf0..06734653 100644 --- a/app/package.json +++ b/app/package.json @@ -11,6 +11,7 @@ "repository": "zeit/hyper", "xo": false, "dependencies": { + "chokidar": "1.7.0", "color": "0.11.3", "convert-css-color-name-to-hex": "0.1.1", "default-shell": "1.0.1", @@ -18,7 +19,6 @@ "electron-is-dev": "0.1.1", "electron-squirrel-startup": "1.0.0", "file-uri-to-path": "0.0.2", - "gaze": "1.1.2", "git-describe": "3.0.2", "mkdirp": "0.5.1", "ms": "0.7.1", diff --git a/app/yarn.lock b/app/yarn.lock index 27ac42e3..a0c60eb4 100644 --- a/app/yarn.lock +++ b/app/yarn.lock @@ -2,25 +2,157 @@ # yarn lockfile v1 +abbrev@1: + version "1.1.0" + resolved "https://registry.yarnpkg.com/abbrev/-/abbrev-1.1.0.tgz#d0554c2256636e2f56e7c2e5ad183f859428d81f" + +ajv@^4.9.1: + version "4.11.8" + resolved "https://registry.yarnpkg.com/ajv/-/ajv-4.11.8.tgz#82ffb02b29e662ae53bdc20af15947706739c536" + dependencies: + co "^4.6.0" + json-stable-stringify "^1.0.1" + ansi-regex@^2.0.0: version "2.0.0" resolved "https://registry.yarnpkg.com/ansi-regex/-/ansi-regex-2.0.0.tgz#c5061b6e0ef8a81775e50f5d66151bf6bf371107" -balanced-match@^0.4.1: - version "0.4.2" - resolved "https://registry.yarnpkg.com/balanced-match/-/balanced-match-0.4.2.tgz#cb3f3e3c732dc0f01ee70b403f302e61d7709838" - -brace-expansion@^1.0.0: - version "1.1.6" - resolved "https://registry.yarnpkg.com/brace-expansion/-/brace-expansion-1.1.6.tgz#7197d7eaa9b87e648390ea61fc66c84427420df9" +anymatch@^1.3.0: + version "1.3.0" + resolved "https://registry.yarnpkg.com/anymatch/-/anymatch-1.3.0.tgz#a3e52fa39168c825ff57b0248126ce5a8ff95507" dependencies: - balanced-match "^0.4.1" + arrify "^1.0.0" + micromatch "^2.1.5" + +aproba@^1.0.3: + version "1.1.2" + resolved "https://registry.yarnpkg.com/aproba/-/aproba-1.1.2.tgz#45c6629094de4e96f693ef7eab74ae079c240fc1" + +are-we-there-yet@~1.1.2: + version "1.1.4" + resolved "https://registry.yarnpkg.com/are-we-there-yet/-/are-we-there-yet-1.1.4.tgz#bb5dca382bb94f05e15194373d16fd3ba1ca110d" + dependencies: + delegates "^1.0.0" + readable-stream "^2.0.6" + +arr-diff@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/arr-diff/-/arr-diff-2.0.0.tgz#8f3b827f955a8bd669697e4a4256ac3ceae356cf" + dependencies: + arr-flatten "^1.0.1" + +arr-flatten@^1.0.1: + version "1.0.3" + resolved "https://registry.yarnpkg.com/arr-flatten/-/arr-flatten-1.0.3.tgz#a274ed85ac08849b6bd7847c4580745dc51adfb1" + +array-unique@^0.2.1: + version "0.2.1" + resolved "https://registry.yarnpkg.com/array-unique/-/array-unique-0.2.1.tgz#a1d97ccafcbc2625cc70fadceb36a50c58b01a53" + +arrify@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/arrify/-/arrify-1.0.1.tgz#898508da2226f380df904728456849c1501a4b0d" + +asn1@~0.2.3: + version "0.2.3" + resolved "https://registry.yarnpkg.com/asn1/-/asn1-0.2.3.tgz#dac8787713c9966849fc8180777ebe9c1ddf3b86" + +assert-plus@1.0.0, assert-plus@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/assert-plus/-/assert-plus-1.0.0.tgz#f12e0f3c5d77b0b1cdd9146942e4e96c1e4dd525" + +assert-plus@^0.2.0: + version "0.2.0" + resolved "https://registry.yarnpkg.com/assert-plus/-/assert-plus-0.2.0.tgz#d74e1b87e7affc0db8aadb7021f3fe48101ab234" + +async-each@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/async-each/-/async-each-1.0.1.tgz#19d386a1d9edc6e7c1c85d388aedbcc56d33602d" + +asynckit@^0.4.0: + version "0.4.0" + resolved "https://registry.yarnpkg.com/asynckit/-/asynckit-0.4.0.tgz#c79ed97f7f34cb8f2ba1bc9790bcc366474b4b79" + +aws-sign2@~0.6.0: + version "0.6.0" + resolved "https://registry.yarnpkg.com/aws-sign2/-/aws-sign2-0.6.0.tgz#14342dd38dbcc94d0e5b87d763cd63612c0e794f" + +aws4@^1.2.1: + version "1.6.0" + resolved "https://registry.yarnpkg.com/aws4/-/aws4-1.6.0.tgz#83ef5ca860b2b32e4a0deedee8c771b9db57471e" + +balanced-match@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/balanced-match/-/balanced-match-1.0.0.tgz#89b4d199ab2bee49de164ea02b89ce462d71b767" + +bcrypt-pbkdf@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/bcrypt-pbkdf/-/bcrypt-pbkdf-1.0.1.tgz#63bc5dcb61331b92bc05fd528953c33462a06f8d" + dependencies: + tweetnacl "^0.14.3" + +binary-extensions@^1.0.0: + version "1.8.0" + resolved "https://registry.yarnpkg.com/binary-extensions/-/binary-extensions-1.8.0.tgz#48ec8d16df4377eae5fa5884682480af4d95c774" + +block-stream@*: + version "0.0.9" + resolved "https://registry.yarnpkg.com/block-stream/-/block-stream-0.0.9.tgz#13ebfe778a03205cfe03751481ebb4b3300c126a" + dependencies: + inherits "~2.0.0" + +boom@2.x.x: + version "2.10.1" + resolved "https://registry.yarnpkg.com/boom/-/boom-2.10.1.tgz#39c8918ceff5799f83f9492a848f625add0c766f" + dependencies: + hoek "2.x.x" + +brace-expansion@^1.1.7: + version "1.1.8" + resolved "https://registry.yarnpkg.com/brace-expansion/-/brace-expansion-1.1.8.tgz#c07b211c7c952ec1f8efd51a77ef0d1d3990a292" + dependencies: + balanced-match "^1.0.0" concat-map "0.0.1" +braces@^1.8.2: + version "1.8.5" + resolved "https://registry.yarnpkg.com/braces/-/braces-1.8.5.tgz#ba77962e12dff969d6b76711e914b737857bf6a7" + dependencies: + expand-range "^1.8.1" + preserve "^0.2.0" + repeat-element "^1.1.2" + +caseless@~0.12.0: + version "0.12.0" + resolved "https://registry.yarnpkg.com/caseless/-/caseless-0.12.0.tgz#1b681c21ff84033c826543090689420d187151dc" + +chokidar@1.7.0: + version "1.7.0" + resolved "https://registry.yarnpkg.com/chokidar/-/chokidar-1.7.0.tgz#798e689778151c8076b4b360e5edd28cda2bb468" + dependencies: + anymatch "^1.3.0" + async-each "^1.0.0" + glob-parent "^2.0.0" + inherits "^2.0.1" + is-binary-path "^1.0.0" + is-glob "^2.0.0" + path-is-absolute "^1.0.0" + readdirp "^2.0.0" + optionalDependencies: + fsevents "^1.0.0" + clone@^1.0.2: version "1.0.2" resolved "https://registry.yarnpkg.com/clone/-/clone-1.0.2.tgz#260b7a99ebb1edfe247538175f783243cb19d149" +co@^4.6.0: + version "4.6.0" + resolved "https://registry.yarnpkg.com/co/-/co-4.6.0.tgz#6ea6bdf3d853ae54ccb8e47bfa0bf3f9031fb184" + +code-point-at@^1.0.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/code-point-at/-/code-point-at-1.1.0.tgz#0d070b4d043a5bea33a2f1a40e2edb3d9a4ccf77" + color-convert@^1.3.0: version "1.8.2" resolved "https://registry.yarnpkg.com/color-convert/-/color-convert-1.8.2.tgz#be868184d7c8631766d54e7078e2672d7c7e3339" @@ -45,6 +177,12 @@ color@0.11.3: color-convert "^1.3.0" color-string "^0.3.0" +combined-stream@^1.0.5, combined-stream@~1.0.5: + version "1.0.5" + resolved "https://registry.yarnpkg.com/combined-stream/-/combined-stream-1.0.5.tgz#938370a57b4a51dea2c77c15d5c5fdf895164009" + dependencies: + delayed-stream "~1.0.0" + concat-map@0.0.1: version "0.0.1" resolved "https://registry.yarnpkg.com/concat-map/-/concat-map-0.0.1.tgz#d8a96bd77fd68df7793a73036a3ba0d5405d477b" @@ -58,6 +196,10 @@ conf@^0.11.1: mkdirp "^0.5.1" pkg-up "^1.0.0" +console-control-strings@^1.0.0, console-control-strings@~1.1.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/console-control-strings/-/console-control-strings-1.1.0.tgz#3d7cf4464db6446ea644bf4b39507f9851008e8e" + convert-css-color-name-to-hex@0.1.1: version "0.1.1" resolved "https://registry.yarnpkg.com/convert-css-color-name-to-hex/-/convert-css-color-name-to-hex-0.1.1.tgz#38ac4d27ca470593fd663b18a072a308926a35a2" @@ -65,6 +207,10 @@ convert-css-color-name-to-hex@0.1.1: css-color-names "0.0.3" is-css-color-name "^0.1.1" +core-util-is@~1.0.0: + version "1.0.2" + resolved "https://registry.yarnpkg.com/core-util-is/-/core-util-is-1.0.2.tgz#b5fd54220aa2bc5ab57aab7140c940754503c1a7" + cross-spawn-async@^2.1.1: version "2.2.5" resolved "https://registry.yarnpkg.com/cross-spawn-async/-/cross-spawn-async-2.2.5.tgz#845ff0c0834a3ded9d160daca6d390906bb288cc" @@ -72,6 +218,12 @@ cross-spawn-async@^2.1.1: lru-cache "^4.0.0" which "^1.2.8" +cryptiles@2.x.x: + version "2.0.5" + resolved "https://registry.yarnpkg.com/cryptiles/-/cryptiles-2.0.5.tgz#3bdfecdc608147c1c67202fa291e7dca59eaa3b8" + dependencies: + boom "2.x.x" + css-color-names@0.0.2: version "0.0.2" resolved "https://registry.yarnpkg.com/css-color-names/-/css-color-names-0.0.2.tgz#fba18e8cff86579572d749c146c47ee83f0ea955" @@ -80,22 +232,46 @@ css-color-names@0.0.3: version "0.0.3" resolved "https://registry.yarnpkg.com/css-color-names/-/css-color-names-0.0.3.tgz#de0cef16f4d8aa8222a320d5b6d7e9bbada7b9f6" +dashdash@^1.12.0: + version "1.14.1" + resolved "https://registry.yarnpkg.com/dashdash/-/dashdash-1.14.1.tgz#853cfa0f7cbe2fed5de20326b8dd581035f6e2f0" + dependencies: + assert-plus "^1.0.0" + debug@^2.2.0: version "2.6.0" resolved "https://registry.yarnpkg.com/debug/-/debug-2.6.0.tgz#bc596bcabe7617f11d9fa15361eded5608b8499b" dependencies: ms "0.7.2" +deep-extend@~0.4.0: + version "0.4.2" + resolved "https://registry.yarnpkg.com/deep-extend/-/deep-extend-0.4.2.tgz#48b699c27e334bf89f10892be432f6e4c7d34a7f" + default-shell@1.0.1, default-shell@^1.0.0: version "1.0.1" resolved "https://registry.yarnpkg.com/default-shell/-/default-shell-1.0.1.tgz#752304bddc6174f49eb29cb988feea0b8813c8bc" +delayed-stream@~1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/delayed-stream/-/delayed-stream-1.0.0.tgz#df3ae199acadfb7d440aaae0b29e2272b24ec619" + +delegates@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/delegates/-/delegates-1.0.0.tgz#84c6e159b81904fdca59a0ef44cd870d31250f9a" + dot-prop@^3.0.0: version "3.0.0" resolved "https://registry.yarnpkg.com/dot-prop/-/dot-prop-3.0.0.tgz#1b708af094a49c9a0e7dbcad790aba539dac1177" dependencies: is-obj "^1.0.0" +ecc-jsbn@~0.1.1: + version "0.1.1" + resolved "https://registry.yarnpkg.com/ecc-jsbn/-/ecc-jsbn-0.1.1.tgz#0fc73a9ed5f0d53c38193398523ef7e543777505" + dependencies: + jsbn "~0.1.0" + electron-config@0.2.1: version "0.2.1" resolved "https://registry.yarnpkg.com/electron-config/-/electron-config-0.2.1.tgz#7e12c26412d06bf3ed3896d0479df162986b95ba" @@ -133,10 +309,50 @@ execa@^0.4.0: path-key "^1.0.0" strip-eof "^1.0.0" +expand-brackets@^0.1.4: + version "0.1.5" + resolved "https://registry.yarnpkg.com/expand-brackets/-/expand-brackets-0.1.5.tgz#df07284e342a807cd733ac5af72411e581d1177b" + dependencies: + is-posix-bracket "^0.1.0" + +expand-range@^1.8.1: + version "1.8.2" + resolved "https://registry.yarnpkg.com/expand-range/-/expand-range-1.8.2.tgz#a299effd335fe2721ebae8e257ec79644fc85337" + dependencies: + fill-range "^2.1.0" + +extend@~3.0.0: + version "3.0.1" + resolved "https://registry.yarnpkg.com/extend/-/extend-3.0.1.tgz#a755ea7bc1adfcc5a31ce7e762dbaadc5e636444" + +extglob@^0.3.1: + version "0.3.2" + resolved "https://registry.yarnpkg.com/extglob/-/extglob-0.3.2.tgz#2e18ff3d2f49ab2765cec9023f011daa8d8349a1" + dependencies: + is-extglob "^1.0.0" + +extsprintf@1.0.2: + version "1.0.2" + resolved "https://registry.yarnpkg.com/extsprintf/-/extsprintf-1.0.2.tgz#e1080e0658e300b06294990cc70e1502235fd550" + file-uri-to-path@0.0.2: version "0.0.2" resolved "https://registry.yarnpkg.com/file-uri-to-path/-/file-uri-to-path-0.0.2.tgz#37cdd1b5b905404b3f05e1b23645be694ff70f82" +filename-regex@^2.0.0: + version "2.0.1" + resolved "https://registry.yarnpkg.com/filename-regex/-/filename-regex-2.0.1.tgz#c1c4b9bee3e09725ddb106b75c1e301fe2f18b26" + +fill-range@^2.1.0: + version "2.2.3" + resolved "https://registry.yarnpkg.com/fill-range/-/fill-range-2.2.3.tgz#50b77dfd7e469bc7492470963699fe7a8485a723" + dependencies: + is-number "^2.1.0" + isobject "^2.0.0" + randomatic "^1.1.3" + repeat-element "^1.1.2" + repeat-string "^1.5.2" + find-up@^1.0.0: version "1.1.2" resolved "https://registry.yarnpkg.com/find-up/-/find-up-1.1.2.tgz#6b2e9822b1a2ce0a60ab64d610eccad53cb24d0f" @@ -144,15 +360,74 @@ find-up@^1.0.0: path-exists "^2.0.0" pinkie-promise "^2.0.0" +for-in@^1.0.1: + version "1.0.2" + resolved "https://registry.yarnpkg.com/for-in/-/for-in-1.0.2.tgz#81068d295a8142ec0ac726c6e2200c30fb6d5e80" + +for-own@^0.1.4: + version "0.1.5" + resolved "https://registry.yarnpkg.com/for-own/-/for-own-0.1.5.tgz#5265c681a4f294dabbf17c9509b6763aa84510ce" + dependencies: + for-in "^1.0.1" + +forever-agent@~0.6.1: + version "0.6.1" + resolved "https://registry.yarnpkg.com/forever-agent/-/forever-agent-0.6.1.tgz#fbc71f0c41adeb37f96c577ad1ed42d8fdacca91" + +form-data@~2.1.1: + version "2.1.4" + resolved "https://registry.yarnpkg.com/form-data/-/form-data-2.1.4.tgz#33c183acf193276ecaa98143a69e94bfee1750d1" + dependencies: + asynckit "^0.4.0" + combined-stream "^1.0.5" + mime-types "^2.1.12" + fs.realpath@^1.0.0: version "1.0.0" resolved "https://registry.yarnpkg.com/fs.realpath/-/fs.realpath-1.0.0.tgz#1504ad2523158caa40db4a2787cb01411994ea4f" -gaze@1.1.2: +fsevents@^1.0.0: version "1.1.2" - resolved "https://registry.yarnpkg.com/gaze/-/gaze-1.1.2.tgz#847224677adb8870d679257ed3388fdb61e40105" + resolved "https://registry.yarnpkg.com/fsevents/-/fsevents-1.1.2.tgz#3282b713fb3ad80ede0e9fcf4611b5aa6fc033f4" dependencies: - globule "^1.0.0" + nan "^2.3.0" + node-pre-gyp "^0.6.36" + +fstream-ignore@^1.0.5: + version "1.0.5" + resolved "https://registry.yarnpkg.com/fstream-ignore/-/fstream-ignore-1.0.5.tgz#9c31dae34767018fe1d249b24dada67d092da105" + dependencies: + fstream "^1.0.0" + inherits "2" + minimatch "^3.0.0" + +fstream@^1.0.0, fstream@^1.0.10, fstream@^1.0.2: + version "1.0.11" + resolved "https://registry.yarnpkg.com/fstream/-/fstream-1.0.11.tgz#5c1fb1f117477114f0632a0eb4b71b3cb0fd3171" + dependencies: + graceful-fs "^4.1.2" + inherits "~2.0.0" + mkdirp ">=0.5 0" + rimraf "2" + +gauge@~2.7.3: + version "2.7.4" + resolved "https://registry.yarnpkg.com/gauge/-/gauge-2.7.4.tgz#2c03405c7538c39d7eb37b317022e325fb018bf7" + dependencies: + aproba "^1.0.3" + console-control-strings "^1.0.0" + has-unicode "^2.0.0" + object-assign "^4.1.0" + signal-exit "^3.0.0" + string-width "^1.0.1" + strip-ansi "^3.0.1" + wide-align "^1.1.0" + +getpass@^0.1.1: + version "0.1.7" + resolved "https://registry.yarnpkg.com/getpass/-/getpass-0.1.7.tgz#5eff8e3e684d569ae4cb2b1282604e8ba62149fa" + dependencies: + assert-plus "^1.0.0" git-describe@3.0.2: version "3.0.2" @@ -161,24 +436,69 @@ git-describe@3.0.2: lodash "^4.13.1" semver "^5.2.0" -glob@~7.1.1: - version "7.1.1" - resolved "https://registry.yarnpkg.com/glob/-/glob-7.1.1.tgz#805211df04faaf1c63a3600306cdf5ade50b2ec8" +glob-base@^0.3.0: + version "0.3.0" + resolved "https://registry.yarnpkg.com/glob-base/-/glob-base-0.3.0.tgz#dbb164f6221b1c0b1ccf82aea328b497df0ea3c4" + dependencies: + glob-parent "^2.0.0" + is-glob "^2.0.0" + +glob-parent@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/glob-parent/-/glob-parent-2.0.0.tgz#81383d72db054fcccf5336daa902f182f6edbb28" + dependencies: + is-glob "^2.0.0" + +glob@^7.0.5: + version "7.1.2" + resolved "https://registry.yarnpkg.com/glob/-/glob-7.1.2.tgz#c19c9df9a028702d678612384a6552404c636d15" dependencies: fs.realpath "^1.0.0" inflight "^1.0.4" inherits "2" - minimatch "^3.0.2" + minimatch "^3.0.4" once "^1.3.0" path-is-absolute "^1.0.0" -globule@^1.0.0: - version "1.1.0" - resolved "https://registry.yarnpkg.com/globule/-/globule-1.1.0.tgz#c49352e4dc183d85893ee825385eb994bb6df45f" +graceful-fs@^4.1.2: + version "4.1.11" + resolved "https://registry.yarnpkg.com/graceful-fs/-/graceful-fs-4.1.11.tgz#0e8bdfe4d1ddb8854d64e04ea7c00e2a026e5658" + +har-schema@^1.0.5: + version "1.0.5" + resolved "https://registry.yarnpkg.com/har-schema/-/har-schema-1.0.5.tgz#d263135f43307c02c602afc8fe95970c0151369e" + +har-validator@~4.2.1: + version "4.2.1" + resolved "https://registry.yarnpkg.com/har-validator/-/har-validator-4.2.1.tgz#33481d0f1bbff600dd203d75812a6a5fba002e2a" dependencies: - glob "~7.1.1" - lodash "~4.16.4" - minimatch "~3.0.2" + ajv "^4.9.1" + har-schema "^1.0.5" + +has-unicode@^2.0.0: + version "2.0.1" + resolved "https://registry.yarnpkg.com/has-unicode/-/has-unicode-2.0.1.tgz#e0e6fe6a28cf51138855e086d1691e771de2a8b9" + +hawk@~3.1.3: + version "3.1.3" + resolved "https://registry.yarnpkg.com/hawk/-/hawk-3.1.3.tgz#078444bd7c1640b0fe540d2c9b73d59678e8e1c4" + dependencies: + boom "2.x.x" + cryptiles "2.x.x" + hoek "2.x.x" + sntp "1.x.x" + +hoek@2.x.x: + version "2.16.3" + resolved "https://registry.yarnpkg.com/hoek/-/hoek-2.16.3.tgz#20bb7403d3cea398e91dc4710a8ff1b8274a25ed" + +http-signature@~1.1.0: + version "1.1.1" + resolved "https://registry.yarnpkg.com/http-signature/-/http-signature-1.1.1.tgz#df72e267066cd0ac67fb76adf8e134a8fbcf91bf" + dependencies: + assert-plus "^0.2.0" + jsprim "^1.2.2" + sshpk "^1.7.0" iconv-lite@~0.4.13: version "0.4.15" @@ -191,36 +511,157 @@ inflight@^1.0.4: once "^1.3.0" wrappy "1" -inherits@2: +inherits@2, inherits@^2.0.1, inherits@~2.0.0, inherits@~2.0.1: version "2.0.3" resolved "https://registry.yarnpkg.com/inherits/-/inherits-2.0.3.tgz#633c2c83e3da42a502f52466022480f4208261de" +ini@~1.3.0: + version "1.3.4" + resolved "https://registry.yarnpkg.com/ini/-/ini-1.3.4.tgz#0537cb79daf59b59a1a517dff706c86ec039162e" + +is-binary-path@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/is-binary-path/-/is-binary-path-1.0.1.tgz#75f16642b480f187a711c814161fd3a4a7655898" + dependencies: + binary-extensions "^1.0.0" + +is-buffer@^1.1.5: + version "1.1.5" + resolved "https://registry.yarnpkg.com/is-buffer/-/is-buffer-1.1.5.tgz#1f3b26ef613b214b88cbca23cc6c01d87961eecc" + is-css-color-name@^0.1.1: version "0.1.3" resolved "https://registry.yarnpkg.com/is-css-color-name/-/is-css-color-name-0.1.3.tgz#ea3b51bc901d8a243d32c9b7873d0680dbbef7f1" dependencies: css-color-names "0.0.2" +is-dotfile@^1.0.0: + version "1.0.3" + resolved "https://registry.yarnpkg.com/is-dotfile/-/is-dotfile-1.0.3.tgz#a6a2f32ffd2dfb04f5ca25ecd0f6b83cf798a1e1" + +is-equal-shallow@^0.1.3: + version "0.1.3" + resolved "https://registry.yarnpkg.com/is-equal-shallow/-/is-equal-shallow-0.1.3.tgz#2238098fc221de0bcfa5d9eac4c45d638aa1c534" + dependencies: + is-primitive "^2.0.0" + +is-extendable@^0.1.1: + version "0.1.1" + resolved "https://registry.yarnpkg.com/is-extendable/-/is-extendable-0.1.1.tgz#62b110e289a471418e3ec36a617d472e301dfc89" + +is-extglob@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/is-extglob/-/is-extglob-1.0.0.tgz#ac468177c4943405a092fc8f29760c6ffc6206c0" + +is-fullwidth-code-point@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/is-fullwidth-code-point/-/is-fullwidth-code-point-1.0.0.tgz#ef9e31386f031a7f0d643af82fde50c457ef00cb" + dependencies: + number-is-nan "^1.0.0" + +is-glob@^2.0.0, is-glob@^2.0.1: + version "2.0.1" + resolved "https://registry.yarnpkg.com/is-glob/-/is-glob-2.0.1.tgz#d096f926a3ded5600f3fdfd91198cb0888c2d863" + dependencies: + is-extglob "^1.0.0" + +is-number@^2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/is-number/-/is-number-2.1.0.tgz#01fcbbb393463a548f2f466cce16dece49db908f" + dependencies: + kind-of "^3.0.2" + +is-number@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/is-number/-/is-number-3.0.0.tgz#24fd6201a4782cf50561c810276afc7d12d71195" + dependencies: + kind-of "^3.0.2" + is-obj@^1.0.0: version "1.0.1" resolved "https://registry.yarnpkg.com/is-obj/-/is-obj-1.0.1.tgz#3e4729ac1f5fde025cd7d83a896dab9f4f67db0f" +is-posix-bracket@^0.1.0: + version "0.1.1" + resolved "https://registry.yarnpkg.com/is-posix-bracket/-/is-posix-bracket-0.1.1.tgz#3334dc79774368e92f016e6fbc0a88f5cd6e6bc4" + +is-primitive@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/is-primitive/-/is-primitive-2.0.0.tgz#207bab91638499c07b2adf240a41a87210034575" + is-stream@^1.0.1, is-stream@^1.1.0: version "1.1.0" resolved "https://registry.yarnpkg.com/is-stream/-/is-stream-1.1.0.tgz#12d4a3dd4e68e0b79ceb8dbc84173ae80d91ca44" +is-typedarray@~1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/is-typedarray/-/is-typedarray-1.0.0.tgz#e479c80858df0c1b11ddda6940f96011fcda4a9a" + +isarray@1.0.0, isarray@~1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/isarray/-/isarray-1.0.0.tgz#bb935d48582cba168c06834957a54a3e07124f11" + isexe@^1.1.1: version "1.1.2" resolved "https://registry.yarnpkg.com/isexe/-/isexe-1.1.2.tgz#36f3e22e60750920f5e7241a476a8c6a42275ad0" +isobject@^2.0.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/isobject/-/isobject-2.1.0.tgz#f065561096a3f1da2ef46272f815c840d87e0c89" + dependencies: + isarray "1.0.0" + +isstream@~0.1.2: + version "0.1.2" + resolved "https://registry.yarnpkg.com/isstream/-/isstream-0.1.2.tgz#47e63f7af55afa6f92e1500e690eb8b8529c099a" + +jsbn@~0.1.0: + version "0.1.1" + resolved "https://registry.yarnpkg.com/jsbn/-/jsbn-0.1.1.tgz#a5e654c2e5a2deb5f201d96cefbca80c0ef2f513" + +json-schema@0.2.3: + version "0.2.3" + resolved "https://registry.yarnpkg.com/json-schema/-/json-schema-0.2.3.tgz#b480c892e59a2f05954ce727bd3f2a4e882f9e13" + +json-stable-stringify@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/json-stable-stringify/-/json-stable-stringify-1.0.1.tgz#9a759d39c5f2ff503fd5300646ed445f88c4f9af" + dependencies: + jsonify "~0.0.0" + +json-stringify-safe@~5.0.1: + version "5.0.1" + resolved "https://registry.yarnpkg.com/json-stringify-safe/-/json-stringify-safe-5.0.1.tgz#1296a2d58fd45f19a0f6ce01d65701e2c735b6eb" + +jsonify@~0.0.0: + version "0.0.0" + resolved "https://registry.yarnpkg.com/jsonify/-/jsonify-0.0.0.tgz#2c74b6ee41d93ca51b7b5aaee8f503631d252a73" + +jsprim@^1.2.2: + version "1.4.0" + resolved "https://registry.yarnpkg.com/jsprim/-/jsprim-1.4.0.tgz#a3b87e40298d8c380552d8cc7628a0bb95a22918" + dependencies: + assert-plus "1.0.0" + extsprintf "1.0.2" + json-schema "0.2.3" + verror "1.3.6" + +kind-of@^3.0.2: + version "3.2.2" + resolved "https://registry.yarnpkg.com/kind-of/-/kind-of-3.2.2.tgz#31ea21a734bab9bbb0f32466d893aea51e4a3c64" + dependencies: + is-buffer "^1.1.5" + +kind-of@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/kind-of/-/kind-of-4.0.0.tgz#20813df3d712928b207378691a45066fae72dd57" + dependencies: + is-buffer "^1.1.5" + lodash@^4.13.1: version "4.17.4" resolved "https://registry.yarnpkg.com/lodash/-/lodash-4.17.4.tgz#78203a4d1c328ae1d86dca6460e369b57f4055ae" -lodash@~4.16.4: - version "4.16.6" - resolved "https://registry.yarnpkg.com/lodash/-/lodash-4.16.6.tgz#d22c9ac660288f3843e16ba7d2b5d06cca27d777" - lru-cache@^4.0.0: version "4.0.2" resolved "https://registry.yarnpkg.com/lru-cache/-/lru-cache-4.0.2.tgz#1d17679c069cda5d040991a09dbc2c0db377e55e" @@ -228,17 +669,49 @@ lru-cache@^4.0.0: pseudomap "^1.0.1" yallist "^2.0.0" -minimatch@^3.0.2, minimatch@~3.0.2: - version "3.0.3" - resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-3.0.3.tgz#2a4e4090b96b2db06a9d7df01055a62a77c9b774" +micromatch@^2.1.5: + version "2.3.11" + resolved "https://registry.yarnpkg.com/micromatch/-/micromatch-2.3.11.tgz#86677c97d1720b363431d04d0d15293bd38c1565" dependencies: - brace-expansion "^1.0.0" + arr-diff "^2.0.0" + array-unique "^0.2.1" + braces "^1.8.2" + expand-brackets "^0.1.4" + extglob "^0.3.1" + filename-regex "^2.0.0" + is-extglob "^1.0.0" + is-glob "^2.0.1" + kind-of "^3.0.2" + normalize-path "^2.0.1" + object.omit "^2.0.0" + parse-glob "^3.0.4" + regex-cache "^0.4.2" + +mime-db@~1.27.0: + version "1.27.0" + resolved "https://registry.yarnpkg.com/mime-db/-/mime-db-1.27.0.tgz#820f572296bbd20ec25ed55e5b5de869e5436eb1" + +mime-types@^2.1.12, mime-types@~2.1.7: + version "2.1.15" + resolved "https://registry.yarnpkg.com/mime-types/-/mime-types-2.1.15.tgz#a4ebf5064094569237b8cf70046776d09fc92aed" + dependencies: + mime-db "~1.27.0" + +minimatch@^3.0.0, minimatch@^3.0.2, minimatch@^3.0.4: + version "3.0.4" + resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-3.0.4.tgz#5166e286457f03306064be5497e8dbb0c3d32083" + dependencies: + brace-expansion "^1.1.7" minimist@0.0.8: version "0.0.8" resolved "https://registry.yarnpkg.com/minimist/-/minimist-0.0.8.tgz#857fcabfc3397d2625b8228262e86aa7a011b05d" -mkdirp@0.5.1, mkdirp@^0.5.1: +minimist@^1.2.0: + version "1.2.0" + resolved "https://registry.yarnpkg.com/minimist/-/minimist-1.2.0.tgz#a35008b20f41383eec1fb914f4cd5df79a264284" + +mkdirp@0.5.1, "mkdirp@>=0.5 0", mkdirp@^0.5.1: version "0.5.1" resolved "https://registry.yarnpkg.com/mkdirp/-/mkdirp-0.5.1.tgz#30057438eac6cf7f8c4767f38648d6697d75c903" dependencies: @@ -252,7 +725,7 @@ ms@0.7.2: version "0.7.2" resolved "https://registry.yarnpkg.com/ms/-/ms-0.7.2.tgz#ae25cf2512b3885a1d95d7f037868d8431124765" -nan@2.5.0: +nan@2.5.0, nan@^2.3.0: version "2.5.0" resolved "https://registry.yarnpkg.com/nan/-/nan-2.5.0.tgz#aa8f1e34531d807e9e27755b234b4a6ec0c152a8" @@ -263,28 +736,103 @@ node-fetch@1.6.3: encoding "^0.1.11" is-stream "^1.0.1" +node-pre-gyp@^0.6.36: + version "0.6.36" + resolved "https://registry.yarnpkg.com/node-pre-gyp/-/node-pre-gyp-0.6.36.tgz#db604112cb74e0d477554e9b505b17abddfab786" + dependencies: + mkdirp "^0.5.1" + nopt "^4.0.1" + npmlog "^4.0.2" + rc "^1.1.7" + request "^2.81.0" + rimraf "^2.6.1" + semver "^5.3.0" + tar "^2.2.1" + tar-pack "^3.4.0" + node-pty@0.6.10: version "0.6.10" resolved "https://registry.yarnpkg.com/node-pty/-/node-pty-0.6.10.tgz#b7d355bb2002d16e14c3c353e58c48f7ee131a67" dependencies: nan "2.5.0" +nopt@^4.0.1: + version "4.0.1" + resolved "https://registry.yarnpkg.com/nopt/-/nopt-4.0.1.tgz#d0d4685afd5415193c8c7505602d0d17cd64474d" + dependencies: + abbrev "1" + osenv "^0.1.4" + +normalize-path@^2.0.1: + version "2.1.1" + resolved "https://registry.yarnpkg.com/normalize-path/-/normalize-path-2.1.1.tgz#1ab28b556e198363a8c1a6f7e6fa20137fe6aed9" + dependencies: + remove-trailing-separator "^1.0.1" + npm-run-path@^1.0.0: version "1.0.0" resolved "https://registry.yarnpkg.com/npm-run-path/-/npm-run-path-1.0.0.tgz#f5c32bf595fe81ae927daec52e82f8b000ac3c8f" dependencies: path-key "^1.0.0" -object-assign@^4.0.1: +npmlog@^4.0.2: + version "4.1.0" + resolved "https://registry.yarnpkg.com/npmlog/-/npmlog-4.1.0.tgz#dc59bee85f64f00ed424efb2af0783df25d1c0b5" + dependencies: + are-we-there-yet "~1.1.2" + console-control-strings "~1.1.0" + gauge "~2.7.3" + set-blocking "~2.0.0" + +number-is-nan@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/number-is-nan/-/number-is-nan-1.0.1.tgz#097b602b53422a522c1afb8790318336941a011d" + +oauth-sign@~0.8.1: + version "0.8.2" + resolved "https://registry.yarnpkg.com/oauth-sign/-/oauth-sign-0.8.2.tgz#46a6ab7f0aead8deae9ec0565780b7d4efeb9d43" + +object-assign@^4.0.1, object-assign@^4.1.0: version "4.1.0" resolved "https://registry.yarnpkg.com/object-assign/-/object-assign-4.1.0.tgz#7a3b3d0e98063d43f4c03f2e8ae6cd51a86883a0" -once@^1.3.0: +object.omit@^2.0.0: + version "2.0.1" + resolved "https://registry.yarnpkg.com/object.omit/-/object.omit-2.0.1.tgz#1a9c744829f39dbb858c76ca3579ae2a54ebd1fa" + dependencies: + for-own "^0.1.4" + is-extendable "^0.1.1" + +once@^1.3.0, once@^1.3.3: version "1.4.0" resolved "https://registry.yarnpkg.com/once/-/once-1.4.0.tgz#583b1aa775961d4b113ac17d9c50baef9dd76bd1" dependencies: wrappy "1" +os-homedir@^1.0.0: + version "1.0.2" + resolved "https://registry.yarnpkg.com/os-homedir/-/os-homedir-1.0.2.tgz#ffbc4988336e0e833de0c168c7ef152121aa7fb3" + +os-tmpdir@^1.0.0: + version "1.0.2" + resolved "https://registry.yarnpkg.com/os-tmpdir/-/os-tmpdir-1.0.2.tgz#bbe67406c79aa85c5cfec766fe5734555dfa1274" + +osenv@^0.1.4: + version "0.1.4" + resolved "https://registry.yarnpkg.com/osenv/-/osenv-0.1.4.tgz#42fe6d5953df06c8064be6f176c3d05aaaa34644" + dependencies: + os-homedir "^1.0.0" + os-tmpdir "^1.0.0" + +parse-glob@^3.0.4: + version "3.0.4" + resolved "https://registry.yarnpkg.com/parse-glob/-/parse-glob-3.0.4.tgz#b2c376cfb11f35513badd173ef0bb6e3a388391c" + dependencies: + glob-base "^0.3.0" + is-dotfile "^1.0.0" + is-extglob "^1.0.0" + is-glob "^2.0.0" + path-exists@^2.0.0: version "2.1.0" resolved "https://registry.yarnpkg.com/path-exists/-/path-exists-2.1.0.tgz#0feb6c64f0fc518d9a754dd5efb62c7022761f4b" @@ -299,6 +847,10 @@ path-key@^1.0.0: version "1.0.0" resolved "https://registry.yarnpkg.com/path-key/-/path-key-1.0.0.tgz#5d53d578019646c0d68800db4e146e6bdc2ac7af" +performance-now@^0.2.0: + version "0.2.0" + resolved "https://registry.yarnpkg.com/performance-now/-/performance-now-0.2.0.tgz#33ef30c5c77d4ea21c5a53869d91b56d8f2555e5" + pinkie-promise@^2.0.0: version "2.0.1" resolved "https://registry.yarnpkg.com/pinkie-promise/-/pinkie-promise-2.0.1.tgz#2135d6dfa7a358c069ac9b178776288228450ffa" @@ -315,14 +867,131 @@ pkg-up@^1.0.0: dependencies: find-up "^1.0.0" +preserve@^0.2.0: + version "0.2.0" + resolved "https://registry.yarnpkg.com/preserve/-/preserve-0.2.0.tgz#815ed1f6ebc65926f865b310c0713bcb3315ce4b" + +process-nextick-args@~1.0.6: + version "1.0.7" + resolved "https://registry.yarnpkg.com/process-nextick-args/-/process-nextick-args-1.0.7.tgz#150e20b756590ad3f91093f25a4f2ad8bff30ba3" + pseudomap@^1.0.1: version "1.0.2" resolved "https://registry.yarnpkg.com/pseudomap/-/pseudomap-1.0.2.tgz#f052a28da70e618917ef0a8ac34c1ae5a68286b3" -semver@5.3.0, semver@^5.2.0: +punycode@^1.4.1: + version "1.4.1" + resolved "https://registry.yarnpkg.com/punycode/-/punycode-1.4.1.tgz#c0d5a63b2718800ad8e1eb0fa5269c84dd41845e" + +qs@~6.4.0: + version "6.4.0" + resolved "https://registry.yarnpkg.com/qs/-/qs-6.4.0.tgz#13e26d28ad6b0ffaa91312cd3bf708ed351e7233" + +randomatic@^1.1.3: + version "1.1.7" + resolved "https://registry.yarnpkg.com/randomatic/-/randomatic-1.1.7.tgz#c7abe9cc8b87c0baa876b19fde83fd464797e38c" + dependencies: + is-number "^3.0.0" + kind-of "^4.0.0" + +rc@^1.1.7: + version "1.2.1" + resolved "https://registry.yarnpkg.com/rc/-/rc-1.2.1.tgz#2e03e8e42ee450b8cb3dce65be1bf8974e1dfd95" + dependencies: + deep-extend "~0.4.0" + ini "~1.3.0" + minimist "^1.2.0" + strip-json-comments "~2.0.1" + +readable-stream@^2.0.2, readable-stream@^2.0.6, readable-stream@^2.1.4: + version "2.2.11" + resolved "https://registry.yarnpkg.com/readable-stream/-/readable-stream-2.2.11.tgz#0796b31f8d7688007ff0b93a8088d34aa17c0f72" + dependencies: + core-util-is "~1.0.0" + inherits "~2.0.1" + isarray "~1.0.0" + process-nextick-args "~1.0.6" + safe-buffer "~5.0.1" + string_decoder "~1.0.0" + util-deprecate "~1.0.1" + +readdirp@^2.0.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/readdirp/-/readdirp-2.1.0.tgz#4ed0ad060df3073300c48440373f72d1cc642d78" + dependencies: + graceful-fs "^4.1.2" + minimatch "^3.0.2" + readable-stream "^2.0.2" + set-immediate-shim "^1.0.1" + +regex-cache@^0.4.2: + version "0.4.3" + resolved "https://registry.yarnpkg.com/regex-cache/-/regex-cache-0.4.3.tgz#9b1a6c35d4d0dfcef5711ae651e8e9d3d7114145" + dependencies: + is-equal-shallow "^0.1.3" + is-primitive "^2.0.0" + +remove-trailing-separator@^1.0.1: + version "1.0.2" + resolved "https://registry.yarnpkg.com/remove-trailing-separator/-/remove-trailing-separator-1.0.2.tgz#69b062d978727ad14dc6b56ba4ab772fd8d70511" + +repeat-element@^1.1.2: + version "1.1.2" + resolved "https://registry.yarnpkg.com/repeat-element/-/repeat-element-1.1.2.tgz#ef089a178d1483baae4d93eb98b4f9e4e11d990a" + +repeat-string@^1.5.2: + version "1.6.1" + resolved "https://registry.yarnpkg.com/repeat-string/-/repeat-string-1.6.1.tgz#8dcae470e1c88abc2d600fff4a776286da75e637" + +request@^2.81.0: + version "2.81.0" + resolved "https://registry.yarnpkg.com/request/-/request-2.81.0.tgz#c6928946a0e06c5f8d6f8a9333469ffda46298a0" + dependencies: + aws-sign2 "~0.6.0" + aws4 "^1.2.1" + caseless "~0.12.0" + combined-stream "~1.0.5" + extend "~3.0.0" + forever-agent "~0.6.1" + form-data "~2.1.1" + har-validator "~4.2.1" + hawk "~3.1.3" + http-signature "~1.1.0" + is-typedarray "~1.0.0" + isstream "~0.1.2" + json-stringify-safe "~5.0.1" + mime-types "~2.1.7" + oauth-sign "~0.8.1" + performance-now "^0.2.0" + qs "~6.4.0" + safe-buffer "^5.0.1" + stringstream "~0.0.4" + tough-cookie "~2.3.0" + tunnel-agent "^0.6.0" + uuid "^3.0.0" + +rimraf@2, rimraf@^2.5.1, rimraf@^2.6.1: + version "2.6.1" + resolved "https://registry.yarnpkg.com/rimraf/-/rimraf-2.6.1.tgz#c2338ec643df7a1b7fe5c54fa86f57428a55f33d" + dependencies: + glob "^7.0.5" + +safe-buffer@^5.0.1, safe-buffer@~5.0.1: + version "5.0.1" + resolved "https://registry.yarnpkg.com/safe-buffer/-/safe-buffer-5.0.1.tgz#d263ca54696cd8a306b5ca6551e92de57918fbe7" + +semver@5.3.0, semver@^5.2.0, semver@^5.3.0: version "5.3.0" resolved "https://registry.yarnpkg.com/semver/-/semver-5.3.0.tgz#9b2ce5d3de02d17c6012ad326aa6b4d0cf54f94f" +set-blocking@~2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/set-blocking/-/set-blocking-2.0.0.tgz#045f9782d011ae9a6803ddd382b24392b3d890f7" + +set-immediate-shim@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/set-immediate-shim/-/set-immediate-shim-1.0.1.tgz#4b2b1b27eb808a9f8dcc481a58e5e56f599f3f61" + shell-env@0.2.0: version "0.2.0" resolved "https://registry.yarnpkg.com/shell-env/-/shell-env-0.2.0.tgz#a84f6ea132e95587df85ed76a4dbfb8d07ac464f" @@ -331,7 +1000,49 @@ shell-env@0.2.0: execa "^0.4.0" strip-ansi "^3.0.0" -strip-ansi@^3.0.0: +signal-exit@^3.0.0: + version "3.0.2" + resolved "https://registry.yarnpkg.com/signal-exit/-/signal-exit-3.0.2.tgz#b5fdc08f1287ea1178628e415e25132b73646c6d" + +sntp@1.x.x: + version "1.0.9" + resolved "https://registry.yarnpkg.com/sntp/-/sntp-1.0.9.tgz#6541184cc90aeea6c6e7b35e2659082443c66198" + dependencies: + hoek "2.x.x" + +sshpk@^1.7.0: + version "1.13.1" + resolved "https://registry.yarnpkg.com/sshpk/-/sshpk-1.13.1.tgz#512df6da6287144316dc4c18fe1cf1d940739be3" + dependencies: + asn1 "~0.2.3" + assert-plus "^1.0.0" + dashdash "^1.12.0" + getpass "^0.1.1" + optionalDependencies: + bcrypt-pbkdf "^1.0.0" + ecc-jsbn "~0.1.1" + jsbn "~0.1.0" + tweetnacl "~0.14.0" + +string-width@^1.0.1, string-width@^1.0.2: + version "1.0.2" + resolved "https://registry.yarnpkg.com/string-width/-/string-width-1.0.2.tgz#118bdf5b8cdc51a2a7e70d211e07e2b0b9b107d3" + dependencies: + code-point-at "^1.0.0" + is-fullwidth-code-point "^1.0.0" + strip-ansi "^3.0.0" + +string_decoder@~1.0.0: + version "1.0.2" + resolved "https://registry.yarnpkg.com/string_decoder/-/string_decoder-1.0.2.tgz#b29e1f4e1125fa97a10382b8a533737b7491e179" + dependencies: + safe-buffer "~5.0.1" + +stringstream@~0.0.4: + version "0.0.5" + resolved "https://registry.yarnpkg.com/stringstream/-/stringstream-0.0.5.tgz#4e484cd4de5a0bbbee18e46307710a8a81621878" + +strip-ansi@^3.0.0, strip-ansi@^3.0.1: version "3.0.1" resolved "https://registry.yarnpkg.com/strip-ansi/-/strip-ansi-3.0.1.tgz#6a385fb8853d952d5ff05d0e8aaf94278dc63dcf" dependencies: @@ -341,16 +1052,77 @@ strip-eof@^1.0.0: version "1.0.0" resolved "https://registry.yarnpkg.com/strip-eof/-/strip-eof-1.0.0.tgz#bb43ff5598a6eb05d89b59fcd129c983313606bf" -uuid@3.0.0: +strip-json-comments@~2.0.1: + version "2.0.1" + resolved "https://registry.yarnpkg.com/strip-json-comments/-/strip-json-comments-2.0.1.tgz#3c531942e908c2697c0ec344858c286c7ca0a60a" + +tar-pack@^3.4.0: + version "3.4.0" + resolved "https://registry.yarnpkg.com/tar-pack/-/tar-pack-3.4.0.tgz#23be2d7f671a8339376cbdb0b8fe3fdebf317984" + dependencies: + debug "^2.2.0" + fstream "^1.0.10" + fstream-ignore "^1.0.5" + once "^1.3.3" + readable-stream "^2.1.4" + rimraf "^2.5.1" + tar "^2.2.1" + uid-number "^0.0.6" + +tar@^2.2.1: + version "2.2.1" + resolved "https://registry.yarnpkg.com/tar/-/tar-2.2.1.tgz#8e4d2a256c0e2185c6b18ad694aec968b83cb1d1" + dependencies: + block-stream "*" + fstream "^1.0.2" + inherits "2" + +tough-cookie@~2.3.0: + version "2.3.2" + resolved "https://registry.yarnpkg.com/tough-cookie/-/tough-cookie-2.3.2.tgz#f081f76e4c85720e6c37a5faced737150d84072a" + dependencies: + punycode "^1.4.1" + +tunnel-agent@^0.6.0: + version "0.6.0" + resolved "https://registry.yarnpkg.com/tunnel-agent/-/tunnel-agent-0.6.0.tgz#27a5dea06b36b04a0a9966774b290868f0fc40fd" + dependencies: + safe-buffer "^5.0.1" + +tweetnacl@^0.14.3, tweetnacl@~0.14.0: + version "0.14.5" + resolved "https://registry.yarnpkg.com/tweetnacl/-/tweetnacl-0.14.5.tgz#5ae68177f192d4456269d108afa93ff8743f4f64" + +uid-number@^0.0.6: + version "0.0.6" + resolved "https://registry.yarnpkg.com/uid-number/-/uid-number-0.0.6.tgz#0ea10e8035e8eb5b8e4449f06da1c730663baa81" + +util-deprecate@~1.0.1: + version "1.0.2" + resolved "https://registry.yarnpkg.com/util-deprecate/-/util-deprecate-1.0.2.tgz#450d4dc9fa70de732762fbd2d4a28981419a0ccf" + +uuid@3.0.0, uuid@^3.0.0: version "3.0.0" resolved "https://registry.yarnpkg.com/uuid/-/uuid-3.0.0.tgz#6728fc0459c450d796a99c31837569bdf672d728" +verror@1.3.6: + version "1.3.6" + resolved "https://registry.yarnpkg.com/verror/-/verror-1.3.6.tgz#cff5df12946d297d2baaefaa2689e25be01c005c" + dependencies: + extsprintf "1.0.2" + which@^1.2.8: version "1.2.12" resolved "https://registry.yarnpkg.com/which/-/which-1.2.12.tgz#de67b5e450269f194909ef23ece4ebe416fa1192" dependencies: isexe "^1.1.1" +wide-align@^1.1.0: + version "1.1.2" + resolved "https://registry.yarnpkg.com/wide-align/-/wide-align-1.1.2.tgz#571e0f1b0604636ebc0dfc21b0339bbe31341710" + dependencies: + string-width "^1.0.2" + winreg@1.2.2: version "1.2.2" resolved "https://registry.yarnpkg.com/winreg/-/winreg-1.2.2.tgz#8509afa3b71c5bbd110a6d7c6247ec67736c598f" From de8e70f935c79bb25d996ec53bd87ca7a525922c Mon Sep 17 00:00:00 2001 From: Andy Date: Sun, 13 Aug 2017 07:03:35 +0200 Subject: [PATCH 25/62] Make builds work again and catch squirrel errors on windows (#2078) * Catch errors for electron-squirrel-startup * Made builds work again * linting * linting --- .gitignore | 1 + app/index.html | 2 +- app/index.js | 22 ++++++++++++++++------ lib/components/header.js | 10 +++++----- package.json | 4 ++-- webpack.config.js | 2 +- 6 files changed, 26 insertions(+), 15 deletions(-) diff --git a/.gitignore b/.gitignore index fa4e7c02..be68f684 100644 --- a/.gitignore +++ b/.gitignore @@ -1,5 +1,6 @@ # build output dist +app/renderer # dependencies node_modules diff --git a/app/index.html b/app/index.html index a1309b99..04a2a4fa 100644 --- a/app/index.html +++ b/app/index.html @@ -31,7 +31,7 @@
- + diff --git a/app/index.js b/app/index.js index 6b1c2c3f..afdc80a6 100644 --- a/app/index.js +++ b/app/index.js @@ -9,6 +9,19 @@ if (['--help', '-v', '--version'].includes(process.argv[1])) { process.exit(); } +const checkSquirrel = () => { + let squirrel; + + try { + squirrel = require('electron-squirrel-startup'); + } catch (err) {} + + if (squirrel) { + // eslint-disable-next-line unicorn/no-process-exit + process.exit(); + } +}; + // handle startup squirrel events if (process.platform === 'win32') { // eslint-disable-next-line import/order @@ -18,19 +31,16 @@ if (process.platform === 'win32') { case '--squirrel-install': case '--squirrel-updated': systemContextMenu.add(() => { - // eslint-disable-next-line curly, unicorn/no-process-exit - if (require('electron-squirrel-startup')) process.exit(); + checkSquirrel(); }); break; case '--squirrel-uninstall': systemContextMenu.remove(() => { - // eslint-disable-next-line curly, unicorn/no-process-exit - if (require('electron-squirrel-startup')) process.exit(); + checkSquirrel(); }); break; default: - // eslint-disable-next-line curly, unicorn/no-process-exit - if (require('electron-squirrel-startup')) process.exit(); + checkSquirrel(); } } diff --git a/lib/components/header.js b/lib/components/header.js index 2a711bb7..19d2a9e7 100644 --- a/lib/components/header.js +++ b/lib/components/header.js @@ -106,8 +106,8 @@ export default class Header extends Component { const {hambMenu, winCtrls} = this.getWindowHeaderConfig(); const left = winCtrls === 'left'; const maxButtonHref = this.props.maximized ? - './dist/assets/icons.svg#restore-window' : - './dist/assets/icons.svg#maximize-window'; + './renderer/assets/icons.svg#restore-window' : + './renderer/assets/icons.svg#maximize-window'; return (
- + } {title} @@ -137,7 +137,7 @@ export default class Header extends Component { className={css('shape', left && 'minimizeWindowLeft')} onClick={this.handleMinimizeClick} > - + - + } diff --git a/package.json b/package.json index 30c8f50c..0951e039 100644 --- a/package.json +++ b/package.json @@ -12,8 +12,8 @@ "prepush": "npm test", "postinstall": "electron-builder install-app-deps && npm run rebuild-node-pty", "rebuild-node-pty": "electron-rebuild -f -w app/node_modules/node-pty -m app", - "dist": "npm run build && cross-env BABEL_ENV=production babel --out-file app/dist/bundle.js --no-comments --minified app/dist/bundle.js && build", - "clean": "node ./bin/rimraf-standalone.js node_modules && node ./bin/rimraf-standalone.js ./app/node_modules && node ./bin/rimraf-standalone.js ./app/dist" + "dist": "npm run build && cross-env BABEL_ENV=production babel --out-file app/renderer/bundle.js --no-comments --minified app/renderer/bundle.js && build", + "clean": "node ./bin/rimraf-standalone.js node_modules && node ./bin/rimraf-standalone.js ./app/node_modules && node ./bin/rimraf-standalone.js ./app/renderer" }, "xo": { "extends": "xo-react", diff --git a/webpack.config.js b/webpack.config.js index 5edfec2d..b6c10394 100644 --- a/webpack.config.js +++ b/webpack.config.js @@ -13,7 +13,7 @@ module.exports = { devtool: isProd ? 'hidden-source-map' : 'cheap-module-source-map', entry: './lib/index.js', output: { - path: path.join(__dirname, 'app', 'dist'), + path: path.join(__dirname, 'app', 'renderer'), filename: 'bundle.js' }, module: { From 10abd8149e7ab35c5178f0a64b37443a6a9d81f8 Mon Sep 17 00:00:00 2001 From: Benjamin Staneck Date: Sun, 13 Aug 2017 18:53:28 +0200 Subject: [PATCH 26/62] Travis: use yarn cache, update node to v7.9.0 and remove git-lfs (#2060) --- .travis.yml | 10 +++++----- appveyor.yml | 2 +- 2 files changed, 6 insertions(+), 6 deletions(-) diff --git a/.travis.yml b/.travis.yml index 0f4d53e4..7c7bc11c 100644 --- a/.travis.yml +++ b/.travis.yml @@ -6,9 +6,9 @@ language: node_js matrix: include: - os: osx - node_js: 7.4 + node_js: 7.9.0 - os: linux - node_js: 7.4 + node_js: 7.9.0 env: CC=clang CXX=clang++ npm_config_clang=1 compiler: clang @@ -26,10 +26,10 @@ addons: - snapd before_install: - - mkdir -p /tmp/git-lfs && curl -L https://github.com/github/git-lfs/releases/download/v1.2.1/git-lfs-$([ "$TRAVIS_OS_NAME" == "linux" ] && echo "linux" || echo "darwin")-amd64-1.2.1.tar.gz | tar -xz -C /tmp/git-lfs --strip-components 1 && /tmp/git-lfs/git-lfs pull - if [[ "$TRAVIS_OS_NAME" == "linux" ]]; then export DISPLAY=:99.0; sh -e /etc/init.d/xvfb start; sleep 3; fi - - if [[ "$TRAVIS_OS_NAME" == "osx" ]]; then brew update; fi - - if [[ "$TRAVIS_OS_NAME" == "osx" ]]; then brew install yarn; fi + - npm install -g yarn + +cache: yarn install: - yarn diff --git a/appveyor.yml b/appveyor.yml index 67d2c07c..79d79d11 100644 --- a/appveyor.yml +++ b/appveyor.yml @@ -12,7 +12,7 @@ init: - yarn config set msvs_version 2015 # we need this to build `pty.js` install: - - ps: Install-Product node 8 x64 + - ps: Install-Product node 7.9.0 x64 - set CI=true - yarn From cd1b8cd0649a8d303cc48da3b586c566750d90b6 Mon Sep 17 00:00:00 2001 From: Adam Stankiewicz Date: Mon, 14 Aug 2017 09:42:28 +0200 Subject: [PATCH 27/62] Ship yarn with hyper (#381) --- app/package.json | 3 +- app/plugins.js | 95 +- app/yarn.lock | 154 +- bin/yarn-standalone.js | 121409 ++++++++++++++++++++++++++++++++++++++ package.json | 2 + yarn.lock | 620 +- 6 files changed, 121824 insertions(+), 459 deletions(-) create mode 100644 bin/yarn-standalone.js diff --git a/app/package.json b/app/package.json index 06734653..fa2287de 100644 --- a/app/package.json +++ b/app/package.json @@ -24,9 +24,10 @@ "ms": "0.7.1", "node-fetch": "1.6.3", "node-pty": "0.6.10", + "queue": "4.0.0", "semver": "5.3.0", - "shell-env": "0.2.0", "uuid": "3.0.0", + "shell-env": "0.2.0", "winreg": "1.2.2" } } diff --git a/app/plugins.js b/app/plugins.js index ec264eb3..9c3b8a2d 100644 --- a/app/plugins.js +++ b/app/plugins.js @@ -1,12 +1,13 @@ -const {exec} = require('child_process'); +const {app, dialog} = require('electron'); const {resolve, basename} = require('path'); const {writeFileSync} = require('fs'); - -const {app, dialog} = require('electron'); +const cp = require('child_process'); const {sync: mkdirpSync} = require('mkdirp'); const Config = require('electron-config'); const ms = require('ms'); -const shellEnv = require('shell-env'); +const queue = require('queue'); + +const spawnQueue = queue({concurrency: 1}); const config = require('./config'); const notify = require('./notify'); @@ -18,6 +19,7 @@ const cache = new Config(); // modules path const path = resolve(config.getConfigDir(), '.hyper_plugins'); const localPath = resolve(path, 'local'); +const cachePath = resolve(path, 'cache'); const availableExtensions = new Set([ 'onApp', 'onWindow', 'onRendererWindow', 'onUnload', 'middleware', 'reduceUI', 'reduceSessions', 'reduceTermGroups', @@ -79,17 +81,10 @@ function updatePlugins({force = false} = {}) { if (err) { console.error(err.stack); - if (/not a recognized/.test(err.message) || /command not found/.test(err.message)) { - notify( - 'Error updating plugins.', - 'We could not find the `npm` command. Make sure it\'s in $PATH' - ); - } else { - notify( - 'Error updating plugins.', - 'Check `~/.hyper_plugins/npm-debug.log` for more information.' - ); - } + notify( + 'Error updating plugins.', + err.message + ); } else { // flag successful plugin update cache.set('hyper.plugins', id_); @@ -228,46 +223,44 @@ function toDependencies(plugins) { } function install(fn) { - const {shell: cfgShell, npmRegistry} = exports.getDecoratedConfig(); - - const shell = cfgShell && cfgShell !== '' ? cfgShell : undefined; - - shellEnv(shell).then(env => { - if (npmRegistry) { - env.NPM_CONFIG_REGISTRY = npmRegistry; - } - /* eslint-disable camelcase */ - env.npm_config_runtime = 'electron'; - env.npm_config_target = process.versions.electron; - env.npm_config_disturl = 'https://atom.io/download/atom-shell'; - /* eslint-enable camelcase */ - // Shell-specific installation commands - const installCommands = { - fish: 'npm prune; and npm install --production --no-shrinkwrap', - posix: 'npm prune && npm install --production --no-shrinkwrap' - }; - // determine the shell we're running in - const whichShell = (typeof cfgShell === 'string' && cfgShell.match(/fish/)) ? 'fish' : 'posix'; - const execOptions = { - cwd: path, - env + function yarn(args, cb) { + const yarnPath = resolve(__dirname, '..', 'bin', 'yarn-standalone.js'); + const env = { + NODE_ENV: 'production', + ELECTRON_RUN_AS_NODE: 'true' }; - // https://nodejs.org/api/child_process.html#child_process_child_process_exec_command_options_callback - // node.js requires command line parsing should be compatible with cmd.exe on Windows, should able to accept `/d /s /c` - // but most custom shell doesn't. Instead, falls back to default shell - if (process.platform !== 'win32') { - execOptions.shell = shell; - } + spawnQueue.push(end => { + const cmd = [process.execPath, yarnPath].concat(args).join(' '); + console.log('Launching yarn:', cmd); - // Use the install command that is appropriate for our shell - exec(installCommands[whichShell], execOptions, err => { - if (err) { - return fn(err); - } - fn(null); + cp.exec(cmd, { + cwd: path, + env, + shell: true, + timeout: ms('5m'), + stdio: ['ignore', 'ignore', 'inherit'] + }, err => { + if (err) { + cb(err); + } else { + cb(null); + } + + end(); + spawnQueue.start(); + }); }); - }).catch(fn); + + spawnQueue.start(); + } + + yarn(['install', '--no-emoji', '--no-lockfile', '--cache-folder', cachePath], err => { + if (err) { + return fn(err); + } + fn(null); + }); } exports.subscribe = function (fn) { diff --git a/app/yarn.lock b/app/yarn.lock index a0c60eb4..6e8493f8 100644 --- a/app/yarn.lock +++ b/app/yarn.lock @@ -14,15 +14,15 @@ ajv@^4.9.1: json-stable-stringify "^1.0.1" ansi-regex@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/ansi-regex/-/ansi-regex-2.0.0.tgz#c5061b6e0ef8a81775e50f5d66151bf6bf371107" + version "2.1.1" + resolved "https://registry.yarnpkg.com/ansi-regex/-/ansi-regex-2.1.1.tgz#c3b33ab5ee360d86e0e628f0468ae7ef27d654df" anymatch@^1.3.0: - version "1.3.0" - resolved "https://registry.yarnpkg.com/anymatch/-/anymatch-1.3.0.tgz#a3e52fa39168c825ff57b0248126ce5a8ff95507" + version "1.3.2" + resolved "https://registry.yarnpkg.com/anymatch/-/anymatch-1.3.2.tgz#553dcb8f91e3c889845dfdba34c77721b90b9d7a" dependencies: - arrify "^1.0.0" micromatch "^2.1.5" + normalize-path "^2.0.0" aproba@^1.0.3: version "1.1.2" @@ -42,17 +42,13 @@ arr-diff@^2.0.0: arr-flatten "^1.0.1" arr-flatten@^1.0.1: - version "1.0.3" - resolved "https://registry.yarnpkg.com/arr-flatten/-/arr-flatten-1.0.3.tgz#a274ed85ac08849b6bd7847c4580745dc51adfb1" + version "1.1.0" + resolved "https://registry.yarnpkg.com/arr-flatten/-/arr-flatten-1.1.0.tgz#36048bbff4e7b47e136644316c99669ea5ae91f1" array-unique@^0.2.1: version "0.2.1" resolved "https://registry.yarnpkg.com/array-unique/-/array-unique-0.2.1.tgz#a1d97ccafcbc2625cc70fadceb36a50c58b01a53" -arrify@^1.0.0: - version "1.0.1" - resolved "https://registry.yarnpkg.com/arrify/-/arrify-1.0.1.tgz#898508da2226f380df904728456849c1501a4b0d" - asn1@~0.2.3: version "0.2.3" resolved "https://registry.yarnpkg.com/asn1/-/asn1-0.2.3.tgz#dac8787713c9966849fc8180777ebe9c1ddf3b86" @@ -92,8 +88,8 @@ bcrypt-pbkdf@^1.0.0: tweetnacl "^0.14.3" binary-extensions@^1.0.0: - version "1.8.0" - resolved "https://registry.yarnpkg.com/binary-extensions/-/binary-extensions-1.8.0.tgz#48ec8d16df4377eae5fa5884682480af4d95c774" + version "1.9.0" + resolved "https://registry.yarnpkg.com/binary-extensions/-/binary-extensions-1.9.0.tgz#66506c16ce6f4d6928a5b3cd6a33ca41e941e37b" block-stream@*: version "0.0.9" @@ -154,14 +150,14 @@ code-point-at@^1.0.0: resolved "https://registry.yarnpkg.com/code-point-at/-/code-point-at-1.1.0.tgz#0d070b4d043a5bea33a2f1a40e2edb3d9a4ccf77" color-convert@^1.3.0: - version "1.8.2" - resolved "https://registry.yarnpkg.com/color-convert/-/color-convert-1.8.2.tgz#be868184d7c8631766d54e7078e2672d7c7e3339" + version "1.9.0" + resolved "https://registry.yarnpkg.com/color-convert/-/color-convert-1.9.0.tgz#1accf97dd739b983bf994d56fec8f95853641b7a" dependencies: color-name "^1.1.1" color-name@^1.0.0, color-name@^1.1.1: - version "1.1.1" - resolved "https://registry.yarnpkg.com/color-name/-/color-name-1.1.1.tgz#4b1415304cf50028ea81643643bd82ea05803689" + version "1.1.3" + resolved "https://registry.yarnpkg.com/color-name/-/color-name-1.1.3.tgz#a7d0558bd89c42f795dd42328f740831ca53bc25" color-string@^0.3.0: version "0.3.0" @@ -207,7 +203,7 @@ convert-css-color-name-to-hex@0.1.1: css-color-names "0.0.3" is-css-color-name "^0.1.1" -core-util-is@~1.0.0: +core-util-is@1.0.2, core-util-is@~1.0.0: version "1.0.2" resolved "https://registry.yarnpkg.com/core-util-is/-/core-util-is-1.0.2.tgz#b5fd54220aa2bc5ab57aab7140c940754503c1a7" @@ -239,10 +235,10 @@ dashdash@^1.12.0: assert-plus "^1.0.0" debug@^2.2.0: - version "2.6.0" - resolved "https://registry.yarnpkg.com/debug/-/debug-2.6.0.tgz#bc596bcabe7617f11d9fa15361eded5608b8499b" + version "2.6.8" + resolved "https://registry.yarnpkg.com/debug/-/debug-2.6.8.tgz#e731531ca2ede27d188222427da17821d68ff4fc" dependencies: - ms "0.7.2" + ms "2.0.0" deep-extend@~0.4.0: version "0.4.2" @@ -331,9 +327,9 @@ extglob@^0.3.1: dependencies: is-extglob "^1.0.0" -extsprintf@1.0.2: - version "1.0.2" - resolved "https://registry.yarnpkg.com/extsprintf/-/extsprintf-1.0.2.tgz#e1080e0658e300b06294990cc70e1502235fd550" +extsprintf@1.3.0, extsprintf@^1.2.0: + version "1.3.0" + resolved "https://registry.yarnpkg.com/extsprintf/-/extsprintf-1.3.0.tgz#96918440e3041a7a414f8c52e3c574eb3c3e1e05" file-uri-to-path@0.0.2: version "0.0.2" @@ -501,8 +497,8 @@ http-signature@~1.1.0: sshpk "^1.7.0" iconv-lite@~0.4.13: - version "0.4.15" - resolved "https://registry.yarnpkg.com/iconv-lite/-/iconv-lite-0.4.15.tgz#fe265a218ac6a57cfe854927e9d04c19825eddeb" + version "0.4.18" + resolved "https://registry.yarnpkg.com/iconv-lite/-/iconv-lite-0.4.18.tgz#23d8656b16aae6742ac29732ea8f0336a4789cf2" inflight@^1.0.4: version "1.0.6" @@ -511,7 +507,7 @@ inflight@^1.0.4: once "^1.3.0" wrappy "1" -inherits@2, inherits@^2.0.1, inherits@~2.0.0, inherits@~2.0.1: +inherits@2, inherits@^2.0.1, inherits@~2.0.0, inherits@~2.0.3: version "2.0.3" resolved "https://registry.yarnpkg.com/inherits/-/inherits-2.0.3.tgz#633c2c83e3da42a502f52466022480f4208261de" @@ -601,9 +597,9 @@ isarray@1.0.0, isarray@~1.0.0: version "1.0.0" resolved "https://registry.yarnpkg.com/isarray/-/isarray-1.0.0.tgz#bb935d48582cba168c06834957a54a3e07124f11" -isexe@^1.1.1: - version "1.1.2" - resolved "https://registry.yarnpkg.com/isexe/-/isexe-1.1.2.tgz#36f3e22e60750920f5e7241a476a8c6a42275ad0" +isexe@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/isexe/-/isexe-2.0.0.tgz#e8fbf374dc556ff8947a10dcb0572d633f2cfa10" isobject@^2.0.0: version "2.1.0" @@ -638,13 +634,13 @@ jsonify@~0.0.0: resolved "https://registry.yarnpkg.com/jsonify/-/jsonify-0.0.0.tgz#2c74b6ee41d93ca51b7b5aaee8f503631d252a73" jsprim@^1.2.2: - version "1.4.0" - resolved "https://registry.yarnpkg.com/jsprim/-/jsprim-1.4.0.tgz#a3b87e40298d8c380552d8cc7628a0bb95a22918" + version "1.4.1" + resolved "https://registry.yarnpkg.com/jsprim/-/jsprim-1.4.1.tgz#313e66bc1e5cc06e438bc1b7499c2e5c56acb6a2" dependencies: assert-plus "1.0.0" - extsprintf "1.0.2" + extsprintf "1.3.0" json-schema "0.2.3" - verror "1.3.6" + verror "1.10.0" kind-of@^3.0.2: version "3.2.2" @@ -663,11 +659,11 @@ lodash@^4.13.1: resolved "https://registry.yarnpkg.com/lodash/-/lodash-4.17.4.tgz#78203a4d1c328ae1d86dca6460e369b57f4055ae" lru-cache@^4.0.0: - version "4.0.2" - resolved "https://registry.yarnpkg.com/lru-cache/-/lru-cache-4.0.2.tgz#1d17679c069cda5d040991a09dbc2c0db377e55e" + version "4.1.1" + resolved "https://registry.yarnpkg.com/lru-cache/-/lru-cache-4.1.1.tgz#622e32e82488b49279114a4f9ecf45e7cd6bba55" dependencies: - pseudomap "^1.0.1" - yallist "^2.0.0" + pseudomap "^1.0.2" + yallist "^2.1.2" micromatch@^2.1.5: version "2.3.11" @@ -687,15 +683,15 @@ micromatch@^2.1.5: parse-glob "^3.0.4" regex-cache "^0.4.2" -mime-db@~1.27.0: - version "1.27.0" - resolved "https://registry.yarnpkg.com/mime-db/-/mime-db-1.27.0.tgz#820f572296bbd20ec25ed55e5b5de869e5436eb1" +mime-db@~1.29.0: + version "1.29.0" + resolved "https://registry.yarnpkg.com/mime-db/-/mime-db-1.29.0.tgz#48d26d235589651704ac5916ca06001914266878" mime-types@^2.1.12, mime-types@~2.1.7: - version "2.1.15" - resolved "https://registry.yarnpkg.com/mime-types/-/mime-types-2.1.15.tgz#a4ebf5064094569237b8cf70046776d09fc92aed" + version "2.1.16" + resolved "https://registry.yarnpkg.com/mime-types/-/mime-types-2.1.16.tgz#2b858a52e5ecd516db897ac2be87487830698e23" dependencies: - mime-db "~1.27.0" + mime-db "~1.29.0" minimatch@^3.0.0, minimatch@^3.0.2, minimatch@^3.0.4: version "3.0.4" @@ -721,9 +717,9 @@ ms@0.7.1: version "0.7.1" resolved "https://registry.yarnpkg.com/ms/-/ms-0.7.1.tgz#9cd13c03adbff25b65effde7ce864ee952017098" -ms@0.7.2: - version "0.7.2" - resolved "https://registry.yarnpkg.com/ms/-/ms-0.7.2.tgz#ae25cf2512b3885a1d95d7f037868d8431124765" +ms@2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/ms/-/ms-2.0.0.tgz#5608aeadfc00be6c2901df5f9861788de0d597c8" nan@2.5.0, nan@^2.3.0: version "2.5.0" @@ -763,7 +759,7 @@ nopt@^4.0.1: abbrev "1" osenv "^0.1.4" -normalize-path@^2.0.1: +normalize-path@^2.0.0, normalize-path@^2.0.1: version "2.1.1" resolved "https://registry.yarnpkg.com/normalize-path/-/normalize-path-2.1.1.tgz#1ab28b556e198363a8c1a6f7e6fa20137fe6aed9" dependencies: @@ -776,8 +772,8 @@ npm-run-path@^1.0.0: path-key "^1.0.0" npmlog@^4.0.2: - version "4.1.0" - resolved "https://registry.yarnpkg.com/npmlog/-/npmlog-4.1.0.tgz#dc59bee85f64f00ed424efb2af0783df25d1c0b5" + version "4.1.2" + resolved "https://registry.yarnpkg.com/npmlog/-/npmlog-4.1.2.tgz#08a7f2a8bf734604779a9efa4ad5cc717abb954b" dependencies: are-we-there-yet "~1.1.2" console-control-strings "~1.1.0" @@ -793,8 +789,8 @@ oauth-sign@~0.8.1: resolved "https://registry.yarnpkg.com/oauth-sign/-/oauth-sign-0.8.2.tgz#46a6ab7f0aead8deae9ec0565780b7d4efeb9d43" object-assign@^4.0.1, object-assign@^4.1.0: - version "4.1.0" - resolved "https://registry.yarnpkg.com/object-assign/-/object-assign-4.1.0.tgz#7a3b3d0e98063d43f4c03f2e8ae6cd51a86883a0" + version "4.1.1" + resolved "https://registry.yarnpkg.com/object-assign/-/object-assign-4.1.1.tgz#2109adc7965887cfc05cbbd442cac8bfbb360863" object.omit@^2.0.0: version "2.0.1" @@ -875,7 +871,7 @@ process-nextick-args@~1.0.6: version "1.0.7" resolved "https://registry.yarnpkg.com/process-nextick-args/-/process-nextick-args-1.0.7.tgz#150e20b756590ad3f91093f25a4f2ad8bff30ba3" -pseudomap@^1.0.1: +pseudomap@^1.0.2: version "1.0.2" resolved "https://registry.yarnpkg.com/pseudomap/-/pseudomap-1.0.2.tgz#f052a28da70e618917ef0a8ac34c1ae5a68286b3" @@ -887,6 +883,12 @@ qs@~6.4.0: version "6.4.0" resolved "https://registry.yarnpkg.com/qs/-/qs-6.4.0.tgz#13e26d28ad6b0ffaa91312cd3bf708ed351e7233" +queue@4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/queue/-/queue-4.0.0.tgz#e5b10fa5847c696c64149a40c58d270ad79ac713" + dependencies: + inherits "~2.0.0" + randomatic@^1.1.3: version "1.1.7" resolved "https://registry.yarnpkg.com/randomatic/-/randomatic-1.1.7.tgz#c7abe9cc8b87c0baa876b19fde83fd464797e38c" @@ -904,15 +906,15 @@ rc@^1.1.7: strip-json-comments "~2.0.1" readable-stream@^2.0.2, readable-stream@^2.0.6, readable-stream@^2.1.4: - version "2.2.11" - resolved "https://registry.yarnpkg.com/readable-stream/-/readable-stream-2.2.11.tgz#0796b31f8d7688007ff0b93a8088d34aa17c0f72" + version "2.3.3" + resolved "https://registry.yarnpkg.com/readable-stream/-/readable-stream-2.3.3.tgz#368f2512d79f9d46fdfc71349ae7878bbc1eb95c" dependencies: core-util-is "~1.0.0" - inherits "~2.0.1" + inherits "~2.0.3" isarray "~1.0.0" process-nextick-args "~1.0.6" - safe-buffer "~5.0.1" - string_decoder "~1.0.0" + safe-buffer "~5.1.1" + string_decoder "~1.0.3" util-deprecate "~1.0.1" readdirp@^2.0.0: @@ -976,9 +978,9 @@ rimraf@2, rimraf@^2.5.1, rimraf@^2.6.1: dependencies: glob "^7.0.5" -safe-buffer@^5.0.1, safe-buffer@~5.0.1: - version "5.0.1" - resolved "https://registry.yarnpkg.com/safe-buffer/-/safe-buffer-5.0.1.tgz#d263ca54696cd8a306b5ca6551e92de57918fbe7" +safe-buffer@^5.0.1, safe-buffer@~5.1.0, safe-buffer@~5.1.1: + version "5.1.1" + resolved "https://registry.yarnpkg.com/safe-buffer/-/safe-buffer-5.1.1.tgz#893312af69b2123def71f57889001671eeb2c853" semver@5.3.0, semver@^5.2.0, semver@^5.3.0: version "5.3.0" @@ -1032,11 +1034,11 @@ string-width@^1.0.1, string-width@^1.0.2: is-fullwidth-code-point "^1.0.0" strip-ansi "^3.0.0" -string_decoder@~1.0.0: - version "1.0.2" - resolved "https://registry.yarnpkg.com/string_decoder/-/string_decoder-1.0.2.tgz#b29e1f4e1125fa97a10382b8a533737b7491e179" +string_decoder@~1.0.3: + version "1.0.3" + resolved "https://registry.yarnpkg.com/string_decoder/-/string_decoder-1.0.3.tgz#0fc67d7c141825de94282dd536bec6b9bce860ab" dependencies: - safe-buffer "~5.0.1" + safe-buffer "~5.1.0" stringstream@~0.0.4: version "0.0.5" @@ -1105,17 +1107,19 @@ uuid@3.0.0, uuid@^3.0.0: version "3.0.0" resolved "https://registry.yarnpkg.com/uuid/-/uuid-3.0.0.tgz#6728fc0459c450d796a99c31837569bdf672d728" -verror@1.3.6: - version "1.3.6" - resolved "https://registry.yarnpkg.com/verror/-/verror-1.3.6.tgz#cff5df12946d297d2baaefaa2689e25be01c005c" +verror@1.10.0: + version "1.10.0" + resolved "https://registry.yarnpkg.com/verror/-/verror-1.10.0.tgz#3a105ca17053af55d6e270c1f8288682e18da400" dependencies: - extsprintf "1.0.2" + assert-plus "^1.0.0" + core-util-is "1.0.2" + extsprintf "^1.2.0" which@^1.2.8: - version "1.2.12" - resolved "https://registry.yarnpkg.com/which/-/which-1.2.12.tgz#de67b5e450269f194909ef23ece4ebe416fa1192" + version "1.3.0" + resolved "https://registry.yarnpkg.com/which/-/which-1.3.0.tgz#ff04bdfc010ee547d780bec38e1ac1c2777d253a" dependencies: - isexe "^1.1.1" + isexe "^2.0.0" wide-align@^1.1.0: version "1.1.2" @@ -1131,6 +1135,6 @@ wrappy@1: version "1.0.2" resolved "https://registry.yarnpkg.com/wrappy/-/wrappy-1.0.2.tgz#b5243d8f3ec1aa35f1364605bc0d1036e30ab69f" -yallist@^2.0.0: - version "2.0.0" - resolved "https://registry.yarnpkg.com/yallist/-/yallist-2.0.0.tgz#306c543835f09ee1a4cb23b7bce9ab341c91cdd4" +yallist@^2.1.2: + version "2.1.2" + resolved "https://registry.yarnpkg.com/yallist/-/yallist-2.1.2.tgz#1c11f9218f076089a47dd512f93c6699a6a81d52" diff --git a/bin/yarn-standalone.js b/bin/yarn-standalone.js new file mode 100644 index 00000000..367b34a4 --- /dev/null +++ b/bin/yarn-standalone.js @@ -0,0 +1,121409 @@ +#!/usr/bin/env node +/******/ (function(modules) { // webpackBootstrap +/******/ // The module cache +/******/ var installedModules = {}; + +/******/ // The require function +/******/ function __webpack_require__(moduleId) { + +/******/ // Check if module is in cache +/******/ if(installedModules[moduleId]) +/******/ return installedModules[moduleId].exports; + +/******/ // Create a new module (and put it into the cache) +/******/ var module = installedModules[moduleId] = { +/******/ i: moduleId, +/******/ l: false, +/******/ exports: {} +/******/ }; + +/******/ // Execute the module function +/******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__); + +/******/ // Flag the module as loaded +/******/ module.l = true; + +/******/ // Return the exports of the module +/******/ return module.exports; +/******/ } + + +/******/ // expose the modules object (__webpack_modules__) +/******/ __webpack_require__.m = modules; + +/******/ // expose the module cache +/******/ __webpack_require__.c = installedModules; + +/******/ // identity function for calling harmony imports with the correct context +/******/ __webpack_require__.i = function(value) { return value; }; + +/******/ // define getter function for harmony exports +/******/ __webpack_require__.d = function(exports, name, getter) { +/******/ if(!__webpack_require__.o(exports, name)) { +/******/ Object.defineProperty(exports, name, { +/******/ configurable: false, +/******/ enumerable: true, +/******/ get: getter +/******/ }); +/******/ } +/******/ }; + +/******/ // getDefaultExport function for compatibility with non-harmony modules +/******/ __webpack_require__.n = function(module) { +/******/ var getter = module && module.__esModule ? +/******/ function getDefault() { return module['default']; } : +/******/ function getModuleExports() { return module; }; +/******/ __webpack_require__.d(getter, 'a', getter); +/******/ return getter; +/******/ }; + +/******/ // Object.prototype.hasOwnProperty.call +/******/ __webpack_require__.o = function(object, property) { return Object.prototype.hasOwnProperty.call(object, property); }; + +/******/ // __webpack_public_path__ +/******/ __webpack_require__.p = ""; + +/******/ // Load entry module and return exports +/******/ return __webpack_require__(__webpack_require__.s = 593); +/******/ }) +/************************************************************************/ +/******/ ([ +/* 0 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +exports.__esModule = true; + +var _promise = __webpack_require__(375); + +var _promise2 = _interopRequireDefault(_promise); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +exports.default = function (fn) { + return function () { + var gen = fn.apply(this, arguments); + return new _promise2.default(function (resolve, reject) { + function step(key, arg) { + try { + var info = gen[key](arg); + var value = info.value; + } catch (error) { + reject(error); + return; + } + + if (info.done) { + resolve(value); + } else { + return _promise2.default.resolve(value).then(function (value) { + step("next", value); + }, function (err) { + step("throw", err); + }); + } + } + + return step("next"); + }); + }; +}; + +/***/ }), +/* 1 */ +/***/ (function(module, exports) { + +module.exports = require("path"); + +/***/ }), +/* 2 */ +/***/ (function(module, exports) { + +module.exports = require("util"); + +/***/ }), +/* 3 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); +class MessageError extends Error { + constructor(msg, code) { + super(msg); + this.code = code; + } + +} + +exports.MessageError = MessageError; +class SecurityError extends MessageError {} + +exports.SecurityError = SecurityError; +class SpawnError extends MessageError {} +exports.SpawnError = SpawnError; + +/***/ }), +/* 4 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.makeTempDir = exports.hardlinksWork = exports.writeFilePreservingEol = exports.getFileSizeOnDisk = exports.walk = exports.symlink = exports.find = exports.readJsonAndFile = exports.readJson = exports.readFileAny = exports.hardlinkBulk = exports.copyBulk = exports.fileDatesEqual = exports.link = exports.chmod = exports.lstat = exports.exists = exports.mkdirp = exports.unlink = exports.stat = exports.access = exports.rename = exports.readdir = exports.realpath = exports.readlink = exports.writeFile = exports.readFileBuffer = exports.lockQueue = undefined; + +var _asyncToGenerator2; + +function _load_asyncToGenerator() { + return _asyncToGenerator2 = _interopRequireDefault(__webpack_require__(0)); +} + +let buildActionsForCopy = (() => { + var _ref = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (queue, events, possibleExtraneous, reporter) { + + // + let build = (() => { + var _ref2 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (data) { + const src = data.src, + dest = data.dest; + + const onFresh = data.onFresh || noop; + const onDone = data.onDone || noop; + files.add(dest); + + if (events.ignoreBasenames.indexOf(path.basename(src)) >= 0) { + // ignored file + return; + } + + const srcStat = yield lstat(src); + let srcFiles; + + if (srcStat.isDirectory()) { + srcFiles = yield readdir(src); + } + + let destStat; + try { + // try accessing the destination + destStat = yield lstat(dest); + } catch (e) { + // proceed if destination doesn't exist, otherwise error + if (e.code !== 'ENOENT') { + throw e; + } + } + + // if destination exists + if (destStat) { + const bothSymlinks = srcStat.isSymbolicLink() && destStat.isSymbolicLink(); + const bothFolders = srcStat.isDirectory() && destStat.isDirectory(); + const bothFiles = srcStat.isFile() && destStat.isFile(); + + // EINVAL access errors sometimes happen which shouldn't because node shouldn't be giving + // us modes that aren't valid. investigate this, it's generally safe to proceed. + + /* if (srcStat.mode !== destStat.mode) { + try { + await access(dest, srcStat.mode); + } catch (err) {} + } */ + + if (bothFiles && srcStat.size === destStat.size && fileDatesEqual(srcStat.mtime, destStat.mtime)) { + // we can safely assume this is the same file + onDone(); + reporter.verbose(reporter.lang('verboseFileSkip', src, dest, srcStat.size, +srcStat.mtime)); + return; + } + + if (bothSymlinks) { + const srcReallink = yield readlink(src); + if (srcReallink === (yield readlink(dest))) { + // if both symlinks are the same then we can continue on + onDone(); + reporter.verbose(reporter.lang('verboseFileSkipSymlink', src, dest, srcReallink)); + return; + } + } + + if (bothFolders) { + // mark files that aren't in this folder as possibly extraneous + const destFiles = yield readdir(dest); + invariant(srcFiles, 'src files not initialised'); + + for (const file of destFiles) { + if (srcFiles.indexOf(file) < 0) { + const loc = path.join(dest, file); + possibleExtraneous.add(loc); + + if ((yield lstat(loc)).isDirectory()) { + for (const file of yield readdir(loc)) { + possibleExtraneous.add(path.join(loc, file)); + } + } + } + } + } + } + + if (srcStat.isSymbolicLink()) { + onFresh(); + const linkname = yield readlink(src); + actions.push({ + type: 'symlink', + dest, + linkname + }); + onDone(); + } else if (srcStat.isDirectory()) { + if (!destStat) { + reporter.verbose(reporter.lang('verboseFileFolder', dest)); + yield mkdirp(dest); + } + + const destParts = dest.split(path.sep); + while (destParts.length) { + files.add(destParts.join(path.sep)); + destParts.pop(); + } + + // push all files to queue + invariant(srcFiles, 'src files not initialised'); + let remaining = srcFiles.length; + if (!remaining) { + onDone(); + } + for (const file of srcFiles) { + queue.push({ + onFresh, + src: path.join(src, file), + dest: path.join(dest, file), + onDone: function () { + if (--remaining === 0) { + onDone(); + } + } + }); + } + } else if (srcStat.isFile()) { + onFresh(); + actions.push({ + type: 'file', + src, + dest, + atime: srcStat.atime, + mtime: srcStat.mtime, + mode: srcStat.mode + }); + onDone(); + } else { + throw new Error(`unsure how to copy this: ${src}`); + } + }); + + return function build(_x5) { + return _ref2.apply(this, arguments); + }; + })(); + + const artifactFiles = new Set(events.artifactFiles || []); + const files = new Set(); + + // initialise events + for (const item of queue) { + const onDone = item.onDone; + item.onDone = function () { + events.onProgress(item.dest); + if (onDone) { + onDone(); + } + }; + } + events.onStart(queue.length); + + // start building actions + const actions = []; + + // custom concurrency logic as we're always executing stacks of CONCURRENT_QUEUE_ITEMS queue items + // at a time due to the requirement to push items onto the queue + while (queue.length) { + const items = queue.splice(0, CONCURRENT_QUEUE_ITEMS); + yield Promise.all(items.map(build)); + } + + // simulate the existence of some files to prevent considering them extraenous + for (const file of artifactFiles) { + if (possibleExtraneous.has(file)) { + reporter.verbose(reporter.lang('verboseFilePhantomExtraneous', file)); + possibleExtraneous.delete(file); + } + } + + for (const loc of possibleExtraneous) { + if (files.has(loc)) { + possibleExtraneous.delete(loc); + } + } + + return actions; + }); + + return function buildActionsForCopy(_x, _x2, _x3, _x4) { + return _ref.apply(this, arguments); + }; +})(); + +let buildActionsForHardlink = (() => { + var _ref3 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (queue, events, possibleExtraneous, reporter) { + + // + let build = (() => { + var _ref4 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (data) { + const src = data.src, + dest = data.dest; + + const onFresh = data.onFresh || noop; + const onDone = data.onDone || noop; + files.add(dest); + + if (events.ignoreBasenames.indexOf(path.basename(src)) >= 0) { + // ignored file + return; + } + + const srcStat = yield lstat(src); + let srcFiles; + + if (srcStat.isDirectory()) { + srcFiles = yield readdir(src); + } + + const destExists = yield exists(dest); + if (destExists) { + const destStat = yield lstat(dest); + + const bothSymlinks = srcStat.isSymbolicLink() && destStat.isSymbolicLink(); + const bothFolders = srcStat.isDirectory() && destStat.isDirectory(); + const bothFiles = srcStat.isFile() && destStat.isFile(); + + if (srcStat.mode !== destStat.mode) { + try { + yield access(dest, srcStat.mode); + } catch (err) { + // EINVAL access errors sometimes happen which shouldn't because node shouldn't be giving + // us modes that aren't valid. investigate this, it's generally safe to proceed. + reporter.verbose(err); + } + } + + // correct hardlink + if (bothFiles && srcStat.ino !== null && srcStat.ino === destStat.ino) { + onDone(); + reporter.verbose(reporter.lang('verboseFileSkip', src, dest, srcStat.ino)); + return; + } + + if (bothSymlinks) { + const srcReallink = yield readlink(src); + if (srcReallink === (yield readlink(dest))) { + // if both symlinks are the same then we can continue on + onDone(); + reporter.verbose(reporter.lang('verboseFileSkipSymlink', src, dest, srcReallink)); + return; + } + } + + if (bothFolders) { + // mark files that aren't in this folder as possibly extraneous + const destFiles = yield readdir(dest); + invariant(srcFiles, 'src files not initialised'); + + for (const file of destFiles) { + if (srcFiles.indexOf(file) < 0) { + const loc = path.join(dest, file); + possibleExtraneous.add(loc); + + if ((yield lstat(loc)).isDirectory()) { + for (const file of yield readdir(loc)) { + possibleExtraneous.add(path.join(loc, file)); + } + } + } + } + } + } + + if (srcStat.isSymbolicLink()) { + onFresh(); + const linkname = yield readlink(src); + actions.push({ + type: 'symlink', + dest, + linkname + }); + onDone(); + } else if (srcStat.isDirectory()) { + reporter.verbose(reporter.lang('verboseFileFolder', dest)); + yield mkdirp(dest); + + const destParts = dest.split(path.sep); + while (destParts.length) { + files.add(destParts.join(path.sep)); + destParts.pop(); + } + + // push all files to queue + invariant(srcFiles, 'src files not initialised'); + let remaining = srcFiles.length; + if (!remaining) { + onDone(); + } + for (const file of srcFiles) { + queue.push({ + onFresh, + src: path.join(src, file), + dest: path.join(dest, file), + onDone: function () { + if (--remaining === 0) { + onDone(); + } + } + }); + } + } else if (srcStat.isFile()) { + onFresh(); + actions.push({ + type: 'link', + src, + dest, + removeDest: destExists + }); + onDone(); + } else { + throw new Error(`unsure how to copy this: ${src}`); + } + }); + + return function build(_x10) { + return _ref4.apply(this, arguments); + }; + })(); + + const artifactFiles = new Set(events.artifactFiles || []); + const files = new Set(); + + // initialise events + for (const item of queue) { + const onDone = item.onDone; + item.onDone = function () { + events.onProgress(item.dest); + if (onDone) { + onDone(); + } + }; + } + events.onStart(queue.length); + + // start building actions + const actions = []; + + // custom concurrency logic as we're always executing stacks of CONCURRENT_QUEUE_ITEMS queue items + // at a time due to the requirement to push items onto the queue + while (queue.length) { + const items = queue.splice(0, CONCURRENT_QUEUE_ITEMS); + yield Promise.all(items.map(build)); + } + + // simulate the existence of some files to prevent considering them extraenous + for (const file of artifactFiles) { + if (possibleExtraneous.has(file)) { + reporter.verbose(reporter.lang('verboseFilePhantomExtraneous', file)); + possibleExtraneous.delete(file); + } + } + + for (const loc of possibleExtraneous) { + if (files.has(loc)) { + possibleExtraneous.delete(loc); + } + } + + return actions; + }); + + return function buildActionsForHardlink(_x6, _x7, _x8, _x9) { + return _ref3.apply(this, arguments); + }; +})(); + +let copyBulk = exports.copyBulk = (() => { + var _ref5 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (queue, reporter, _events) { + const events = { + onStart: _events && _events.onStart || noop, + onProgress: _events && _events.onProgress || noop, + possibleExtraneous: _events ? _events.possibleExtraneous : new Set(), + ignoreBasenames: _events && _events.ignoreBasenames || [], + artifactFiles: _events && _events.artifactFiles || [] + }; + + const actions = yield buildActionsForCopy(queue, events, events.possibleExtraneous, reporter); + events.onStart(actions.length); + + const fileActions = actions.filter(function (action) { + return action.type === 'file'; + }); + + const currentlyWriting = {}; + + yield (_promise || _load_promise()).queue(fileActions, (() => { + var _ref6 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (data) { + let writePromise; + while (writePromise = currentlyWriting[data.dest]) { + yield writePromise; + } + + const cleanup = function () { + return delete currentlyWriting[data.dest]; + }; + return currentlyWriting[data.dest] = new Promise(function (resolve, reject) { + const readStream = fs.createReadStream(data.src); + const writeStream = fs.createWriteStream(data.dest, { mode: data.mode }); + + reporter.verbose(reporter.lang('verboseFileCopy', data.src, data.dest)); + + readStream.on('error', reject); + writeStream.on('error', reject); + + writeStream.on('open', function () { + readStream.pipe(writeStream); + }); + + writeStream.once('close', function () { + fs.utimes(data.dest, data.atime, data.mtime, function (err) { + if (err) { + reject(err); + } else { + events.onProgress(data.dest); + cleanup(); + resolve(); + } + }); + }); + }).then(function (arg) { + cleanup(); + return arg; + }).catch(function (arg) { + cleanup(); + throw arg; + }); + }); + + return function (_x14) { + return _ref6.apply(this, arguments); + }; + })(), CONCURRENT_QUEUE_ITEMS); + + // we need to copy symlinks last as they could reference files we were copying + const symlinkActions = actions.filter(function (action) { + return action.type === 'symlink'; + }); + yield (_promise || _load_promise()).queue(symlinkActions, function (data) { + const linkname = path.resolve(path.dirname(data.dest), data.linkname); + reporter.verbose(reporter.lang('verboseFileSymlink', data.dest, linkname)); + return symlink(linkname, data.dest); + }); + }); + + return function copyBulk(_x11, _x12, _x13) { + return _ref5.apply(this, arguments); + }; +})(); + +let hardlinkBulk = exports.hardlinkBulk = (() => { + var _ref7 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (queue, reporter, _events) { + const events = { + onStart: _events && _events.onStart || noop, + onProgress: _events && _events.onProgress || noop, + possibleExtraneous: _events ? _events.possibleExtraneous : new Set(), + artifactFiles: _events && _events.artifactFiles || [], + ignoreBasenames: [] + }; + + const actions = yield buildActionsForHardlink(queue, events, events.possibleExtraneous, reporter); + events.onStart(actions.length); + + const fileActions = actions.filter(function (action) { + return action.type === 'link'; + }); + + yield (_promise || _load_promise()).queue(fileActions, (() => { + var _ref8 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (data) { + reporter.verbose(reporter.lang('verboseFileLink', data.src, data.dest)); + if (data.removeDest) { + yield unlink(data.dest); + } + yield link(data.src, data.dest); + }); + + return function (_x18) { + return _ref8.apply(this, arguments); + }; + })(), CONCURRENT_QUEUE_ITEMS); + + // we need to copy symlinks last as they could reference files we were copying + const symlinkActions = actions.filter(function (action) { + return action.type === 'symlink'; + }); + yield (_promise || _load_promise()).queue(symlinkActions, function (data) { + const linkname = path.resolve(path.dirname(data.dest), data.linkname); + reporter.verbose(reporter.lang('verboseFileSymlink', data.dest, linkname)); + return symlink(linkname, data.dest); + }); + }); + + return function hardlinkBulk(_x15, _x16, _x17) { + return _ref7.apply(this, arguments); + }; +})(); + +let readFileAny = exports.readFileAny = (() => { + var _ref9 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (files) { + for (const file of files) { + if (yield exists(file)) { + return readFile(file); + } + } + return null; + }); + + return function readFileAny(_x19) { + return _ref9.apply(this, arguments); + }; +})(); + +let readJson = exports.readJson = (() => { + var _ref10 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (loc) { + return (yield readJsonAndFile(loc)).object; + }); + + return function readJson(_x20) { + return _ref10.apply(this, arguments); + }; +})(); + +let readJsonAndFile = exports.readJsonAndFile = (() => { + var _ref11 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (loc) { + const file = yield readFile(loc); + try { + return { + object: (0, (_map || _load_map()).default)(JSON.parse(stripBOM(file))), + content: file + }; + } catch (err) { + err.message = `${loc}: ${err.message}`; + throw err; + } + }); + + return function readJsonAndFile(_x21) { + return _ref11.apply(this, arguments); + }; +})(); + +let find = exports.find = (() => { + var _ref12 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (filename, dir) { + const parts = dir.split(path.sep); + + while (parts.length) { + const loc = parts.concat(filename).join(path.sep); + + if (yield exists(loc)) { + return loc; + } else { + parts.pop(); + } + } + + return false; + }); + + return function find(_x22, _x23) { + return _ref12.apply(this, arguments); + }; +})(); + +let symlink = exports.symlink = (() => { + var _ref13 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (src, dest) { + try { + const stats = yield lstat(dest); + + if (stats.isSymbolicLink() && (yield exists(dest))) { + const resolved = yield realpath(dest); + if (resolved === src) { + return; + } + } + + yield unlink(dest); + } catch (err) { + if (err.code !== 'ENOENT') { + throw err; + } + } + + try { + if (process.platform === 'win32') { + // use directory junctions if possible on win32, this requires absolute paths + yield fsSymlink(src, dest, 'junction'); + } else { + // use relative paths otherwise which will be retained if the directory is moved + let relative; + if (yield exists(src)) { + relative = path.relative(fs.realpathSync(path.dirname(dest)), fs.realpathSync(src)); + } else { + relative = path.relative(path.dirname(dest), src); + } + yield fsSymlink(relative, dest); + } + } catch (err) { + if (err.code === 'EEXIST') { + // race condition + yield symlink(src, dest); + } else { + throw err; + } + } + }); + + return function symlink(_x24, _x25) { + return _ref13.apply(this, arguments); + }; +})(); + +let walk = exports.walk = (() => { + var _ref14 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (dir, relativeDir) { + let ignoreBasenames = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : new Set(); + + let files = []; + + let filenames = yield readdir(dir); + if (ignoreBasenames.size) { + filenames = filenames.filter(function (name) { + return !ignoreBasenames.has(name); + }); + } + + for (const name of filenames) { + const relative = relativeDir ? path.join(relativeDir, name) : name; + const loc = path.join(dir, name); + const stat = yield lstat(loc); + + files.push({ + relative, + basename: name, + absolute: loc, + mtime: +stat.mtime + }); + + if (stat.isDirectory()) { + files = files.concat((yield walk(loc, relative, ignoreBasenames))); + } + } + + return files; + }); + + return function walk(_x26, _x27) { + return _ref14.apply(this, arguments); + }; +})(); + +let getFileSizeOnDisk = exports.getFileSizeOnDisk = (() => { + var _ref15 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (loc) { + const stat = yield lstat(loc); + const size = stat.size, + blockSize = stat.blksize; + + + return Math.ceil(size / blockSize) * blockSize; + }); + + return function getFileSizeOnDisk(_x29) { + return _ref15.apply(this, arguments); + }; +})(); + +let getEolFromFile = (() => { + var _ref16 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (path) { + if (!(yield exists(path))) { + return undefined; + } + + const buffer = yield readFileBuffer(path); + + for (let i = 0; i < buffer.length; ++i) { + if (buffer[i] === cr) { + return '\r\n'; + } + if (buffer[i] === lf) { + return '\n'; + } + } + return undefined; + }); + + return function getEolFromFile(_x30) { + return _ref16.apply(this, arguments); + }; +})(); + +let writeFilePreservingEol = exports.writeFilePreservingEol = (() => { + var _ref17 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (path, data) { + const eol = (yield getEolFromFile(path)) || os.EOL; + if (eol !== '\n') { + data = data.replace(/\n/g, eol); + } + yield (0, (_promise2 || _load_promise2()).promisify)(fs.writeFile)(path, data); + }); + + return function writeFilePreservingEol(_x31, _x32) { + return _ref17.apply(this, arguments); + }; +})(); + +let hardlinksWork = exports.hardlinksWork = (() => { + var _ref18 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (dir) { + const filename = 'test-file' + Math.random(); + const file = path.join(dir, filename); + const fileLink = path.join(dir, filename + '-link'); + try { + yield writeFile(file, 'test'); + yield link(file, fileLink); + } catch (err) { + return false; + } finally { + yield unlink(file); + yield unlink(fileLink); + } + return true; + }); + + return function hardlinksWork(_x33) { + return _ref18.apply(this, arguments); + }; +})(); + +// not a strict polyfill for Node's fs.mkdtemp + + +let makeTempDir = exports.makeTempDir = (() => { + var _ref19 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (prefix) { + const dir = path.join(os.tmpdir(), `yarn-${prefix || ''}-${Date.now()}-${Math.random()}`); + yield unlink(dir); + yield mkdirp(dir); + return dir; + }); + + return function makeTempDir(_x34) { + return _ref19.apply(this, arguments); + }; +})(); + +exports.copy = copy; +exports.readFile = readFile; +exports.readFileRaw = readFileRaw; +exports.normalizeOS = normalizeOS; + +var _blockingQueue; + +function _load_blockingQueue() { + return _blockingQueue = _interopRequireDefault(__webpack_require__(80)); +} + +var _promise; + +function _load_promise() { + return _promise = _interopRequireWildcard(__webpack_require__(61)); +} + +var _promise2; + +function _load_promise2() { + return _promise2 = __webpack_require__(61); +} + +var _map; + +function _load_map() { + return _map = _interopRequireDefault(__webpack_require__(24)); +} + +function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +const path = __webpack_require__(1); + +const fs = __webpack_require__(5); +const os = __webpack_require__(106); + +const lockQueue = exports.lockQueue = new (_blockingQueue || _load_blockingQueue()).default('fs lock'); + +const readFileBuffer = exports.readFileBuffer = (0, (_promise2 || _load_promise2()).promisify)(fs.readFile); +const writeFile = exports.writeFile = (0, (_promise2 || _load_promise2()).promisify)(fs.writeFile); +const readlink = exports.readlink = (0, (_promise2 || _load_promise2()).promisify)(fs.readlink); +const realpath = exports.realpath = (0, (_promise2 || _load_promise2()).promisify)(fs.realpath); +const readdir = exports.readdir = (0, (_promise2 || _load_promise2()).promisify)(fs.readdir); +const rename = exports.rename = (0, (_promise2 || _load_promise2()).promisify)(fs.rename); +const access = exports.access = (0, (_promise2 || _load_promise2()).promisify)(fs.access); +const stat = exports.stat = (0, (_promise2 || _load_promise2()).promisify)(fs.stat); +const unlink = exports.unlink = (0, (_promise2 || _load_promise2()).promisify)(__webpack_require__(555)); +const mkdirp = exports.mkdirp = (0, (_promise2 || _load_promise2()).promisify)(__webpack_require__(149)); +const exists = exports.exists = (0, (_promise2 || _load_promise2()).promisify)(fs.exists, true); +const lstat = exports.lstat = (0, (_promise2 || _load_promise2()).promisify)(fs.lstat); +const chmod = exports.chmod = (0, (_promise2 || _load_promise2()).promisify)(fs.chmod); +const link = exports.link = (0, (_promise2 || _load_promise2()).promisify)(fs.link); + +const CONCURRENT_QUEUE_ITEMS = 4; + +const fsSymlink = (0, (_promise2 || _load_promise2()).promisify)(fs.symlink); +const invariant = __webpack_require__(7); +const stripBOM = __webpack_require__(253); + +const noop = () => {}; + +const fileDatesEqual = exports.fileDatesEqual = (a, b) => { + const aTime = a.getTime(); + const bTime = b.getTime(); + + if (process.platform !== 'win32') { + return aTime === bTime; + } + + // See https://github.com/nodejs/node/pull/12607 + // Submillisecond times from stat and utimes are truncated on Windows, + // causing a file with mtime 8.0079998 and 8.0081144 to become 8.007 and 8.008 + // and making it impossible to update these files to their correct timestamps. + if (Math.abs(aTime - bTime) <= 1) { + return true; + } + + const aTimeSec = Math.floor(aTime / 1000); + const bTimeSec = Math.floor(bTime / 1000); + + // See https://github.com/nodejs/node/issues/2069 + // Some versions of Node on windows zero the milliseconds when utime is used + // So if any of the time has a milliseconds part of zero we suspect that the + // bug is present and compare only seconds. + if (aTime - aTimeSec * 1000 === 0 || bTime - bTimeSec * 1000 === 0) { + return aTimeSec === bTimeSec; + } + + return aTime === bTime; +}; + +function copy(src, dest, reporter) { + return copyBulk([{ src, dest }], reporter); +} + +function _readFile(loc, encoding) { + return new Promise((resolve, reject) => { + fs.readFile(loc, encoding, function (err, content) { + if (err) { + reject(err); + } else { + resolve(content); + } + }); + }); +} + +function readFile(loc) { + return _readFile(loc, 'utf8').then(normalizeOS); +} + +function readFileRaw(loc) { + return _readFile(loc, 'binary'); +} + +function normalizeOS(body) { + return body.replace(/\r\n/g, '\n'); +} + +const cr = new Buffer('\r', 'utf8')[0]; +const lf = new Buffer('\n', 'utf8')[0]; + +/***/ }), +/* 5 */ +/***/ (function(module, exports) { + +module.exports = require("fs"); + +/***/ }), +/* 6 */ +/***/ (function(module, exports) { + +module.exports = require("crypto"); + +/***/ }), +/* 7 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; +/** + * Copyright 2013-2015, Facebook, Inc. + * All rights reserved. + * + * This source code is licensed under the BSD-style license found in the + * LICENSE file in the root directory of this source tree. An additional grant + * of patent rights can be found in the PATENTS file in the same directory. + */ + + + +/** + * Use invariant() to assert state which your program assumes to be true. + * + * Provide sprintf-style format (only %s is supported) and arguments + * to provide information about what broke and what you were + * expecting. + * + * The invariant message will be stripped in production, but the invariant + * will remain to ensure logic does not differ in production. + */ + +var NODE_ENV = process.env.NODE_ENV; + +var invariant = function(condition, format, a, b, c, d, e, f) { + if (NODE_ENV !== 'production') { + if (format === undefined) { + throw new Error('invariant requires an error message argument'); + } + } + + if (!condition) { + var error; + if (format === undefined) { + error = new Error( + 'Minified exception occurred; use the non-minified dev environment ' + + 'for the full error message and additional helpful warnings.' + ); + } else { + var args = [a, b, c, d, e, f]; + var argIndex = 0; + error = new Error( + format.replace(/%s/g, function() { return args[argIndex++]; }) + ); + error.name = 'Invariant Violation'; + } + + error.framesToPop = 1; // we don't care about invariant's own frame + throw error; + } +}; + +module.exports = invariant; + + +/***/ }), +/* 8 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.getPathKey = getPathKey; +const path = __webpack_require__(1); +const userHome = __webpack_require__(121).default; + +const DEPENDENCY_TYPES = exports.DEPENDENCY_TYPES = ['devDependencies', 'dependencies', 'optionalDependencies', 'peerDependencies']; + +const YARN_REGISTRY = exports.YARN_REGISTRY = 'https://registry.yarnpkg.com'; + +const YARN_DOCS = exports.YARN_DOCS = 'https://yarnpkg.com/en/docs/cli/'; +const YARN_INSTALLER_SH = exports.YARN_INSTALLER_SH = 'https://yarnpkg.com/install.sh'; +const YARN_INSTALLER_MSI = exports.YARN_INSTALLER_MSI = 'https://yarnpkg.com/latest.msi'; + +const SELF_UPDATE_VERSION_URL = exports.SELF_UPDATE_VERSION_URL = 'https://yarnpkg.com/latest-version'; +const SELF_UPDATE_TARBALL_URL = exports.SELF_UPDATE_TARBALL_URL = 'https://yarnpkg.com/latest.tar.gz'; +const SELF_UPDATE_DOWNLOAD_FOLDER = exports.SELF_UPDATE_DOWNLOAD_FOLDER = 'updates'; + +// cache version, bump whenever we make backwards incompatible changes +const CACHE_VERSION = exports.CACHE_VERSION = 1; + +// lockfile version, bump whenever we make backwards incompatible changes +const LOCKFILE_VERSION = exports.LOCKFILE_VERSION = 1; + +// max amount of network requests to perform concurrently +const NETWORK_CONCURRENCY = exports.NETWORK_CONCURRENCY = 8; + +// HTTP timeout used when downloading packages +const NETWORK_TIMEOUT = exports.NETWORK_TIMEOUT = 30 * 1000; // in milliseconds + +// max amount of child processes to execute concurrently +const CHILD_CONCURRENCY = exports.CHILD_CONCURRENCY = 5; + +const REQUIRED_PACKAGE_KEYS = exports.REQUIRED_PACKAGE_KEYS = ['name', 'version', '_uid']; + +function getDirectory(category) { + // use %LOCALAPPDATA%/Yarn on Windows + if (process.platform === 'win32' && process.env.LOCALAPPDATA) { + return path.join(process.env.LOCALAPPDATA, 'Yarn', category); + } + + // otherwise use ~/.{category}/yarn + return path.join(userHome, `.${category}`, 'yarn'); +} + +function getCacheDirectory() { + if (process.platform === 'darwin') { + return path.join(userHome, 'Library', 'Caches', 'Yarn'); + } + + return getDirectory('cache'); +} + +const MODULE_CACHE_DIRECTORY = exports.MODULE_CACHE_DIRECTORY = getCacheDirectory(); +const CONFIG_DIRECTORY = exports.CONFIG_DIRECTORY = getDirectory('config'); +const LINK_REGISTRY_DIRECTORY = exports.LINK_REGISTRY_DIRECTORY = path.join(CONFIG_DIRECTORY, 'link'); +const GLOBAL_MODULE_DIRECTORY = exports.GLOBAL_MODULE_DIRECTORY = path.join(CONFIG_DIRECTORY, 'global'); + +const META_FOLDER = exports.META_FOLDER = '.yarn-meta'; +const INTEGRITY_FILENAME = exports.INTEGRITY_FILENAME = '.yarn-integrity'; +const LOCKFILE_FILENAME = exports.LOCKFILE_FILENAME = 'yarn.lock'; +const METADATA_FILENAME = exports.METADATA_FILENAME = '.yarn-metadata.json'; +const TARBALL_FILENAME = exports.TARBALL_FILENAME = '.yarn-tarball.tgz'; +const CLEAN_FILENAME = exports.CLEAN_FILENAME = '.yarnclean'; + +const DEFAULT_INDENT = exports.DEFAULT_INDENT = ' '; +const SINGLE_INSTANCE_PORT = exports.SINGLE_INSTANCE_PORT = 31997; +const SINGLE_INSTANCE_FILENAME = exports.SINGLE_INSTANCE_FILENAME = '.yarn-single-instance'; + +const ENV_PATH_KEY = exports.ENV_PATH_KEY = getPathKey(process.platform, process.env); + +function getPathKey(platform, env) { + let pathKey = 'PATH'; + + // windows calls its path "Path" usually, but this is not guaranteed. + if (platform === 'win32') { + pathKey = 'Path'; + + for (const key in env) { + if (key.toLowerCase() === 'path') { + pathKey = key; + } + } + } + + return pathKey; +} + +/***/ }), +/* 9 */ +/***/ (function(module, exports, __webpack_require__) { + +// Copyright (c) 2012, Mark Cavage. All rights reserved. +// Copyright 2015 Joyent, Inc. + +var assert = __webpack_require__(22); +var Stream = __webpack_require__(14).Stream; +var util = __webpack_require__(2); + + +///--- Globals + +/* JSSTYLED */ +var UUID_REGEXP = /^[a-fA-F0-9]{8}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{12}$/; + + +///--- Internal + +function _capitalize(str) { + return (str.charAt(0).toUpperCase() + str.slice(1)); +} + +function _toss(name, expected, oper, arg, actual) { + throw new assert.AssertionError({ + message: util.format('%s (%s) is required', name, expected), + actual: (actual === undefined) ? typeof (arg) : actual(arg), + expected: expected, + operator: oper || '===', + stackStartFunction: _toss.caller + }); +} + +function _getClass(arg) { + return (Object.prototype.toString.call(arg).slice(8, -1)); +} + +function noop() { + // Why even bother with asserts? +} + + +///--- Exports + +var types = { + bool: { + check: function (arg) { return typeof (arg) === 'boolean'; } + }, + func: { + check: function (arg) { return typeof (arg) === 'function'; } + }, + string: { + check: function (arg) { return typeof (arg) === 'string'; } + }, + object: { + check: function (arg) { + return typeof (arg) === 'object' && arg !== null; + } + }, + number: { + check: function (arg) { + return typeof (arg) === 'number' && !isNaN(arg); + } + }, + finite: { + check: function (arg) { + return typeof (arg) === 'number' && !isNaN(arg) && isFinite(arg); + } + }, + buffer: { + check: function (arg) { return Buffer.isBuffer(arg); }, + operator: 'Buffer.isBuffer' + }, + array: { + check: function (arg) { return Array.isArray(arg); }, + operator: 'Array.isArray' + }, + stream: { + check: function (arg) { return arg instanceof Stream; }, + operator: 'instanceof', + actual: _getClass + }, + date: { + check: function (arg) { return arg instanceof Date; }, + operator: 'instanceof', + actual: _getClass + }, + regexp: { + check: function (arg) { return arg instanceof RegExp; }, + operator: 'instanceof', + actual: _getClass + }, + uuid: { + check: function (arg) { + return typeof (arg) === 'string' && UUID_REGEXP.test(arg); + }, + operator: 'isUUID' + } +}; + +function _setExports(ndebug) { + var keys = Object.keys(types); + var out; + + /* re-export standard assert */ + if (process.env.NODE_NDEBUG) { + out = noop; + } else { + out = function (arg, msg) { + if (!arg) { + _toss(msg, 'true', arg); + } + }; + } + + /* standard checks */ + keys.forEach(function (k) { + if (ndebug) { + out[k] = noop; + return; + } + var type = types[k]; + out[k] = function (arg, msg) { + if (!type.check(arg)) { + _toss(msg, k, type.operator, arg, type.actual); + } + }; + }); + + /* optional checks */ + keys.forEach(function (k) { + var name = 'optional' + _capitalize(k); + if (ndebug) { + out[name] = noop; + return; + } + var type = types[k]; + out[name] = function (arg, msg) { + if (arg === undefined || arg === null) { + return; + } + if (!type.check(arg)) { + _toss(msg, k, type.operator, arg, type.actual); + } + }; + }); + + /* arrayOf checks */ + keys.forEach(function (k) { + var name = 'arrayOf' + _capitalize(k); + if (ndebug) { + out[name] = noop; + return; + } + var type = types[k]; + var expected = '[' + k + ']'; + out[name] = function (arg, msg) { + if (!Array.isArray(arg)) { + _toss(msg, expected, type.operator, arg, type.actual); + } + var i; + for (i = 0; i < arg.length; i++) { + if (!type.check(arg[i])) { + _toss(msg, expected, type.operator, arg, type.actual); + } + } + }; + }); + + /* optionalArrayOf checks */ + keys.forEach(function (k) { + var name = 'optionalArrayOf' + _capitalize(k); + if (ndebug) { + out[name] = noop; + return; + } + var type = types[k]; + var expected = '[' + k + ']'; + out[name] = function (arg, msg) { + if (arg === undefined || arg === null) { + return; + } + if (!Array.isArray(arg)) { + _toss(msg, expected, type.operator, arg, type.actual); + } + var i; + for (i = 0; i < arg.length; i++) { + if (!type.check(arg[i])) { + _toss(msg, expected, type.operator, arg, type.actual); + } + } + }; + }); + + /* re-export built-in assertions */ + Object.keys(assert).forEach(function (k) { + if (k === 'AssertionError') { + out[k] = assert[k]; + return; + } + if (ndebug) { + out[k] = noop; + return; + } + out[k] = assert[k]; + }); + + /* export ourselves (for unit tests _only_) */ + out._setExports = _setExports; + + return out; +} + +module.exports = _setExports(process.env.NODE_NDEBUG); + + +/***/ }), +/* 10 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.sortAlpha = sortAlpha; +exports.entries = entries; +exports.removePrefix = removePrefix; +exports.removeSuffix = removeSuffix; +exports.addSuffix = addSuffix; +exports.hyphenate = hyphenate; +exports.camelCase = camelCase; +exports.compareSortedArrays = compareSortedArrays; +const _camelCase = __webpack_require__(381); + +function sortAlpha(a, b) { + // sort alphabetically in a deterministic way + const shortLen = Math.min(a.length, b.length); + for (let i = 0; i < shortLen; i++) { + const aChar = a.charCodeAt(i); + const bChar = b.charCodeAt(i); + if (aChar !== bChar) { + return aChar - bChar; + } + } + return a.length - b.length; +} + +function entries(obj) { + const entries = []; + if (obj) { + for (const key in obj) { + entries.push([key, obj[key]]); + } + } + return entries; +} + +function removePrefix(pattern, prefix) { + if (pattern.startsWith(prefix)) { + pattern = pattern.slice(prefix.length); + } + + return pattern; +} + +function removeSuffix(pattern, suffix) { + if (pattern.endsWith(suffix)) { + return pattern.slice(0, -suffix.length); + } + + return pattern; +} + +function addSuffix(pattern, suffix) { + if (!pattern.endsWith(suffix)) { + return pattern + suffix; + } + + return pattern; +} + +function hyphenate(str) { + return str.replace(/[A-Z]/g, match => { + return '-' + match.charAt(0).toLowerCase(); + }); +} + +function camelCase(str) { + if (/[A-Z]/.test(str)) { + return null; + } else { + return _camelCase(str); + } +} + +function compareSortedArrays(array1, array2) { + if (array1.length !== array2.length) { + return false; + } + for (let i = 0, len = array1.length; i < len; i++) { + if (array1[i] !== array2[i]) { + return false; + } + } + return true; +} + +/***/ }), +/* 11 */ +/***/ (function(module, exports) { + +module.exports = require("url"); + +/***/ }), +/* 12 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +exports.__esModule = true; + +var _isIterable2 = __webpack_require__(373); + +var _isIterable3 = _interopRequireDefault(_isIterable2); + +var _getIterator2 = __webpack_require__(372); + +var _getIterator3 = _interopRequireDefault(_getIterator2); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +exports.default = function () { + function sliceIterator(arr, i) { + var _arr = []; + var _n = true; + var _d = false; + var _e = undefined; + + try { + for (var _i = (0, _getIterator3.default)(arr), _s; !(_n = (_s = _i.next()).done); _n = true) { + _arr.push(_s.value); + + if (i && _arr.length === i) break; + } + } catch (err) { + _d = true; + _e = err; + } finally { + try { + if (!_n && _i["return"]) _i["return"](); + } finally { + if (_d) throw _e; + } + } + + return _arr; + } + + return function (arr, i) { + if (Array.isArray(arr)) { + return arr; + } else if ((0, _isIterable3.default)(Object(arr))) { + return sliceIterator(arr, i); + } else { + throw new TypeError("Invalid attempt to destructure non-iterable instance"); + } + }; +}(); + +/***/ }), +/* 13 */ +/***/ (function(module, exports, __webpack_require__) { + +// Copyright 2015 Joyent, Inc. + +module.exports = { + bufferSplit: bufferSplit, + addRSAMissing: addRSAMissing, + calculateDSAPublic: calculateDSAPublic, + mpNormalize: mpNormalize, + ecNormalize: ecNormalize, + countZeros: countZeros, + assertCompatible: assertCompatible, + isCompatible: isCompatible, + opensslKeyDeriv: opensslKeyDeriv, + opensshCipherInfo: opensshCipherInfo +}; + +var assert = __webpack_require__(9); +var PrivateKey = __webpack_require__(19); +var crypto = __webpack_require__(6); + +var MAX_CLASS_DEPTH = 3; + +function isCompatible(obj, klass, needVer) { + if (obj === null || typeof (obj) !== 'object') + return (false); + if (needVer === undefined) + needVer = klass.prototype._sshpkApiVersion; + if (obj instanceof klass && + klass.prototype._sshpkApiVersion[0] == needVer[0]) + return (true); + var proto = Object.getPrototypeOf(obj); + var depth = 0; + while (proto.constructor.name !== klass.name) { + proto = Object.getPrototypeOf(proto); + if (!proto || ++depth > MAX_CLASS_DEPTH) + return (false); + } + if (proto.constructor.name !== klass.name) + return (false); + var ver = proto._sshpkApiVersion; + if (ver === undefined) + ver = klass._oldVersionDetect(obj); + if (ver[0] != needVer[0] || ver[1] < needVer[1]) + return (false); + return (true); +} + +function assertCompatible(obj, klass, needVer, name) { + if (name === undefined) + name = 'object'; + assert.ok(obj, name + ' must not be null'); + assert.object(obj, name + ' must be an object'); + if (needVer === undefined) + needVer = klass.prototype._sshpkApiVersion; + if (obj instanceof klass && + klass.prototype._sshpkApiVersion[0] == needVer[0]) + return; + var proto = Object.getPrototypeOf(obj); + var depth = 0; + while (proto.constructor.name !== klass.name) { + proto = Object.getPrototypeOf(proto); + assert.ok(proto && ++depth <= MAX_CLASS_DEPTH, + name + ' must be a ' + klass.name + ' instance'); + } + assert.strictEqual(proto.constructor.name, klass.name, + name + ' must be a ' + klass.name + ' instance'); + var ver = proto._sshpkApiVersion; + if (ver === undefined) + ver = klass._oldVersionDetect(obj); + assert.ok(ver[0] == needVer[0] && ver[1] >= needVer[1], + name + ' must be compatible with ' + klass.name + ' klass ' + + 'version ' + needVer[0] + '.' + needVer[1]); +} + +var CIPHER_LEN = { + 'des-ede3-cbc': { key: 7, iv: 8 }, + 'aes-128-cbc': { key: 16, iv: 16 } +}; +var PKCS5_SALT_LEN = 8; + +function opensslKeyDeriv(cipher, salt, passphrase, count) { + assert.buffer(salt, 'salt'); + assert.buffer(passphrase, 'passphrase'); + assert.number(count, 'iteration count'); + + var clen = CIPHER_LEN[cipher]; + assert.object(clen, 'supported cipher'); + + salt = salt.slice(0, PKCS5_SALT_LEN); + + var D, D_prev, bufs; + var material = new Buffer(0); + while (material.length < clen.key + clen.iv) { + bufs = []; + if (D_prev) + bufs.push(D_prev); + bufs.push(passphrase); + bufs.push(salt); + D = Buffer.concat(bufs); + for (var j = 0; j < count; ++j) + D = crypto.createHash('md5').update(D).digest(); + material = Buffer.concat([material, D]); + D_prev = D; + } + + return ({ + key: material.slice(0, clen.key), + iv: material.slice(clen.key, clen.key + clen.iv) + }); +} + +/* Count leading zero bits on a buffer */ +function countZeros(buf) { + var o = 0, obit = 8; + while (o < buf.length) { + var mask = (1 << obit); + if ((buf[o] & mask) === mask) + break; + obit--; + if (obit < 0) { + o++; + obit = 8; + } + } + return (o*8 + (8 - obit) - 1); +} + +function bufferSplit(buf, chr) { + assert.buffer(buf); + assert.string(chr); + + var parts = []; + var lastPart = 0; + var matches = 0; + for (var i = 0; i < buf.length; ++i) { + if (buf[i] === chr.charCodeAt(matches)) + ++matches; + else if (buf[i] === chr.charCodeAt(0)) + matches = 1; + else + matches = 0; + + if (matches >= chr.length) { + var newPart = i + 1; + parts.push(buf.slice(lastPart, newPart - matches)); + lastPart = newPart; + matches = 0; + } + } + if (lastPart <= buf.length) + parts.push(buf.slice(lastPart, buf.length)); + + return (parts); +} + +function ecNormalize(buf, addZero) { + assert.buffer(buf); + if (buf[0] === 0x00 && buf[1] === 0x04) { + if (addZero) + return (buf); + return (buf.slice(1)); + } else if (buf[0] === 0x04) { + if (!addZero) + return (buf); + } else { + while (buf[0] === 0x00) + buf = buf.slice(1); + if (buf[0] === 0x02 || buf[0] === 0x03) + throw (new Error('Compressed elliptic curve points ' + + 'are not supported')); + if (buf[0] !== 0x04) + throw (new Error('Not a valid elliptic curve point')); + if (!addZero) + return (buf); + } + var b = new Buffer(buf.length + 1); + b[0] = 0x0; + buf.copy(b, 1); + return (b); +} + +function mpNormalize(buf) { + assert.buffer(buf); + while (buf.length > 1 && buf[0] === 0x00 && (buf[1] & 0x80) === 0x00) + buf = buf.slice(1); + if ((buf[0] & 0x80) === 0x80) { + var b = new Buffer(buf.length + 1); + b[0] = 0x00; + buf.copy(b, 1); + buf = b; + } + return (buf); +} + +function bigintToMpBuf(bigint) { + var buf = new Buffer(bigint.toByteArray()); + buf = mpNormalize(buf); + return (buf); +} + +function calculateDSAPublic(g, p, x) { + assert.buffer(g); + assert.buffer(p); + assert.buffer(x); + try { + var bigInt = __webpack_require__(45).BigInteger; + } catch (e) { + throw (new Error('To load a PKCS#8 format DSA private key, ' + + 'the node jsbn library is required.')); + } + g = new bigInt(g); + p = new bigInt(p); + x = new bigInt(x); + var y = g.modPow(x, p); + var ybuf = bigintToMpBuf(y); + return (ybuf); +} + +function addRSAMissing(key) { + assert.object(key); + assertCompatible(key, PrivateKey, [1, 1]); + try { + var bigInt = __webpack_require__(45).BigInteger; + } catch (e) { + throw (new Error('To write a PEM private key from ' + + 'this source, the node jsbn lib is required.')); + } + + var d = new bigInt(key.part.d.data); + var buf; + + if (!key.part.dmodp) { + var p = new bigInt(key.part.p.data); + var dmodp = d.mod(p.subtract(1)); + + buf = bigintToMpBuf(dmodp); + key.part.dmodp = {name: 'dmodp', data: buf}; + key.parts.push(key.part.dmodp); + } + if (!key.part.dmodq) { + var q = new bigInt(key.part.q.data); + var dmodq = d.mod(q.subtract(1)); + + buf = bigintToMpBuf(dmodq); + key.part.dmodq = {name: 'dmodq', data: buf}; + key.parts.push(key.part.dmodq); + } +} + +function opensshCipherInfo(cipher) { + var inf = {}; + switch (cipher) { + case '3des-cbc': + inf.keySize = 24; + inf.blockSize = 8; + inf.opensslName = 'des-ede3-cbc'; + break; + case 'blowfish-cbc': + inf.keySize = 16; + inf.blockSize = 8; + inf.opensslName = 'bf-cbc'; + break; + case 'aes128-cbc': + case 'aes128-ctr': + case 'aes128-gcm@openssh.com': + inf.keySize = 16; + inf.blockSize = 16; + inf.opensslName = 'aes-128-' + cipher.slice(7, 10); + break; + case 'aes192-cbc': + case 'aes192-ctr': + case 'aes192-gcm@openssh.com': + inf.keySize = 24; + inf.blockSize = 16; + inf.opensslName = 'aes-192-' + cipher.slice(7, 10); + break; + case 'aes256-cbc': + case 'aes256-ctr': + case 'aes256-gcm@openssh.com': + inf.keySize = 32; + inf.blockSize = 16; + inf.opensslName = 'aes-256-' + cipher.slice(7, 10); + break; + default: + throw (new Error( + 'Unsupported openssl cipher "' + cipher + '"')); + } + return (inf); +} + + +/***/ }), +/* 14 */ +/***/ (function(module, exports) { + +module.exports = require("stream"); + +/***/ }), +/* 15 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", { + value: true +}); +exports.stringify = exports.parse = undefined; + +var _asyncToGenerator2; + +function _load_asyncToGenerator() { + return _asyncToGenerator2 = _interopRequireDefault(__webpack_require__(0)); +} + +var _parse; + +function _load_parse() { + return _parse = __webpack_require__(77); +} + +Object.defineProperty(exports, 'parse', { + enumerable: true, + get: function () { + return _interopRequireDefault(_parse || _load_parse()).default; + } +}); + +var _stringify; + +function _load_stringify() { + return _stringify = __webpack_require__(78); +} + +Object.defineProperty(exports, 'stringify', { + enumerable: true, + get: function () { + return _interopRequireDefault(_stringify || _load_stringify()).default; + } +}); +exports.implodeEntry = implodeEntry; +exports.explodeEntry = explodeEntry; + +var _misc; + +function _load_misc() { + return _misc = __webpack_require__(10); +} + +var _packageRequest; + +function _load_packageRequest() { + return _packageRequest = _interopRequireDefault(__webpack_require__(30)); +} + +var _parse2; + +function _load_parse2() { + return _parse2 = _interopRequireDefault(__webpack_require__(77)); +} + +var _constants; + +function _load_constants() { + return _constants = _interopRequireWildcard(__webpack_require__(8)); +} + +var _fs; + +function _load_fs() { + return _fs = _interopRequireWildcard(__webpack_require__(4)); +} + +function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +const invariant = __webpack_require__(7); +const path = __webpack_require__(1); + +function getName(pattern) { + return (_packageRequest || _load_packageRequest()).default.normalizePattern(pattern).name; +} + +function blankObjectUndefined(obj) { + return obj && Object.keys(obj).length ? obj : undefined; +} + +function implodeEntry(pattern, obj) { + const inferredName = getName(pattern); + return { + name: inferredName === obj.name ? undefined : obj.name, + version: obj.version, + uid: obj.uid === obj.version ? undefined : obj.uid, + resolved: obj.resolved, + registry: obj.registry === 'npm' ? undefined : obj.registry, + dependencies: blankObjectUndefined(obj.dependencies), + optionalDependencies: blankObjectUndefined(obj.optionalDependencies), + permissions: blankObjectUndefined(obj.permissions) + }; +} + +function explodeEntry(pattern, obj) { + obj.optionalDependencies = obj.optionalDependencies || {}; + obj.dependencies = obj.dependencies || {}; + obj.uid = obj.uid || obj.version; + obj.permissions = obj.permissions || {}; + obj.registry = obj.registry || 'npm'; + obj.name = obj.name || getName(pattern); + return obj; +} + +class Lockfile { + constructor(cache, source) { + this.source = source || ''; + this.cache = cache; + } + + // source string if the `cache` was parsed + + + static fromDirectory(dir, reporter) { + return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { + // read the manifest in this directory + const lockfileLoc = path.join(dir, (_constants || _load_constants()).LOCKFILE_FILENAME); + let lockfile; + let rawLockfile = ''; + + if (yield (_fs || _load_fs()).exists(lockfileLoc)) { + rawLockfile = yield (_fs || _load_fs()).readFile(lockfileLoc); + lockfile = (0, (_parse2 || _load_parse2()).default)(rawLockfile, lockfileLoc); + } else { + if (reporter) { + reporter.info(reporter.lang('noLockfileFound')); + } + } + + return new Lockfile(lockfile, rawLockfile); + })(); + } + + getLocked(pattern) { + const cache = this.cache; + if (!cache) { + return undefined; + } + + const shrunk = pattern in cache && cache[pattern]; + + if (typeof shrunk === 'string') { + return this.getLocked(shrunk); + } else if (shrunk) { + explodeEntry(pattern, shrunk); + return shrunk; + } + + return undefined; + } + + removePattern(pattern) { + const cache = this.cache; + if (!cache) { + return; + } + delete cache[pattern]; + } + + getLockfile(patterns) { + const lockfile = {}; + const seen = new Map(); + + // order by name so that lockfile manifest is assigned to the first dependency with this manifest + // the others that have the same remote.resolved will just refer to the first + // ordering allows for consistency in lockfile when it is serialized + const sortedPatternsKeys = Object.keys(patterns).sort((_misc || _load_misc()).sortAlpha); + + for (const pattern of sortedPatternsKeys) { + const pkg = patterns[pattern]; + const remote = pkg._remote, + ref = pkg._reference; + + invariant(ref, 'Package is missing a reference'); + invariant(remote, 'Package is missing a remote'); + + const seenPattern = remote.resolved && seen.get(remote.resolved); + if (seenPattern) { + // no point in duplicating it + lockfile[pattern] = seenPattern; + + // if we're relying on our name being inferred and two of the patterns have + // different inferred names then we need to set it + if (!seenPattern.name && getName(pattern) !== pkg.name) { + seenPattern.name = pkg.name; + } + continue; + } + + const obj = implodeEntry(pattern, { + name: pkg.name, + version: pkg.version, + uid: pkg._uid, + resolved: remote.resolved, + registry: remote.registry, + dependencies: pkg.dependencies, + peerDependencies: pkg.peerDependencies, + optionalDependencies: pkg.optionalDependencies, + permissions: ref.permissions + }); + lockfile[pattern] = obj; + + if (remote.resolved) { + seen.set(remote.resolved, obj); + } + } + + return lockfile; + } +} +exports.default = Lockfile; + +/***/ }), +/* 16 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; + +var escapeStringRegexp = __webpack_require__(223); +var ansiStyles = __webpack_require__(300); +var stripAnsi = __webpack_require__(157); +var hasAnsi = __webpack_require__(473); +var supportsColor = __webpack_require__(382); +var defineProps = Object.defineProperties; +var isSimpleWindowsTerm = process.platform === 'win32' && !/^xterm/i.test(process.env.TERM); + +function Chalk(options) { + // detect mode if not set manually + this.enabled = !options || options.enabled === undefined ? supportsColor : options.enabled; +} + +// use bright blue on Windows as the normal blue color is illegible +if (isSimpleWindowsTerm) { + ansiStyles.blue.open = '\u001b[94m'; +} + +var styles = (function () { + var ret = {}; + + Object.keys(ansiStyles).forEach(function (key) { + ansiStyles[key].closeRe = new RegExp(escapeStringRegexp(ansiStyles[key].close), 'g'); + + ret[key] = { + get: function () { + return build.call(this, this._styles.concat(key)); + } + }; + }); + + return ret; +})(); + +var proto = defineProps(function chalk() {}, styles); + +function build(_styles) { + var builder = function () { + return applyStyle.apply(builder, arguments); + }; + + builder._styles = _styles; + builder.enabled = this.enabled; + // __proto__ is used because we must return a function, but there is + // no way to create a function with a different prototype. + /* eslint-disable no-proto */ + builder.__proto__ = proto; + + return builder; +} + +function applyStyle() { + // support varags, but simply cast to string in case there's only one arg + var args = arguments; + var argsLen = args.length; + var str = argsLen !== 0 && String(arguments[0]); + + if (argsLen > 1) { + // don't slice `arguments`, it prevents v8 optimizations + for (var a = 1; a < argsLen; a++) { + str += ' ' + args[a]; + } + } + + if (!this.enabled || !str) { + return str; + } + + var nestedStyles = this._styles; + var i = nestedStyles.length; + + // Turns out that on Windows dimmed gray text becomes invisible in cmd.exe, + // see https://github.com/chalk/chalk/issues/58 + // If we're on Windows and we're dealing with a gray color, temporarily make 'dim' a noop. + var originalDim = ansiStyles.dim.open; + if (isSimpleWindowsTerm && (nestedStyles.indexOf('gray') !== -1 || nestedStyles.indexOf('grey') !== -1)) { + ansiStyles.dim.open = ''; + } + + while (i--) { + var code = ansiStyles[nestedStyles[i]]; + + // Replace any instances already present with a re-opening code + // otherwise only the part of the string until said closing code + // will be colored, and the rest will simply be 'plain'. + str = code.open + str.replace(code.closeRe, code.open) + code.close; + } + + // Reset the original 'dim' if we changed it to work around the Windows dimmed gray issue. + ansiStyles.dim.open = originalDim; + + return str; +} + +function init() { + var ret = {}; + + Object.keys(styles).forEach(function (name) { + ret[name] = { + get: function () { + return build.call(this, [name]); + } + }; + }); + + return ret; +} + +defineProps(Chalk.prototype, init()); + +module.exports = new Chalk(); +module.exports.styles = ansiStyles; +module.exports.hasColor = hasAnsi; +module.exports.stripColor = stripAnsi; +module.exports.supportsColor = supportsColor; + + +/***/ }), +/* 17 */ +/***/ (function(module, exports) { + +// Copyright 2015 Joyent, Inc. + +var algInfo = { + 'dsa': { + parts: ['p', 'q', 'g', 'y'], + sizePart: 'p' + }, + 'rsa': { + parts: ['e', 'n'], + sizePart: 'n' + }, + 'ecdsa': { + parts: ['curve', 'Q'], + sizePart: 'Q' + }, + 'ed25519': { + parts: ['R'], + normalize: false, + sizePart: 'R' + } +}; +algInfo['curve25519'] = algInfo['ed25519']; + +var algPrivInfo = { + 'dsa': { + parts: ['p', 'q', 'g', 'y', 'x'] + }, + 'rsa': { + parts: ['n', 'e', 'd', 'iqmp', 'p', 'q'] + }, + 'ecdsa': { + parts: ['curve', 'Q', 'd'] + }, + 'ed25519': { + parts: ['R', 'r'], + normalize: false + } +}; +algPrivInfo['curve25519'] = algPrivInfo['ed25519']; + +var hashAlgs = { + 'md5': true, + 'sha1': true, + 'sha256': true, + 'sha384': true, + 'sha512': true +}; + +/* + * Taken from + * http://csrc.nist.gov/groups/ST/toolkit/documents/dss/NISTReCur.pdf + */ +var curves = { + 'nistp256': { + size: 256, + pkcs8oid: '1.2.840.10045.3.1.7', + p: new Buffer(('00' + + 'ffffffff 00000001 00000000 00000000' + + '00000000 ffffffff ffffffff ffffffff'). + replace(/ /g, ''), 'hex'), + a: new Buffer(('00' + + 'FFFFFFFF 00000001 00000000 00000000' + + '00000000 FFFFFFFF FFFFFFFF FFFFFFFC'). + replace(/ /g, ''), 'hex'), + b: new Buffer(( + '5ac635d8 aa3a93e7 b3ebbd55 769886bc' + + '651d06b0 cc53b0f6 3bce3c3e 27d2604b'). + replace(/ /g, ''), 'hex'), + s: new Buffer(('00' + + 'c49d3608 86e70493 6a6678e1 139d26b7' + + '819f7e90'). + replace(/ /g, ''), 'hex'), + n: new Buffer(('00' + + 'ffffffff 00000000 ffffffff ffffffff' + + 'bce6faad a7179e84 f3b9cac2 fc632551'). + replace(/ /g, ''), 'hex'), + G: new Buffer(('04' + + '6b17d1f2 e12c4247 f8bce6e5 63a440f2' + + '77037d81 2deb33a0 f4a13945 d898c296' + + '4fe342e2 fe1a7f9b 8ee7eb4a 7c0f9e16' + + '2bce3357 6b315ece cbb64068 37bf51f5'). + replace(/ /g, ''), 'hex') + }, + 'nistp384': { + size: 384, + pkcs8oid: '1.3.132.0.34', + p: new Buffer(('00' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff fffffffe' + + 'ffffffff 00000000 00000000 ffffffff'). + replace(/ /g, ''), 'hex'), + a: new Buffer(('00' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFE' + + 'FFFFFFFF 00000000 00000000 FFFFFFFC'). + replace(/ /g, ''), 'hex'), + b: new Buffer(( + 'b3312fa7 e23ee7e4 988e056b e3f82d19' + + '181d9c6e fe814112 0314088f 5013875a' + + 'c656398d 8a2ed19d 2a85c8ed d3ec2aef'). + replace(/ /g, ''), 'hex'), + s: new Buffer(('00' + + 'a335926a a319a27a 1d00896a 6773a482' + + '7acdac73'). + replace(/ /g, ''), 'hex'), + n: new Buffer(('00' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff c7634d81 f4372ddf' + + '581a0db2 48b0a77a ecec196a ccc52973'). + replace(/ /g, ''), 'hex'), + G: new Buffer(('04' + + 'aa87ca22 be8b0537 8eb1c71e f320ad74' + + '6e1d3b62 8ba79b98 59f741e0 82542a38' + + '5502f25d bf55296c 3a545e38 72760ab7' + + '3617de4a 96262c6f 5d9e98bf 9292dc29' + + 'f8f41dbd 289a147c e9da3113 b5f0b8c0' + + '0a60b1ce 1d7e819d 7a431d7c 90ea0e5f'). + replace(/ /g, ''), 'hex') + }, + 'nistp521': { + size: 521, + pkcs8oid: '1.3.132.0.35', + p: new Buffer(( + '01ffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffff').replace(/ /g, ''), 'hex'), + a: new Buffer(('01FF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFC'). + replace(/ /g, ''), 'hex'), + b: new Buffer(('51' + + '953eb961 8e1c9a1f 929a21a0 b68540ee' + + 'a2da725b 99b315f3 b8b48991 8ef109e1' + + '56193951 ec7e937b 1652c0bd 3bb1bf07' + + '3573df88 3d2c34f1 ef451fd4 6b503f00'). + replace(/ /g, ''), 'hex'), + s: new Buffer(('00' + + 'd09e8800 291cb853 96cc6717 393284aa' + + 'a0da64ba').replace(/ /g, ''), 'hex'), + n: new Buffer(('01ff' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff fffffffa' + + '51868783 bf2f966b 7fcc0148 f709a5d0' + + '3bb5c9b8 899c47ae bb6fb71e 91386409'). + replace(/ /g, ''), 'hex'), + G: new Buffer(('04' + + '00c6 858e06b7 0404e9cd 9e3ecb66 2395b442' + + '9c648139 053fb521 f828af60 6b4d3dba' + + 'a14b5e77 efe75928 fe1dc127 a2ffa8de' + + '3348b3c1 856a429b f97e7e31 c2e5bd66' + + '0118 39296a78 9a3bc004 5c8a5fb4 2c7d1bd9' + + '98f54449 579b4468 17afbd17 273e662c' + + '97ee7299 5ef42640 c550b901 3fad0761' + + '353c7086 a272c240 88be9476 9fd16650'). + replace(/ /g, ''), 'hex') + } +}; + +module.exports = { + info: algInfo, + privInfo: algPrivInfo, + hashAlgs: hashAlgs, + curves: curves +}; + + +/***/ }), +/* 18 */ +/***/ (function(module, exports, __webpack_require__) { + +// Copyright 2015 Joyent, Inc. + +module.exports = Key; + +var assert = __webpack_require__(9); +var algs = __webpack_require__(17); +var crypto = __webpack_require__(6); +var Fingerprint = __webpack_require__(70); +var Signature = __webpack_require__(33); +var DiffieHellman = __webpack_require__(571); +var errs = __webpack_require__(32); +var utils = __webpack_require__(13); +var PrivateKey = __webpack_require__(19); +var edCompat; + +try { + edCompat = __webpack_require__(248); +} catch (e) { + /* Just continue through, and bail out if we try to use it. */ +} + +var InvalidAlgorithmError = errs.InvalidAlgorithmError; +var KeyParseError = errs.KeyParseError; + +var formats = {}; +formats['auto'] = __webpack_require__(249); +formats['pem'] = __webpack_require__(40); +formats['pkcs1'] = __webpack_require__(155); +formats['pkcs8'] = __webpack_require__(71); +formats['rfc4253'] = __webpack_require__(47); +formats['ssh'] = __webpack_require__(250); +formats['ssh-private'] = __webpack_require__(100); +formats['openssh'] = formats['ssh-private']; + +function Key(opts) { + assert.object(opts, 'options'); + assert.arrayOfObject(opts.parts, 'options.parts'); + assert.string(opts.type, 'options.type'); + assert.optionalString(opts.comment, 'options.comment'); + + var algInfo = algs.info[opts.type]; + if (typeof (algInfo) !== 'object') + throw (new InvalidAlgorithmError(opts.type)); + + var partLookup = {}; + for (var i = 0; i < opts.parts.length; ++i) { + var part = opts.parts[i]; + partLookup[part.name] = part; + } + + this.type = opts.type; + this.parts = opts.parts; + this.part = partLookup; + this.comment = undefined; + this.source = opts.source; + + /* for speeding up hashing/fingerprint operations */ + this._rfc4253Cache = opts._rfc4253Cache; + this._hashCache = {}; + + var sz; + this.curve = undefined; + if (this.type === 'ecdsa') { + var curve = this.part.curve.data.toString(); + this.curve = curve; + sz = algs.curves[curve].size; + } else if (this.type === 'ed25519') { + sz = 256; + this.curve = 'curve25519'; + } else { + var szPart = this.part[algInfo.sizePart]; + sz = szPart.data.length; + sz = sz * 8 - utils.countZeros(szPart.data); + } + this.size = sz; +} + +Key.formats = formats; + +Key.prototype.toBuffer = function (format, options) { + if (format === undefined) + format = 'ssh'; + assert.string(format, 'format'); + assert.object(formats[format], 'formats[format]'); + assert.optionalObject(options, 'options'); + + if (format === 'rfc4253') { + if (this._rfc4253Cache === undefined) + this._rfc4253Cache = formats['rfc4253'].write(this); + return (this._rfc4253Cache); + } + + return (formats[format].write(this, options)); +}; + +Key.prototype.toString = function (format, options) { + return (this.toBuffer(format, options).toString()); +}; + +Key.prototype.hash = function (algo) { + assert.string(algo, 'algorithm'); + algo = algo.toLowerCase(); + if (algs.hashAlgs[algo] === undefined) + throw (new InvalidAlgorithmError(algo)); + + if (this._hashCache[algo]) + return (this._hashCache[algo]); + + var hash = crypto.createHash(algo). + update(this.toBuffer('rfc4253')).digest(); + this._hashCache[algo] = hash; + return (hash); +}; + +Key.prototype.fingerprint = function (algo) { + if (algo === undefined) + algo = 'sha256'; + assert.string(algo, 'algorithm'); + var opts = { + type: 'key', + hash: this.hash(algo), + algorithm: algo + }; + return (new Fingerprint(opts)); +}; + +Key.prototype.defaultHashAlgorithm = function () { + var hashAlgo = 'sha1'; + if (this.type === 'rsa') + hashAlgo = 'sha256'; + if (this.type === 'dsa' && this.size > 1024) + hashAlgo = 'sha256'; + if (this.type === 'ed25519') + hashAlgo = 'sha512'; + if (this.type === 'ecdsa') { + if (this.size <= 256) + hashAlgo = 'sha256'; + else if (this.size <= 384) + hashAlgo = 'sha384'; + else + hashAlgo = 'sha512'; + } + return (hashAlgo); +}; + +Key.prototype.createVerify = function (hashAlgo) { + if (hashAlgo === undefined) + hashAlgo = this.defaultHashAlgorithm(); + assert.string(hashAlgo, 'hash algorithm'); + + /* ED25519 is not supported by OpenSSL, use a javascript impl. */ + if (this.type === 'ed25519' && edCompat !== undefined) + return (new edCompat.Verifier(this, hashAlgo)); + if (this.type === 'curve25519') + throw (new Error('Curve25519 keys are not suitable for ' + + 'signing or verification')); + + var v, nm, err; + try { + nm = hashAlgo.toUpperCase(); + v = crypto.createVerify(nm); + } catch (e) { + err = e; + } + if (v === undefined || (err instanceof Error && + err.message.match(/Unknown message digest/))) { + nm = 'RSA-'; + nm += hashAlgo.toUpperCase(); + v = crypto.createVerify(nm); + } + assert.ok(v, 'failed to create verifier'); + var oldVerify = v.verify.bind(v); + var key = this.toBuffer('pkcs8'); + var self = this; + v.verify = function (signature, fmt) { + if (Signature.isSignature(signature, [2, 0])) { + if (signature.type !== self.type) + return (false); + if (signature.hashAlgorithm && + signature.hashAlgorithm !== hashAlgo) + return (false); + return (oldVerify(key, signature.toBuffer('asn1'))); + + } else if (typeof (signature) === 'string' || + Buffer.isBuffer(signature)) { + return (oldVerify(key, signature, fmt)); + + /* + * Avoid doing this on valid arguments, walking the prototype + * chain can be quite slow. + */ + } else if (Signature.isSignature(signature, [1, 0])) { + throw (new Error('signature was created by too old ' + + 'a version of sshpk and cannot be verified')); + + } else { + throw (new TypeError('signature must be a string, ' + + 'Buffer, or Signature object')); + } + }; + return (v); +}; + +Key.prototype.createDiffieHellman = function () { + if (this.type === 'rsa') + throw (new Error('RSA keys do not support Diffie-Hellman')); + + return (new DiffieHellman(this)); +}; +Key.prototype.createDH = Key.prototype.createDiffieHellman; + +Key.parse = function (data, format, options) { + if (typeof (data) !== 'string') + assert.buffer(data, 'data'); + if (format === undefined) + format = 'auto'; + assert.string(format, 'format'); + if (typeof (options) === 'string') + options = { filename: options }; + assert.optionalObject(options, 'options'); + if (options === undefined) + options = {}; + assert.optionalString(options.filename, 'options.filename'); + if (options.filename === undefined) + options.filename = '(unnamed)'; + + assert.object(formats[format], 'formats[format]'); + + try { + var k = formats[format].read(data, options); + if (k instanceof PrivateKey) + k = k.toPublic(); + if (!k.comment) + k.comment = options.filename; + return (k); + } catch (e) { + if (e.name === 'KeyEncryptedError') + throw (e); + throw (new KeyParseError(options.filename, format, e)); + } +}; + +Key.isKey = function (obj, ver) { + return (utils.isCompatible(obj, Key, ver)); +}; + +/* + * API versions for Key: + * [1,0] -- initial ver, may take Signature for createVerify or may not + * [1,1] -- added pkcs1, pkcs8 formats + * [1,2] -- added auto, ssh-private, openssh formats + * [1,3] -- added defaultHashAlgorithm + * [1,4] -- added ed support, createDH + * [1,5] -- first explicitly tagged version + */ +Key.prototype._sshpkApiVersion = [1, 5]; + +Key._oldVersionDetect = function (obj) { + assert.func(obj.toBuffer); + assert.func(obj.fingerprint); + if (obj.createDH) + return ([1, 4]); + if (obj.defaultHashAlgorithm) + return ([1, 3]); + if (obj.formats['auto']) + return ([1, 2]); + if (obj.formats['pkcs1']) + return ([1, 1]); + return ([1, 0]); +}; + + +/***/ }), +/* 19 */ +/***/ (function(module, exports, __webpack_require__) { + +// Copyright 2015 Joyent, Inc. + +module.exports = PrivateKey; + +var assert = __webpack_require__(9); +var algs = __webpack_require__(17); +var crypto = __webpack_require__(6); +var Fingerprint = __webpack_require__(70); +var Signature = __webpack_require__(33); +var errs = __webpack_require__(32); +var util = __webpack_require__(2); +var utils = __webpack_require__(13); +var edCompat; +var ed; + +try { + edCompat = __webpack_require__(248); +} catch (e) { + /* Just continue through, and bail out if we try to use it. */ +} + +var Key = __webpack_require__(18); + +var InvalidAlgorithmError = errs.InvalidAlgorithmError; +var KeyParseError = errs.KeyParseError; +var KeyEncryptedError = errs.KeyEncryptedError; + +var formats = {}; +formats['auto'] = __webpack_require__(249); +formats['pem'] = __webpack_require__(40); +formats['pkcs1'] = __webpack_require__(155); +formats['pkcs8'] = __webpack_require__(71); +formats['rfc4253'] = __webpack_require__(47); +formats['ssh-private'] = __webpack_require__(100); +formats['openssh'] = formats['ssh-private']; +formats['ssh'] = formats['ssh-private']; + +function PrivateKey(opts) { + assert.object(opts, 'options'); + Key.call(this, opts); + + this._pubCache = undefined; +} +util.inherits(PrivateKey, Key); + +PrivateKey.formats = formats; + +PrivateKey.prototype.toBuffer = function (format, options) { + if (format === undefined) + format = 'pkcs1'; + assert.string(format, 'format'); + assert.object(formats[format], 'formats[format]'); + assert.optionalObject(options, 'options'); + + return (formats[format].write(this, options)); +}; + +PrivateKey.prototype.hash = function (algo) { + return (this.toPublic().hash(algo)); +}; + +PrivateKey.prototype.toPublic = function () { + if (this._pubCache) + return (this._pubCache); + + var algInfo = algs.info[this.type]; + var pubParts = []; + for (var i = 0; i < algInfo.parts.length; ++i) { + var p = algInfo.parts[i]; + pubParts.push(this.part[p]); + } + + this._pubCache = new Key({ + type: this.type, + source: this, + parts: pubParts + }); + if (this.comment) + this._pubCache.comment = this.comment; + return (this._pubCache); +}; + +PrivateKey.prototype.derive = function (newType, newSize) { + assert.string(newType, 'type'); + assert.optionalNumber(newSize, 'size'); + var priv, pub; + + if (this.type === 'ed25519' && newType === 'curve25519') { + if (ed === undefined) + ed = __webpack_require__(146); + + priv = this.part.r.data; + if (priv[0] === 0x00) + priv = priv.slice(1); + priv = priv.slice(0, 32); + + pub = ed.dh.publicKey(priv); + priv = utils.mpNormalize(Buffer.concat([priv, pub])); + + return (new PrivateKey({ + type: 'curve25519', + parts: [ + { name: 'R', data: utils.mpNormalize(pub) }, + { name: 'r', data: priv } + ] + })); + } else if (this.type === 'curve25519' && newType === 'ed25519') { + if (ed === undefined) + ed = __webpack_require__(146); + + priv = this.part.r.data; + if (priv[0] === 0x00) + priv = priv.slice(1); + priv = priv.slice(0, 32); + + pub = ed.eddsa.publicKey(priv.toString('binary')); + pub = new Buffer(pub, 'binary'); + + priv = utils.mpNormalize(Buffer.concat([priv, pub])); + + return (new PrivateKey({ + type: 'ed25519', + parts: [ + { name: 'R', data: utils.mpNormalize(pub) }, + { name: 'r', data: priv } + ] + })); + } + throw (new Error('Key derivation not supported from ' + this.type + + ' to ' + newType)); +}; + +PrivateKey.prototype.createVerify = function (hashAlgo) { + return (this.toPublic().createVerify(hashAlgo)); +}; + +PrivateKey.prototype.createSign = function (hashAlgo) { + if (hashAlgo === undefined) + hashAlgo = this.defaultHashAlgorithm(); + assert.string(hashAlgo, 'hash algorithm'); + + /* ED25519 is not supported by OpenSSL, use a javascript impl. */ + if (this.type === 'ed25519' && edCompat !== undefined) + return (new edCompat.Signer(this, hashAlgo)); + if (this.type === 'curve25519') + throw (new Error('Curve25519 keys are not suitable for ' + + 'signing or verification')); + + var v, nm, err; + try { + nm = hashAlgo.toUpperCase(); + v = crypto.createSign(nm); + } catch (e) { + err = e; + } + if (v === undefined || (err instanceof Error && + err.message.match(/Unknown message digest/))) { + nm = 'RSA-'; + nm += hashAlgo.toUpperCase(); + v = crypto.createSign(nm); + } + assert.ok(v, 'failed to create verifier'); + var oldSign = v.sign.bind(v); + var key = this.toBuffer('pkcs1'); + var type = this.type; + v.sign = function () { + var sig = oldSign(key); + if (typeof (sig) === 'string') + sig = new Buffer(sig, 'binary'); + sig = Signature.parse(sig, type, 'asn1'); + sig.hashAlgorithm = hashAlgo; + return (sig); + }; + return (v); +}; + +PrivateKey.parse = function (data, format, options) { + if (typeof (data) !== 'string') + assert.buffer(data, 'data'); + if (format === undefined) + format = 'auto'; + assert.string(format, 'format'); + if (typeof (options) === 'string') + options = { filename: options }; + assert.optionalObject(options, 'options'); + if (options === undefined) + options = {}; + assert.optionalString(options.filename, 'options.filename'); + if (options.filename === undefined) + options.filename = '(unnamed)'; + + assert.object(formats[format], 'formats[format]'); + + try { + var k = formats[format].read(data, options); + assert.ok(k instanceof PrivateKey, 'key is not a private key'); + if (!k.comment) + k.comment = options.filename; + return (k); + } catch (e) { + if (e.name === 'KeyEncryptedError') + throw (e); + throw (new KeyParseError(options.filename, format, e)); + } +}; + +PrivateKey.isPrivateKey = function (obj, ver) { + return (utils.isCompatible(obj, PrivateKey, ver)); +}; + +/* + * API versions for PrivateKey: + * [1,0] -- initial ver + * [1,1] -- added auto, pkcs[18], openssh/ssh-private formats + * [1,2] -- added defaultHashAlgorithm + * [1,3] -- added derive, ed, createDH + * [1,4] -- first tagged version + */ +PrivateKey.prototype._sshpkApiVersion = [1, 4]; + +PrivateKey._oldVersionDetect = function (obj) { + assert.func(obj.toPublic); + assert.func(obj.createSign); + if (obj.derive) + return ([1, 3]); + if (obj.defaultHashAlgorithm) + return ([1, 2]); + if (obj.formats['auto']) + return ([1, 1]); + return ([1, 0]); +}; + + +/***/ }), +/* 20 */ +/***/ (function(module, exports) { + +module.exports = function(module) { + if(!module.webpackPolyfill) { + module.deprecate = function() {}; + module.paths = []; + // module.parent = undefined by default + if(!module.children) module.children = []; + Object.defineProperty(module, "loaded", { + enumerable: true, + get: function() { + return module.l; + } + }); + Object.defineProperty(module, "id", { + enumerable: true, + get: function() { + return module.i; + } + }); + module.webpackPolyfill = 1; + } + return module; +}; + + +/***/ }), +/* 21 */ +/***/ (function(module, exports, __webpack_require__) { + +/* WEBPACK VAR INJECTION */(function(module) {var __WEBPACK_AMD_DEFINE_RESULT__;/** + * @license + * Lodash + * Copyright JS Foundation and other contributors + * Released under MIT license + * Based on Underscore.js 1.8.3 + * Copyright Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors + */ +;(function() { + + /** Used as a safe reference for `undefined` in pre-ES5 environments. */ + var undefined; + + /** Used as the semantic version number. */ + var VERSION = '4.17.4'; + + /** Used as the size to enable large array optimizations. */ + var LARGE_ARRAY_SIZE = 200; + + /** Error message constants. */ + var CORE_ERROR_TEXT = 'Unsupported core-js use. Try https://npms.io/search?q=ponyfill.', + FUNC_ERROR_TEXT = 'Expected a function'; + + /** Used to stand-in for `undefined` hash values. */ + var HASH_UNDEFINED = '__lodash_hash_undefined__'; + + /** Used as the maximum memoize cache size. */ + var MAX_MEMOIZE_SIZE = 500; + + /** Used as the internal argument placeholder. */ + var PLACEHOLDER = '__lodash_placeholder__'; + + /** Used to compose bitmasks for cloning. */ + var CLONE_DEEP_FLAG = 1, + CLONE_FLAT_FLAG = 2, + CLONE_SYMBOLS_FLAG = 4; + + /** Used to compose bitmasks for value comparisons. */ + var COMPARE_PARTIAL_FLAG = 1, + COMPARE_UNORDERED_FLAG = 2; + + /** Used to compose bitmasks for function metadata. */ + var WRAP_BIND_FLAG = 1, + WRAP_BIND_KEY_FLAG = 2, + WRAP_CURRY_BOUND_FLAG = 4, + WRAP_CURRY_FLAG = 8, + WRAP_CURRY_RIGHT_FLAG = 16, + WRAP_PARTIAL_FLAG = 32, + WRAP_PARTIAL_RIGHT_FLAG = 64, + WRAP_ARY_FLAG = 128, + WRAP_REARG_FLAG = 256, + WRAP_FLIP_FLAG = 512; + + /** Used as default options for `_.truncate`. */ + var DEFAULT_TRUNC_LENGTH = 30, + DEFAULT_TRUNC_OMISSION = '...'; + + /** Used to detect hot functions by number of calls within a span of milliseconds. */ + var HOT_COUNT = 800, + HOT_SPAN = 16; + + /** Used to indicate the type of lazy iteratees. */ + var LAZY_FILTER_FLAG = 1, + LAZY_MAP_FLAG = 2, + LAZY_WHILE_FLAG = 3; + + /** Used as references for various `Number` constants. */ + var INFINITY = 1 / 0, + MAX_SAFE_INTEGER = 9007199254740991, + MAX_INTEGER = 1.7976931348623157e+308, + NAN = 0 / 0; + + /** Used as references for the maximum length and index of an array. */ + var MAX_ARRAY_LENGTH = 4294967295, + MAX_ARRAY_INDEX = MAX_ARRAY_LENGTH - 1, + HALF_MAX_ARRAY_LENGTH = MAX_ARRAY_LENGTH >>> 1; + + /** Used to associate wrap methods with their bit flags. */ + var wrapFlags = [ + ['ary', WRAP_ARY_FLAG], + ['bind', WRAP_BIND_FLAG], + ['bindKey', WRAP_BIND_KEY_FLAG], + ['curry', WRAP_CURRY_FLAG], + ['curryRight', WRAP_CURRY_RIGHT_FLAG], + ['flip', WRAP_FLIP_FLAG], + ['partial', WRAP_PARTIAL_FLAG], + ['partialRight', WRAP_PARTIAL_RIGHT_FLAG], + ['rearg', WRAP_REARG_FLAG] + ]; + + /** `Object#toString` result references. */ + var argsTag = '[object Arguments]', + arrayTag = '[object Array]', + asyncTag = '[object AsyncFunction]', + boolTag = '[object Boolean]', + dateTag = '[object Date]', + domExcTag = '[object DOMException]', + errorTag = '[object Error]', + funcTag = '[object Function]', + genTag = '[object GeneratorFunction]', + mapTag = '[object Map]', + numberTag = '[object Number]', + nullTag = '[object Null]', + objectTag = '[object Object]', + promiseTag = '[object Promise]', + proxyTag = '[object Proxy]', + regexpTag = '[object RegExp]', + setTag = '[object Set]', + stringTag = '[object String]', + symbolTag = '[object Symbol]', + undefinedTag = '[object Undefined]', + weakMapTag = '[object WeakMap]', + weakSetTag = '[object WeakSet]'; + + var arrayBufferTag = '[object ArrayBuffer]', + dataViewTag = '[object DataView]', + float32Tag = '[object Float32Array]', + float64Tag = '[object Float64Array]', + int8Tag = '[object Int8Array]', + int16Tag = '[object Int16Array]', + int32Tag = '[object Int32Array]', + uint8Tag = '[object Uint8Array]', + uint8ClampedTag = '[object Uint8ClampedArray]', + uint16Tag = '[object Uint16Array]', + uint32Tag = '[object Uint32Array]'; + + /** Used to match empty string literals in compiled template source. */ + var reEmptyStringLeading = /\b__p \+= '';/g, + reEmptyStringMiddle = /\b(__p \+=) '' \+/g, + reEmptyStringTrailing = /(__e\(.*?\)|\b__t\)) \+\n'';/g; + + /** Used to match HTML entities and HTML characters. */ + var reEscapedHtml = /&(?:amp|lt|gt|quot|#39);/g, + reUnescapedHtml = /[&<>"']/g, + reHasEscapedHtml = RegExp(reEscapedHtml.source), + reHasUnescapedHtml = RegExp(reUnescapedHtml.source); + + /** Used to match template delimiters. */ + var reEscape = /<%-([\s\S]+?)%>/g, + reEvaluate = /<%([\s\S]+?)%>/g, + reInterpolate = /<%=([\s\S]+?)%>/g; + + /** Used to match property names within property paths. */ + var reIsDeepProp = /\.|\[(?:[^[\]]*|(["'])(?:(?!\1)[^\\]|\\.)*?\1)\]/, + reIsPlainProp = /^\w*$/, + reLeadingDot = /^\./, + rePropName = /[^.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|$))/g; + + /** + * Used to match `RegExp` + * [syntax characters](http://ecma-international.org/ecma-262/7.0/#sec-patterns). + */ + var reRegExpChar = /[\\^$.*+?()[\]{}|]/g, + reHasRegExpChar = RegExp(reRegExpChar.source); + + /** Used to match leading and trailing whitespace. */ + var reTrim = /^\s+|\s+$/g, + reTrimStart = /^\s+/, + reTrimEnd = /\s+$/; + + /** Used to match wrap detail comments. */ + var reWrapComment = /\{(?:\n\/\* \[wrapped with .+\] \*\/)?\n?/, + reWrapDetails = /\{\n\/\* \[wrapped with (.+)\] \*/, + reSplitDetails = /,? & /; + + /** Used to match words composed of alphanumeric characters. */ + var reAsciiWord = /[^\x00-\x2f\x3a-\x40\x5b-\x60\x7b-\x7f]+/g; + + /** Used to match backslashes in property paths. */ + var reEscapeChar = /\\(\\)?/g; + + /** + * Used to match + * [ES template delimiters](http://ecma-international.org/ecma-262/7.0/#sec-template-literal-lexical-components). + */ + var reEsTemplate = /\$\{([^\\}]*(?:\\.[^\\}]*)*)\}/g; + + /** Used to match `RegExp` flags from their coerced string values. */ + var reFlags = /\w*$/; + + /** Used to detect bad signed hexadecimal string values. */ + var reIsBadHex = /^[-+]0x[0-9a-f]+$/i; + + /** Used to detect binary string values. */ + var reIsBinary = /^0b[01]+$/i; + + /** Used to detect host constructors (Safari). */ + var reIsHostCtor = /^\[object .+?Constructor\]$/; + + /** Used to detect octal string values. */ + var reIsOctal = /^0o[0-7]+$/i; + + /** Used to detect unsigned integer values. */ + var reIsUint = /^(?:0|[1-9]\d*)$/; + + /** Used to match Latin Unicode letters (excluding mathematical operators). */ + var reLatin = /[\xc0-\xd6\xd8-\xf6\xf8-\xff\u0100-\u017f]/g; + + /** Used to ensure capturing order of template delimiters. */ + var reNoMatch = /($^)/; + + /** Used to match unescaped characters in compiled string literals. */ + var reUnescapedString = /['\n\r\u2028\u2029\\]/g; + + /** Used to compose unicode character classes. */ + var rsAstralRange = '\\ud800-\\udfff', + rsComboMarksRange = '\\u0300-\\u036f', + reComboHalfMarksRange = '\\ufe20-\\ufe2f', + rsComboSymbolsRange = '\\u20d0-\\u20ff', + rsComboRange = rsComboMarksRange + reComboHalfMarksRange + rsComboSymbolsRange, + rsDingbatRange = '\\u2700-\\u27bf', + rsLowerRange = 'a-z\\xdf-\\xf6\\xf8-\\xff', + rsMathOpRange = '\\xac\\xb1\\xd7\\xf7', + rsNonCharRange = '\\x00-\\x2f\\x3a-\\x40\\x5b-\\x60\\x7b-\\xbf', + rsPunctuationRange = '\\u2000-\\u206f', + rsSpaceRange = ' \\t\\x0b\\f\\xa0\\ufeff\\n\\r\\u2028\\u2029\\u1680\\u180e\\u2000\\u2001\\u2002\\u2003\\u2004\\u2005\\u2006\\u2007\\u2008\\u2009\\u200a\\u202f\\u205f\\u3000', + rsUpperRange = 'A-Z\\xc0-\\xd6\\xd8-\\xde', + rsVarRange = '\\ufe0e\\ufe0f', + rsBreakRange = rsMathOpRange + rsNonCharRange + rsPunctuationRange + rsSpaceRange; + + /** Used to compose unicode capture groups. */ + var rsApos = "['\u2019]", + rsAstral = '[' + rsAstralRange + ']', + rsBreak = '[' + rsBreakRange + ']', + rsCombo = '[' + rsComboRange + ']', + rsDigits = '\\d+', + rsDingbat = '[' + rsDingbatRange + ']', + rsLower = '[' + rsLowerRange + ']', + rsMisc = '[^' + rsAstralRange + rsBreakRange + rsDigits + rsDingbatRange + rsLowerRange + rsUpperRange + ']', + rsFitz = '\\ud83c[\\udffb-\\udfff]', + rsModifier = '(?:' + rsCombo + '|' + rsFitz + ')', + rsNonAstral = '[^' + rsAstralRange + ']', + rsRegional = '(?:\\ud83c[\\udde6-\\uddff]){2}', + rsSurrPair = '[\\ud800-\\udbff][\\udc00-\\udfff]', + rsUpper = '[' + rsUpperRange + ']', + rsZWJ = '\\u200d'; + + /** Used to compose unicode regexes. */ + var rsMiscLower = '(?:' + rsLower + '|' + rsMisc + ')', + rsMiscUpper = '(?:' + rsUpper + '|' + rsMisc + ')', + rsOptContrLower = '(?:' + rsApos + '(?:d|ll|m|re|s|t|ve))?', + rsOptContrUpper = '(?:' + rsApos + '(?:D|LL|M|RE|S|T|VE))?', + reOptMod = rsModifier + '?', + rsOptVar = '[' + rsVarRange + ']?', + rsOptJoin = '(?:' + rsZWJ + '(?:' + [rsNonAstral, rsRegional, rsSurrPair].join('|') + ')' + rsOptVar + reOptMod + ')*', + rsOrdLower = '\\d*(?:(?:1st|2nd|3rd|(?![123])\\dth)\\b)', + rsOrdUpper = '\\d*(?:(?:1ST|2ND|3RD|(?![123])\\dTH)\\b)', + rsSeq = rsOptVar + reOptMod + rsOptJoin, + rsEmoji = '(?:' + [rsDingbat, rsRegional, rsSurrPair].join('|') + ')' + rsSeq, + rsSymbol = '(?:' + [rsNonAstral + rsCombo + '?', rsCombo, rsRegional, rsSurrPair, rsAstral].join('|') + ')'; + + /** Used to match apostrophes. */ + var reApos = RegExp(rsApos, 'g'); + + /** + * Used to match [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks) and + * [combining diacritical marks for symbols](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks_for_Symbols). + */ + var reComboMark = RegExp(rsCombo, 'g'); + + /** Used to match [string symbols](https://mathiasbynens.be/notes/javascript-unicode). */ + var reUnicode = RegExp(rsFitz + '(?=' + rsFitz + ')|' + rsSymbol + rsSeq, 'g'); + + /** Used to match complex or compound words. */ + var reUnicodeWord = RegExp([ + rsUpper + '?' + rsLower + '+' + rsOptContrLower + '(?=' + [rsBreak, rsUpper, '$'].join('|') + ')', + rsMiscUpper + '+' + rsOptContrUpper + '(?=' + [rsBreak, rsUpper + rsMiscLower, '$'].join('|') + ')', + rsUpper + '?' + rsMiscLower + '+' + rsOptContrLower, + rsUpper + '+' + rsOptContrUpper, + rsOrdUpper, + rsOrdLower, + rsDigits, + rsEmoji + ].join('|'), 'g'); + + /** Used to detect strings with [zero-width joiners or code points from the astral planes](http://eev.ee/blog/2015/09/12/dark-corners-of-unicode/). */ + var reHasUnicode = RegExp('[' + rsZWJ + rsAstralRange + rsComboRange + rsVarRange + ']'); + + /** Used to detect strings that need a more robust regexp to match words. */ + var reHasUnicodeWord = /[a-z][A-Z]|[A-Z]{2,}[a-z]|[0-9][a-zA-Z]|[a-zA-Z][0-9]|[^a-zA-Z0-9 ]/; + + /** Used to assign default `context` object properties. */ + var contextProps = [ + 'Array', 'Buffer', 'DataView', 'Date', 'Error', 'Float32Array', 'Float64Array', + 'Function', 'Int8Array', 'Int16Array', 'Int32Array', 'Map', 'Math', 'Object', + 'Promise', 'RegExp', 'Set', 'String', 'Symbol', 'TypeError', 'Uint8Array', + 'Uint8ClampedArray', 'Uint16Array', 'Uint32Array', 'WeakMap', + '_', 'clearTimeout', 'isFinite', 'parseInt', 'setTimeout' + ]; + + /** Used to make template sourceURLs easier to identify. */ + var templateCounter = -1; + + /** Used to identify `toStringTag` values of typed arrays. */ + var typedArrayTags = {}; + typedArrayTags[float32Tag] = typedArrayTags[float64Tag] = + typedArrayTags[int8Tag] = typedArrayTags[int16Tag] = + typedArrayTags[int32Tag] = typedArrayTags[uint8Tag] = + typedArrayTags[uint8ClampedTag] = typedArrayTags[uint16Tag] = + typedArrayTags[uint32Tag] = true; + typedArrayTags[argsTag] = typedArrayTags[arrayTag] = + typedArrayTags[arrayBufferTag] = typedArrayTags[boolTag] = + typedArrayTags[dataViewTag] = typedArrayTags[dateTag] = + typedArrayTags[errorTag] = typedArrayTags[funcTag] = + typedArrayTags[mapTag] = typedArrayTags[numberTag] = + typedArrayTags[objectTag] = typedArrayTags[regexpTag] = + typedArrayTags[setTag] = typedArrayTags[stringTag] = + typedArrayTags[weakMapTag] = false; + + /** Used to identify `toStringTag` values supported by `_.clone`. */ + var cloneableTags = {}; + cloneableTags[argsTag] = cloneableTags[arrayTag] = + cloneableTags[arrayBufferTag] = cloneableTags[dataViewTag] = + cloneableTags[boolTag] = cloneableTags[dateTag] = + cloneableTags[float32Tag] = cloneableTags[float64Tag] = + cloneableTags[int8Tag] = cloneableTags[int16Tag] = + cloneableTags[int32Tag] = cloneableTags[mapTag] = + cloneableTags[numberTag] = cloneableTags[objectTag] = + cloneableTags[regexpTag] = cloneableTags[setTag] = + cloneableTags[stringTag] = cloneableTags[symbolTag] = + cloneableTags[uint8Tag] = cloneableTags[uint8ClampedTag] = + cloneableTags[uint16Tag] = cloneableTags[uint32Tag] = true; + cloneableTags[errorTag] = cloneableTags[funcTag] = + cloneableTags[weakMapTag] = false; + + /** Used to map Latin Unicode letters to basic Latin letters. */ + var deburredLetters = { + // Latin-1 Supplement block. + '\xc0': 'A', '\xc1': 'A', '\xc2': 'A', '\xc3': 'A', '\xc4': 'A', '\xc5': 'A', + '\xe0': 'a', '\xe1': 'a', '\xe2': 'a', '\xe3': 'a', '\xe4': 'a', '\xe5': 'a', + '\xc7': 'C', '\xe7': 'c', + '\xd0': 'D', '\xf0': 'd', + '\xc8': 'E', '\xc9': 'E', '\xca': 'E', '\xcb': 'E', + '\xe8': 'e', '\xe9': 'e', '\xea': 'e', '\xeb': 'e', + '\xcc': 'I', '\xcd': 'I', '\xce': 'I', '\xcf': 'I', + '\xec': 'i', '\xed': 'i', '\xee': 'i', '\xef': 'i', + '\xd1': 'N', '\xf1': 'n', + '\xd2': 'O', '\xd3': 'O', '\xd4': 'O', '\xd5': 'O', '\xd6': 'O', '\xd8': 'O', + '\xf2': 'o', '\xf3': 'o', '\xf4': 'o', '\xf5': 'o', '\xf6': 'o', '\xf8': 'o', + '\xd9': 'U', '\xda': 'U', '\xdb': 'U', '\xdc': 'U', + '\xf9': 'u', '\xfa': 'u', '\xfb': 'u', '\xfc': 'u', + '\xdd': 'Y', '\xfd': 'y', '\xff': 'y', + '\xc6': 'Ae', '\xe6': 'ae', + '\xde': 'Th', '\xfe': 'th', + '\xdf': 'ss', + // Latin Extended-A block. + '\u0100': 'A', '\u0102': 'A', '\u0104': 'A', + '\u0101': 'a', '\u0103': 'a', '\u0105': 'a', + '\u0106': 'C', '\u0108': 'C', '\u010a': 'C', '\u010c': 'C', + '\u0107': 'c', '\u0109': 'c', '\u010b': 'c', '\u010d': 'c', + '\u010e': 'D', '\u0110': 'D', '\u010f': 'd', '\u0111': 'd', + '\u0112': 'E', '\u0114': 'E', '\u0116': 'E', '\u0118': 'E', '\u011a': 'E', + '\u0113': 'e', '\u0115': 'e', '\u0117': 'e', '\u0119': 'e', '\u011b': 'e', + '\u011c': 'G', '\u011e': 'G', '\u0120': 'G', '\u0122': 'G', + '\u011d': 'g', '\u011f': 'g', '\u0121': 'g', '\u0123': 'g', + '\u0124': 'H', '\u0126': 'H', '\u0125': 'h', '\u0127': 'h', + '\u0128': 'I', '\u012a': 'I', '\u012c': 'I', '\u012e': 'I', '\u0130': 'I', + '\u0129': 'i', '\u012b': 'i', '\u012d': 'i', '\u012f': 'i', '\u0131': 'i', + '\u0134': 'J', '\u0135': 'j', + '\u0136': 'K', '\u0137': 'k', '\u0138': 'k', + '\u0139': 'L', '\u013b': 'L', '\u013d': 'L', '\u013f': 'L', '\u0141': 'L', + '\u013a': 'l', '\u013c': 'l', '\u013e': 'l', '\u0140': 'l', '\u0142': 'l', + '\u0143': 'N', '\u0145': 'N', '\u0147': 'N', '\u014a': 'N', + '\u0144': 'n', '\u0146': 'n', '\u0148': 'n', '\u014b': 'n', + '\u014c': 'O', '\u014e': 'O', '\u0150': 'O', + '\u014d': 'o', '\u014f': 'o', '\u0151': 'o', + '\u0154': 'R', '\u0156': 'R', '\u0158': 'R', + '\u0155': 'r', '\u0157': 'r', '\u0159': 'r', + '\u015a': 'S', '\u015c': 'S', '\u015e': 'S', '\u0160': 'S', + '\u015b': 's', '\u015d': 's', '\u015f': 's', '\u0161': 's', + '\u0162': 'T', '\u0164': 'T', '\u0166': 'T', + '\u0163': 't', '\u0165': 't', '\u0167': 't', + '\u0168': 'U', '\u016a': 'U', '\u016c': 'U', '\u016e': 'U', '\u0170': 'U', '\u0172': 'U', + '\u0169': 'u', '\u016b': 'u', '\u016d': 'u', '\u016f': 'u', '\u0171': 'u', '\u0173': 'u', + '\u0174': 'W', '\u0175': 'w', + '\u0176': 'Y', '\u0177': 'y', '\u0178': 'Y', + '\u0179': 'Z', '\u017b': 'Z', '\u017d': 'Z', + '\u017a': 'z', '\u017c': 'z', '\u017e': 'z', + '\u0132': 'IJ', '\u0133': 'ij', + '\u0152': 'Oe', '\u0153': 'oe', + '\u0149': "'n", '\u017f': 's' + }; + + /** Used to map characters to HTML entities. */ + var htmlEscapes = { + '&': '&', + '<': '<', + '>': '>', + '"': '"', + "'": ''' + }; + + /** Used to map HTML entities to characters. */ + var htmlUnescapes = { + '&': '&', + '<': '<', + '>': '>', + '"': '"', + ''': "'" + }; + + /** Used to escape characters for inclusion in compiled string literals. */ + var stringEscapes = { + '\\': '\\', + "'": "'", + '\n': 'n', + '\r': 'r', + '\u2028': 'u2028', + '\u2029': 'u2029' + }; + + /** Built-in method references without a dependency on `root`. */ + var freeParseFloat = parseFloat, + freeParseInt = parseInt; + + /** Detect free variable `global` from Node.js. */ + var freeGlobal = typeof global == 'object' && global && global.Object === Object && global; + + /** Detect free variable `self`. */ + var freeSelf = typeof self == 'object' && self && self.Object === Object && self; + + /** Used as a reference to the global object. */ + var root = freeGlobal || freeSelf || Function('return this')(); + + /** Detect free variable `exports`. */ + var freeExports = typeof exports == 'object' && exports && !exports.nodeType && exports; + + /** Detect free variable `module`. */ + var freeModule = freeExports && typeof module == 'object' && module && !module.nodeType && module; + + /** Detect the popular CommonJS extension `module.exports`. */ + var moduleExports = freeModule && freeModule.exports === freeExports; + + /** Detect free variable `process` from Node.js. */ + var freeProcess = moduleExports && freeGlobal.process; + + /** Used to access faster Node.js helpers. */ + var nodeUtil = (function() { + try { + return freeProcess && freeProcess.binding && freeProcess.binding('util'); + } catch (e) {} + }()); + + /* Node.js helper references. */ + var nodeIsArrayBuffer = nodeUtil && nodeUtil.isArrayBuffer, + nodeIsDate = nodeUtil && nodeUtil.isDate, + nodeIsMap = nodeUtil && nodeUtil.isMap, + nodeIsRegExp = nodeUtil && nodeUtil.isRegExp, + nodeIsSet = nodeUtil && nodeUtil.isSet, + nodeIsTypedArray = nodeUtil && nodeUtil.isTypedArray; + + /*--------------------------------------------------------------------------*/ + + /** + * Adds the key-value `pair` to `map`. + * + * @private + * @param {Object} map The map to modify. + * @param {Array} pair The key-value pair to add. + * @returns {Object} Returns `map`. + */ + function addMapEntry(map, pair) { + // Don't return `map.set` because it's not chainable in IE 11. + map.set(pair[0], pair[1]); + return map; + } + + /** + * Adds `value` to `set`. + * + * @private + * @param {Object} set The set to modify. + * @param {*} value The value to add. + * @returns {Object} Returns `set`. + */ + function addSetEntry(set, value) { + // Don't return `set.add` because it's not chainable in IE 11. + set.add(value); + return set; + } + + /** + * A faster alternative to `Function#apply`, this function invokes `func` + * with the `this` binding of `thisArg` and the arguments of `args`. + * + * @private + * @param {Function} func The function to invoke. + * @param {*} thisArg The `this` binding of `func`. + * @param {Array} args The arguments to invoke `func` with. + * @returns {*} Returns the result of `func`. + */ + function apply(func, thisArg, args) { + switch (args.length) { + case 0: return func.call(thisArg); + case 1: return func.call(thisArg, args[0]); + case 2: return func.call(thisArg, args[0], args[1]); + case 3: return func.call(thisArg, args[0], args[1], args[2]); + } + return func.apply(thisArg, args); + } + + /** + * A specialized version of `baseAggregator` for arrays. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} setter The function to set `accumulator` values. + * @param {Function} iteratee The iteratee to transform keys. + * @param {Object} accumulator The initial aggregated object. + * @returns {Function} Returns `accumulator`. + */ + function arrayAggregator(array, setter, iteratee, accumulator) { + var index = -1, + length = array == null ? 0 : array.length; + + while (++index < length) { + var value = array[index]; + setter(accumulator, value, iteratee(value), array); + } + return accumulator; + } + + /** + * A specialized version of `_.forEach` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array} Returns `array`. + */ + function arrayEach(array, iteratee) { + var index = -1, + length = array == null ? 0 : array.length; + + while (++index < length) { + if (iteratee(array[index], index, array) === false) { + break; + } + } + return array; + } + + /** + * A specialized version of `_.forEachRight` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array} Returns `array`. + */ + function arrayEachRight(array, iteratee) { + var length = array == null ? 0 : array.length; + + while (length--) { + if (iteratee(array[length], length, array) === false) { + break; + } + } + return array; + } + + /** + * A specialized version of `_.every` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {boolean} Returns `true` if all elements pass the predicate check, + * else `false`. + */ + function arrayEvery(array, predicate) { + var index = -1, + length = array == null ? 0 : array.length; + + while (++index < length) { + if (!predicate(array[index], index, array)) { + return false; + } + } + return true; + } + + /** + * A specialized version of `_.filter` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {Array} Returns the new filtered array. + */ + function arrayFilter(array, predicate) { + var index = -1, + length = array == null ? 0 : array.length, + resIndex = 0, + result = []; + + while (++index < length) { + var value = array[index]; + if (predicate(value, index, array)) { + result[resIndex++] = value; + } + } + return result; + } + + /** + * A specialized version of `_.includes` for arrays without support for + * specifying an index to search from. + * + * @private + * @param {Array} [array] The array to inspect. + * @param {*} target The value to search for. + * @returns {boolean} Returns `true` if `target` is found, else `false`. + */ + function arrayIncludes(array, value) { + var length = array == null ? 0 : array.length; + return !!length && baseIndexOf(array, value, 0) > -1; + } + + /** + * This function is like `arrayIncludes` except that it accepts a comparator. + * + * @private + * @param {Array} [array] The array to inspect. + * @param {*} target The value to search for. + * @param {Function} comparator The comparator invoked per element. + * @returns {boolean} Returns `true` if `target` is found, else `false`. + */ + function arrayIncludesWith(array, value, comparator) { + var index = -1, + length = array == null ? 0 : array.length; + + while (++index < length) { + if (comparator(value, array[index])) { + return true; + } + } + return false; + } + + /** + * A specialized version of `_.map` for arrays without support for iteratee + * shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array} Returns the new mapped array. + */ + function arrayMap(array, iteratee) { + var index = -1, + length = array == null ? 0 : array.length, + result = Array(length); + + while (++index < length) { + result[index] = iteratee(array[index], index, array); + } + return result; + } + + /** + * Appends the elements of `values` to `array`. + * + * @private + * @param {Array} array The array to modify. + * @param {Array} values The values to append. + * @returns {Array} Returns `array`. + */ + function arrayPush(array, values) { + var index = -1, + length = values.length, + offset = array.length; + + while (++index < length) { + array[offset + index] = values[index]; + } + return array; + } + + /** + * A specialized version of `_.reduce` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @param {*} [accumulator] The initial value. + * @param {boolean} [initAccum] Specify using the first element of `array` as + * the initial value. + * @returns {*} Returns the accumulated value. + */ + function arrayReduce(array, iteratee, accumulator, initAccum) { + var index = -1, + length = array == null ? 0 : array.length; + + if (initAccum && length) { + accumulator = array[++index]; + } + while (++index < length) { + accumulator = iteratee(accumulator, array[index], index, array); + } + return accumulator; + } + + /** + * A specialized version of `_.reduceRight` for arrays without support for + * iteratee shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @param {*} [accumulator] The initial value. + * @param {boolean} [initAccum] Specify using the last element of `array` as + * the initial value. + * @returns {*} Returns the accumulated value. + */ + function arrayReduceRight(array, iteratee, accumulator, initAccum) { + var length = array == null ? 0 : array.length; + if (initAccum && length) { + accumulator = array[--length]; + } + while (length--) { + accumulator = iteratee(accumulator, array[length], length, array); + } + return accumulator; + } + + /** + * A specialized version of `_.some` for arrays without support for iteratee + * shorthands. + * + * @private + * @param {Array} [array] The array to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {boolean} Returns `true` if any element passes the predicate check, + * else `false`. + */ + function arraySome(array, predicate) { + var index = -1, + length = array == null ? 0 : array.length; + + while (++index < length) { + if (predicate(array[index], index, array)) { + return true; + } + } + return false; + } + + /** + * Gets the size of an ASCII `string`. + * + * @private + * @param {string} string The string inspect. + * @returns {number} Returns the string size. + */ + var asciiSize = baseProperty('length'); + + /** + * Converts an ASCII `string` to an array. + * + * @private + * @param {string} string The string to convert. + * @returns {Array} Returns the converted array. + */ + function asciiToArray(string) { + return string.split(''); + } + + /** + * Splits an ASCII `string` into an array of its words. + * + * @private + * @param {string} The string to inspect. + * @returns {Array} Returns the words of `string`. + */ + function asciiWords(string) { + return string.match(reAsciiWord) || []; + } + + /** + * The base implementation of methods like `_.findKey` and `_.findLastKey`, + * without support for iteratee shorthands, which iterates over `collection` + * using `eachFunc`. + * + * @private + * @param {Array|Object} collection The collection to inspect. + * @param {Function} predicate The function invoked per iteration. + * @param {Function} eachFunc The function to iterate over `collection`. + * @returns {*} Returns the found element or its key, else `undefined`. + */ + function baseFindKey(collection, predicate, eachFunc) { + var result; + eachFunc(collection, function(value, key, collection) { + if (predicate(value, key, collection)) { + result = key; + return false; + } + }); + return result; + } + + /** + * The base implementation of `_.findIndex` and `_.findLastIndex` without + * support for iteratee shorthands. + * + * @private + * @param {Array} array The array to inspect. + * @param {Function} predicate The function invoked per iteration. + * @param {number} fromIndex The index to search from. + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {number} Returns the index of the matched value, else `-1`. + */ + function baseFindIndex(array, predicate, fromIndex, fromRight) { + var length = array.length, + index = fromIndex + (fromRight ? 1 : -1); + + while ((fromRight ? index-- : ++index < length)) { + if (predicate(array[index], index, array)) { + return index; + } + } + return -1; + } + + /** + * The base implementation of `_.indexOf` without `fromIndex` bounds checks. + * + * @private + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @param {number} fromIndex The index to search from. + * @returns {number} Returns the index of the matched value, else `-1`. + */ + function baseIndexOf(array, value, fromIndex) { + return value === value + ? strictIndexOf(array, value, fromIndex) + : baseFindIndex(array, baseIsNaN, fromIndex); + } + + /** + * This function is like `baseIndexOf` except that it accepts a comparator. + * + * @private + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @param {number} fromIndex The index to search from. + * @param {Function} comparator The comparator invoked per element. + * @returns {number} Returns the index of the matched value, else `-1`. + */ + function baseIndexOfWith(array, value, fromIndex, comparator) { + var index = fromIndex - 1, + length = array.length; + + while (++index < length) { + if (comparator(array[index], value)) { + return index; + } + } + return -1; + } + + /** + * The base implementation of `_.isNaN` without support for number objects. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`. + */ + function baseIsNaN(value) { + return value !== value; + } + + /** + * The base implementation of `_.mean` and `_.meanBy` without support for + * iteratee shorthands. + * + * @private + * @param {Array} array The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {number} Returns the mean. + */ + function baseMean(array, iteratee) { + var length = array == null ? 0 : array.length; + return length ? (baseSum(array, iteratee) / length) : NAN; + } + + /** + * The base implementation of `_.property` without support for deep paths. + * + * @private + * @param {string} key The key of the property to get. + * @returns {Function} Returns the new accessor function. + */ + function baseProperty(key) { + return function(object) { + return object == null ? undefined : object[key]; + }; + } + + /** + * The base implementation of `_.propertyOf` without support for deep paths. + * + * @private + * @param {Object} object The object to query. + * @returns {Function} Returns the new accessor function. + */ + function basePropertyOf(object) { + return function(key) { + return object == null ? undefined : object[key]; + }; + } + + /** + * The base implementation of `_.reduce` and `_.reduceRight`, without support + * for iteratee shorthands, which iterates over `collection` using `eachFunc`. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @param {*} accumulator The initial value. + * @param {boolean} initAccum Specify using the first or last element of + * `collection` as the initial value. + * @param {Function} eachFunc The function to iterate over `collection`. + * @returns {*} Returns the accumulated value. + */ + function baseReduce(collection, iteratee, accumulator, initAccum, eachFunc) { + eachFunc(collection, function(value, index, collection) { + accumulator = initAccum + ? (initAccum = false, value) + : iteratee(accumulator, value, index, collection); + }); + return accumulator; + } + + /** + * The base implementation of `_.sortBy` which uses `comparer` to define the + * sort order of `array` and replaces criteria objects with their corresponding + * values. + * + * @private + * @param {Array} array The array to sort. + * @param {Function} comparer The function to define sort order. + * @returns {Array} Returns `array`. + */ + function baseSortBy(array, comparer) { + var length = array.length; + + array.sort(comparer); + while (length--) { + array[length] = array[length].value; + } + return array; + } + + /** + * The base implementation of `_.sum` and `_.sumBy` without support for + * iteratee shorthands. + * + * @private + * @param {Array} array The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {number} Returns the sum. + */ + function baseSum(array, iteratee) { + var result, + index = -1, + length = array.length; + + while (++index < length) { + var current = iteratee(array[index]); + if (current !== undefined) { + result = result === undefined ? current : (result + current); + } + } + return result; + } + + /** + * The base implementation of `_.times` without support for iteratee shorthands + * or max array length checks. + * + * @private + * @param {number} n The number of times to invoke `iteratee`. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array} Returns the array of results. + */ + function baseTimes(n, iteratee) { + var index = -1, + result = Array(n); + + while (++index < n) { + result[index] = iteratee(index); + } + return result; + } + + /** + * The base implementation of `_.toPairs` and `_.toPairsIn` which creates an array + * of key-value pairs for `object` corresponding to the property names of `props`. + * + * @private + * @param {Object} object The object to query. + * @param {Array} props The property names to get values for. + * @returns {Object} Returns the key-value pairs. + */ + function baseToPairs(object, props) { + return arrayMap(props, function(key) { + return [key, object[key]]; + }); + } + + /** + * The base implementation of `_.unary` without support for storing metadata. + * + * @private + * @param {Function} func The function to cap arguments for. + * @returns {Function} Returns the new capped function. + */ + function baseUnary(func) { + return function(value) { + return func(value); + }; + } + + /** + * The base implementation of `_.values` and `_.valuesIn` which creates an + * array of `object` property values corresponding to the property names + * of `props`. + * + * @private + * @param {Object} object The object to query. + * @param {Array} props The property names to get values for. + * @returns {Object} Returns the array of property values. + */ + function baseValues(object, props) { + return arrayMap(props, function(key) { + return object[key]; + }); + } + + /** + * Checks if a `cache` value for `key` exists. + * + * @private + * @param {Object} cache The cache to query. + * @param {string} key The key of the entry to check. + * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. + */ + function cacheHas(cache, key) { + return cache.has(key); + } + + /** + * Used by `_.trim` and `_.trimStart` to get the index of the first string symbol + * that is not found in the character symbols. + * + * @private + * @param {Array} strSymbols The string symbols to inspect. + * @param {Array} chrSymbols The character symbols to find. + * @returns {number} Returns the index of the first unmatched string symbol. + */ + function charsStartIndex(strSymbols, chrSymbols) { + var index = -1, + length = strSymbols.length; + + while (++index < length && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {} + return index; + } + + /** + * Used by `_.trim` and `_.trimEnd` to get the index of the last string symbol + * that is not found in the character symbols. + * + * @private + * @param {Array} strSymbols The string symbols to inspect. + * @param {Array} chrSymbols The character symbols to find. + * @returns {number} Returns the index of the last unmatched string symbol. + */ + function charsEndIndex(strSymbols, chrSymbols) { + var index = strSymbols.length; + + while (index-- && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {} + return index; + } + + /** + * Gets the number of `placeholder` occurrences in `array`. + * + * @private + * @param {Array} array The array to inspect. + * @param {*} placeholder The placeholder to search for. + * @returns {number} Returns the placeholder count. + */ + function countHolders(array, placeholder) { + var length = array.length, + result = 0; + + while (length--) { + if (array[length] === placeholder) { + ++result; + } + } + return result; + } + + /** + * Used by `_.deburr` to convert Latin-1 Supplement and Latin Extended-A + * letters to basic Latin letters. + * + * @private + * @param {string} letter The matched letter to deburr. + * @returns {string} Returns the deburred letter. + */ + var deburrLetter = basePropertyOf(deburredLetters); + + /** + * Used by `_.escape` to convert characters to HTML entities. + * + * @private + * @param {string} chr The matched character to escape. + * @returns {string} Returns the escaped character. + */ + var escapeHtmlChar = basePropertyOf(htmlEscapes); + + /** + * Used by `_.template` to escape characters for inclusion in compiled string literals. + * + * @private + * @param {string} chr The matched character to escape. + * @returns {string} Returns the escaped character. + */ + function escapeStringChar(chr) { + return '\\' + stringEscapes[chr]; + } + + /** + * Gets the value at `key` of `object`. + * + * @private + * @param {Object} [object] The object to query. + * @param {string} key The key of the property to get. + * @returns {*} Returns the property value. + */ + function getValue(object, key) { + return object == null ? undefined : object[key]; + } + + /** + * Checks if `string` contains Unicode symbols. + * + * @private + * @param {string} string The string to inspect. + * @returns {boolean} Returns `true` if a symbol is found, else `false`. + */ + function hasUnicode(string) { + return reHasUnicode.test(string); + } + + /** + * Checks if `string` contains a word composed of Unicode symbols. + * + * @private + * @param {string} string The string to inspect. + * @returns {boolean} Returns `true` if a word is found, else `false`. + */ + function hasUnicodeWord(string) { + return reHasUnicodeWord.test(string); + } + + /** + * Converts `iterator` to an array. + * + * @private + * @param {Object} iterator The iterator to convert. + * @returns {Array} Returns the converted array. + */ + function iteratorToArray(iterator) { + var data, + result = []; + + while (!(data = iterator.next()).done) { + result.push(data.value); + } + return result; + } + + /** + * Converts `map` to its key-value pairs. + * + * @private + * @param {Object} map The map to convert. + * @returns {Array} Returns the key-value pairs. + */ + function mapToArray(map) { + var index = -1, + result = Array(map.size); + + map.forEach(function(value, key) { + result[++index] = [key, value]; + }); + return result; + } + + /** + * Creates a unary function that invokes `func` with its argument transformed. + * + * @private + * @param {Function} func The function to wrap. + * @param {Function} transform The argument transform. + * @returns {Function} Returns the new function. + */ + function overArg(func, transform) { + return function(arg) { + return func(transform(arg)); + }; + } + + /** + * Replaces all `placeholder` elements in `array` with an internal placeholder + * and returns an array of their indexes. + * + * @private + * @param {Array} array The array to modify. + * @param {*} placeholder The placeholder to replace. + * @returns {Array} Returns the new array of placeholder indexes. + */ + function replaceHolders(array, placeholder) { + var index = -1, + length = array.length, + resIndex = 0, + result = []; + + while (++index < length) { + var value = array[index]; + if (value === placeholder || value === PLACEHOLDER) { + array[index] = PLACEHOLDER; + result[resIndex++] = index; + } + } + return result; + } + + /** + * Converts `set` to an array of its values. + * + * @private + * @param {Object} set The set to convert. + * @returns {Array} Returns the values. + */ + function setToArray(set) { + var index = -1, + result = Array(set.size); + + set.forEach(function(value) { + result[++index] = value; + }); + return result; + } + + /** + * Converts `set` to its value-value pairs. + * + * @private + * @param {Object} set The set to convert. + * @returns {Array} Returns the value-value pairs. + */ + function setToPairs(set) { + var index = -1, + result = Array(set.size); + + set.forEach(function(value) { + result[++index] = [value, value]; + }); + return result; + } + + /** + * A specialized version of `_.indexOf` which performs strict equality + * comparisons of values, i.e. `===`. + * + * @private + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @param {number} fromIndex The index to search from. + * @returns {number} Returns the index of the matched value, else `-1`. + */ + function strictIndexOf(array, value, fromIndex) { + var index = fromIndex - 1, + length = array.length; + + while (++index < length) { + if (array[index] === value) { + return index; + } + } + return -1; + } + + /** + * A specialized version of `_.lastIndexOf` which performs strict equality + * comparisons of values, i.e. `===`. + * + * @private + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @param {number} fromIndex The index to search from. + * @returns {number} Returns the index of the matched value, else `-1`. + */ + function strictLastIndexOf(array, value, fromIndex) { + var index = fromIndex + 1; + while (index--) { + if (array[index] === value) { + return index; + } + } + return index; + } + + /** + * Gets the number of symbols in `string`. + * + * @private + * @param {string} string The string to inspect. + * @returns {number} Returns the string size. + */ + function stringSize(string) { + return hasUnicode(string) + ? unicodeSize(string) + : asciiSize(string); + } + + /** + * Converts `string` to an array. + * + * @private + * @param {string} string The string to convert. + * @returns {Array} Returns the converted array. + */ + function stringToArray(string) { + return hasUnicode(string) + ? unicodeToArray(string) + : asciiToArray(string); + } + + /** + * Used by `_.unescape` to convert HTML entities to characters. + * + * @private + * @param {string} chr The matched character to unescape. + * @returns {string} Returns the unescaped character. + */ + var unescapeHtmlChar = basePropertyOf(htmlUnescapes); + + /** + * Gets the size of a Unicode `string`. + * + * @private + * @param {string} string The string inspect. + * @returns {number} Returns the string size. + */ + function unicodeSize(string) { + var result = reUnicode.lastIndex = 0; + while (reUnicode.test(string)) { + ++result; + } + return result; + } + + /** + * Converts a Unicode `string` to an array. + * + * @private + * @param {string} string The string to convert. + * @returns {Array} Returns the converted array. + */ + function unicodeToArray(string) { + return string.match(reUnicode) || []; + } + + /** + * Splits a Unicode `string` into an array of its words. + * + * @private + * @param {string} The string to inspect. + * @returns {Array} Returns the words of `string`. + */ + function unicodeWords(string) { + return string.match(reUnicodeWord) || []; + } + + /*--------------------------------------------------------------------------*/ + + /** + * Create a new pristine `lodash` function using the `context` object. + * + * @static + * @memberOf _ + * @since 1.1.0 + * @category Util + * @param {Object} [context=root] The context object. + * @returns {Function} Returns a new `lodash` function. + * @example + * + * _.mixin({ 'foo': _.constant('foo') }); + * + * var lodash = _.runInContext(); + * lodash.mixin({ 'bar': lodash.constant('bar') }); + * + * _.isFunction(_.foo); + * // => true + * _.isFunction(_.bar); + * // => false + * + * lodash.isFunction(lodash.foo); + * // => false + * lodash.isFunction(lodash.bar); + * // => true + * + * // Create a suped-up `defer` in Node.js. + * var defer = _.runInContext({ 'setTimeout': setImmediate }).defer; + */ + var runInContext = (function runInContext(context) { + context = context == null ? root : _.defaults(root.Object(), context, _.pick(root, contextProps)); + + /** Built-in constructor references. */ + var Array = context.Array, + Date = context.Date, + Error = context.Error, + Function = context.Function, + Math = context.Math, + Object = context.Object, + RegExp = context.RegExp, + String = context.String, + TypeError = context.TypeError; + + /** Used for built-in method references. */ + var arrayProto = Array.prototype, + funcProto = Function.prototype, + objectProto = Object.prototype; + + /** Used to detect overreaching core-js shims. */ + var coreJsData = context['__core-js_shared__']; + + /** Used to resolve the decompiled source of functions. */ + var funcToString = funcProto.toString; + + /** Used to check objects for own properties. */ + var hasOwnProperty = objectProto.hasOwnProperty; + + /** Used to generate unique IDs. */ + var idCounter = 0; + + /** Used to detect methods masquerading as native. */ + var maskSrcKey = (function() { + var uid = /[^.]+$/.exec(coreJsData && coreJsData.keys && coreJsData.keys.IE_PROTO || ''); + return uid ? ('Symbol(src)_1.' + uid) : ''; + }()); + + /** + * Used to resolve the + * [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring) + * of values. + */ + var nativeObjectToString = objectProto.toString; + + /** Used to infer the `Object` constructor. */ + var objectCtorString = funcToString.call(Object); + + /** Used to restore the original `_` reference in `_.noConflict`. */ + var oldDash = root._; + + /** Used to detect if a method is native. */ + var reIsNative = RegExp('^' + + funcToString.call(hasOwnProperty).replace(reRegExpChar, '\\$&') + .replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, '$1.*?') + '$' + ); + + /** Built-in value references. */ + var Buffer = moduleExports ? context.Buffer : undefined, + Symbol = context.Symbol, + Uint8Array = context.Uint8Array, + allocUnsafe = Buffer ? Buffer.allocUnsafe : undefined, + getPrototype = overArg(Object.getPrototypeOf, Object), + objectCreate = Object.create, + propertyIsEnumerable = objectProto.propertyIsEnumerable, + splice = arrayProto.splice, + spreadableSymbol = Symbol ? Symbol.isConcatSpreadable : undefined, + symIterator = Symbol ? Symbol.iterator : undefined, + symToStringTag = Symbol ? Symbol.toStringTag : undefined; + + var defineProperty = (function() { + try { + var func = getNative(Object, 'defineProperty'); + func({}, '', {}); + return func; + } catch (e) {} + }()); + + /** Mocked built-ins. */ + var ctxClearTimeout = context.clearTimeout !== root.clearTimeout && context.clearTimeout, + ctxNow = Date && Date.now !== root.Date.now && Date.now, + ctxSetTimeout = context.setTimeout !== root.setTimeout && context.setTimeout; + + /* Built-in method references for those with the same name as other `lodash` methods. */ + var nativeCeil = Math.ceil, + nativeFloor = Math.floor, + nativeGetSymbols = Object.getOwnPropertySymbols, + nativeIsBuffer = Buffer ? Buffer.isBuffer : undefined, + nativeIsFinite = context.isFinite, + nativeJoin = arrayProto.join, + nativeKeys = overArg(Object.keys, Object), + nativeMax = Math.max, + nativeMin = Math.min, + nativeNow = Date.now, + nativeParseInt = context.parseInt, + nativeRandom = Math.random, + nativeReverse = arrayProto.reverse; + + /* Built-in method references that are verified to be native. */ + var DataView = getNative(context, 'DataView'), + Map = getNative(context, 'Map'), + Promise = getNative(context, 'Promise'), + Set = getNative(context, 'Set'), + WeakMap = getNative(context, 'WeakMap'), + nativeCreate = getNative(Object, 'create'); + + /** Used to store function metadata. */ + var metaMap = WeakMap && new WeakMap; + + /** Used to lookup unminified function names. */ + var realNames = {}; + + /** Used to detect maps, sets, and weakmaps. */ + var dataViewCtorString = toSource(DataView), + mapCtorString = toSource(Map), + promiseCtorString = toSource(Promise), + setCtorString = toSource(Set), + weakMapCtorString = toSource(WeakMap); + + /** Used to convert symbols to primitives and strings. */ + var symbolProto = Symbol ? Symbol.prototype : undefined, + symbolValueOf = symbolProto ? symbolProto.valueOf : undefined, + symbolToString = symbolProto ? symbolProto.toString : undefined; + + /*------------------------------------------------------------------------*/ + + /** + * Creates a `lodash` object which wraps `value` to enable implicit method + * chain sequences. Methods that operate on and return arrays, collections, + * and functions can be chained together. Methods that retrieve a single value + * or may return a primitive value will automatically end the chain sequence + * and return the unwrapped value. Otherwise, the value must be unwrapped + * with `_#value`. + * + * Explicit chain sequences, which must be unwrapped with `_#value`, may be + * enabled using `_.chain`. + * + * The execution of chained methods is lazy, that is, it's deferred until + * `_#value` is implicitly or explicitly called. + * + * Lazy evaluation allows several methods to support shortcut fusion. + * Shortcut fusion is an optimization to merge iteratee calls; this avoids + * the creation of intermediate arrays and can greatly reduce the number of + * iteratee executions. Sections of a chain sequence qualify for shortcut + * fusion if the section is applied to an array and iteratees accept only + * one argument. The heuristic for whether a section qualifies for shortcut + * fusion is subject to change. + * + * Chaining is supported in custom builds as long as the `_#value` method is + * directly or indirectly included in the build. + * + * In addition to lodash methods, wrappers have `Array` and `String` methods. + * + * The wrapper `Array` methods are: + * `concat`, `join`, `pop`, `push`, `shift`, `sort`, `splice`, and `unshift` + * + * The wrapper `String` methods are: + * `replace` and `split` + * + * The wrapper methods that support shortcut fusion are: + * `at`, `compact`, `drop`, `dropRight`, `dropWhile`, `filter`, `find`, + * `findLast`, `head`, `initial`, `last`, `map`, `reject`, `reverse`, `slice`, + * `tail`, `take`, `takeRight`, `takeRightWhile`, `takeWhile`, and `toArray` + * + * The chainable wrapper methods are: + * `after`, `ary`, `assign`, `assignIn`, `assignInWith`, `assignWith`, `at`, + * `before`, `bind`, `bindAll`, `bindKey`, `castArray`, `chain`, `chunk`, + * `commit`, `compact`, `concat`, `conforms`, `constant`, `countBy`, `create`, + * `curry`, `debounce`, `defaults`, `defaultsDeep`, `defer`, `delay`, + * `difference`, `differenceBy`, `differenceWith`, `drop`, `dropRight`, + * `dropRightWhile`, `dropWhile`, `extend`, `extendWith`, `fill`, `filter`, + * `flatMap`, `flatMapDeep`, `flatMapDepth`, `flatten`, `flattenDeep`, + * `flattenDepth`, `flip`, `flow`, `flowRight`, `fromPairs`, `functions`, + * `functionsIn`, `groupBy`, `initial`, `intersection`, `intersectionBy`, + * `intersectionWith`, `invert`, `invertBy`, `invokeMap`, `iteratee`, `keyBy`, + * `keys`, `keysIn`, `map`, `mapKeys`, `mapValues`, `matches`, `matchesProperty`, + * `memoize`, `merge`, `mergeWith`, `method`, `methodOf`, `mixin`, `negate`, + * `nthArg`, `omit`, `omitBy`, `once`, `orderBy`, `over`, `overArgs`, + * `overEvery`, `overSome`, `partial`, `partialRight`, `partition`, `pick`, + * `pickBy`, `plant`, `property`, `propertyOf`, `pull`, `pullAll`, `pullAllBy`, + * `pullAllWith`, `pullAt`, `push`, `range`, `rangeRight`, `rearg`, `reject`, + * `remove`, `rest`, `reverse`, `sampleSize`, `set`, `setWith`, `shuffle`, + * `slice`, `sort`, `sortBy`, `splice`, `spread`, `tail`, `take`, `takeRight`, + * `takeRightWhile`, `takeWhile`, `tap`, `throttle`, `thru`, `toArray`, + * `toPairs`, `toPairsIn`, `toPath`, `toPlainObject`, `transform`, `unary`, + * `union`, `unionBy`, `unionWith`, `uniq`, `uniqBy`, `uniqWith`, `unset`, + * `unshift`, `unzip`, `unzipWith`, `update`, `updateWith`, `values`, + * `valuesIn`, `without`, `wrap`, `xor`, `xorBy`, `xorWith`, `zip`, + * `zipObject`, `zipObjectDeep`, and `zipWith` + * + * The wrapper methods that are **not** chainable by default are: + * `add`, `attempt`, `camelCase`, `capitalize`, `ceil`, `clamp`, `clone`, + * `cloneDeep`, `cloneDeepWith`, `cloneWith`, `conformsTo`, `deburr`, + * `defaultTo`, `divide`, `each`, `eachRight`, `endsWith`, `eq`, `escape`, + * `escapeRegExp`, `every`, `find`, `findIndex`, `findKey`, `findLast`, + * `findLastIndex`, `findLastKey`, `first`, `floor`, `forEach`, `forEachRight`, + * `forIn`, `forInRight`, `forOwn`, `forOwnRight`, `get`, `gt`, `gte`, `has`, + * `hasIn`, `head`, `identity`, `includes`, `indexOf`, `inRange`, `invoke`, + * `isArguments`, `isArray`, `isArrayBuffer`, `isArrayLike`, `isArrayLikeObject`, + * `isBoolean`, `isBuffer`, `isDate`, `isElement`, `isEmpty`, `isEqual`, + * `isEqualWith`, `isError`, `isFinite`, `isFunction`, `isInteger`, `isLength`, + * `isMap`, `isMatch`, `isMatchWith`, `isNaN`, `isNative`, `isNil`, `isNull`, + * `isNumber`, `isObject`, `isObjectLike`, `isPlainObject`, `isRegExp`, + * `isSafeInteger`, `isSet`, `isString`, `isUndefined`, `isTypedArray`, + * `isWeakMap`, `isWeakSet`, `join`, `kebabCase`, `last`, `lastIndexOf`, + * `lowerCase`, `lowerFirst`, `lt`, `lte`, `max`, `maxBy`, `mean`, `meanBy`, + * `min`, `minBy`, `multiply`, `noConflict`, `noop`, `now`, `nth`, `pad`, + * `padEnd`, `padStart`, `parseInt`, `pop`, `random`, `reduce`, `reduceRight`, + * `repeat`, `result`, `round`, `runInContext`, `sample`, `shift`, `size`, + * `snakeCase`, `some`, `sortedIndex`, `sortedIndexBy`, `sortedLastIndex`, + * `sortedLastIndexBy`, `startCase`, `startsWith`, `stubArray`, `stubFalse`, + * `stubObject`, `stubString`, `stubTrue`, `subtract`, `sum`, `sumBy`, + * `template`, `times`, `toFinite`, `toInteger`, `toJSON`, `toLength`, + * `toLower`, `toNumber`, `toSafeInteger`, `toString`, `toUpper`, `trim`, + * `trimEnd`, `trimStart`, `truncate`, `unescape`, `uniqueId`, `upperCase`, + * `upperFirst`, `value`, and `words` + * + * @name _ + * @constructor + * @category Seq + * @param {*} value The value to wrap in a `lodash` instance. + * @returns {Object} Returns the new `lodash` wrapper instance. + * @example + * + * function square(n) { + * return n * n; + * } + * + * var wrapped = _([1, 2, 3]); + * + * // Returns an unwrapped value. + * wrapped.reduce(_.add); + * // => 6 + * + * // Returns a wrapped value. + * var squares = wrapped.map(square); + * + * _.isArray(squares); + * // => false + * + * _.isArray(squares.value()); + * // => true + */ + function lodash(value) { + if (isObjectLike(value) && !isArray(value) && !(value instanceof LazyWrapper)) { + if (value instanceof LodashWrapper) { + return value; + } + if (hasOwnProperty.call(value, '__wrapped__')) { + return wrapperClone(value); + } + } + return new LodashWrapper(value); + } + + /** + * The base implementation of `_.create` without support for assigning + * properties to the created object. + * + * @private + * @param {Object} proto The object to inherit from. + * @returns {Object} Returns the new object. + */ + var baseCreate = (function() { + function object() {} + return function(proto) { + if (!isObject(proto)) { + return {}; + } + if (objectCreate) { + return objectCreate(proto); + } + object.prototype = proto; + var result = new object; + object.prototype = undefined; + return result; + }; + }()); + + /** + * The function whose prototype chain sequence wrappers inherit from. + * + * @private + */ + function baseLodash() { + // No operation performed. + } + + /** + * The base constructor for creating `lodash` wrapper objects. + * + * @private + * @param {*} value The value to wrap. + * @param {boolean} [chainAll] Enable explicit method chain sequences. + */ + function LodashWrapper(value, chainAll) { + this.__wrapped__ = value; + this.__actions__ = []; + this.__chain__ = !!chainAll; + this.__index__ = 0; + this.__values__ = undefined; + } + + /** + * By default, the template delimiters used by lodash are like those in + * embedded Ruby (ERB) as well as ES2015 template strings. Change the + * following template settings to use alternative delimiters. + * + * @static + * @memberOf _ + * @type {Object} + */ + lodash.templateSettings = { + + /** + * Used to detect `data` property values to be HTML-escaped. + * + * @memberOf _.templateSettings + * @type {RegExp} + */ + 'escape': reEscape, + + /** + * Used to detect code to be evaluated. + * + * @memberOf _.templateSettings + * @type {RegExp} + */ + 'evaluate': reEvaluate, + + /** + * Used to detect `data` property values to inject. + * + * @memberOf _.templateSettings + * @type {RegExp} + */ + 'interpolate': reInterpolate, + + /** + * Used to reference the data object in the template text. + * + * @memberOf _.templateSettings + * @type {string} + */ + 'variable': '', + + /** + * Used to import variables into the compiled template. + * + * @memberOf _.templateSettings + * @type {Object} + */ + 'imports': { + + /** + * A reference to the `lodash` function. + * + * @memberOf _.templateSettings.imports + * @type {Function} + */ + '_': lodash + } + }; + + // Ensure wrappers are instances of `baseLodash`. + lodash.prototype = baseLodash.prototype; + lodash.prototype.constructor = lodash; + + LodashWrapper.prototype = baseCreate(baseLodash.prototype); + LodashWrapper.prototype.constructor = LodashWrapper; + + /*------------------------------------------------------------------------*/ + + /** + * Creates a lazy wrapper object which wraps `value` to enable lazy evaluation. + * + * @private + * @constructor + * @param {*} value The value to wrap. + */ + function LazyWrapper(value) { + this.__wrapped__ = value; + this.__actions__ = []; + this.__dir__ = 1; + this.__filtered__ = false; + this.__iteratees__ = []; + this.__takeCount__ = MAX_ARRAY_LENGTH; + this.__views__ = []; + } + + /** + * Creates a clone of the lazy wrapper object. + * + * @private + * @name clone + * @memberOf LazyWrapper + * @returns {Object} Returns the cloned `LazyWrapper` object. + */ + function lazyClone() { + var result = new LazyWrapper(this.__wrapped__); + result.__actions__ = copyArray(this.__actions__); + result.__dir__ = this.__dir__; + result.__filtered__ = this.__filtered__; + result.__iteratees__ = copyArray(this.__iteratees__); + result.__takeCount__ = this.__takeCount__; + result.__views__ = copyArray(this.__views__); + return result; + } + + /** + * Reverses the direction of lazy iteration. + * + * @private + * @name reverse + * @memberOf LazyWrapper + * @returns {Object} Returns the new reversed `LazyWrapper` object. + */ + function lazyReverse() { + if (this.__filtered__) { + var result = new LazyWrapper(this); + result.__dir__ = -1; + result.__filtered__ = true; + } else { + result = this.clone(); + result.__dir__ *= -1; + } + return result; + } + + /** + * Extracts the unwrapped value from its lazy wrapper. + * + * @private + * @name value + * @memberOf LazyWrapper + * @returns {*} Returns the unwrapped value. + */ + function lazyValue() { + var array = this.__wrapped__.value(), + dir = this.__dir__, + isArr = isArray(array), + isRight = dir < 0, + arrLength = isArr ? array.length : 0, + view = getView(0, arrLength, this.__views__), + start = view.start, + end = view.end, + length = end - start, + index = isRight ? end : (start - 1), + iteratees = this.__iteratees__, + iterLength = iteratees.length, + resIndex = 0, + takeCount = nativeMin(length, this.__takeCount__); + + if (!isArr || (!isRight && arrLength == length && takeCount == length)) { + return baseWrapperValue(array, this.__actions__); + } + var result = []; + + outer: + while (length-- && resIndex < takeCount) { + index += dir; + + var iterIndex = -1, + value = array[index]; + + while (++iterIndex < iterLength) { + var data = iteratees[iterIndex], + iteratee = data.iteratee, + type = data.type, + computed = iteratee(value); + + if (type == LAZY_MAP_FLAG) { + value = computed; + } else if (!computed) { + if (type == LAZY_FILTER_FLAG) { + continue outer; + } else { + break outer; + } + } + } + result[resIndex++] = value; + } + return result; + } + + // Ensure `LazyWrapper` is an instance of `baseLodash`. + LazyWrapper.prototype = baseCreate(baseLodash.prototype); + LazyWrapper.prototype.constructor = LazyWrapper; + + /*------------------------------------------------------------------------*/ + + /** + * Creates a hash object. + * + * @private + * @constructor + * @param {Array} [entries] The key-value pairs to cache. + */ + function Hash(entries) { + var index = -1, + length = entries == null ? 0 : entries.length; + + this.clear(); + while (++index < length) { + var entry = entries[index]; + this.set(entry[0], entry[1]); + } + } + + /** + * Removes all key-value entries from the hash. + * + * @private + * @name clear + * @memberOf Hash + */ + function hashClear() { + this.__data__ = nativeCreate ? nativeCreate(null) : {}; + this.size = 0; + } + + /** + * Removes `key` and its value from the hash. + * + * @private + * @name delete + * @memberOf Hash + * @param {Object} hash The hash to modify. + * @param {string} key The key of the value to remove. + * @returns {boolean} Returns `true` if the entry was removed, else `false`. + */ + function hashDelete(key) { + var result = this.has(key) && delete this.__data__[key]; + this.size -= result ? 1 : 0; + return result; + } + + /** + * Gets the hash value for `key`. + * + * @private + * @name get + * @memberOf Hash + * @param {string} key The key of the value to get. + * @returns {*} Returns the entry value. + */ + function hashGet(key) { + var data = this.__data__; + if (nativeCreate) { + var result = data[key]; + return result === HASH_UNDEFINED ? undefined : result; + } + return hasOwnProperty.call(data, key) ? data[key] : undefined; + } + + /** + * Checks if a hash value for `key` exists. + * + * @private + * @name has + * @memberOf Hash + * @param {string} key The key of the entry to check. + * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. + */ + function hashHas(key) { + var data = this.__data__; + return nativeCreate ? (data[key] !== undefined) : hasOwnProperty.call(data, key); + } + + /** + * Sets the hash `key` to `value`. + * + * @private + * @name set + * @memberOf Hash + * @param {string} key The key of the value to set. + * @param {*} value The value to set. + * @returns {Object} Returns the hash instance. + */ + function hashSet(key, value) { + var data = this.__data__; + this.size += this.has(key) ? 0 : 1; + data[key] = (nativeCreate && value === undefined) ? HASH_UNDEFINED : value; + return this; + } + + // Add methods to `Hash`. + Hash.prototype.clear = hashClear; + Hash.prototype['delete'] = hashDelete; + Hash.prototype.get = hashGet; + Hash.prototype.has = hashHas; + Hash.prototype.set = hashSet; + + /*------------------------------------------------------------------------*/ + + /** + * Creates an list cache object. + * + * @private + * @constructor + * @param {Array} [entries] The key-value pairs to cache. + */ + function ListCache(entries) { + var index = -1, + length = entries == null ? 0 : entries.length; + + this.clear(); + while (++index < length) { + var entry = entries[index]; + this.set(entry[0], entry[1]); + } + } + + /** + * Removes all key-value entries from the list cache. + * + * @private + * @name clear + * @memberOf ListCache + */ + function listCacheClear() { + this.__data__ = []; + this.size = 0; + } + + /** + * Removes `key` and its value from the list cache. + * + * @private + * @name delete + * @memberOf ListCache + * @param {string} key The key of the value to remove. + * @returns {boolean} Returns `true` if the entry was removed, else `false`. + */ + function listCacheDelete(key) { + var data = this.__data__, + index = assocIndexOf(data, key); + + if (index < 0) { + return false; + } + var lastIndex = data.length - 1; + if (index == lastIndex) { + data.pop(); + } else { + splice.call(data, index, 1); + } + --this.size; + return true; + } + + /** + * Gets the list cache value for `key`. + * + * @private + * @name get + * @memberOf ListCache + * @param {string} key The key of the value to get. + * @returns {*} Returns the entry value. + */ + function listCacheGet(key) { + var data = this.__data__, + index = assocIndexOf(data, key); + + return index < 0 ? undefined : data[index][1]; + } + + /** + * Checks if a list cache value for `key` exists. + * + * @private + * @name has + * @memberOf ListCache + * @param {string} key The key of the entry to check. + * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. + */ + function listCacheHas(key) { + return assocIndexOf(this.__data__, key) > -1; + } + + /** + * Sets the list cache `key` to `value`. + * + * @private + * @name set + * @memberOf ListCache + * @param {string} key The key of the value to set. + * @param {*} value The value to set. + * @returns {Object} Returns the list cache instance. + */ + function listCacheSet(key, value) { + var data = this.__data__, + index = assocIndexOf(data, key); + + if (index < 0) { + ++this.size; + data.push([key, value]); + } else { + data[index][1] = value; + } + return this; + } + + // Add methods to `ListCache`. + ListCache.prototype.clear = listCacheClear; + ListCache.prototype['delete'] = listCacheDelete; + ListCache.prototype.get = listCacheGet; + ListCache.prototype.has = listCacheHas; + ListCache.prototype.set = listCacheSet; + + /*------------------------------------------------------------------------*/ + + /** + * Creates a map cache object to store key-value pairs. + * + * @private + * @constructor + * @param {Array} [entries] The key-value pairs to cache. + */ + function MapCache(entries) { + var index = -1, + length = entries == null ? 0 : entries.length; + + this.clear(); + while (++index < length) { + var entry = entries[index]; + this.set(entry[0], entry[1]); + } + } + + /** + * Removes all key-value entries from the map. + * + * @private + * @name clear + * @memberOf MapCache + */ + function mapCacheClear() { + this.size = 0; + this.__data__ = { + 'hash': new Hash, + 'map': new (Map || ListCache), + 'string': new Hash + }; + } + + /** + * Removes `key` and its value from the map. + * + * @private + * @name delete + * @memberOf MapCache + * @param {string} key The key of the value to remove. + * @returns {boolean} Returns `true` if the entry was removed, else `false`. + */ + function mapCacheDelete(key) { + var result = getMapData(this, key)['delete'](key); + this.size -= result ? 1 : 0; + return result; + } + + /** + * Gets the map value for `key`. + * + * @private + * @name get + * @memberOf MapCache + * @param {string} key The key of the value to get. + * @returns {*} Returns the entry value. + */ + function mapCacheGet(key) { + return getMapData(this, key).get(key); + } + + /** + * Checks if a map value for `key` exists. + * + * @private + * @name has + * @memberOf MapCache + * @param {string} key The key of the entry to check. + * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. + */ + function mapCacheHas(key) { + return getMapData(this, key).has(key); + } + + /** + * Sets the map `key` to `value`. + * + * @private + * @name set + * @memberOf MapCache + * @param {string} key The key of the value to set. + * @param {*} value The value to set. + * @returns {Object} Returns the map cache instance. + */ + function mapCacheSet(key, value) { + var data = getMapData(this, key), + size = data.size; + + data.set(key, value); + this.size += data.size == size ? 0 : 1; + return this; + } + + // Add methods to `MapCache`. + MapCache.prototype.clear = mapCacheClear; + MapCache.prototype['delete'] = mapCacheDelete; + MapCache.prototype.get = mapCacheGet; + MapCache.prototype.has = mapCacheHas; + MapCache.prototype.set = mapCacheSet; + + /*------------------------------------------------------------------------*/ + + /** + * + * Creates an array cache object to store unique values. + * + * @private + * @constructor + * @param {Array} [values] The values to cache. + */ + function SetCache(values) { + var index = -1, + length = values == null ? 0 : values.length; + + this.__data__ = new MapCache; + while (++index < length) { + this.add(values[index]); + } + } + + /** + * Adds `value` to the array cache. + * + * @private + * @name add + * @memberOf SetCache + * @alias push + * @param {*} value The value to cache. + * @returns {Object} Returns the cache instance. + */ + function setCacheAdd(value) { + this.__data__.set(value, HASH_UNDEFINED); + return this; + } + + /** + * Checks if `value` is in the array cache. + * + * @private + * @name has + * @memberOf SetCache + * @param {*} value The value to search for. + * @returns {number} Returns `true` if `value` is found, else `false`. + */ + function setCacheHas(value) { + return this.__data__.has(value); + } + + // Add methods to `SetCache`. + SetCache.prototype.add = SetCache.prototype.push = setCacheAdd; + SetCache.prototype.has = setCacheHas; + + /*------------------------------------------------------------------------*/ + + /** + * Creates a stack cache object to store key-value pairs. + * + * @private + * @constructor + * @param {Array} [entries] The key-value pairs to cache. + */ + function Stack(entries) { + var data = this.__data__ = new ListCache(entries); + this.size = data.size; + } + + /** + * Removes all key-value entries from the stack. + * + * @private + * @name clear + * @memberOf Stack + */ + function stackClear() { + this.__data__ = new ListCache; + this.size = 0; + } + + /** + * Removes `key` and its value from the stack. + * + * @private + * @name delete + * @memberOf Stack + * @param {string} key The key of the value to remove. + * @returns {boolean} Returns `true` if the entry was removed, else `false`. + */ + function stackDelete(key) { + var data = this.__data__, + result = data['delete'](key); + + this.size = data.size; + return result; + } + + /** + * Gets the stack value for `key`. + * + * @private + * @name get + * @memberOf Stack + * @param {string} key The key of the value to get. + * @returns {*} Returns the entry value. + */ + function stackGet(key) { + return this.__data__.get(key); + } + + /** + * Checks if a stack value for `key` exists. + * + * @private + * @name has + * @memberOf Stack + * @param {string} key The key of the entry to check. + * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. + */ + function stackHas(key) { + return this.__data__.has(key); + } + + /** + * Sets the stack `key` to `value`. + * + * @private + * @name set + * @memberOf Stack + * @param {string} key The key of the value to set. + * @param {*} value The value to set. + * @returns {Object} Returns the stack cache instance. + */ + function stackSet(key, value) { + var data = this.__data__; + if (data instanceof ListCache) { + var pairs = data.__data__; + if (!Map || (pairs.length < LARGE_ARRAY_SIZE - 1)) { + pairs.push([key, value]); + this.size = ++data.size; + return this; + } + data = this.__data__ = new MapCache(pairs); + } + data.set(key, value); + this.size = data.size; + return this; + } + + // Add methods to `Stack`. + Stack.prototype.clear = stackClear; + Stack.prototype['delete'] = stackDelete; + Stack.prototype.get = stackGet; + Stack.prototype.has = stackHas; + Stack.prototype.set = stackSet; + + /*------------------------------------------------------------------------*/ + + /** + * Creates an array of the enumerable property names of the array-like `value`. + * + * @private + * @param {*} value The value to query. + * @param {boolean} inherited Specify returning inherited property names. + * @returns {Array} Returns the array of property names. + */ + function arrayLikeKeys(value, inherited) { + var isArr = isArray(value), + isArg = !isArr && isArguments(value), + isBuff = !isArr && !isArg && isBuffer(value), + isType = !isArr && !isArg && !isBuff && isTypedArray(value), + skipIndexes = isArr || isArg || isBuff || isType, + result = skipIndexes ? baseTimes(value.length, String) : [], + length = result.length; + + for (var key in value) { + if ((inherited || hasOwnProperty.call(value, key)) && + !(skipIndexes && ( + // Safari 9 has enumerable `arguments.length` in strict mode. + key == 'length' || + // Node.js 0.10 has enumerable non-index properties on buffers. + (isBuff && (key == 'offset' || key == 'parent')) || + // PhantomJS 2 has enumerable non-index properties on typed arrays. + (isType && (key == 'buffer' || key == 'byteLength' || key == 'byteOffset')) || + // Skip index properties. + isIndex(key, length) + ))) { + result.push(key); + } + } + return result; + } + + /** + * A specialized version of `_.sample` for arrays. + * + * @private + * @param {Array} array The array to sample. + * @returns {*} Returns the random element. + */ + function arraySample(array) { + var length = array.length; + return length ? array[baseRandom(0, length - 1)] : undefined; + } + + /** + * A specialized version of `_.sampleSize` for arrays. + * + * @private + * @param {Array} array The array to sample. + * @param {number} n The number of elements to sample. + * @returns {Array} Returns the random elements. + */ + function arraySampleSize(array, n) { + return shuffleSelf(copyArray(array), baseClamp(n, 0, array.length)); + } + + /** + * A specialized version of `_.shuffle` for arrays. + * + * @private + * @param {Array} array The array to shuffle. + * @returns {Array} Returns the new shuffled array. + */ + function arrayShuffle(array) { + return shuffleSelf(copyArray(array)); + } + + /** + * This function is like `assignValue` except that it doesn't assign + * `undefined` values. + * + * @private + * @param {Object} object The object to modify. + * @param {string} key The key of the property to assign. + * @param {*} value The value to assign. + */ + function assignMergeValue(object, key, value) { + if ((value !== undefined && !eq(object[key], value)) || + (value === undefined && !(key in object))) { + baseAssignValue(object, key, value); + } + } + + /** + * Assigns `value` to `key` of `object` if the existing value is not equivalent + * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. + * + * @private + * @param {Object} object The object to modify. + * @param {string} key The key of the property to assign. + * @param {*} value The value to assign. + */ + function assignValue(object, key, value) { + var objValue = object[key]; + if (!(hasOwnProperty.call(object, key) && eq(objValue, value)) || + (value === undefined && !(key in object))) { + baseAssignValue(object, key, value); + } + } + + /** + * Gets the index at which the `key` is found in `array` of key-value pairs. + * + * @private + * @param {Array} array The array to inspect. + * @param {*} key The key to search for. + * @returns {number} Returns the index of the matched value, else `-1`. + */ + function assocIndexOf(array, key) { + var length = array.length; + while (length--) { + if (eq(array[length][0], key)) { + return length; + } + } + return -1; + } + + /** + * Aggregates elements of `collection` on `accumulator` with keys transformed + * by `iteratee` and values set by `setter`. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} setter The function to set `accumulator` values. + * @param {Function} iteratee The iteratee to transform keys. + * @param {Object} accumulator The initial aggregated object. + * @returns {Function} Returns `accumulator`. + */ + function baseAggregator(collection, setter, iteratee, accumulator) { + baseEach(collection, function(value, key, collection) { + setter(accumulator, value, iteratee(value), collection); + }); + return accumulator; + } + + /** + * The base implementation of `_.assign` without support for multiple sources + * or `customizer` functions. + * + * @private + * @param {Object} object The destination object. + * @param {Object} source The source object. + * @returns {Object} Returns `object`. + */ + function baseAssign(object, source) { + return object && copyObject(source, keys(source), object); + } + + /** + * The base implementation of `_.assignIn` without support for multiple sources + * or `customizer` functions. + * + * @private + * @param {Object} object The destination object. + * @param {Object} source The source object. + * @returns {Object} Returns `object`. + */ + function baseAssignIn(object, source) { + return object && copyObject(source, keysIn(source), object); + } + + /** + * The base implementation of `assignValue` and `assignMergeValue` without + * value checks. + * + * @private + * @param {Object} object The object to modify. + * @param {string} key The key of the property to assign. + * @param {*} value The value to assign. + */ + function baseAssignValue(object, key, value) { + if (key == '__proto__' && defineProperty) { + defineProperty(object, key, { + 'configurable': true, + 'enumerable': true, + 'value': value, + 'writable': true + }); + } else { + object[key] = value; + } + } + + /** + * The base implementation of `_.at` without support for individual paths. + * + * @private + * @param {Object} object The object to iterate over. + * @param {string[]} paths The property paths to pick. + * @returns {Array} Returns the picked elements. + */ + function baseAt(object, paths) { + var index = -1, + length = paths.length, + result = Array(length), + skip = object == null; + + while (++index < length) { + result[index] = skip ? undefined : get(object, paths[index]); + } + return result; + } + + /** + * The base implementation of `_.clamp` which doesn't coerce arguments. + * + * @private + * @param {number} number The number to clamp. + * @param {number} [lower] The lower bound. + * @param {number} upper The upper bound. + * @returns {number} Returns the clamped number. + */ + function baseClamp(number, lower, upper) { + if (number === number) { + if (upper !== undefined) { + number = number <= upper ? number : upper; + } + if (lower !== undefined) { + number = number >= lower ? number : lower; + } + } + return number; + } + + /** + * The base implementation of `_.clone` and `_.cloneDeep` which tracks + * traversed objects. + * + * @private + * @param {*} value The value to clone. + * @param {boolean} bitmask The bitmask flags. + * 1 - Deep clone + * 2 - Flatten inherited properties + * 4 - Clone symbols + * @param {Function} [customizer] The function to customize cloning. + * @param {string} [key] The key of `value`. + * @param {Object} [object] The parent object of `value`. + * @param {Object} [stack] Tracks traversed objects and their clone counterparts. + * @returns {*} Returns the cloned value. + */ + function baseClone(value, bitmask, customizer, key, object, stack) { + var result, + isDeep = bitmask & CLONE_DEEP_FLAG, + isFlat = bitmask & CLONE_FLAT_FLAG, + isFull = bitmask & CLONE_SYMBOLS_FLAG; + + if (customizer) { + result = object ? customizer(value, key, object, stack) : customizer(value); + } + if (result !== undefined) { + return result; + } + if (!isObject(value)) { + return value; + } + var isArr = isArray(value); + if (isArr) { + result = initCloneArray(value); + if (!isDeep) { + return copyArray(value, result); + } + } else { + var tag = getTag(value), + isFunc = tag == funcTag || tag == genTag; + + if (isBuffer(value)) { + return cloneBuffer(value, isDeep); + } + if (tag == objectTag || tag == argsTag || (isFunc && !object)) { + result = (isFlat || isFunc) ? {} : initCloneObject(value); + if (!isDeep) { + return isFlat + ? copySymbolsIn(value, baseAssignIn(result, value)) + : copySymbols(value, baseAssign(result, value)); + } + } else { + if (!cloneableTags[tag]) { + return object ? value : {}; + } + result = initCloneByTag(value, tag, baseClone, isDeep); + } + } + // Check for circular references and return its corresponding clone. + stack || (stack = new Stack); + var stacked = stack.get(value); + if (stacked) { + return stacked; + } + stack.set(value, result); + + var keysFunc = isFull + ? (isFlat ? getAllKeysIn : getAllKeys) + : (isFlat ? keysIn : keys); + + var props = isArr ? undefined : keysFunc(value); + arrayEach(props || value, function(subValue, key) { + if (props) { + key = subValue; + subValue = value[key]; + } + // Recursively populate clone (susceptible to call stack limits). + assignValue(result, key, baseClone(subValue, bitmask, customizer, key, value, stack)); + }); + return result; + } + + /** + * The base implementation of `_.conforms` which doesn't clone `source`. + * + * @private + * @param {Object} source The object of property predicates to conform to. + * @returns {Function} Returns the new spec function. + */ + function baseConforms(source) { + var props = keys(source); + return function(object) { + return baseConformsTo(object, source, props); + }; + } + + /** + * The base implementation of `_.conformsTo` which accepts `props` to check. + * + * @private + * @param {Object} object The object to inspect. + * @param {Object} source The object of property predicates to conform to. + * @returns {boolean} Returns `true` if `object` conforms, else `false`. + */ + function baseConformsTo(object, source, props) { + var length = props.length; + if (object == null) { + return !length; + } + object = Object(object); + while (length--) { + var key = props[length], + predicate = source[key], + value = object[key]; + + if ((value === undefined && !(key in object)) || !predicate(value)) { + return false; + } + } + return true; + } + + /** + * The base implementation of `_.delay` and `_.defer` which accepts `args` + * to provide to `func`. + * + * @private + * @param {Function} func The function to delay. + * @param {number} wait The number of milliseconds to delay invocation. + * @param {Array} args The arguments to provide to `func`. + * @returns {number|Object} Returns the timer id or timeout object. + */ + function baseDelay(func, wait, args) { + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + return setTimeout(function() { func.apply(undefined, args); }, wait); + } + + /** + * The base implementation of methods like `_.difference` without support + * for excluding multiple arrays or iteratee shorthands. + * + * @private + * @param {Array} array The array to inspect. + * @param {Array} values The values to exclude. + * @param {Function} [iteratee] The iteratee invoked per element. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of filtered values. + */ + function baseDifference(array, values, iteratee, comparator) { + var index = -1, + includes = arrayIncludes, + isCommon = true, + length = array.length, + result = [], + valuesLength = values.length; + + if (!length) { + return result; + } + if (iteratee) { + values = arrayMap(values, baseUnary(iteratee)); + } + if (comparator) { + includes = arrayIncludesWith; + isCommon = false; + } + else if (values.length >= LARGE_ARRAY_SIZE) { + includes = cacheHas; + isCommon = false; + values = new SetCache(values); + } + outer: + while (++index < length) { + var value = array[index], + computed = iteratee == null ? value : iteratee(value); + + value = (comparator || value !== 0) ? value : 0; + if (isCommon && computed === computed) { + var valuesIndex = valuesLength; + while (valuesIndex--) { + if (values[valuesIndex] === computed) { + continue outer; + } + } + result.push(value); + } + else if (!includes(values, computed, comparator)) { + result.push(value); + } + } + return result; + } + + /** + * The base implementation of `_.forEach` without support for iteratee shorthands. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array|Object} Returns `collection`. + */ + var baseEach = createBaseEach(baseForOwn); + + /** + * The base implementation of `_.forEachRight` without support for iteratee shorthands. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array|Object} Returns `collection`. + */ + var baseEachRight = createBaseEach(baseForOwnRight, true); + + /** + * The base implementation of `_.every` without support for iteratee shorthands. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {boolean} Returns `true` if all elements pass the predicate check, + * else `false` + */ + function baseEvery(collection, predicate) { + var result = true; + baseEach(collection, function(value, index, collection) { + result = !!predicate(value, index, collection); + return result; + }); + return result; + } + + /** + * The base implementation of methods like `_.max` and `_.min` which accepts a + * `comparator` to determine the extremum value. + * + * @private + * @param {Array} array The array to iterate over. + * @param {Function} iteratee The iteratee invoked per iteration. + * @param {Function} comparator The comparator used to compare values. + * @returns {*} Returns the extremum value. + */ + function baseExtremum(array, iteratee, comparator) { + var index = -1, + length = array.length; + + while (++index < length) { + var value = array[index], + current = iteratee(value); + + if (current != null && (computed === undefined + ? (current === current && !isSymbol(current)) + : comparator(current, computed) + )) { + var computed = current, + result = value; + } + } + return result; + } + + /** + * The base implementation of `_.fill` without an iteratee call guard. + * + * @private + * @param {Array} array The array to fill. + * @param {*} value The value to fill `array` with. + * @param {number} [start=0] The start position. + * @param {number} [end=array.length] The end position. + * @returns {Array} Returns `array`. + */ + function baseFill(array, value, start, end) { + var length = array.length; + + start = toInteger(start); + if (start < 0) { + start = -start > length ? 0 : (length + start); + } + end = (end === undefined || end > length) ? length : toInteger(end); + if (end < 0) { + end += length; + } + end = start > end ? 0 : toLength(end); + while (start < end) { + array[start++] = value; + } + return array; + } + + /** + * The base implementation of `_.filter` without support for iteratee shorthands. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {Array} Returns the new filtered array. + */ + function baseFilter(collection, predicate) { + var result = []; + baseEach(collection, function(value, index, collection) { + if (predicate(value, index, collection)) { + result.push(value); + } + }); + return result; + } + + /** + * The base implementation of `_.flatten` with support for restricting flattening. + * + * @private + * @param {Array} array The array to flatten. + * @param {number} depth The maximum recursion depth. + * @param {boolean} [predicate=isFlattenable] The function invoked per iteration. + * @param {boolean} [isStrict] Restrict to values that pass `predicate` checks. + * @param {Array} [result=[]] The initial result value. + * @returns {Array} Returns the new flattened array. + */ + function baseFlatten(array, depth, predicate, isStrict, result) { + var index = -1, + length = array.length; + + predicate || (predicate = isFlattenable); + result || (result = []); + + while (++index < length) { + var value = array[index]; + if (depth > 0 && predicate(value)) { + if (depth > 1) { + // Recursively flatten arrays (susceptible to call stack limits). + baseFlatten(value, depth - 1, predicate, isStrict, result); + } else { + arrayPush(result, value); + } + } else if (!isStrict) { + result[result.length] = value; + } + } + return result; + } + + /** + * The base implementation of `baseForOwn` which iterates over `object` + * properties returned by `keysFunc` and invokes `iteratee` for each property. + * Iteratee functions may exit iteration early by explicitly returning `false`. + * + * @private + * @param {Object} object The object to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @param {Function} keysFunc The function to get the keys of `object`. + * @returns {Object} Returns `object`. + */ + var baseFor = createBaseFor(); + + /** + * This function is like `baseFor` except that it iterates over properties + * in the opposite order. + * + * @private + * @param {Object} object The object to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @param {Function} keysFunc The function to get the keys of `object`. + * @returns {Object} Returns `object`. + */ + var baseForRight = createBaseFor(true); + + /** + * The base implementation of `_.forOwn` without support for iteratee shorthands. + * + * @private + * @param {Object} object The object to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Object} Returns `object`. + */ + function baseForOwn(object, iteratee) { + return object && baseFor(object, iteratee, keys); + } + + /** + * The base implementation of `_.forOwnRight` without support for iteratee shorthands. + * + * @private + * @param {Object} object The object to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Object} Returns `object`. + */ + function baseForOwnRight(object, iteratee) { + return object && baseForRight(object, iteratee, keys); + } + + /** + * The base implementation of `_.functions` which creates an array of + * `object` function property names filtered from `props`. + * + * @private + * @param {Object} object The object to inspect. + * @param {Array} props The property names to filter. + * @returns {Array} Returns the function names. + */ + function baseFunctions(object, props) { + return arrayFilter(props, function(key) { + return isFunction(object[key]); + }); + } + + /** + * The base implementation of `_.get` without support for default values. + * + * @private + * @param {Object} object The object to query. + * @param {Array|string} path The path of the property to get. + * @returns {*} Returns the resolved value. + */ + function baseGet(object, path) { + path = castPath(path, object); + + var index = 0, + length = path.length; + + while (object != null && index < length) { + object = object[toKey(path[index++])]; + } + return (index && index == length) ? object : undefined; + } + + /** + * The base implementation of `getAllKeys` and `getAllKeysIn` which uses + * `keysFunc` and `symbolsFunc` to get the enumerable property names and + * symbols of `object`. + * + * @private + * @param {Object} object The object to query. + * @param {Function} keysFunc The function to get the keys of `object`. + * @param {Function} symbolsFunc The function to get the symbols of `object`. + * @returns {Array} Returns the array of property names and symbols. + */ + function baseGetAllKeys(object, keysFunc, symbolsFunc) { + var result = keysFunc(object); + return isArray(object) ? result : arrayPush(result, symbolsFunc(object)); + } + + /** + * The base implementation of `getTag` without fallbacks for buggy environments. + * + * @private + * @param {*} value The value to query. + * @returns {string} Returns the `toStringTag`. + */ + function baseGetTag(value) { + if (value == null) { + return value === undefined ? undefinedTag : nullTag; + } + return (symToStringTag && symToStringTag in Object(value)) + ? getRawTag(value) + : objectToString(value); + } + + /** + * The base implementation of `_.gt` which doesn't coerce arguments. + * + * @private + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if `value` is greater than `other`, + * else `false`. + */ + function baseGt(value, other) { + return value > other; + } + + /** + * The base implementation of `_.has` without support for deep paths. + * + * @private + * @param {Object} [object] The object to query. + * @param {Array|string} key The key to check. + * @returns {boolean} Returns `true` if `key` exists, else `false`. + */ + function baseHas(object, key) { + return object != null && hasOwnProperty.call(object, key); + } + + /** + * The base implementation of `_.hasIn` without support for deep paths. + * + * @private + * @param {Object} [object] The object to query. + * @param {Array|string} key The key to check. + * @returns {boolean} Returns `true` if `key` exists, else `false`. + */ + function baseHasIn(object, key) { + return object != null && key in Object(object); + } + + /** + * The base implementation of `_.inRange` which doesn't coerce arguments. + * + * @private + * @param {number} number The number to check. + * @param {number} start The start of the range. + * @param {number} end The end of the range. + * @returns {boolean} Returns `true` if `number` is in the range, else `false`. + */ + function baseInRange(number, start, end) { + return number >= nativeMin(start, end) && number < nativeMax(start, end); + } + + /** + * The base implementation of methods like `_.intersection`, without support + * for iteratee shorthands, that accepts an array of arrays to inspect. + * + * @private + * @param {Array} arrays The arrays to inspect. + * @param {Function} [iteratee] The iteratee invoked per element. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of shared values. + */ + function baseIntersection(arrays, iteratee, comparator) { + var includes = comparator ? arrayIncludesWith : arrayIncludes, + length = arrays[0].length, + othLength = arrays.length, + othIndex = othLength, + caches = Array(othLength), + maxLength = Infinity, + result = []; + + while (othIndex--) { + var array = arrays[othIndex]; + if (othIndex && iteratee) { + array = arrayMap(array, baseUnary(iteratee)); + } + maxLength = nativeMin(array.length, maxLength); + caches[othIndex] = !comparator && (iteratee || (length >= 120 && array.length >= 120)) + ? new SetCache(othIndex && array) + : undefined; + } + array = arrays[0]; + + var index = -1, + seen = caches[0]; + + outer: + while (++index < length && result.length < maxLength) { + var value = array[index], + computed = iteratee ? iteratee(value) : value; + + value = (comparator || value !== 0) ? value : 0; + if (!(seen + ? cacheHas(seen, computed) + : includes(result, computed, comparator) + )) { + othIndex = othLength; + while (--othIndex) { + var cache = caches[othIndex]; + if (!(cache + ? cacheHas(cache, computed) + : includes(arrays[othIndex], computed, comparator)) + ) { + continue outer; + } + } + if (seen) { + seen.push(computed); + } + result.push(value); + } + } + return result; + } + + /** + * The base implementation of `_.invert` and `_.invertBy` which inverts + * `object` with values transformed by `iteratee` and set by `setter`. + * + * @private + * @param {Object} object The object to iterate over. + * @param {Function} setter The function to set `accumulator` values. + * @param {Function} iteratee The iteratee to transform values. + * @param {Object} accumulator The initial inverted object. + * @returns {Function} Returns `accumulator`. + */ + function baseInverter(object, setter, iteratee, accumulator) { + baseForOwn(object, function(value, key, object) { + setter(accumulator, iteratee(value), key, object); + }); + return accumulator; + } + + /** + * The base implementation of `_.invoke` without support for individual + * method arguments. + * + * @private + * @param {Object} object The object to query. + * @param {Array|string} path The path of the method to invoke. + * @param {Array} args The arguments to invoke the method with. + * @returns {*} Returns the result of the invoked method. + */ + function baseInvoke(object, path, args) { + path = castPath(path, object); + object = parent(object, path); + var func = object == null ? object : object[toKey(last(path))]; + return func == null ? undefined : apply(func, object, args); + } + + /** + * The base implementation of `_.isArguments`. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an `arguments` object, + */ + function baseIsArguments(value) { + return isObjectLike(value) && baseGetTag(value) == argsTag; + } + + /** + * The base implementation of `_.isArrayBuffer` without Node.js optimizations. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`. + */ + function baseIsArrayBuffer(value) { + return isObjectLike(value) && baseGetTag(value) == arrayBufferTag; + } + + /** + * The base implementation of `_.isDate` without Node.js optimizations. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a date object, else `false`. + */ + function baseIsDate(value) { + return isObjectLike(value) && baseGetTag(value) == dateTag; + } + + /** + * The base implementation of `_.isEqual` which supports partial comparisons + * and tracks traversed objects. + * + * @private + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @param {boolean} bitmask The bitmask flags. + * 1 - Unordered comparison + * 2 - Partial comparison + * @param {Function} [customizer] The function to customize comparisons. + * @param {Object} [stack] Tracks traversed `value` and `other` objects. + * @returns {boolean} Returns `true` if the values are equivalent, else `false`. + */ + function baseIsEqual(value, other, bitmask, customizer, stack) { + if (value === other) { + return true; + } + if (value == null || other == null || (!isObjectLike(value) && !isObjectLike(other))) { + return value !== value && other !== other; + } + return baseIsEqualDeep(value, other, bitmask, customizer, baseIsEqual, stack); + } + + /** + * A specialized version of `baseIsEqual` for arrays and objects which performs + * deep comparisons and tracks traversed objects enabling objects with circular + * references to be compared. + * + * @private + * @param {Object} object The object to compare. + * @param {Object} other The other object to compare. + * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. + * @param {Function} customizer The function to customize comparisons. + * @param {Function} equalFunc The function to determine equivalents of values. + * @param {Object} [stack] Tracks traversed `object` and `other` objects. + * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. + */ + function baseIsEqualDeep(object, other, bitmask, customizer, equalFunc, stack) { + var objIsArr = isArray(object), + othIsArr = isArray(other), + objTag = objIsArr ? arrayTag : getTag(object), + othTag = othIsArr ? arrayTag : getTag(other); + + objTag = objTag == argsTag ? objectTag : objTag; + othTag = othTag == argsTag ? objectTag : othTag; + + var objIsObj = objTag == objectTag, + othIsObj = othTag == objectTag, + isSameTag = objTag == othTag; + + if (isSameTag && isBuffer(object)) { + if (!isBuffer(other)) { + return false; + } + objIsArr = true; + objIsObj = false; + } + if (isSameTag && !objIsObj) { + stack || (stack = new Stack); + return (objIsArr || isTypedArray(object)) + ? equalArrays(object, other, bitmask, customizer, equalFunc, stack) + : equalByTag(object, other, objTag, bitmask, customizer, equalFunc, stack); + } + if (!(bitmask & COMPARE_PARTIAL_FLAG)) { + var objIsWrapped = objIsObj && hasOwnProperty.call(object, '__wrapped__'), + othIsWrapped = othIsObj && hasOwnProperty.call(other, '__wrapped__'); + + if (objIsWrapped || othIsWrapped) { + var objUnwrapped = objIsWrapped ? object.value() : object, + othUnwrapped = othIsWrapped ? other.value() : other; + + stack || (stack = new Stack); + return equalFunc(objUnwrapped, othUnwrapped, bitmask, customizer, stack); + } + } + if (!isSameTag) { + return false; + } + stack || (stack = new Stack); + return equalObjects(object, other, bitmask, customizer, equalFunc, stack); + } + + /** + * The base implementation of `_.isMap` without Node.js optimizations. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a map, else `false`. + */ + function baseIsMap(value) { + return isObjectLike(value) && getTag(value) == mapTag; + } + + /** + * The base implementation of `_.isMatch` without support for iteratee shorthands. + * + * @private + * @param {Object} object The object to inspect. + * @param {Object} source The object of property values to match. + * @param {Array} matchData The property names, values, and compare flags to match. + * @param {Function} [customizer] The function to customize comparisons. + * @returns {boolean} Returns `true` if `object` is a match, else `false`. + */ + function baseIsMatch(object, source, matchData, customizer) { + var index = matchData.length, + length = index, + noCustomizer = !customizer; + + if (object == null) { + return !length; + } + object = Object(object); + while (index--) { + var data = matchData[index]; + if ((noCustomizer && data[2]) + ? data[1] !== object[data[0]] + : !(data[0] in object) + ) { + return false; + } + } + while (++index < length) { + data = matchData[index]; + var key = data[0], + objValue = object[key], + srcValue = data[1]; + + if (noCustomizer && data[2]) { + if (objValue === undefined && !(key in object)) { + return false; + } + } else { + var stack = new Stack; + if (customizer) { + var result = customizer(objValue, srcValue, key, object, source, stack); + } + if (!(result === undefined + ? baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG, customizer, stack) + : result + )) { + return false; + } + } + } + return true; + } + + /** + * The base implementation of `_.isNative` without bad shim checks. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a native function, + * else `false`. + */ + function baseIsNative(value) { + if (!isObject(value) || isMasked(value)) { + return false; + } + var pattern = isFunction(value) ? reIsNative : reIsHostCtor; + return pattern.test(toSource(value)); + } + + /** + * The base implementation of `_.isRegExp` without Node.js optimizations. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a regexp, else `false`. + */ + function baseIsRegExp(value) { + return isObjectLike(value) && baseGetTag(value) == regexpTag; + } + + /** + * The base implementation of `_.isSet` without Node.js optimizations. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a set, else `false`. + */ + function baseIsSet(value) { + return isObjectLike(value) && getTag(value) == setTag; + } + + /** + * The base implementation of `_.isTypedArray` without Node.js optimizations. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a typed array, else `false`. + */ + function baseIsTypedArray(value) { + return isObjectLike(value) && + isLength(value.length) && !!typedArrayTags[baseGetTag(value)]; + } + + /** + * The base implementation of `_.iteratee`. + * + * @private + * @param {*} [value=_.identity] The value to convert to an iteratee. + * @returns {Function} Returns the iteratee. + */ + function baseIteratee(value) { + // Don't store the `typeof` result in a variable to avoid a JIT bug in Safari 9. + // See https://bugs.webkit.org/show_bug.cgi?id=156034 for more details. + if (typeof value == 'function') { + return value; + } + if (value == null) { + return identity; + } + if (typeof value == 'object') { + return isArray(value) + ? baseMatchesProperty(value[0], value[1]) + : baseMatches(value); + } + return property(value); + } + + /** + * The base implementation of `_.keys` which doesn't treat sparse arrays as dense. + * + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names. + */ + function baseKeys(object) { + if (!isPrototype(object)) { + return nativeKeys(object); + } + var result = []; + for (var key in Object(object)) { + if (hasOwnProperty.call(object, key) && key != 'constructor') { + result.push(key); + } + } + return result; + } + + /** + * The base implementation of `_.keysIn` which doesn't treat sparse arrays as dense. + * + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names. + */ + function baseKeysIn(object) { + if (!isObject(object)) { + return nativeKeysIn(object); + } + var isProto = isPrototype(object), + result = []; + + for (var key in object) { + if (!(key == 'constructor' && (isProto || !hasOwnProperty.call(object, key)))) { + result.push(key); + } + } + return result; + } + + /** + * The base implementation of `_.lt` which doesn't coerce arguments. + * + * @private + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if `value` is less than `other`, + * else `false`. + */ + function baseLt(value, other) { + return value < other; + } + + /** + * The base implementation of `_.map` without support for iteratee shorthands. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array} Returns the new mapped array. + */ + function baseMap(collection, iteratee) { + var index = -1, + result = isArrayLike(collection) ? Array(collection.length) : []; + + baseEach(collection, function(value, key, collection) { + result[++index] = iteratee(value, key, collection); + }); + return result; + } + + /** + * The base implementation of `_.matches` which doesn't clone `source`. + * + * @private + * @param {Object} source The object of property values to match. + * @returns {Function} Returns the new spec function. + */ + function baseMatches(source) { + var matchData = getMatchData(source); + if (matchData.length == 1 && matchData[0][2]) { + return matchesStrictComparable(matchData[0][0], matchData[0][1]); + } + return function(object) { + return object === source || baseIsMatch(object, source, matchData); + }; + } + + /** + * The base implementation of `_.matchesProperty` which doesn't clone `srcValue`. + * + * @private + * @param {string} path The path of the property to get. + * @param {*} srcValue The value to match. + * @returns {Function} Returns the new spec function. + */ + function baseMatchesProperty(path, srcValue) { + if (isKey(path) && isStrictComparable(srcValue)) { + return matchesStrictComparable(toKey(path), srcValue); + } + return function(object) { + var objValue = get(object, path); + return (objValue === undefined && objValue === srcValue) + ? hasIn(object, path) + : baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG); + }; + } + + /** + * The base implementation of `_.merge` without support for multiple sources. + * + * @private + * @param {Object} object The destination object. + * @param {Object} source The source object. + * @param {number} srcIndex The index of `source`. + * @param {Function} [customizer] The function to customize merged values. + * @param {Object} [stack] Tracks traversed source values and their merged + * counterparts. + */ + function baseMerge(object, source, srcIndex, customizer, stack) { + if (object === source) { + return; + } + baseFor(source, function(srcValue, key) { + if (isObject(srcValue)) { + stack || (stack = new Stack); + baseMergeDeep(object, source, key, srcIndex, baseMerge, customizer, stack); + } + else { + var newValue = customizer + ? customizer(object[key], srcValue, (key + ''), object, source, stack) + : undefined; + + if (newValue === undefined) { + newValue = srcValue; + } + assignMergeValue(object, key, newValue); + } + }, keysIn); + } + + /** + * A specialized version of `baseMerge` for arrays and objects which performs + * deep merges and tracks traversed objects enabling objects with circular + * references to be merged. + * + * @private + * @param {Object} object The destination object. + * @param {Object} source The source object. + * @param {string} key The key of the value to merge. + * @param {number} srcIndex The index of `source`. + * @param {Function} mergeFunc The function to merge values. + * @param {Function} [customizer] The function to customize assigned values. + * @param {Object} [stack] Tracks traversed source values and their merged + * counterparts. + */ + function baseMergeDeep(object, source, key, srcIndex, mergeFunc, customizer, stack) { + var objValue = object[key], + srcValue = source[key], + stacked = stack.get(srcValue); + + if (stacked) { + assignMergeValue(object, key, stacked); + return; + } + var newValue = customizer + ? customizer(objValue, srcValue, (key + ''), object, source, stack) + : undefined; + + var isCommon = newValue === undefined; + + if (isCommon) { + var isArr = isArray(srcValue), + isBuff = !isArr && isBuffer(srcValue), + isTyped = !isArr && !isBuff && isTypedArray(srcValue); + + newValue = srcValue; + if (isArr || isBuff || isTyped) { + if (isArray(objValue)) { + newValue = objValue; + } + else if (isArrayLikeObject(objValue)) { + newValue = copyArray(objValue); + } + else if (isBuff) { + isCommon = false; + newValue = cloneBuffer(srcValue, true); + } + else if (isTyped) { + isCommon = false; + newValue = cloneTypedArray(srcValue, true); + } + else { + newValue = []; + } + } + else if (isPlainObject(srcValue) || isArguments(srcValue)) { + newValue = objValue; + if (isArguments(objValue)) { + newValue = toPlainObject(objValue); + } + else if (!isObject(objValue) || (srcIndex && isFunction(objValue))) { + newValue = initCloneObject(srcValue); + } + } + else { + isCommon = false; + } + } + if (isCommon) { + // Recursively merge objects and arrays (susceptible to call stack limits). + stack.set(srcValue, newValue); + mergeFunc(newValue, srcValue, srcIndex, customizer, stack); + stack['delete'](srcValue); + } + assignMergeValue(object, key, newValue); + } + + /** + * The base implementation of `_.nth` which doesn't coerce arguments. + * + * @private + * @param {Array} array The array to query. + * @param {number} n The index of the element to return. + * @returns {*} Returns the nth element of `array`. + */ + function baseNth(array, n) { + var length = array.length; + if (!length) { + return; + } + n += n < 0 ? length : 0; + return isIndex(n, length) ? array[n] : undefined; + } + + /** + * The base implementation of `_.orderBy` without param guards. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function[]|Object[]|string[]} iteratees The iteratees to sort by. + * @param {string[]} orders The sort orders of `iteratees`. + * @returns {Array} Returns the new sorted array. + */ + function baseOrderBy(collection, iteratees, orders) { + var index = -1; + iteratees = arrayMap(iteratees.length ? iteratees : [identity], baseUnary(getIteratee())); + + var result = baseMap(collection, function(value, key, collection) { + var criteria = arrayMap(iteratees, function(iteratee) { + return iteratee(value); + }); + return { 'criteria': criteria, 'index': ++index, 'value': value }; + }); + + return baseSortBy(result, function(object, other) { + return compareMultiple(object, other, orders); + }); + } + + /** + * The base implementation of `_.pick` without support for individual + * property identifiers. + * + * @private + * @param {Object} object The source object. + * @param {string[]} paths The property paths to pick. + * @returns {Object} Returns the new object. + */ + function basePick(object, paths) { + return basePickBy(object, paths, function(value, path) { + return hasIn(object, path); + }); + } + + /** + * The base implementation of `_.pickBy` without support for iteratee shorthands. + * + * @private + * @param {Object} object The source object. + * @param {string[]} paths The property paths to pick. + * @param {Function} predicate The function invoked per property. + * @returns {Object} Returns the new object. + */ + function basePickBy(object, paths, predicate) { + var index = -1, + length = paths.length, + result = {}; + + while (++index < length) { + var path = paths[index], + value = baseGet(object, path); + + if (predicate(value, path)) { + baseSet(result, castPath(path, object), value); + } + } + return result; + } + + /** + * A specialized version of `baseProperty` which supports deep paths. + * + * @private + * @param {Array|string} path The path of the property to get. + * @returns {Function} Returns the new accessor function. + */ + function basePropertyDeep(path) { + return function(object) { + return baseGet(object, path); + }; + } + + /** + * The base implementation of `_.pullAllBy` without support for iteratee + * shorthands. + * + * @private + * @param {Array} array The array to modify. + * @param {Array} values The values to remove. + * @param {Function} [iteratee] The iteratee invoked per element. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns `array`. + */ + function basePullAll(array, values, iteratee, comparator) { + var indexOf = comparator ? baseIndexOfWith : baseIndexOf, + index = -1, + length = values.length, + seen = array; + + if (array === values) { + values = copyArray(values); + } + if (iteratee) { + seen = arrayMap(array, baseUnary(iteratee)); + } + while (++index < length) { + var fromIndex = 0, + value = values[index], + computed = iteratee ? iteratee(value) : value; + + while ((fromIndex = indexOf(seen, computed, fromIndex, comparator)) > -1) { + if (seen !== array) { + splice.call(seen, fromIndex, 1); + } + splice.call(array, fromIndex, 1); + } + } + return array; + } + + /** + * The base implementation of `_.pullAt` without support for individual + * indexes or capturing the removed elements. + * + * @private + * @param {Array} array The array to modify. + * @param {number[]} indexes The indexes of elements to remove. + * @returns {Array} Returns `array`. + */ + function basePullAt(array, indexes) { + var length = array ? indexes.length : 0, + lastIndex = length - 1; + + while (length--) { + var index = indexes[length]; + if (length == lastIndex || index !== previous) { + var previous = index; + if (isIndex(index)) { + splice.call(array, index, 1); + } else { + baseUnset(array, index); + } + } + } + return array; + } + + /** + * The base implementation of `_.random` without support for returning + * floating-point numbers. + * + * @private + * @param {number} lower The lower bound. + * @param {number} upper The upper bound. + * @returns {number} Returns the random number. + */ + function baseRandom(lower, upper) { + return lower + nativeFloor(nativeRandom() * (upper - lower + 1)); + } + + /** + * The base implementation of `_.range` and `_.rangeRight` which doesn't + * coerce arguments. + * + * @private + * @param {number} start The start of the range. + * @param {number} end The end of the range. + * @param {number} step The value to increment or decrement by. + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {Array} Returns the range of numbers. + */ + function baseRange(start, end, step, fromRight) { + var index = -1, + length = nativeMax(nativeCeil((end - start) / (step || 1)), 0), + result = Array(length); + + while (length--) { + result[fromRight ? length : ++index] = start; + start += step; + } + return result; + } + + /** + * The base implementation of `_.repeat` which doesn't coerce arguments. + * + * @private + * @param {string} string The string to repeat. + * @param {number} n The number of times to repeat the string. + * @returns {string} Returns the repeated string. + */ + function baseRepeat(string, n) { + var result = ''; + if (!string || n < 1 || n > MAX_SAFE_INTEGER) { + return result; + } + // Leverage the exponentiation by squaring algorithm for a faster repeat. + // See https://en.wikipedia.org/wiki/Exponentiation_by_squaring for more details. + do { + if (n % 2) { + result += string; + } + n = nativeFloor(n / 2); + if (n) { + string += string; + } + } while (n); + + return result; + } + + /** + * The base implementation of `_.rest` which doesn't validate or coerce arguments. + * + * @private + * @param {Function} func The function to apply a rest parameter to. + * @param {number} [start=func.length-1] The start position of the rest parameter. + * @returns {Function} Returns the new function. + */ + function baseRest(func, start) { + return setToString(overRest(func, start, identity), func + ''); + } + + /** + * The base implementation of `_.sample`. + * + * @private + * @param {Array|Object} collection The collection to sample. + * @returns {*} Returns the random element. + */ + function baseSample(collection) { + return arraySample(values(collection)); + } + + /** + * The base implementation of `_.sampleSize` without param guards. + * + * @private + * @param {Array|Object} collection The collection to sample. + * @param {number} n The number of elements to sample. + * @returns {Array} Returns the random elements. + */ + function baseSampleSize(collection, n) { + var array = values(collection); + return shuffleSelf(array, baseClamp(n, 0, array.length)); + } + + /** + * The base implementation of `_.set`. + * + * @private + * @param {Object} object The object to modify. + * @param {Array|string} path The path of the property to set. + * @param {*} value The value to set. + * @param {Function} [customizer] The function to customize path creation. + * @returns {Object} Returns `object`. + */ + function baseSet(object, path, value, customizer) { + if (!isObject(object)) { + return object; + } + path = castPath(path, object); + + var index = -1, + length = path.length, + lastIndex = length - 1, + nested = object; + + while (nested != null && ++index < length) { + var key = toKey(path[index]), + newValue = value; + + if (index != lastIndex) { + var objValue = nested[key]; + newValue = customizer ? customizer(objValue, key, nested) : undefined; + if (newValue === undefined) { + newValue = isObject(objValue) + ? objValue + : (isIndex(path[index + 1]) ? [] : {}); + } + } + assignValue(nested, key, newValue); + nested = nested[key]; + } + return object; + } + + /** + * The base implementation of `setData` without support for hot loop shorting. + * + * @private + * @param {Function} func The function to associate metadata with. + * @param {*} data The metadata. + * @returns {Function} Returns `func`. + */ + var baseSetData = !metaMap ? identity : function(func, data) { + metaMap.set(func, data); + return func; + }; + + /** + * The base implementation of `setToString` without support for hot loop shorting. + * + * @private + * @param {Function} func The function to modify. + * @param {Function} string The `toString` result. + * @returns {Function} Returns `func`. + */ + var baseSetToString = !defineProperty ? identity : function(func, string) { + return defineProperty(func, 'toString', { + 'configurable': true, + 'enumerable': false, + 'value': constant(string), + 'writable': true + }); + }; + + /** + * The base implementation of `_.shuffle`. + * + * @private + * @param {Array|Object} collection The collection to shuffle. + * @returns {Array} Returns the new shuffled array. + */ + function baseShuffle(collection) { + return shuffleSelf(values(collection)); + } + + /** + * The base implementation of `_.slice` without an iteratee call guard. + * + * @private + * @param {Array} array The array to slice. + * @param {number} [start=0] The start position. + * @param {number} [end=array.length] The end position. + * @returns {Array} Returns the slice of `array`. + */ + function baseSlice(array, start, end) { + var index = -1, + length = array.length; + + if (start < 0) { + start = -start > length ? 0 : (length + start); + } + end = end > length ? length : end; + if (end < 0) { + end += length; + } + length = start > end ? 0 : ((end - start) >>> 0); + start >>>= 0; + + var result = Array(length); + while (++index < length) { + result[index] = array[index + start]; + } + return result; + } + + /** + * The base implementation of `_.some` without support for iteratee shorthands. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {boolean} Returns `true` if any element passes the predicate check, + * else `false`. + */ + function baseSome(collection, predicate) { + var result; + + baseEach(collection, function(value, index, collection) { + result = predicate(value, index, collection); + return !result; + }); + return !!result; + } + + /** + * The base implementation of `_.sortedIndex` and `_.sortedLastIndex` which + * performs a binary search of `array` to determine the index at which `value` + * should be inserted into `array` in order to maintain its sort order. + * + * @private + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @param {boolean} [retHighest] Specify returning the highest qualified index. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. + */ + function baseSortedIndex(array, value, retHighest) { + var low = 0, + high = array == null ? low : array.length; + + if (typeof value == 'number' && value === value && high <= HALF_MAX_ARRAY_LENGTH) { + while (low < high) { + var mid = (low + high) >>> 1, + computed = array[mid]; + + if (computed !== null && !isSymbol(computed) && + (retHighest ? (computed <= value) : (computed < value))) { + low = mid + 1; + } else { + high = mid; + } + } + return high; + } + return baseSortedIndexBy(array, value, identity, retHighest); + } + + /** + * The base implementation of `_.sortedIndexBy` and `_.sortedLastIndexBy` + * which invokes `iteratee` for `value` and each element of `array` to compute + * their sort ranking. The iteratee is invoked with one argument; (value). + * + * @private + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @param {Function} iteratee The iteratee invoked per element. + * @param {boolean} [retHighest] Specify returning the highest qualified index. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. + */ + function baseSortedIndexBy(array, value, iteratee, retHighest) { + value = iteratee(value); + + var low = 0, + high = array == null ? 0 : array.length, + valIsNaN = value !== value, + valIsNull = value === null, + valIsSymbol = isSymbol(value), + valIsUndefined = value === undefined; + + while (low < high) { + var mid = nativeFloor((low + high) / 2), + computed = iteratee(array[mid]), + othIsDefined = computed !== undefined, + othIsNull = computed === null, + othIsReflexive = computed === computed, + othIsSymbol = isSymbol(computed); + + if (valIsNaN) { + var setLow = retHighest || othIsReflexive; + } else if (valIsUndefined) { + setLow = othIsReflexive && (retHighest || othIsDefined); + } else if (valIsNull) { + setLow = othIsReflexive && othIsDefined && (retHighest || !othIsNull); + } else if (valIsSymbol) { + setLow = othIsReflexive && othIsDefined && !othIsNull && (retHighest || !othIsSymbol); + } else if (othIsNull || othIsSymbol) { + setLow = false; + } else { + setLow = retHighest ? (computed <= value) : (computed < value); + } + if (setLow) { + low = mid + 1; + } else { + high = mid; + } + } + return nativeMin(high, MAX_ARRAY_INDEX); + } + + /** + * The base implementation of `_.sortedUniq` and `_.sortedUniqBy` without + * support for iteratee shorthands. + * + * @private + * @param {Array} array The array to inspect. + * @param {Function} [iteratee] The iteratee invoked per element. + * @returns {Array} Returns the new duplicate free array. + */ + function baseSortedUniq(array, iteratee) { + var index = -1, + length = array.length, + resIndex = 0, + result = []; + + while (++index < length) { + var value = array[index], + computed = iteratee ? iteratee(value) : value; + + if (!index || !eq(computed, seen)) { + var seen = computed; + result[resIndex++] = value === 0 ? 0 : value; + } + } + return result; + } + + /** + * The base implementation of `_.toNumber` which doesn't ensure correct + * conversions of binary, hexadecimal, or octal string values. + * + * @private + * @param {*} value The value to process. + * @returns {number} Returns the number. + */ + function baseToNumber(value) { + if (typeof value == 'number') { + return value; + } + if (isSymbol(value)) { + return NAN; + } + return +value; + } + + /** + * The base implementation of `_.toString` which doesn't convert nullish + * values to empty strings. + * + * @private + * @param {*} value The value to process. + * @returns {string} Returns the string. + */ + function baseToString(value) { + // Exit early for strings to avoid a performance hit in some environments. + if (typeof value == 'string') { + return value; + } + if (isArray(value)) { + // Recursively convert values (susceptible to call stack limits). + return arrayMap(value, baseToString) + ''; + } + if (isSymbol(value)) { + return symbolToString ? symbolToString.call(value) : ''; + } + var result = (value + ''); + return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result; + } + + /** + * The base implementation of `_.uniqBy` without support for iteratee shorthands. + * + * @private + * @param {Array} array The array to inspect. + * @param {Function} [iteratee] The iteratee invoked per element. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new duplicate free array. + */ + function baseUniq(array, iteratee, comparator) { + var index = -1, + includes = arrayIncludes, + length = array.length, + isCommon = true, + result = [], + seen = result; + + if (comparator) { + isCommon = false; + includes = arrayIncludesWith; + } + else if (length >= LARGE_ARRAY_SIZE) { + var set = iteratee ? null : createSet(array); + if (set) { + return setToArray(set); + } + isCommon = false; + includes = cacheHas; + seen = new SetCache; + } + else { + seen = iteratee ? [] : result; + } + outer: + while (++index < length) { + var value = array[index], + computed = iteratee ? iteratee(value) : value; + + value = (comparator || value !== 0) ? value : 0; + if (isCommon && computed === computed) { + var seenIndex = seen.length; + while (seenIndex--) { + if (seen[seenIndex] === computed) { + continue outer; + } + } + if (iteratee) { + seen.push(computed); + } + result.push(value); + } + else if (!includes(seen, computed, comparator)) { + if (seen !== result) { + seen.push(computed); + } + result.push(value); + } + } + return result; + } + + /** + * The base implementation of `_.unset`. + * + * @private + * @param {Object} object The object to modify. + * @param {Array|string} path The property path to unset. + * @returns {boolean} Returns `true` if the property is deleted, else `false`. + */ + function baseUnset(object, path) { + path = castPath(path, object); + object = parent(object, path); + return object == null || delete object[toKey(last(path))]; + } + + /** + * The base implementation of `_.update`. + * + * @private + * @param {Object} object The object to modify. + * @param {Array|string} path The path of the property to update. + * @param {Function} updater The function to produce the updated value. + * @param {Function} [customizer] The function to customize path creation. + * @returns {Object} Returns `object`. + */ + function baseUpdate(object, path, updater, customizer) { + return baseSet(object, path, updater(baseGet(object, path)), customizer); + } + + /** + * The base implementation of methods like `_.dropWhile` and `_.takeWhile` + * without support for iteratee shorthands. + * + * @private + * @param {Array} array The array to query. + * @param {Function} predicate The function invoked per iteration. + * @param {boolean} [isDrop] Specify dropping elements instead of taking them. + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {Array} Returns the slice of `array`. + */ + function baseWhile(array, predicate, isDrop, fromRight) { + var length = array.length, + index = fromRight ? length : -1; + + while ((fromRight ? index-- : ++index < length) && + predicate(array[index], index, array)) {} + + return isDrop + ? baseSlice(array, (fromRight ? 0 : index), (fromRight ? index + 1 : length)) + : baseSlice(array, (fromRight ? index + 1 : 0), (fromRight ? length : index)); + } + + /** + * The base implementation of `wrapperValue` which returns the result of + * performing a sequence of actions on the unwrapped `value`, where each + * successive action is supplied the return value of the previous. + * + * @private + * @param {*} value The unwrapped value. + * @param {Array} actions Actions to perform to resolve the unwrapped value. + * @returns {*} Returns the resolved value. + */ + function baseWrapperValue(value, actions) { + var result = value; + if (result instanceof LazyWrapper) { + result = result.value(); + } + return arrayReduce(actions, function(result, action) { + return action.func.apply(action.thisArg, arrayPush([result], action.args)); + }, result); + } + + /** + * The base implementation of methods like `_.xor`, without support for + * iteratee shorthands, that accepts an array of arrays to inspect. + * + * @private + * @param {Array} arrays The arrays to inspect. + * @param {Function} [iteratee] The iteratee invoked per element. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of values. + */ + function baseXor(arrays, iteratee, comparator) { + var length = arrays.length; + if (length < 2) { + return length ? baseUniq(arrays[0]) : []; + } + var index = -1, + result = Array(length); + + while (++index < length) { + var array = arrays[index], + othIndex = -1; + + while (++othIndex < length) { + if (othIndex != index) { + result[index] = baseDifference(result[index] || array, arrays[othIndex], iteratee, comparator); + } + } + } + return baseUniq(baseFlatten(result, 1), iteratee, comparator); + } + + /** + * This base implementation of `_.zipObject` which assigns values using `assignFunc`. + * + * @private + * @param {Array} props The property identifiers. + * @param {Array} values The property values. + * @param {Function} assignFunc The function to assign values. + * @returns {Object} Returns the new object. + */ + function baseZipObject(props, values, assignFunc) { + var index = -1, + length = props.length, + valsLength = values.length, + result = {}; + + while (++index < length) { + var value = index < valsLength ? values[index] : undefined; + assignFunc(result, props[index], value); + } + return result; + } + + /** + * Casts `value` to an empty array if it's not an array like object. + * + * @private + * @param {*} value The value to inspect. + * @returns {Array|Object} Returns the cast array-like object. + */ + function castArrayLikeObject(value) { + return isArrayLikeObject(value) ? value : []; + } + + /** + * Casts `value` to `identity` if it's not a function. + * + * @private + * @param {*} value The value to inspect. + * @returns {Function} Returns cast function. + */ + function castFunction(value) { + return typeof value == 'function' ? value : identity; + } + + /** + * Casts `value` to a path array if it's not one. + * + * @private + * @param {*} value The value to inspect. + * @param {Object} [object] The object to query keys on. + * @returns {Array} Returns the cast property path array. + */ + function castPath(value, object) { + if (isArray(value)) { + return value; + } + return isKey(value, object) ? [value] : stringToPath(toString(value)); + } + + /** + * A `baseRest` alias which can be replaced with `identity` by module + * replacement plugins. + * + * @private + * @type {Function} + * @param {Function} func The function to apply a rest parameter to. + * @returns {Function} Returns the new function. + */ + var castRest = baseRest; + + /** + * Casts `array` to a slice if it's needed. + * + * @private + * @param {Array} array The array to inspect. + * @param {number} start The start position. + * @param {number} [end=array.length] The end position. + * @returns {Array} Returns the cast slice. + */ + function castSlice(array, start, end) { + var length = array.length; + end = end === undefined ? length : end; + return (!start && end >= length) ? array : baseSlice(array, start, end); + } + + /** + * A simple wrapper around the global [`clearTimeout`](https://mdn.io/clearTimeout). + * + * @private + * @param {number|Object} id The timer id or timeout object of the timer to clear. + */ + var clearTimeout = ctxClearTimeout || function(id) { + return root.clearTimeout(id); + }; + + /** + * Creates a clone of `buffer`. + * + * @private + * @param {Buffer} buffer The buffer to clone. + * @param {boolean} [isDeep] Specify a deep clone. + * @returns {Buffer} Returns the cloned buffer. + */ + function cloneBuffer(buffer, isDeep) { + if (isDeep) { + return buffer.slice(); + } + var length = buffer.length, + result = allocUnsafe ? allocUnsafe(length) : new buffer.constructor(length); + + buffer.copy(result); + return result; + } + + /** + * Creates a clone of `arrayBuffer`. + * + * @private + * @param {ArrayBuffer} arrayBuffer The array buffer to clone. + * @returns {ArrayBuffer} Returns the cloned array buffer. + */ + function cloneArrayBuffer(arrayBuffer) { + var result = new arrayBuffer.constructor(arrayBuffer.byteLength); + new Uint8Array(result).set(new Uint8Array(arrayBuffer)); + return result; + } + + /** + * Creates a clone of `dataView`. + * + * @private + * @param {Object} dataView The data view to clone. + * @param {boolean} [isDeep] Specify a deep clone. + * @returns {Object} Returns the cloned data view. + */ + function cloneDataView(dataView, isDeep) { + var buffer = isDeep ? cloneArrayBuffer(dataView.buffer) : dataView.buffer; + return new dataView.constructor(buffer, dataView.byteOffset, dataView.byteLength); + } + + /** + * Creates a clone of `map`. + * + * @private + * @param {Object} map The map to clone. + * @param {Function} cloneFunc The function to clone values. + * @param {boolean} [isDeep] Specify a deep clone. + * @returns {Object} Returns the cloned map. + */ + function cloneMap(map, isDeep, cloneFunc) { + var array = isDeep ? cloneFunc(mapToArray(map), CLONE_DEEP_FLAG) : mapToArray(map); + return arrayReduce(array, addMapEntry, new map.constructor); + } + + /** + * Creates a clone of `regexp`. + * + * @private + * @param {Object} regexp The regexp to clone. + * @returns {Object} Returns the cloned regexp. + */ + function cloneRegExp(regexp) { + var result = new regexp.constructor(regexp.source, reFlags.exec(regexp)); + result.lastIndex = regexp.lastIndex; + return result; + } + + /** + * Creates a clone of `set`. + * + * @private + * @param {Object} set The set to clone. + * @param {Function} cloneFunc The function to clone values. + * @param {boolean} [isDeep] Specify a deep clone. + * @returns {Object} Returns the cloned set. + */ + function cloneSet(set, isDeep, cloneFunc) { + var array = isDeep ? cloneFunc(setToArray(set), CLONE_DEEP_FLAG) : setToArray(set); + return arrayReduce(array, addSetEntry, new set.constructor); + } + + /** + * Creates a clone of the `symbol` object. + * + * @private + * @param {Object} symbol The symbol object to clone. + * @returns {Object} Returns the cloned symbol object. + */ + function cloneSymbol(symbol) { + return symbolValueOf ? Object(symbolValueOf.call(symbol)) : {}; + } + + /** + * Creates a clone of `typedArray`. + * + * @private + * @param {Object} typedArray The typed array to clone. + * @param {boolean} [isDeep] Specify a deep clone. + * @returns {Object} Returns the cloned typed array. + */ + function cloneTypedArray(typedArray, isDeep) { + var buffer = isDeep ? cloneArrayBuffer(typedArray.buffer) : typedArray.buffer; + return new typedArray.constructor(buffer, typedArray.byteOffset, typedArray.length); + } + + /** + * Compares values to sort them in ascending order. + * + * @private + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {number} Returns the sort order indicator for `value`. + */ + function compareAscending(value, other) { + if (value !== other) { + var valIsDefined = value !== undefined, + valIsNull = value === null, + valIsReflexive = value === value, + valIsSymbol = isSymbol(value); + + var othIsDefined = other !== undefined, + othIsNull = other === null, + othIsReflexive = other === other, + othIsSymbol = isSymbol(other); + + if ((!othIsNull && !othIsSymbol && !valIsSymbol && value > other) || + (valIsSymbol && othIsDefined && othIsReflexive && !othIsNull && !othIsSymbol) || + (valIsNull && othIsDefined && othIsReflexive) || + (!valIsDefined && othIsReflexive) || + !valIsReflexive) { + return 1; + } + if ((!valIsNull && !valIsSymbol && !othIsSymbol && value < other) || + (othIsSymbol && valIsDefined && valIsReflexive && !valIsNull && !valIsSymbol) || + (othIsNull && valIsDefined && valIsReflexive) || + (!othIsDefined && valIsReflexive) || + !othIsReflexive) { + return -1; + } + } + return 0; + } + + /** + * Used by `_.orderBy` to compare multiple properties of a value to another + * and stable sort them. + * + * If `orders` is unspecified, all values are sorted in ascending order. Otherwise, + * specify an order of "desc" for descending or "asc" for ascending sort order + * of corresponding values. + * + * @private + * @param {Object} object The object to compare. + * @param {Object} other The other object to compare. + * @param {boolean[]|string[]} orders The order to sort by for each property. + * @returns {number} Returns the sort order indicator for `object`. + */ + function compareMultiple(object, other, orders) { + var index = -1, + objCriteria = object.criteria, + othCriteria = other.criteria, + length = objCriteria.length, + ordersLength = orders.length; + + while (++index < length) { + var result = compareAscending(objCriteria[index], othCriteria[index]); + if (result) { + if (index >= ordersLength) { + return result; + } + var order = orders[index]; + return result * (order == 'desc' ? -1 : 1); + } + } + // Fixes an `Array#sort` bug in the JS engine embedded in Adobe applications + // that causes it, under certain circumstances, to provide the same value for + // `object` and `other`. See https://github.com/jashkenas/underscore/pull/1247 + // for more details. + // + // This also ensures a stable sort in V8 and other engines. + // See https://bugs.chromium.org/p/v8/issues/detail?id=90 for more details. + return object.index - other.index; + } + + /** + * Creates an array that is the composition of partially applied arguments, + * placeholders, and provided arguments into a single array of arguments. + * + * @private + * @param {Array} args The provided arguments. + * @param {Array} partials The arguments to prepend to those provided. + * @param {Array} holders The `partials` placeholder indexes. + * @params {boolean} [isCurried] Specify composing for a curried function. + * @returns {Array} Returns the new array of composed arguments. + */ + function composeArgs(args, partials, holders, isCurried) { + var argsIndex = -1, + argsLength = args.length, + holdersLength = holders.length, + leftIndex = -1, + leftLength = partials.length, + rangeLength = nativeMax(argsLength - holdersLength, 0), + result = Array(leftLength + rangeLength), + isUncurried = !isCurried; + + while (++leftIndex < leftLength) { + result[leftIndex] = partials[leftIndex]; + } + while (++argsIndex < holdersLength) { + if (isUncurried || argsIndex < argsLength) { + result[holders[argsIndex]] = args[argsIndex]; + } + } + while (rangeLength--) { + result[leftIndex++] = args[argsIndex++]; + } + return result; + } + + /** + * This function is like `composeArgs` except that the arguments composition + * is tailored for `_.partialRight`. + * + * @private + * @param {Array} args The provided arguments. + * @param {Array} partials The arguments to append to those provided. + * @param {Array} holders The `partials` placeholder indexes. + * @params {boolean} [isCurried] Specify composing for a curried function. + * @returns {Array} Returns the new array of composed arguments. + */ + function composeArgsRight(args, partials, holders, isCurried) { + var argsIndex = -1, + argsLength = args.length, + holdersIndex = -1, + holdersLength = holders.length, + rightIndex = -1, + rightLength = partials.length, + rangeLength = nativeMax(argsLength - holdersLength, 0), + result = Array(rangeLength + rightLength), + isUncurried = !isCurried; + + while (++argsIndex < rangeLength) { + result[argsIndex] = args[argsIndex]; + } + var offset = argsIndex; + while (++rightIndex < rightLength) { + result[offset + rightIndex] = partials[rightIndex]; + } + while (++holdersIndex < holdersLength) { + if (isUncurried || argsIndex < argsLength) { + result[offset + holders[holdersIndex]] = args[argsIndex++]; + } + } + return result; + } + + /** + * Copies the values of `source` to `array`. + * + * @private + * @param {Array} source The array to copy values from. + * @param {Array} [array=[]] The array to copy values to. + * @returns {Array} Returns `array`. + */ + function copyArray(source, array) { + var index = -1, + length = source.length; + + array || (array = Array(length)); + while (++index < length) { + array[index] = source[index]; + } + return array; + } + + /** + * Copies properties of `source` to `object`. + * + * @private + * @param {Object} source The object to copy properties from. + * @param {Array} props The property identifiers to copy. + * @param {Object} [object={}] The object to copy properties to. + * @param {Function} [customizer] The function to customize copied values. + * @returns {Object} Returns `object`. + */ + function copyObject(source, props, object, customizer) { + var isNew = !object; + object || (object = {}); + + var index = -1, + length = props.length; + + while (++index < length) { + var key = props[index]; + + var newValue = customizer + ? customizer(object[key], source[key], key, object, source) + : undefined; + + if (newValue === undefined) { + newValue = source[key]; + } + if (isNew) { + baseAssignValue(object, key, newValue); + } else { + assignValue(object, key, newValue); + } + } + return object; + } + + /** + * Copies own symbols of `source` to `object`. + * + * @private + * @param {Object} source The object to copy symbols from. + * @param {Object} [object={}] The object to copy symbols to. + * @returns {Object} Returns `object`. + */ + function copySymbols(source, object) { + return copyObject(source, getSymbols(source), object); + } + + /** + * Copies own and inherited symbols of `source` to `object`. + * + * @private + * @param {Object} source The object to copy symbols from. + * @param {Object} [object={}] The object to copy symbols to. + * @returns {Object} Returns `object`. + */ + function copySymbolsIn(source, object) { + return copyObject(source, getSymbolsIn(source), object); + } + + /** + * Creates a function like `_.groupBy`. + * + * @private + * @param {Function} setter The function to set accumulator values. + * @param {Function} [initializer] The accumulator object initializer. + * @returns {Function} Returns the new aggregator function. + */ + function createAggregator(setter, initializer) { + return function(collection, iteratee) { + var func = isArray(collection) ? arrayAggregator : baseAggregator, + accumulator = initializer ? initializer() : {}; + + return func(collection, setter, getIteratee(iteratee, 2), accumulator); + }; + } + + /** + * Creates a function like `_.assign`. + * + * @private + * @param {Function} assigner The function to assign values. + * @returns {Function} Returns the new assigner function. + */ + function createAssigner(assigner) { + return baseRest(function(object, sources) { + var index = -1, + length = sources.length, + customizer = length > 1 ? sources[length - 1] : undefined, + guard = length > 2 ? sources[2] : undefined; + + customizer = (assigner.length > 3 && typeof customizer == 'function') + ? (length--, customizer) + : undefined; + + if (guard && isIterateeCall(sources[0], sources[1], guard)) { + customizer = length < 3 ? undefined : customizer; + length = 1; + } + object = Object(object); + while (++index < length) { + var source = sources[index]; + if (source) { + assigner(object, source, index, customizer); + } + } + return object; + }); + } + + /** + * Creates a `baseEach` or `baseEachRight` function. + * + * @private + * @param {Function} eachFunc The function to iterate over a collection. + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {Function} Returns the new base function. + */ + function createBaseEach(eachFunc, fromRight) { + return function(collection, iteratee) { + if (collection == null) { + return collection; + } + if (!isArrayLike(collection)) { + return eachFunc(collection, iteratee); + } + var length = collection.length, + index = fromRight ? length : -1, + iterable = Object(collection); + + while ((fromRight ? index-- : ++index < length)) { + if (iteratee(iterable[index], index, iterable) === false) { + break; + } + } + return collection; + }; + } + + /** + * Creates a base function for methods like `_.forIn` and `_.forOwn`. + * + * @private + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {Function} Returns the new base function. + */ + function createBaseFor(fromRight) { + return function(object, iteratee, keysFunc) { + var index = -1, + iterable = Object(object), + props = keysFunc(object), + length = props.length; + + while (length--) { + var key = props[fromRight ? length : ++index]; + if (iteratee(iterable[key], key, iterable) === false) { + break; + } + } + return object; + }; + } + + /** + * Creates a function that wraps `func` to invoke it with the optional `this` + * binding of `thisArg`. + * + * @private + * @param {Function} func The function to wrap. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @param {*} [thisArg] The `this` binding of `func`. + * @returns {Function} Returns the new wrapped function. + */ + function createBind(func, bitmask, thisArg) { + var isBind = bitmask & WRAP_BIND_FLAG, + Ctor = createCtor(func); + + function wrapper() { + var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; + return fn.apply(isBind ? thisArg : this, arguments); + } + return wrapper; + } + + /** + * Creates a function like `_.lowerFirst`. + * + * @private + * @param {string} methodName The name of the `String` case method to use. + * @returns {Function} Returns the new case function. + */ + function createCaseFirst(methodName) { + return function(string) { + string = toString(string); + + var strSymbols = hasUnicode(string) + ? stringToArray(string) + : undefined; + + var chr = strSymbols + ? strSymbols[0] + : string.charAt(0); + + var trailing = strSymbols + ? castSlice(strSymbols, 1).join('') + : string.slice(1); + + return chr[methodName]() + trailing; + }; + } + + /** + * Creates a function like `_.camelCase`. + * + * @private + * @param {Function} callback The function to combine each word. + * @returns {Function} Returns the new compounder function. + */ + function createCompounder(callback) { + return function(string) { + return arrayReduce(words(deburr(string).replace(reApos, '')), callback, ''); + }; + } + + /** + * Creates a function that produces an instance of `Ctor` regardless of + * whether it was invoked as part of a `new` expression or by `call` or `apply`. + * + * @private + * @param {Function} Ctor The constructor to wrap. + * @returns {Function} Returns the new wrapped function. + */ + function createCtor(Ctor) { + return function() { + // Use a `switch` statement to work with class constructors. See + // http://ecma-international.org/ecma-262/7.0/#sec-ecmascript-function-objects-call-thisargument-argumentslist + // for more details. + var args = arguments; + switch (args.length) { + case 0: return new Ctor; + case 1: return new Ctor(args[0]); + case 2: return new Ctor(args[0], args[1]); + case 3: return new Ctor(args[0], args[1], args[2]); + case 4: return new Ctor(args[0], args[1], args[2], args[3]); + case 5: return new Ctor(args[0], args[1], args[2], args[3], args[4]); + case 6: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5]); + case 7: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5], args[6]); + } + var thisBinding = baseCreate(Ctor.prototype), + result = Ctor.apply(thisBinding, args); + + // Mimic the constructor's `return` behavior. + // See https://es5.github.io/#x13.2.2 for more details. + return isObject(result) ? result : thisBinding; + }; + } + + /** + * Creates a function that wraps `func` to enable currying. + * + * @private + * @param {Function} func The function to wrap. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @param {number} arity The arity of `func`. + * @returns {Function} Returns the new wrapped function. + */ + function createCurry(func, bitmask, arity) { + var Ctor = createCtor(func); + + function wrapper() { + var length = arguments.length, + args = Array(length), + index = length, + placeholder = getHolder(wrapper); + + while (index--) { + args[index] = arguments[index]; + } + var holders = (length < 3 && args[0] !== placeholder && args[length - 1] !== placeholder) + ? [] + : replaceHolders(args, placeholder); + + length -= holders.length; + if (length < arity) { + return createRecurry( + func, bitmask, createHybrid, wrapper.placeholder, undefined, + args, holders, undefined, undefined, arity - length); + } + var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; + return apply(fn, this, args); + } + return wrapper; + } + + /** + * Creates a `_.find` or `_.findLast` function. + * + * @private + * @param {Function} findIndexFunc The function to find the collection index. + * @returns {Function} Returns the new find function. + */ + function createFind(findIndexFunc) { + return function(collection, predicate, fromIndex) { + var iterable = Object(collection); + if (!isArrayLike(collection)) { + var iteratee = getIteratee(predicate, 3); + collection = keys(collection); + predicate = function(key) { return iteratee(iterable[key], key, iterable); }; + } + var index = findIndexFunc(collection, predicate, fromIndex); + return index > -1 ? iterable[iteratee ? collection[index] : index] : undefined; + }; + } + + /** + * Creates a `_.flow` or `_.flowRight` function. + * + * @private + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {Function} Returns the new flow function. + */ + function createFlow(fromRight) { + return flatRest(function(funcs) { + var length = funcs.length, + index = length, + prereq = LodashWrapper.prototype.thru; + + if (fromRight) { + funcs.reverse(); + } + while (index--) { + var func = funcs[index]; + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + if (prereq && !wrapper && getFuncName(func) == 'wrapper') { + var wrapper = new LodashWrapper([], true); + } + } + index = wrapper ? index : length; + while (++index < length) { + func = funcs[index]; + + var funcName = getFuncName(func), + data = funcName == 'wrapper' ? getData(func) : undefined; + + if (data && isLaziable(data[0]) && + data[1] == (WRAP_ARY_FLAG | WRAP_CURRY_FLAG | WRAP_PARTIAL_FLAG | WRAP_REARG_FLAG) && + !data[4].length && data[9] == 1 + ) { + wrapper = wrapper[getFuncName(data[0])].apply(wrapper, data[3]); + } else { + wrapper = (func.length == 1 && isLaziable(func)) + ? wrapper[funcName]() + : wrapper.thru(func); + } + } + return function() { + var args = arguments, + value = args[0]; + + if (wrapper && args.length == 1 && isArray(value)) { + return wrapper.plant(value).value(); + } + var index = 0, + result = length ? funcs[index].apply(this, args) : value; + + while (++index < length) { + result = funcs[index].call(this, result); + } + return result; + }; + }); + } + + /** + * Creates a function that wraps `func` to invoke it with optional `this` + * binding of `thisArg`, partial application, and currying. + * + * @private + * @param {Function|string} func The function or method name to wrap. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @param {*} [thisArg] The `this` binding of `func`. + * @param {Array} [partials] The arguments to prepend to those provided to + * the new function. + * @param {Array} [holders] The `partials` placeholder indexes. + * @param {Array} [partialsRight] The arguments to append to those provided + * to the new function. + * @param {Array} [holdersRight] The `partialsRight` placeholder indexes. + * @param {Array} [argPos] The argument positions of the new function. + * @param {number} [ary] The arity cap of `func`. + * @param {number} [arity] The arity of `func`. + * @returns {Function} Returns the new wrapped function. + */ + function createHybrid(func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, argPos, ary, arity) { + var isAry = bitmask & WRAP_ARY_FLAG, + isBind = bitmask & WRAP_BIND_FLAG, + isBindKey = bitmask & WRAP_BIND_KEY_FLAG, + isCurried = bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG), + isFlip = bitmask & WRAP_FLIP_FLAG, + Ctor = isBindKey ? undefined : createCtor(func); + + function wrapper() { + var length = arguments.length, + args = Array(length), + index = length; + + while (index--) { + args[index] = arguments[index]; + } + if (isCurried) { + var placeholder = getHolder(wrapper), + holdersCount = countHolders(args, placeholder); + } + if (partials) { + args = composeArgs(args, partials, holders, isCurried); + } + if (partialsRight) { + args = composeArgsRight(args, partialsRight, holdersRight, isCurried); + } + length -= holdersCount; + if (isCurried && length < arity) { + var newHolders = replaceHolders(args, placeholder); + return createRecurry( + func, bitmask, createHybrid, wrapper.placeholder, thisArg, + args, newHolders, argPos, ary, arity - length + ); + } + var thisBinding = isBind ? thisArg : this, + fn = isBindKey ? thisBinding[func] : func; + + length = args.length; + if (argPos) { + args = reorder(args, argPos); + } else if (isFlip && length > 1) { + args.reverse(); + } + if (isAry && ary < length) { + args.length = ary; + } + if (this && this !== root && this instanceof wrapper) { + fn = Ctor || createCtor(fn); + } + return fn.apply(thisBinding, args); + } + return wrapper; + } + + /** + * Creates a function like `_.invertBy`. + * + * @private + * @param {Function} setter The function to set accumulator values. + * @param {Function} toIteratee The function to resolve iteratees. + * @returns {Function} Returns the new inverter function. + */ + function createInverter(setter, toIteratee) { + return function(object, iteratee) { + return baseInverter(object, setter, toIteratee(iteratee), {}); + }; + } + + /** + * Creates a function that performs a mathematical operation on two values. + * + * @private + * @param {Function} operator The function to perform the operation. + * @param {number} [defaultValue] The value used for `undefined` arguments. + * @returns {Function} Returns the new mathematical operation function. + */ + function createMathOperation(operator, defaultValue) { + return function(value, other) { + var result; + if (value === undefined && other === undefined) { + return defaultValue; + } + if (value !== undefined) { + result = value; + } + if (other !== undefined) { + if (result === undefined) { + return other; + } + if (typeof value == 'string' || typeof other == 'string') { + value = baseToString(value); + other = baseToString(other); + } else { + value = baseToNumber(value); + other = baseToNumber(other); + } + result = operator(value, other); + } + return result; + }; + } + + /** + * Creates a function like `_.over`. + * + * @private + * @param {Function} arrayFunc The function to iterate over iteratees. + * @returns {Function} Returns the new over function. + */ + function createOver(arrayFunc) { + return flatRest(function(iteratees) { + iteratees = arrayMap(iteratees, baseUnary(getIteratee())); + return baseRest(function(args) { + var thisArg = this; + return arrayFunc(iteratees, function(iteratee) { + return apply(iteratee, thisArg, args); + }); + }); + }); + } + + /** + * Creates the padding for `string` based on `length`. The `chars` string + * is truncated if the number of characters exceeds `length`. + * + * @private + * @param {number} length The padding length. + * @param {string} [chars=' '] The string used as padding. + * @returns {string} Returns the padding for `string`. + */ + function createPadding(length, chars) { + chars = chars === undefined ? ' ' : baseToString(chars); + + var charsLength = chars.length; + if (charsLength < 2) { + return charsLength ? baseRepeat(chars, length) : chars; + } + var result = baseRepeat(chars, nativeCeil(length / stringSize(chars))); + return hasUnicode(chars) + ? castSlice(stringToArray(result), 0, length).join('') + : result.slice(0, length); + } + + /** + * Creates a function that wraps `func` to invoke it with the `this` binding + * of `thisArg` and `partials` prepended to the arguments it receives. + * + * @private + * @param {Function} func The function to wrap. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @param {*} thisArg The `this` binding of `func`. + * @param {Array} partials The arguments to prepend to those provided to + * the new function. + * @returns {Function} Returns the new wrapped function. + */ + function createPartial(func, bitmask, thisArg, partials) { + var isBind = bitmask & WRAP_BIND_FLAG, + Ctor = createCtor(func); + + function wrapper() { + var argsIndex = -1, + argsLength = arguments.length, + leftIndex = -1, + leftLength = partials.length, + args = Array(leftLength + argsLength), + fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; + + while (++leftIndex < leftLength) { + args[leftIndex] = partials[leftIndex]; + } + while (argsLength--) { + args[leftIndex++] = arguments[++argsIndex]; + } + return apply(fn, isBind ? thisArg : this, args); + } + return wrapper; + } + + /** + * Creates a `_.range` or `_.rangeRight` function. + * + * @private + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {Function} Returns the new range function. + */ + function createRange(fromRight) { + return function(start, end, step) { + if (step && typeof step != 'number' && isIterateeCall(start, end, step)) { + end = step = undefined; + } + // Ensure the sign of `-0` is preserved. + start = toFinite(start); + if (end === undefined) { + end = start; + start = 0; + } else { + end = toFinite(end); + } + step = step === undefined ? (start < end ? 1 : -1) : toFinite(step); + return baseRange(start, end, step, fromRight); + }; + } + + /** + * Creates a function that performs a relational operation on two values. + * + * @private + * @param {Function} operator The function to perform the operation. + * @returns {Function} Returns the new relational operation function. + */ + function createRelationalOperation(operator) { + return function(value, other) { + if (!(typeof value == 'string' && typeof other == 'string')) { + value = toNumber(value); + other = toNumber(other); + } + return operator(value, other); + }; + } + + /** + * Creates a function that wraps `func` to continue currying. + * + * @private + * @param {Function} func The function to wrap. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @param {Function} wrapFunc The function to create the `func` wrapper. + * @param {*} placeholder The placeholder value. + * @param {*} [thisArg] The `this` binding of `func`. + * @param {Array} [partials] The arguments to prepend to those provided to + * the new function. + * @param {Array} [holders] The `partials` placeholder indexes. + * @param {Array} [argPos] The argument positions of the new function. + * @param {number} [ary] The arity cap of `func`. + * @param {number} [arity] The arity of `func`. + * @returns {Function} Returns the new wrapped function. + */ + function createRecurry(func, bitmask, wrapFunc, placeholder, thisArg, partials, holders, argPos, ary, arity) { + var isCurry = bitmask & WRAP_CURRY_FLAG, + newHolders = isCurry ? holders : undefined, + newHoldersRight = isCurry ? undefined : holders, + newPartials = isCurry ? partials : undefined, + newPartialsRight = isCurry ? undefined : partials; + + bitmask |= (isCurry ? WRAP_PARTIAL_FLAG : WRAP_PARTIAL_RIGHT_FLAG); + bitmask &= ~(isCurry ? WRAP_PARTIAL_RIGHT_FLAG : WRAP_PARTIAL_FLAG); + + if (!(bitmask & WRAP_CURRY_BOUND_FLAG)) { + bitmask &= ~(WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG); + } + var newData = [ + func, bitmask, thisArg, newPartials, newHolders, newPartialsRight, + newHoldersRight, argPos, ary, arity + ]; + + var result = wrapFunc.apply(undefined, newData); + if (isLaziable(func)) { + setData(result, newData); + } + result.placeholder = placeholder; + return setWrapToString(result, func, bitmask); + } + + /** + * Creates a function like `_.round`. + * + * @private + * @param {string} methodName The name of the `Math` method to use when rounding. + * @returns {Function} Returns the new round function. + */ + function createRound(methodName) { + var func = Math[methodName]; + return function(number, precision) { + number = toNumber(number); + precision = precision == null ? 0 : nativeMin(toInteger(precision), 292); + if (precision) { + // Shift with exponential notation to avoid floating-point issues. + // See [MDN](https://mdn.io/round#Examples) for more details. + var pair = (toString(number) + 'e').split('e'), + value = func(pair[0] + 'e' + (+pair[1] + precision)); + + pair = (toString(value) + 'e').split('e'); + return +(pair[0] + 'e' + (+pair[1] - precision)); + } + return func(number); + }; + } + + /** + * Creates a set object of `values`. + * + * @private + * @param {Array} values The values to add to the set. + * @returns {Object} Returns the new set. + */ + var createSet = !(Set && (1 / setToArray(new Set([,-0]))[1]) == INFINITY) ? noop : function(values) { + return new Set(values); + }; + + /** + * Creates a `_.toPairs` or `_.toPairsIn` function. + * + * @private + * @param {Function} keysFunc The function to get the keys of a given object. + * @returns {Function} Returns the new pairs function. + */ + function createToPairs(keysFunc) { + return function(object) { + var tag = getTag(object); + if (tag == mapTag) { + return mapToArray(object); + } + if (tag == setTag) { + return setToPairs(object); + } + return baseToPairs(object, keysFunc(object)); + }; + } + + /** + * Creates a function that either curries or invokes `func` with optional + * `this` binding and partially applied arguments. + * + * @private + * @param {Function|string} func The function or method name to wrap. + * @param {number} bitmask The bitmask flags. + * 1 - `_.bind` + * 2 - `_.bindKey` + * 4 - `_.curry` or `_.curryRight` of a bound function + * 8 - `_.curry` + * 16 - `_.curryRight` + * 32 - `_.partial` + * 64 - `_.partialRight` + * 128 - `_.rearg` + * 256 - `_.ary` + * 512 - `_.flip` + * @param {*} [thisArg] The `this` binding of `func`. + * @param {Array} [partials] The arguments to be partially applied. + * @param {Array} [holders] The `partials` placeholder indexes. + * @param {Array} [argPos] The argument positions of the new function. + * @param {number} [ary] The arity cap of `func`. + * @param {number} [arity] The arity of `func`. + * @returns {Function} Returns the new wrapped function. + */ + function createWrap(func, bitmask, thisArg, partials, holders, argPos, ary, arity) { + var isBindKey = bitmask & WRAP_BIND_KEY_FLAG; + if (!isBindKey && typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + var length = partials ? partials.length : 0; + if (!length) { + bitmask &= ~(WRAP_PARTIAL_FLAG | WRAP_PARTIAL_RIGHT_FLAG); + partials = holders = undefined; + } + ary = ary === undefined ? ary : nativeMax(toInteger(ary), 0); + arity = arity === undefined ? arity : toInteger(arity); + length -= holders ? holders.length : 0; + + if (bitmask & WRAP_PARTIAL_RIGHT_FLAG) { + var partialsRight = partials, + holdersRight = holders; + + partials = holders = undefined; + } + var data = isBindKey ? undefined : getData(func); + + var newData = [ + func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, + argPos, ary, arity + ]; + + if (data) { + mergeData(newData, data); + } + func = newData[0]; + bitmask = newData[1]; + thisArg = newData[2]; + partials = newData[3]; + holders = newData[4]; + arity = newData[9] = newData[9] === undefined + ? (isBindKey ? 0 : func.length) + : nativeMax(newData[9] - length, 0); + + if (!arity && bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG)) { + bitmask &= ~(WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG); + } + if (!bitmask || bitmask == WRAP_BIND_FLAG) { + var result = createBind(func, bitmask, thisArg); + } else if (bitmask == WRAP_CURRY_FLAG || bitmask == WRAP_CURRY_RIGHT_FLAG) { + result = createCurry(func, bitmask, arity); + } else if ((bitmask == WRAP_PARTIAL_FLAG || bitmask == (WRAP_BIND_FLAG | WRAP_PARTIAL_FLAG)) && !holders.length) { + result = createPartial(func, bitmask, thisArg, partials); + } else { + result = createHybrid.apply(undefined, newData); + } + var setter = data ? baseSetData : setData; + return setWrapToString(setter(result, newData), func, bitmask); + } + + /** + * Used by `_.defaults` to customize its `_.assignIn` use to assign properties + * of source objects to the destination object for all destination properties + * that resolve to `undefined`. + * + * @private + * @param {*} objValue The destination value. + * @param {*} srcValue The source value. + * @param {string} key The key of the property to assign. + * @param {Object} object The parent object of `objValue`. + * @returns {*} Returns the value to assign. + */ + function customDefaultsAssignIn(objValue, srcValue, key, object) { + if (objValue === undefined || + (eq(objValue, objectProto[key]) && !hasOwnProperty.call(object, key))) { + return srcValue; + } + return objValue; + } + + /** + * Used by `_.defaultsDeep` to customize its `_.merge` use to merge source + * objects into destination objects that are passed thru. + * + * @private + * @param {*} objValue The destination value. + * @param {*} srcValue The source value. + * @param {string} key The key of the property to merge. + * @param {Object} object The parent object of `objValue`. + * @param {Object} source The parent object of `srcValue`. + * @param {Object} [stack] Tracks traversed source values and their merged + * counterparts. + * @returns {*} Returns the value to assign. + */ + function customDefaultsMerge(objValue, srcValue, key, object, source, stack) { + if (isObject(objValue) && isObject(srcValue)) { + // Recursively merge objects and arrays (susceptible to call stack limits). + stack.set(srcValue, objValue); + baseMerge(objValue, srcValue, undefined, customDefaultsMerge, stack); + stack['delete'](srcValue); + } + return objValue; + } + + /** + * Used by `_.omit` to customize its `_.cloneDeep` use to only clone plain + * objects. + * + * @private + * @param {*} value The value to inspect. + * @param {string} key The key of the property to inspect. + * @returns {*} Returns the uncloned value or `undefined` to defer cloning to `_.cloneDeep`. + */ + function customOmitClone(value) { + return isPlainObject(value) ? undefined : value; + } + + /** + * A specialized version of `baseIsEqualDeep` for arrays with support for + * partial deep comparisons. + * + * @private + * @param {Array} array The array to compare. + * @param {Array} other The other array to compare. + * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. + * @param {Function} customizer The function to customize comparisons. + * @param {Function} equalFunc The function to determine equivalents of values. + * @param {Object} stack Tracks traversed `array` and `other` objects. + * @returns {boolean} Returns `true` if the arrays are equivalent, else `false`. + */ + function equalArrays(array, other, bitmask, customizer, equalFunc, stack) { + var isPartial = bitmask & COMPARE_PARTIAL_FLAG, + arrLength = array.length, + othLength = other.length; + + if (arrLength != othLength && !(isPartial && othLength > arrLength)) { + return false; + } + // Assume cyclic values are equal. + var stacked = stack.get(array); + if (stacked && stack.get(other)) { + return stacked == other; + } + var index = -1, + result = true, + seen = (bitmask & COMPARE_UNORDERED_FLAG) ? new SetCache : undefined; + + stack.set(array, other); + stack.set(other, array); + + // Ignore non-index properties. + while (++index < arrLength) { + var arrValue = array[index], + othValue = other[index]; + + if (customizer) { + var compared = isPartial + ? customizer(othValue, arrValue, index, other, array, stack) + : customizer(arrValue, othValue, index, array, other, stack); + } + if (compared !== undefined) { + if (compared) { + continue; + } + result = false; + break; + } + // Recursively compare arrays (susceptible to call stack limits). + if (seen) { + if (!arraySome(other, function(othValue, othIndex) { + if (!cacheHas(seen, othIndex) && + (arrValue === othValue || equalFunc(arrValue, othValue, bitmask, customizer, stack))) { + return seen.push(othIndex); + } + })) { + result = false; + break; + } + } else if (!( + arrValue === othValue || + equalFunc(arrValue, othValue, bitmask, customizer, stack) + )) { + result = false; + break; + } + } + stack['delete'](array); + stack['delete'](other); + return result; + } + + /** + * A specialized version of `baseIsEqualDeep` for comparing objects of + * the same `toStringTag`. + * + * **Note:** This function only supports comparing values with tags of + * `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`. + * + * @private + * @param {Object} object The object to compare. + * @param {Object} other The other object to compare. + * @param {string} tag The `toStringTag` of the objects to compare. + * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. + * @param {Function} customizer The function to customize comparisons. + * @param {Function} equalFunc The function to determine equivalents of values. + * @param {Object} stack Tracks traversed `object` and `other` objects. + * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. + */ + function equalByTag(object, other, tag, bitmask, customizer, equalFunc, stack) { + switch (tag) { + case dataViewTag: + if ((object.byteLength != other.byteLength) || + (object.byteOffset != other.byteOffset)) { + return false; + } + object = object.buffer; + other = other.buffer; + + case arrayBufferTag: + if ((object.byteLength != other.byteLength) || + !equalFunc(new Uint8Array(object), new Uint8Array(other))) { + return false; + } + return true; + + case boolTag: + case dateTag: + case numberTag: + // Coerce booleans to `1` or `0` and dates to milliseconds. + // Invalid dates are coerced to `NaN`. + return eq(+object, +other); + + case errorTag: + return object.name == other.name && object.message == other.message; + + case regexpTag: + case stringTag: + // Coerce regexes to strings and treat strings, primitives and objects, + // as equal. See http://www.ecma-international.org/ecma-262/7.0/#sec-regexp.prototype.tostring + // for more details. + return object == (other + ''); + + case mapTag: + var convert = mapToArray; + + case setTag: + var isPartial = bitmask & COMPARE_PARTIAL_FLAG; + convert || (convert = setToArray); + + if (object.size != other.size && !isPartial) { + return false; + } + // Assume cyclic values are equal. + var stacked = stack.get(object); + if (stacked) { + return stacked == other; + } + bitmask |= COMPARE_UNORDERED_FLAG; + + // Recursively compare objects (susceptible to call stack limits). + stack.set(object, other); + var result = equalArrays(convert(object), convert(other), bitmask, customizer, equalFunc, stack); + stack['delete'](object); + return result; + + case symbolTag: + if (symbolValueOf) { + return symbolValueOf.call(object) == symbolValueOf.call(other); + } + } + return false; + } + + /** + * A specialized version of `baseIsEqualDeep` for objects with support for + * partial deep comparisons. + * + * @private + * @param {Object} object The object to compare. + * @param {Object} other The other object to compare. + * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. + * @param {Function} customizer The function to customize comparisons. + * @param {Function} equalFunc The function to determine equivalents of values. + * @param {Object} stack Tracks traversed `object` and `other` objects. + * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. + */ + function equalObjects(object, other, bitmask, customizer, equalFunc, stack) { + var isPartial = bitmask & COMPARE_PARTIAL_FLAG, + objProps = getAllKeys(object), + objLength = objProps.length, + othProps = getAllKeys(other), + othLength = othProps.length; + + if (objLength != othLength && !isPartial) { + return false; + } + var index = objLength; + while (index--) { + var key = objProps[index]; + if (!(isPartial ? key in other : hasOwnProperty.call(other, key))) { + return false; + } + } + // Assume cyclic values are equal. + var stacked = stack.get(object); + if (stacked && stack.get(other)) { + return stacked == other; + } + var result = true; + stack.set(object, other); + stack.set(other, object); + + var skipCtor = isPartial; + while (++index < objLength) { + key = objProps[index]; + var objValue = object[key], + othValue = other[key]; + + if (customizer) { + var compared = isPartial + ? customizer(othValue, objValue, key, other, object, stack) + : customizer(objValue, othValue, key, object, other, stack); + } + // Recursively compare objects (susceptible to call stack limits). + if (!(compared === undefined + ? (objValue === othValue || equalFunc(objValue, othValue, bitmask, customizer, stack)) + : compared + )) { + result = false; + break; + } + skipCtor || (skipCtor = key == 'constructor'); + } + if (result && !skipCtor) { + var objCtor = object.constructor, + othCtor = other.constructor; + + // Non `Object` object instances with different constructors are not equal. + if (objCtor != othCtor && + ('constructor' in object && 'constructor' in other) && + !(typeof objCtor == 'function' && objCtor instanceof objCtor && + typeof othCtor == 'function' && othCtor instanceof othCtor)) { + result = false; + } + } + stack['delete'](object); + stack['delete'](other); + return result; + } + + /** + * A specialized version of `baseRest` which flattens the rest array. + * + * @private + * @param {Function} func The function to apply a rest parameter to. + * @returns {Function} Returns the new function. + */ + function flatRest(func) { + return setToString(overRest(func, undefined, flatten), func + ''); + } + + /** + * Creates an array of own enumerable property names and symbols of `object`. + * + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names and symbols. + */ + function getAllKeys(object) { + return baseGetAllKeys(object, keys, getSymbols); + } + + /** + * Creates an array of own and inherited enumerable property names and + * symbols of `object`. + * + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names and symbols. + */ + function getAllKeysIn(object) { + return baseGetAllKeys(object, keysIn, getSymbolsIn); + } + + /** + * Gets metadata for `func`. + * + * @private + * @param {Function} func The function to query. + * @returns {*} Returns the metadata for `func`. + */ + var getData = !metaMap ? noop : function(func) { + return metaMap.get(func); + }; + + /** + * Gets the name of `func`. + * + * @private + * @param {Function} func The function to query. + * @returns {string} Returns the function name. + */ + function getFuncName(func) { + var result = (func.name + ''), + array = realNames[result], + length = hasOwnProperty.call(realNames, result) ? array.length : 0; + + while (length--) { + var data = array[length], + otherFunc = data.func; + if (otherFunc == null || otherFunc == func) { + return data.name; + } + } + return result; + } + + /** + * Gets the argument placeholder value for `func`. + * + * @private + * @param {Function} func The function to inspect. + * @returns {*} Returns the placeholder value. + */ + function getHolder(func) { + var object = hasOwnProperty.call(lodash, 'placeholder') ? lodash : func; + return object.placeholder; + } + + /** + * Gets the appropriate "iteratee" function. If `_.iteratee` is customized, + * this function returns the custom method, otherwise it returns `baseIteratee`. + * If arguments are provided, the chosen function is invoked with them and + * its result is returned. + * + * @private + * @param {*} [value] The value to convert to an iteratee. + * @param {number} [arity] The arity of the created iteratee. + * @returns {Function} Returns the chosen function or its result. + */ + function getIteratee() { + var result = lodash.iteratee || iteratee; + result = result === iteratee ? baseIteratee : result; + return arguments.length ? result(arguments[0], arguments[1]) : result; + } + + /** + * Gets the data for `map`. + * + * @private + * @param {Object} map The map to query. + * @param {string} key The reference key. + * @returns {*} Returns the map data. + */ + function getMapData(map, key) { + var data = map.__data__; + return isKeyable(key) + ? data[typeof key == 'string' ? 'string' : 'hash'] + : data.map; + } + + /** + * Gets the property names, values, and compare flags of `object`. + * + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the match data of `object`. + */ + function getMatchData(object) { + var result = keys(object), + length = result.length; + + while (length--) { + var key = result[length], + value = object[key]; + + result[length] = [key, value, isStrictComparable(value)]; + } + return result; + } + + /** + * Gets the native function at `key` of `object`. + * + * @private + * @param {Object} object The object to query. + * @param {string} key The key of the method to get. + * @returns {*} Returns the function if it's native, else `undefined`. + */ + function getNative(object, key) { + var value = getValue(object, key); + return baseIsNative(value) ? value : undefined; + } + + /** + * A specialized version of `baseGetTag` which ignores `Symbol.toStringTag` values. + * + * @private + * @param {*} value The value to query. + * @returns {string} Returns the raw `toStringTag`. + */ + function getRawTag(value) { + var isOwn = hasOwnProperty.call(value, symToStringTag), + tag = value[symToStringTag]; + + try { + value[symToStringTag] = undefined; + var unmasked = true; + } catch (e) {} + + var result = nativeObjectToString.call(value); + if (unmasked) { + if (isOwn) { + value[symToStringTag] = tag; + } else { + delete value[symToStringTag]; + } + } + return result; + } + + /** + * Creates an array of the own enumerable symbols of `object`. + * + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of symbols. + */ + var getSymbols = !nativeGetSymbols ? stubArray : function(object) { + if (object == null) { + return []; + } + object = Object(object); + return arrayFilter(nativeGetSymbols(object), function(symbol) { + return propertyIsEnumerable.call(object, symbol); + }); + }; + + /** + * Creates an array of the own and inherited enumerable symbols of `object`. + * + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of symbols. + */ + var getSymbolsIn = !nativeGetSymbols ? stubArray : function(object) { + var result = []; + while (object) { + arrayPush(result, getSymbols(object)); + object = getPrototype(object); + } + return result; + }; + + /** + * Gets the `toStringTag` of `value`. + * + * @private + * @param {*} value The value to query. + * @returns {string} Returns the `toStringTag`. + */ + var getTag = baseGetTag; + + // Fallback for data views, maps, sets, and weak maps in IE 11 and promises in Node.js < 6. + if ((DataView && getTag(new DataView(new ArrayBuffer(1))) != dataViewTag) || + (Map && getTag(new Map) != mapTag) || + (Promise && getTag(Promise.resolve()) != promiseTag) || + (Set && getTag(new Set) != setTag) || + (WeakMap && getTag(new WeakMap) != weakMapTag)) { + getTag = function(value) { + var result = baseGetTag(value), + Ctor = result == objectTag ? value.constructor : undefined, + ctorString = Ctor ? toSource(Ctor) : ''; + + if (ctorString) { + switch (ctorString) { + case dataViewCtorString: return dataViewTag; + case mapCtorString: return mapTag; + case promiseCtorString: return promiseTag; + case setCtorString: return setTag; + case weakMapCtorString: return weakMapTag; + } + } + return result; + }; + } + + /** + * Gets the view, applying any `transforms` to the `start` and `end` positions. + * + * @private + * @param {number} start The start of the view. + * @param {number} end The end of the view. + * @param {Array} transforms The transformations to apply to the view. + * @returns {Object} Returns an object containing the `start` and `end` + * positions of the view. + */ + function getView(start, end, transforms) { + var index = -1, + length = transforms.length; + + while (++index < length) { + var data = transforms[index], + size = data.size; + + switch (data.type) { + case 'drop': start += size; break; + case 'dropRight': end -= size; break; + case 'take': end = nativeMin(end, start + size); break; + case 'takeRight': start = nativeMax(start, end - size); break; + } + } + return { 'start': start, 'end': end }; + } + + /** + * Extracts wrapper details from the `source` body comment. + * + * @private + * @param {string} source The source to inspect. + * @returns {Array} Returns the wrapper details. + */ + function getWrapDetails(source) { + var match = source.match(reWrapDetails); + return match ? match[1].split(reSplitDetails) : []; + } + + /** + * Checks if `path` exists on `object`. + * + * @private + * @param {Object} object The object to query. + * @param {Array|string} path The path to check. + * @param {Function} hasFunc The function to check properties. + * @returns {boolean} Returns `true` if `path` exists, else `false`. + */ + function hasPath(object, path, hasFunc) { + path = castPath(path, object); + + var index = -1, + length = path.length, + result = false; + + while (++index < length) { + var key = toKey(path[index]); + if (!(result = object != null && hasFunc(object, key))) { + break; + } + object = object[key]; + } + if (result || ++index != length) { + return result; + } + length = object == null ? 0 : object.length; + return !!length && isLength(length) && isIndex(key, length) && + (isArray(object) || isArguments(object)); + } + + /** + * Initializes an array clone. + * + * @private + * @param {Array} array The array to clone. + * @returns {Array} Returns the initialized clone. + */ + function initCloneArray(array) { + var length = array.length, + result = array.constructor(length); + + // Add properties assigned by `RegExp#exec`. + if (length && typeof array[0] == 'string' && hasOwnProperty.call(array, 'index')) { + result.index = array.index; + result.input = array.input; + } + return result; + } + + /** + * Initializes an object clone. + * + * @private + * @param {Object} object The object to clone. + * @returns {Object} Returns the initialized clone. + */ + function initCloneObject(object) { + return (typeof object.constructor == 'function' && !isPrototype(object)) + ? baseCreate(getPrototype(object)) + : {}; + } + + /** + * Initializes an object clone based on its `toStringTag`. + * + * **Note:** This function only supports cloning values with tags of + * `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`. + * + * @private + * @param {Object} object The object to clone. + * @param {string} tag The `toStringTag` of the object to clone. + * @param {Function} cloneFunc The function to clone values. + * @param {boolean} [isDeep] Specify a deep clone. + * @returns {Object} Returns the initialized clone. + */ + function initCloneByTag(object, tag, cloneFunc, isDeep) { + var Ctor = object.constructor; + switch (tag) { + case arrayBufferTag: + return cloneArrayBuffer(object); + + case boolTag: + case dateTag: + return new Ctor(+object); + + case dataViewTag: + return cloneDataView(object, isDeep); + + case float32Tag: case float64Tag: + case int8Tag: case int16Tag: case int32Tag: + case uint8Tag: case uint8ClampedTag: case uint16Tag: case uint32Tag: + return cloneTypedArray(object, isDeep); + + case mapTag: + return cloneMap(object, isDeep, cloneFunc); + + case numberTag: + case stringTag: + return new Ctor(object); + + case regexpTag: + return cloneRegExp(object); + + case setTag: + return cloneSet(object, isDeep, cloneFunc); + + case symbolTag: + return cloneSymbol(object); + } + } + + /** + * Inserts wrapper `details` in a comment at the top of the `source` body. + * + * @private + * @param {string} source The source to modify. + * @returns {Array} details The details to insert. + * @returns {string} Returns the modified source. + */ + function insertWrapDetails(source, details) { + var length = details.length; + if (!length) { + return source; + } + var lastIndex = length - 1; + details[lastIndex] = (length > 1 ? '& ' : '') + details[lastIndex]; + details = details.join(length > 2 ? ', ' : ' '); + return source.replace(reWrapComment, '{\n/* [wrapped with ' + details + '] */\n'); + } + + /** + * Checks if `value` is a flattenable `arguments` object or array. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is flattenable, else `false`. + */ + function isFlattenable(value) { + return isArray(value) || isArguments(value) || + !!(spreadableSymbol && value && value[spreadableSymbol]); + } + + /** + * Checks if `value` is a valid array-like index. + * + * @private + * @param {*} value The value to check. + * @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index. + * @returns {boolean} Returns `true` if `value` is a valid index, else `false`. + */ + function isIndex(value, length) { + length = length == null ? MAX_SAFE_INTEGER : length; + return !!length && + (typeof value == 'number' || reIsUint.test(value)) && + (value > -1 && value % 1 == 0 && value < length); + } + + /** + * Checks if the given arguments are from an iteratee call. + * + * @private + * @param {*} value The potential iteratee value argument. + * @param {*} index The potential iteratee index or key argument. + * @param {*} object The potential iteratee object argument. + * @returns {boolean} Returns `true` if the arguments are from an iteratee call, + * else `false`. + */ + function isIterateeCall(value, index, object) { + if (!isObject(object)) { + return false; + } + var type = typeof index; + if (type == 'number' + ? (isArrayLike(object) && isIndex(index, object.length)) + : (type == 'string' && index in object) + ) { + return eq(object[index], value); + } + return false; + } + + /** + * Checks if `value` is a property name and not a property path. + * + * @private + * @param {*} value The value to check. + * @param {Object} [object] The object to query keys on. + * @returns {boolean} Returns `true` if `value` is a property name, else `false`. + */ + function isKey(value, object) { + if (isArray(value)) { + return false; + } + var type = typeof value; + if (type == 'number' || type == 'symbol' || type == 'boolean' || + value == null || isSymbol(value)) { + return true; + } + return reIsPlainProp.test(value) || !reIsDeepProp.test(value) || + (object != null && value in Object(object)); + } + + /** + * Checks if `value` is suitable for use as unique object key. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is suitable, else `false`. + */ + function isKeyable(value) { + var type = typeof value; + return (type == 'string' || type == 'number' || type == 'symbol' || type == 'boolean') + ? (value !== '__proto__') + : (value === null); + } + + /** + * Checks if `func` has a lazy counterpart. + * + * @private + * @param {Function} func The function to check. + * @returns {boolean} Returns `true` if `func` has a lazy counterpart, + * else `false`. + */ + function isLaziable(func) { + var funcName = getFuncName(func), + other = lodash[funcName]; + + if (typeof other != 'function' || !(funcName in LazyWrapper.prototype)) { + return false; + } + if (func === other) { + return true; + } + var data = getData(other); + return !!data && func === data[0]; + } + + /** + * Checks if `func` has its source masked. + * + * @private + * @param {Function} func The function to check. + * @returns {boolean} Returns `true` if `func` is masked, else `false`. + */ + function isMasked(func) { + return !!maskSrcKey && (maskSrcKey in func); + } + + /** + * Checks if `func` is capable of being masked. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `func` is maskable, else `false`. + */ + var isMaskable = coreJsData ? isFunction : stubFalse; + + /** + * Checks if `value` is likely a prototype object. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a prototype, else `false`. + */ + function isPrototype(value) { + var Ctor = value && value.constructor, + proto = (typeof Ctor == 'function' && Ctor.prototype) || objectProto; + + return value === proto; + } + + /** + * Checks if `value` is suitable for strict equality comparisons, i.e. `===`. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` if suitable for strict + * equality comparisons, else `false`. + */ + function isStrictComparable(value) { + return value === value && !isObject(value); + } + + /** + * A specialized version of `matchesProperty` for source values suitable + * for strict equality comparisons, i.e. `===`. + * + * @private + * @param {string} key The key of the property to get. + * @param {*} srcValue The value to match. + * @returns {Function} Returns the new spec function. + */ + function matchesStrictComparable(key, srcValue) { + return function(object) { + if (object == null) { + return false; + } + return object[key] === srcValue && + (srcValue !== undefined || (key in Object(object))); + }; + } + + /** + * A specialized version of `_.memoize` which clears the memoized function's + * cache when it exceeds `MAX_MEMOIZE_SIZE`. + * + * @private + * @param {Function} func The function to have its output memoized. + * @returns {Function} Returns the new memoized function. + */ + function memoizeCapped(func) { + var result = memoize(func, function(key) { + if (cache.size === MAX_MEMOIZE_SIZE) { + cache.clear(); + } + return key; + }); + + var cache = result.cache; + return result; + } + + /** + * Merges the function metadata of `source` into `data`. + * + * Merging metadata reduces the number of wrappers used to invoke a function. + * This is possible because methods like `_.bind`, `_.curry`, and `_.partial` + * may be applied regardless of execution order. Methods like `_.ary` and + * `_.rearg` modify function arguments, making the order in which they are + * executed important, preventing the merging of metadata. However, we make + * an exception for a safe combined case where curried functions have `_.ary` + * and or `_.rearg` applied. + * + * @private + * @param {Array} data The destination metadata. + * @param {Array} source The source metadata. + * @returns {Array} Returns `data`. + */ + function mergeData(data, source) { + var bitmask = data[1], + srcBitmask = source[1], + newBitmask = bitmask | srcBitmask, + isCommon = newBitmask < (WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG | WRAP_ARY_FLAG); + + var isCombo = + ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_CURRY_FLAG)) || + ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_REARG_FLAG) && (data[7].length <= source[8])) || + ((srcBitmask == (WRAP_ARY_FLAG | WRAP_REARG_FLAG)) && (source[7].length <= source[8]) && (bitmask == WRAP_CURRY_FLAG)); + + // Exit early if metadata can't be merged. + if (!(isCommon || isCombo)) { + return data; + } + // Use source `thisArg` if available. + if (srcBitmask & WRAP_BIND_FLAG) { + data[2] = source[2]; + // Set when currying a bound function. + newBitmask |= bitmask & WRAP_BIND_FLAG ? 0 : WRAP_CURRY_BOUND_FLAG; + } + // Compose partial arguments. + var value = source[3]; + if (value) { + var partials = data[3]; + data[3] = partials ? composeArgs(partials, value, source[4]) : value; + data[4] = partials ? replaceHolders(data[3], PLACEHOLDER) : source[4]; + } + // Compose partial right arguments. + value = source[5]; + if (value) { + partials = data[5]; + data[5] = partials ? composeArgsRight(partials, value, source[6]) : value; + data[6] = partials ? replaceHolders(data[5], PLACEHOLDER) : source[6]; + } + // Use source `argPos` if available. + value = source[7]; + if (value) { + data[7] = value; + } + // Use source `ary` if it's smaller. + if (srcBitmask & WRAP_ARY_FLAG) { + data[8] = data[8] == null ? source[8] : nativeMin(data[8], source[8]); + } + // Use source `arity` if one is not provided. + if (data[9] == null) { + data[9] = source[9]; + } + // Use source `func` and merge bitmasks. + data[0] = source[0]; + data[1] = newBitmask; + + return data; + } + + /** + * This function is like + * [`Object.keys`](http://ecma-international.org/ecma-262/7.0/#sec-object.keys) + * except that it includes inherited enumerable properties. + * + * @private + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names. + */ + function nativeKeysIn(object) { + var result = []; + if (object != null) { + for (var key in Object(object)) { + result.push(key); + } + } + return result; + } + + /** + * Converts `value` to a string using `Object.prototype.toString`. + * + * @private + * @param {*} value The value to convert. + * @returns {string} Returns the converted string. + */ + function objectToString(value) { + return nativeObjectToString.call(value); + } + + /** + * A specialized version of `baseRest` which transforms the rest array. + * + * @private + * @param {Function} func The function to apply a rest parameter to. + * @param {number} [start=func.length-1] The start position of the rest parameter. + * @param {Function} transform The rest array transform. + * @returns {Function} Returns the new function. + */ + function overRest(func, start, transform) { + start = nativeMax(start === undefined ? (func.length - 1) : start, 0); + return function() { + var args = arguments, + index = -1, + length = nativeMax(args.length - start, 0), + array = Array(length); + + while (++index < length) { + array[index] = args[start + index]; + } + index = -1; + var otherArgs = Array(start + 1); + while (++index < start) { + otherArgs[index] = args[index]; + } + otherArgs[start] = transform(array); + return apply(func, this, otherArgs); + }; + } + + /** + * Gets the parent value at `path` of `object`. + * + * @private + * @param {Object} object The object to query. + * @param {Array} path The path to get the parent value of. + * @returns {*} Returns the parent value. + */ + function parent(object, path) { + return path.length < 2 ? object : baseGet(object, baseSlice(path, 0, -1)); + } + + /** + * Reorder `array` according to the specified indexes where the element at + * the first index is assigned as the first element, the element at + * the second index is assigned as the second element, and so on. + * + * @private + * @param {Array} array The array to reorder. + * @param {Array} indexes The arranged array indexes. + * @returns {Array} Returns `array`. + */ + function reorder(array, indexes) { + var arrLength = array.length, + length = nativeMin(indexes.length, arrLength), + oldArray = copyArray(array); + + while (length--) { + var index = indexes[length]; + array[length] = isIndex(index, arrLength) ? oldArray[index] : undefined; + } + return array; + } + + /** + * Sets metadata for `func`. + * + * **Note:** If this function becomes hot, i.e. is invoked a lot in a short + * period of time, it will trip its breaker and transition to an identity + * function to avoid garbage collection pauses in V8. See + * [V8 issue 2070](https://bugs.chromium.org/p/v8/issues/detail?id=2070) + * for more details. + * + * @private + * @param {Function} func The function to associate metadata with. + * @param {*} data The metadata. + * @returns {Function} Returns `func`. + */ + var setData = shortOut(baseSetData); + + /** + * A simple wrapper around the global [`setTimeout`](https://mdn.io/setTimeout). + * + * @private + * @param {Function} func The function to delay. + * @param {number} wait The number of milliseconds to delay invocation. + * @returns {number|Object} Returns the timer id or timeout object. + */ + var setTimeout = ctxSetTimeout || function(func, wait) { + return root.setTimeout(func, wait); + }; + + /** + * Sets the `toString` method of `func` to return `string`. + * + * @private + * @param {Function} func The function to modify. + * @param {Function} string The `toString` result. + * @returns {Function} Returns `func`. + */ + var setToString = shortOut(baseSetToString); + + /** + * Sets the `toString` method of `wrapper` to mimic the source of `reference` + * with wrapper details in a comment at the top of the source body. + * + * @private + * @param {Function} wrapper The function to modify. + * @param {Function} reference The reference function. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @returns {Function} Returns `wrapper`. + */ + function setWrapToString(wrapper, reference, bitmask) { + var source = (reference + ''); + return setToString(wrapper, insertWrapDetails(source, updateWrapDetails(getWrapDetails(source), bitmask))); + } + + /** + * Creates a function that'll short out and invoke `identity` instead + * of `func` when it's called `HOT_COUNT` or more times in `HOT_SPAN` + * milliseconds. + * + * @private + * @param {Function} func The function to restrict. + * @returns {Function} Returns the new shortable function. + */ + function shortOut(func) { + var count = 0, + lastCalled = 0; + + return function() { + var stamp = nativeNow(), + remaining = HOT_SPAN - (stamp - lastCalled); + + lastCalled = stamp; + if (remaining > 0) { + if (++count >= HOT_COUNT) { + return arguments[0]; + } + } else { + count = 0; + } + return func.apply(undefined, arguments); + }; + } + + /** + * A specialized version of `_.shuffle` which mutates and sets the size of `array`. + * + * @private + * @param {Array} array The array to shuffle. + * @param {number} [size=array.length] The size of `array`. + * @returns {Array} Returns `array`. + */ + function shuffleSelf(array, size) { + var index = -1, + length = array.length, + lastIndex = length - 1; + + size = size === undefined ? length : size; + while (++index < size) { + var rand = baseRandom(index, lastIndex), + value = array[rand]; + + array[rand] = array[index]; + array[index] = value; + } + array.length = size; + return array; + } + + /** + * Converts `string` to a property path array. + * + * @private + * @param {string} string The string to convert. + * @returns {Array} Returns the property path array. + */ + var stringToPath = memoizeCapped(function(string) { + var result = []; + if (reLeadingDot.test(string)) { + result.push(''); + } + string.replace(rePropName, function(match, number, quote, string) { + result.push(quote ? string.replace(reEscapeChar, '$1') : (number || match)); + }); + return result; + }); + + /** + * Converts `value` to a string key if it's not a string or symbol. + * + * @private + * @param {*} value The value to inspect. + * @returns {string|symbol} Returns the key. + */ + function toKey(value) { + if (typeof value == 'string' || isSymbol(value)) { + return value; + } + var result = (value + ''); + return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result; + } + + /** + * Converts `func` to its source code. + * + * @private + * @param {Function} func The function to convert. + * @returns {string} Returns the source code. + */ + function toSource(func) { + if (func != null) { + try { + return funcToString.call(func); + } catch (e) {} + try { + return (func + ''); + } catch (e) {} + } + return ''; + } + + /** + * Updates wrapper `details` based on `bitmask` flags. + * + * @private + * @returns {Array} details The details to modify. + * @param {number} bitmask The bitmask flags. See `createWrap` for more details. + * @returns {Array} Returns `details`. + */ + function updateWrapDetails(details, bitmask) { + arrayEach(wrapFlags, function(pair) { + var value = '_.' + pair[0]; + if ((bitmask & pair[1]) && !arrayIncludes(details, value)) { + details.push(value); + } + }); + return details.sort(); + } + + /** + * Creates a clone of `wrapper`. + * + * @private + * @param {Object} wrapper The wrapper to clone. + * @returns {Object} Returns the cloned wrapper. + */ + function wrapperClone(wrapper) { + if (wrapper instanceof LazyWrapper) { + return wrapper.clone(); + } + var result = new LodashWrapper(wrapper.__wrapped__, wrapper.__chain__); + result.__actions__ = copyArray(wrapper.__actions__); + result.__index__ = wrapper.__index__; + result.__values__ = wrapper.__values__; + return result; + } + + /*------------------------------------------------------------------------*/ + + /** + * Creates an array of elements split into groups the length of `size`. + * If `array` can't be split evenly, the final chunk will be the remaining + * elements. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to process. + * @param {number} [size=1] The length of each chunk + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Array} Returns the new array of chunks. + * @example + * + * _.chunk(['a', 'b', 'c', 'd'], 2); + * // => [['a', 'b'], ['c', 'd']] + * + * _.chunk(['a', 'b', 'c', 'd'], 3); + * // => [['a', 'b', 'c'], ['d']] + */ + function chunk(array, size, guard) { + if ((guard ? isIterateeCall(array, size, guard) : size === undefined)) { + size = 1; + } else { + size = nativeMax(toInteger(size), 0); + } + var length = array == null ? 0 : array.length; + if (!length || size < 1) { + return []; + } + var index = 0, + resIndex = 0, + result = Array(nativeCeil(length / size)); + + while (index < length) { + result[resIndex++] = baseSlice(array, index, (index += size)); + } + return result; + } + + /** + * Creates an array with all falsey values removed. The values `false`, `null`, + * `0`, `""`, `undefined`, and `NaN` are falsey. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to compact. + * @returns {Array} Returns the new array of filtered values. + * @example + * + * _.compact([0, 1, false, 2, '', 3]); + * // => [1, 2, 3] + */ + function compact(array) { + var index = -1, + length = array == null ? 0 : array.length, + resIndex = 0, + result = []; + + while (++index < length) { + var value = array[index]; + if (value) { + result[resIndex++] = value; + } + } + return result; + } + + /** + * Creates a new array concatenating `array` with any additional arrays + * and/or values. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to concatenate. + * @param {...*} [values] The values to concatenate. + * @returns {Array} Returns the new concatenated array. + * @example + * + * var array = [1]; + * var other = _.concat(array, 2, [3], [[4]]); + * + * console.log(other); + * // => [1, 2, 3, [4]] + * + * console.log(array); + * // => [1] + */ + function concat() { + var length = arguments.length; + if (!length) { + return []; + } + var args = Array(length - 1), + array = arguments[0], + index = length; + + while (index--) { + args[index - 1] = arguments[index]; + } + return arrayPush(isArray(array) ? copyArray(array) : [array], baseFlatten(args, 1)); + } + + /** + * Creates an array of `array` values not included in the other given arrays + * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. The order and references of result values are + * determined by the first array. + * + * **Note:** Unlike `_.pullAll`, this method returns a new array. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {...Array} [values] The values to exclude. + * @returns {Array} Returns the new array of filtered values. + * @see _.without, _.xor + * @example + * + * _.difference([2, 1], [2, 3]); + * // => [1] + */ + var difference = baseRest(function(array, values) { + return isArrayLikeObject(array) + ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true)) + : []; + }); + + /** + * This method is like `_.difference` except that it accepts `iteratee` which + * is invoked for each element of `array` and `values` to generate the criterion + * by which they're compared. The order and references of result values are + * determined by the first array. The iteratee is invoked with one argument: + * (value). + * + * **Note:** Unlike `_.pullAllBy`, this method returns a new array. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {...Array} [values] The values to exclude. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Array} Returns the new array of filtered values. + * @example + * + * _.differenceBy([2.1, 1.2], [2.3, 3.4], Math.floor); + * // => [1.2] + * + * // The `_.property` iteratee shorthand. + * _.differenceBy([{ 'x': 2 }, { 'x': 1 }], [{ 'x': 1 }], 'x'); + * // => [{ 'x': 2 }] + */ + var differenceBy = baseRest(function(array, values) { + var iteratee = last(values); + if (isArrayLikeObject(iteratee)) { + iteratee = undefined; + } + return isArrayLikeObject(array) + ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), getIteratee(iteratee, 2)) + : []; + }); + + /** + * This method is like `_.difference` except that it accepts `comparator` + * which is invoked to compare elements of `array` to `values`. The order and + * references of result values are determined by the first array. The comparator + * is invoked with two arguments: (arrVal, othVal). + * + * **Note:** Unlike `_.pullAllWith`, this method returns a new array. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {...Array} [values] The values to exclude. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of filtered values. + * @example + * + * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; + * + * _.differenceWith(objects, [{ 'x': 1, 'y': 2 }], _.isEqual); + * // => [{ 'x': 2, 'y': 1 }] + */ + var differenceWith = baseRest(function(array, values) { + var comparator = last(values); + if (isArrayLikeObject(comparator)) { + comparator = undefined; + } + return isArrayLikeObject(array) + ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), undefined, comparator) + : []; + }); + + /** + * Creates a slice of `array` with `n` elements dropped from the beginning. + * + * @static + * @memberOf _ + * @since 0.5.0 + * @category Array + * @param {Array} array The array to query. + * @param {number} [n=1] The number of elements to drop. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Array} Returns the slice of `array`. + * @example + * + * _.drop([1, 2, 3]); + * // => [2, 3] + * + * _.drop([1, 2, 3], 2); + * // => [3] + * + * _.drop([1, 2, 3], 5); + * // => [] + * + * _.drop([1, 2, 3], 0); + * // => [1, 2, 3] + */ + function drop(array, n, guard) { + var length = array == null ? 0 : array.length; + if (!length) { + return []; + } + n = (guard || n === undefined) ? 1 : toInteger(n); + return baseSlice(array, n < 0 ? 0 : n, length); + } + + /** + * Creates a slice of `array` with `n` elements dropped from the end. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to query. + * @param {number} [n=1] The number of elements to drop. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Array} Returns the slice of `array`. + * @example + * + * _.dropRight([1, 2, 3]); + * // => [1, 2] + * + * _.dropRight([1, 2, 3], 2); + * // => [1] + * + * _.dropRight([1, 2, 3], 5); + * // => [] + * + * _.dropRight([1, 2, 3], 0); + * // => [1, 2, 3] + */ + function dropRight(array, n, guard) { + var length = array == null ? 0 : array.length; + if (!length) { + return []; + } + n = (guard || n === undefined) ? 1 : toInteger(n); + n = length - n; + return baseSlice(array, 0, n < 0 ? 0 : n); + } + + /** + * Creates a slice of `array` excluding elements dropped from the end. + * Elements are dropped until `predicate` returns falsey. The predicate is + * invoked with three arguments: (value, index, array). + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to query. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the slice of `array`. + * @example + * + * var users = [ + * { 'user': 'barney', 'active': true }, + * { 'user': 'fred', 'active': false }, + * { 'user': 'pebbles', 'active': false } + * ]; + * + * _.dropRightWhile(users, function(o) { return !o.active; }); + * // => objects for ['barney'] + * + * // The `_.matches` iteratee shorthand. + * _.dropRightWhile(users, { 'user': 'pebbles', 'active': false }); + * // => objects for ['barney', 'fred'] + * + * // The `_.matchesProperty` iteratee shorthand. + * _.dropRightWhile(users, ['active', false]); + * // => objects for ['barney'] + * + * // The `_.property` iteratee shorthand. + * _.dropRightWhile(users, 'active'); + * // => objects for ['barney', 'fred', 'pebbles'] + */ + function dropRightWhile(array, predicate) { + return (array && array.length) + ? baseWhile(array, getIteratee(predicate, 3), true, true) + : []; + } + + /** + * Creates a slice of `array` excluding elements dropped from the beginning. + * Elements are dropped until `predicate` returns falsey. The predicate is + * invoked with three arguments: (value, index, array). + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to query. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the slice of `array`. + * @example + * + * var users = [ + * { 'user': 'barney', 'active': false }, + * { 'user': 'fred', 'active': false }, + * { 'user': 'pebbles', 'active': true } + * ]; + * + * _.dropWhile(users, function(o) { return !o.active; }); + * // => objects for ['pebbles'] + * + * // The `_.matches` iteratee shorthand. + * _.dropWhile(users, { 'user': 'barney', 'active': false }); + * // => objects for ['fred', 'pebbles'] + * + * // The `_.matchesProperty` iteratee shorthand. + * _.dropWhile(users, ['active', false]); + * // => objects for ['pebbles'] + * + * // The `_.property` iteratee shorthand. + * _.dropWhile(users, 'active'); + * // => objects for ['barney', 'fred', 'pebbles'] + */ + function dropWhile(array, predicate) { + return (array && array.length) + ? baseWhile(array, getIteratee(predicate, 3), true) + : []; + } + + /** + * Fills elements of `array` with `value` from `start` up to, but not + * including, `end`. + * + * **Note:** This method mutates `array`. + * + * @static + * @memberOf _ + * @since 3.2.0 + * @category Array + * @param {Array} array The array to fill. + * @param {*} value The value to fill `array` with. + * @param {number} [start=0] The start position. + * @param {number} [end=array.length] The end position. + * @returns {Array} Returns `array`. + * @example + * + * var array = [1, 2, 3]; + * + * _.fill(array, 'a'); + * console.log(array); + * // => ['a', 'a', 'a'] + * + * _.fill(Array(3), 2); + * // => [2, 2, 2] + * + * _.fill([4, 6, 8, 10], '*', 1, 3); + * // => [4, '*', '*', 10] + */ + function fill(array, value, start, end) { + var length = array == null ? 0 : array.length; + if (!length) { + return []; + } + if (start && typeof start != 'number' && isIterateeCall(array, value, start)) { + start = 0; + end = length; + } + return baseFill(array, value, start, end); + } + + /** + * This method is like `_.find` except that it returns the index of the first + * element `predicate` returns truthy for instead of the element itself. + * + * @static + * @memberOf _ + * @since 1.1.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @param {number} [fromIndex=0] The index to search from. + * @returns {number} Returns the index of the found element, else `-1`. + * @example + * + * var users = [ + * { 'user': 'barney', 'active': false }, + * { 'user': 'fred', 'active': false }, + * { 'user': 'pebbles', 'active': true } + * ]; + * + * _.findIndex(users, function(o) { return o.user == 'barney'; }); + * // => 0 + * + * // The `_.matches` iteratee shorthand. + * _.findIndex(users, { 'user': 'fred', 'active': false }); + * // => 1 + * + * // The `_.matchesProperty` iteratee shorthand. + * _.findIndex(users, ['active', false]); + * // => 0 + * + * // The `_.property` iteratee shorthand. + * _.findIndex(users, 'active'); + * // => 2 + */ + function findIndex(array, predicate, fromIndex) { + var length = array == null ? 0 : array.length; + if (!length) { + return -1; + } + var index = fromIndex == null ? 0 : toInteger(fromIndex); + if (index < 0) { + index = nativeMax(length + index, 0); + } + return baseFindIndex(array, getIteratee(predicate, 3), index); + } + + /** + * This method is like `_.findIndex` except that it iterates over elements + * of `collection` from right to left. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @param {number} [fromIndex=array.length-1] The index to search from. + * @returns {number} Returns the index of the found element, else `-1`. + * @example + * + * var users = [ + * { 'user': 'barney', 'active': true }, + * { 'user': 'fred', 'active': false }, + * { 'user': 'pebbles', 'active': false } + * ]; + * + * _.findLastIndex(users, function(o) { return o.user == 'pebbles'; }); + * // => 2 + * + * // The `_.matches` iteratee shorthand. + * _.findLastIndex(users, { 'user': 'barney', 'active': true }); + * // => 0 + * + * // The `_.matchesProperty` iteratee shorthand. + * _.findLastIndex(users, ['active', false]); + * // => 2 + * + * // The `_.property` iteratee shorthand. + * _.findLastIndex(users, 'active'); + * // => 0 + */ + function findLastIndex(array, predicate, fromIndex) { + var length = array == null ? 0 : array.length; + if (!length) { + return -1; + } + var index = length - 1; + if (fromIndex !== undefined) { + index = toInteger(fromIndex); + index = fromIndex < 0 + ? nativeMax(length + index, 0) + : nativeMin(index, length - 1); + } + return baseFindIndex(array, getIteratee(predicate, 3), index, true); + } + + /** + * Flattens `array` a single level deep. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to flatten. + * @returns {Array} Returns the new flattened array. + * @example + * + * _.flatten([1, [2, [3, [4]], 5]]); + * // => [1, 2, [3, [4]], 5] + */ + function flatten(array) { + var length = array == null ? 0 : array.length; + return length ? baseFlatten(array, 1) : []; + } + + /** + * Recursively flattens `array`. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to flatten. + * @returns {Array} Returns the new flattened array. + * @example + * + * _.flattenDeep([1, [2, [3, [4]], 5]]); + * // => [1, 2, 3, 4, 5] + */ + function flattenDeep(array) { + var length = array == null ? 0 : array.length; + return length ? baseFlatten(array, INFINITY) : []; + } + + /** + * Recursively flatten `array` up to `depth` times. + * + * @static + * @memberOf _ + * @since 4.4.0 + * @category Array + * @param {Array} array The array to flatten. + * @param {number} [depth=1] The maximum recursion depth. + * @returns {Array} Returns the new flattened array. + * @example + * + * var array = [1, [2, [3, [4]], 5]]; + * + * _.flattenDepth(array, 1); + * // => [1, 2, [3, [4]], 5] + * + * _.flattenDepth(array, 2); + * // => [1, 2, 3, [4], 5] + */ + function flattenDepth(array, depth) { + var length = array == null ? 0 : array.length; + if (!length) { + return []; + } + depth = depth === undefined ? 1 : toInteger(depth); + return baseFlatten(array, depth); + } + + /** + * The inverse of `_.toPairs`; this method returns an object composed + * from key-value `pairs`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} pairs The key-value pairs. + * @returns {Object} Returns the new object. + * @example + * + * _.fromPairs([['a', 1], ['b', 2]]); + * // => { 'a': 1, 'b': 2 } + */ + function fromPairs(pairs) { + var index = -1, + length = pairs == null ? 0 : pairs.length, + result = {}; + + while (++index < length) { + var pair = pairs[index]; + result[pair[0]] = pair[1]; + } + return result; + } + + /** + * Gets the first element of `array`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @alias first + * @category Array + * @param {Array} array The array to query. + * @returns {*} Returns the first element of `array`. + * @example + * + * _.head([1, 2, 3]); + * // => 1 + * + * _.head([]); + * // => undefined + */ + function head(array) { + return (array && array.length) ? array[0] : undefined; + } + + /** + * Gets the index at which the first occurrence of `value` is found in `array` + * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. If `fromIndex` is negative, it's used as the + * offset from the end of `array`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @param {number} [fromIndex=0] The index to search from. + * @returns {number} Returns the index of the matched value, else `-1`. + * @example + * + * _.indexOf([1, 2, 1, 2], 2); + * // => 1 + * + * // Search from the `fromIndex`. + * _.indexOf([1, 2, 1, 2], 2, 2); + * // => 3 + */ + function indexOf(array, value, fromIndex) { + var length = array == null ? 0 : array.length; + if (!length) { + return -1; + } + var index = fromIndex == null ? 0 : toInteger(fromIndex); + if (index < 0) { + index = nativeMax(length + index, 0); + } + return baseIndexOf(array, value, index); + } + + /** + * Gets all but the last element of `array`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to query. + * @returns {Array} Returns the slice of `array`. + * @example + * + * _.initial([1, 2, 3]); + * // => [1, 2] + */ + function initial(array) { + var length = array == null ? 0 : array.length; + return length ? baseSlice(array, 0, -1) : []; + } + + /** + * Creates an array of unique values that are included in all given arrays + * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. The order and references of result values are + * determined by the first array. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @returns {Array} Returns the new array of intersecting values. + * @example + * + * _.intersection([2, 1], [2, 3]); + * // => [2] + */ + var intersection = baseRest(function(arrays) { + var mapped = arrayMap(arrays, castArrayLikeObject); + return (mapped.length && mapped[0] === arrays[0]) + ? baseIntersection(mapped) + : []; + }); + + /** + * This method is like `_.intersection` except that it accepts `iteratee` + * which is invoked for each element of each `arrays` to generate the criterion + * by which they're compared. The order and references of result values are + * determined by the first array. The iteratee is invoked with one argument: + * (value). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Array} Returns the new array of intersecting values. + * @example + * + * _.intersectionBy([2.1, 1.2], [2.3, 3.4], Math.floor); + * // => [2.1] + * + * // The `_.property` iteratee shorthand. + * _.intersectionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); + * // => [{ 'x': 1 }] + */ + var intersectionBy = baseRest(function(arrays) { + var iteratee = last(arrays), + mapped = arrayMap(arrays, castArrayLikeObject); + + if (iteratee === last(mapped)) { + iteratee = undefined; + } else { + mapped.pop(); + } + return (mapped.length && mapped[0] === arrays[0]) + ? baseIntersection(mapped, getIteratee(iteratee, 2)) + : []; + }); + + /** + * This method is like `_.intersection` except that it accepts `comparator` + * which is invoked to compare elements of `arrays`. The order and references + * of result values are determined by the first array. The comparator is + * invoked with two arguments: (arrVal, othVal). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of intersecting values. + * @example + * + * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; + * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; + * + * _.intersectionWith(objects, others, _.isEqual); + * // => [{ 'x': 1, 'y': 2 }] + */ + var intersectionWith = baseRest(function(arrays) { + var comparator = last(arrays), + mapped = arrayMap(arrays, castArrayLikeObject); + + comparator = typeof comparator == 'function' ? comparator : undefined; + if (comparator) { + mapped.pop(); + } + return (mapped.length && mapped[0] === arrays[0]) + ? baseIntersection(mapped, undefined, comparator) + : []; + }); + + /** + * Converts all elements in `array` into a string separated by `separator`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to convert. + * @param {string} [separator=','] The element separator. + * @returns {string} Returns the joined string. + * @example + * + * _.join(['a', 'b', 'c'], '~'); + * // => 'a~b~c' + */ + function join(array, separator) { + return array == null ? '' : nativeJoin.call(array, separator); + } + + /** + * Gets the last element of `array`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to query. + * @returns {*} Returns the last element of `array`. + * @example + * + * _.last([1, 2, 3]); + * // => 3 + */ + function last(array) { + var length = array == null ? 0 : array.length; + return length ? array[length - 1] : undefined; + } + + /** + * This method is like `_.indexOf` except that it iterates over elements of + * `array` from right to left. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @param {number} [fromIndex=array.length-1] The index to search from. + * @returns {number} Returns the index of the matched value, else `-1`. + * @example + * + * _.lastIndexOf([1, 2, 1, 2], 2); + * // => 3 + * + * // Search from the `fromIndex`. + * _.lastIndexOf([1, 2, 1, 2], 2, 2); + * // => 1 + */ + function lastIndexOf(array, value, fromIndex) { + var length = array == null ? 0 : array.length; + if (!length) { + return -1; + } + var index = length; + if (fromIndex !== undefined) { + index = toInteger(fromIndex); + index = index < 0 ? nativeMax(length + index, 0) : nativeMin(index, length - 1); + } + return value === value + ? strictLastIndexOf(array, value, index) + : baseFindIndex(array, baseIsNaN, index, true); + } + + /** + * Gets the element at index `n` of `array`. If `n` is negative, the nth + * element from the end is returned. + * + * @static + * @memberOf _ + * @since 4.11.0 + * @category Array + * @param {Array} array The array to query. + * @param {number} [n=0] The index of the element to return. + * @returns {*} Returns the nth element of `array`. + * @example + * + * var array = ['a', 'b', 'c', 'd']; + * + * _.nth(array, 1); + * // => 'b' + * + * _.nth(array, -2); + * // => 'c'; + */ + function nth(array, n) { + return (array && array.length) ? baseNth(array, toInteger(n)) : undefined; + } + + /** + * Removes all given values from `array` using + * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. + * + * **Note:** Unlike `_.without`, this method mutates `array`. Use `_.remove` + * to remove elements from an array by predicate. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @category Array + * @param {Array} array The array to modify. + * @param {...*} [values] The values to remove. + * @returns {Array} Returns `array`. + * @example + * + * var array = ['a', 'b', 'c', 'a', 'b', 'c']; + * + * _.pull(array, 'a', 'c'); + * console.log(array); + * // => ['b', 'b'] + */ + var pull = baseRest(pullAll); + + /** + * This method is like `_.pull` except that it accepts an array of values to remove. + * + * **Note:** Unlike `_.difference`, this method mutates `array`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to modify. + * @param {Array} values The values to remove. + * @returns {Array} Returns `array`. + * @example + * + * var array = ['a', 'b', 'c', 'a', 'b', 'c']; + * + * _.pullAll(array, ['a', 'c']); + * console.log(array); + * // => ['b', 'b'] + */ + function pullAll(array, values) { + return (array && array.length && values && values.length) + ? basePullAll(array, values) + : array; + } + + /** + * This method is like `_.pullAll` except that it accepts `iteratee` which is + * invoked for each element of `array` and `values` to generate the criterion + * by which they're compared. The iteratee is invoked with one argument: (value). + * + * **Note:** Unlike `_.differenceBy`, this method mutates `array`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to modify. + * @param {Array} values The values to remove. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Array} Returns `array`. + * @example + * + * var array = [{ 'x': 1 }, { 'x': 2 }, { 'x': 3 }, { 'x': 1 }]; + * + * _.pullAllBy(array, [{ 'x': 1 }, { 'x': 3 }], 'x'); + * console.log(array); + * // => [{ 'x': 2 }] + */ + function pullAllBy(array, values, iteratee) { + return (array && array.length && values && values.length) + ? basePullAll(array, values, getIteratee(iteratee, 2)) + : array; + } + + /** + * This method is like `_.pullAll` except that it accepts `comparator` which + * is invoked to compare elements of `array` to `values`. The comparator is + * invoked with two arguments: (arrVal, othVal). + * + * **Note:** Unlike `_.differenceWith`, this method mutates `array`. + * + * @static + * @memberOf _ + * @since 4.6.0 + * @category Array + * @param {Array} array The array to modify. + * @param {Array} values The values to remove. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns `array`. + * @example + * + * var array = [{ 'x': 1, 'y': 2 }, { 'x': 3, 'y': 4 }, { 'x': 5, 'y': 6 }]; + * + * _.pullAllWith(array, [{ 'x': 3, 'y': 4 }], _.isEqual); + * console.log(array); + * // => [{ 'x': 1, 'y': 2 }, { 'x': 5, 'y': 6 }] + */ + function pullAllWith(array, values, comparator) { + return (array && array.length && values && values.length) + ? basePullAll(array, values, undefined, comparator) + : array; + } + + /** + * Removes elements from `array` corresponding to `indexes` and returns an + * array of removed elements. + * + * **Note:** Unlike `_.at`, this method mutates `array`. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to modify. + * @param {...(number|number[])} [indexes] The indexes of elements to remove. + * @returns {Array} Returns the new array of removed elements. + * @example + * + * var array = ['a', 'b', 'c', 'd']; + * var pulled = _.pullAt(array, [1, 3]); + * + * console.log(array); + * // => ['a', 'c'] + * + * console.log(pulled); + * // => ['b', 'd'] + */ + var pullAt = flatRest(function(array, indexes) { + var length = array == null ? 0 : array.length, + result = baseAt(array, indexes); + + basePullAt(array, arrayMap(indexes, function(index) { + return isIndex(index, length) ? +index : index; + }).sort(compareAscending)); + + return result; + }); + + /** + * Removes all elements from `array` that `predicate` returns truthy for + * and returns an array of the removed elements. The predicate is invoked + * with three arguments: (value, index, array). + * + * **Note:** Unlike `_.filter`, this method mutates `array`. Use `_.pull` + * to pull elements from an array by value. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @category Array + * @param {Array} array The array to modify. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the new array of removed elements. + * @example + * + * var array = [1, 2, 3, 4]; + * var evens = _.remove(array, function(n) { + * return n % 2 == 0; + * }); + * + * console.log(array); + * // => [1, 3] + * + * console.log(evens); + * // => [2, 4] + */ + function remove(array, predicate) { + var result = []; + if (!(array && array.length)) { + return result; + } + var index = -1, + indexes = [], + length = array.length; + + predicate = getIteratee(predicate, 3); + while (++index < length) { + var value = array[index]; + if (predicate(value, index, array)) { + result.push(value); + indexes.push(index); + } + } + basePullAt(array, indexes); + return result; + } + + /** + * Reverses `array` so that the first element becomes the last, the second + * element becomes the second to last, and so on. + * + * **Note:** This method mutates `array` and is based on + * [`Array#reverse`](https://mdn.io/Array/reverse). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to modify. + * @returns {Array} Returns `array`. + * @example + * + * var array = [1, 2, 3]; + * + * _.reverse(array); + * // => [3, 2, 1] + * + * console.log(array); + * // => [3, 2, 1] + */ + function reverse(array) { + return array == null ? array : nativeReverse.call(array); + } + + /** + * Creates a slice of `array` from `start` up to, but not including, `end`. + * + * **Note:** This method is used instead of + * [`Array#slice`](https://mdn.io/Array/slice) to ensure dense arrays are + * returned. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to slice. + * @param {number} [start=0] The start position. + * @param {number} [end=array.length] The end position. + * @returns {Array} Returns the slice of `array`. + */ + function slice(array, start, end) { + var length = array == null ? 0 : array.length; + if (!length) { + return []; + } + if (end && typeof end != 'number' && isIterateeCall(array, start, end)) { + start = 0; + end = length; + } + else { + start = start == null ? 0 : toInteger(start); + end = end === undefined ? length : toInteger(end); + } + return baseSlice(array, start, end); + } + + /** + * Uses a binary search to determine the lowest index at which `value` + * should be inserted into `array` in order to maintain its sort order. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. + * @example + * + * _.sortedIndex([30, 50], 40); + * // => 1 + */ + function sortedIndex(array, value) { + return baseSortedIndex(array, value); + } + + /** + * This method is like `_.sortedIndex` except that it accepts `iteratee` + * which is invoked for `value` and each element of `array` to compute their + * sort ranking. The iteratee is invoked with one argument: (value). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. + * @example + * + * var objects = [{ 'x': 4 }, { 'x': 5 }]; + * + * _.sortedIndexBy(objects, { 'x': 4 }, function(o) { return o.x; }); + * // => 0 + * + * // The `_.property` iteratee shorthand. + * _.sortedIndexBy(objects, { 'x': 4 }, 'x'); + * // => 0 + */ + function sortedIndexBy(array, value, iteratee) { + return baseSortedIndexBy(array, value, getIteratee(iteratee, 2)); + } + + /** + * This method is like `_.indexOf` except that it performs a binary + * search on a sorted `array`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @returns {number} Returns the index of the matched value, else `-1`. + * @example + * + * _.sortedIndexOf([4, 5, 5, 5, 6], 5); + * // => 1 + */ + function sortedIndexOf(array, value) { + var length = array == null ? 0 : array.length; + if (length) { + var index = baseSortedIndex(array, value); + if (index < length && eq(array[index], value)) { + return index; + } + } + return -1; + } + + /** + * This method is like `_.sortedIndex` except that it returns the highest + * index at which `value` should be inserted into `array` in order to + * maintain its sort order. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. + * @example + * + * _.sortedLastIndex([4, 5, 5, 5, 6], 5); + * // => 4 + */ + function sortedLastIndex(array, value) { + return baseSortedIndex(array, value, true); + } + + /** + * This method is like `_.sortedLastIndex` except that it accepts `iteratee` + * which is invoked for `value` and each element of `array` to compute their + * sort ranking. The iteratee is invoked with one argument: (value). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. + * @example + * + * var objects = [{ 'x': 4 }, { 'x': 5 }]; + * + * _.sortedLastIndexBy(objects, { 'x': 4 }, function(o) { return o.x; }); + * // => 1 + * + * // The `_.property` iteratee shorthand. + * _.sortedLastIndexBy(objects, { 'x': 4 }, 'x'); + * // => 1 + */ + function sortedLastIndexBy(array, value, iteratee) { + return baseSortedIndexBy(array, value, getIteratee(iteratee, 2), true); + } + + /** + * This method is like `_.lastIndexOf` except that it performs a binary + * search on a sorted `array`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {*} value The value to search for. + * @returns {number} Returns the index of the matched value, else `-1`. + * @example + * + * _.sortedLastIndexOf([4, 5, 5, 5, 6], 5); + * // => 3 + */ + function sortedLastIndexOf(array, value) { + var length = array == null ? 0 : array.length; + if (length) { + var index = baseSortedIndex(array, value, true) - 1; + if (eq(array[index], value)) { + return index; + } + } + return -1; + } + + /** + * This method is like `_.uniq` except that it's designed and optimized + * for sorted arrays. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @returns {Array} Returns the new duplicate free array. + * @example + * + * _.sortedUniq([1, 1, 2]); + * // => [1, 2] + */ + function sortedUniq(array) { + return (array && array.length) + ? baseSortedUniq(array) + : []; + } + + /** + * This method is like `_.uniqBy` except that it's designed and optimized + * for sorted arrays. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {Function} [iteratee] The iteratee invoked per element. + * @returns {Array} Returns the new duplicate free array. + * @example + * + * _.sortedUniqBy([1.1, 1.2, 2.3, 2.4], Math.floor); + * // => [1.1, 2.3] + */ + function sortedUniqBy(array, iteratee) { + return (array && array.length) + ? baseSortedUniq(array, getIteratee(iteratee, 2)) + : []; + } + + /** + * Gets all but the first element of `array`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to query. + * @returns {Array} Returns the slice of `array`. + * @example + * + * _.tail([1, 2, 3]); + * // => [2, 3] + */ + function tail(array) { + var length = array == null ? 0 : array.length; + return length ? baseSlice(array, 1, length) : []; + } + + /** + * Creates a slice of `array` with `n` elements taken from the beginning. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to query. + * @param {number} [n=1] The number of elements to take. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Array} Returns the slice of `array`. + * @example + * + * _.take([1, 2, 3]); + * // => [1] + * + * _.take([1, 2, 3], 2); + * // => [1, 2] + * + * _.take([1, 2, 3], 5); + * // => [1, 2, 3] + * + * _.take([1, 2, 3], 0); + * // => [] + */ + function take(array, n, guard) { + if (!(array && array.length)) { + return []; + } + n = (guard || n === undefined) ? 1 : toInteger(n); + return baseSlice(array, 0, n < 0 ? 0 : n); + } + + /** + * Creates a slice of `array` with `n` elements taken from the end. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to query. + * @param {number} [n=1] The number of elements to take. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Array} Returns the slice of `array`. + * @example + * + * _.takeRight([1, 2, 3]); + * // => [3] + * + * _.takeRight([1, 2, 3], 2); + * // => [2, 3] + * + * _.takeRight([1, 2, 3], 5); + * // => [1, 2, 3] + * + * _.takeRight([1, 2, 3], 0); + * // => [] + */ + function takeRight(array, n, guard) { + var length = array == null ? 0 : array.length; + if (!length) { + return []; + } + n = (guard || n === undefined) ? 1 : toInteger(n); + n = length - n; + return baseSlice(array, n < 0 ? 0 : n, length); + } + + /** + * Creates a slice of `array` with elements taken from the end. Elements are + * taken until `predicate` returns falsey. The predicate is invoked with + * three arguments: (value, index, array). + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to query. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the slice of `array`. + * @example + * + * var users = [ + * { 'user': 'barney', 'active': true }, + * { 'user': 'fred', 'active': false }, + * { 'user': 'pebbles', 'active': false } + * ]; + * + * _.takeRightWhile(users, function(o) { return !o.active; }); + * // => objects for ['fred', 'pebbles'] + * + * // The `_.matches` iteratee shorthand. + * _.takeRightWhile(users, { 'user': 'pebbles', 'active': false }); + * // => objects for ['pebbles'] + * + * // The `_.matchesProperty` iteratee shorthand. + * _.takeRightWhile(users, ['active', false]); + * // => objects for ['fred', 'pebbles'] + * + * // The `_.property` iteratee shorthand. + * _.takeRightWhile(users, 'active'); + * // => [] + */ + function takeRightWhile(array, predicate) { + return (array && array.length) + ? baseWhile(array, getIteratee(predicate, 3), false, true) + : []; + } + + /** + * Creates a slice of `array` with elements taken from the beginning. Elements + * are taken until `predicate` returns falsey. The predicate is invoked with + * three arguments: (value, index, array). + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Array + * @param {Array} array The array to query. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the slice of `array`. + * @example + * + * var users = [ + * { 'user': 'barney', 'active': false }, + * { 'user': 'fred', 'active': false }, + * { 'user': 'pebbles', 'active': true } + * ]; + * + * _.takeWhile(users, function(o) { return !o.active; }); + * // => objects for ['barney', 'fred'] + * + * // The `_.matches` iteratee shorthand. + * _.takeWhile(users, { 'user': 'barney', 'active': false }); + * // => objects for ['barney'] + * + * // The `_.matchesProperty` iteratee shorthand. + * _.takeWhile(users, ['active', false]); + * // => objects for ['barney', 'fred'] + * + * // The `_.property` iteratee shorthand. + * _.takeWhile(users, 'active'); + * // => [] + */ + function takeWhile(array, predicate) { + return (array && array.length) + ? baseWhile(array, getIteratee(predicate, 3)) + : []; + } + + /** + * Creates an array of unique values, in order, from all given arrays using + * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @returns {Array} Returns the new array of combined values. + * @example + * + * _.union([2], [1, 2]); + * // => [2, 1] + */ + var union = baseRest(function(arrays) { + return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true)); + }); + + /** + * This method is like `_.union` except that it accepts `iteratee` which is + * invoked for each element of each `arrays` to generate the criterion by + * which uniqueness is computed. Result values are chosen from the first + * array in which the value occurs. The iteratee is invoked with one argument: + * (value). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Array} Returns the new array of combined values. + * @example + * + * _.unionBy([2.1], [1.2, 2.3], Math.floor); + * // => [2.1, 1.2] + * + * // The `_.property` iteratee shorthand. + * _.unionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); + * // => [{ 'x': 1 }, { 'x': 2 }] + */ + var unionBy = baseRest(function(arrays) { + var iteratee = last(arrays); + if (isArrayLikeObject(iteratee)) { + iteratee = undefined; + } + return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), getIteratee(iteratee, 2)); + }); + + /** + * This method is like `_.union` except that it accepts `comparator` which + * is invoked to compare elements of `arrays`. Result values are chosen from + * the first array in which the value occurs. The comparator is invoked + * with two arguments: (arrVal, othVal). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of combined values. + * @example + * + * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; + * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; + * + * _.unionWith(objects, others, _.isEqual); + * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }] + */ + var unionWith = baseRest(function(arrays) { + var comparator = last(arrays); + comparator = typeof comparator == 'function' ? comparator : undefined; + return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), undefined, comparator); + }); + + /** + * Creates a duplicate-free version of an array, using + * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons, in which only the first occurrence of each element + * is kept. The order of result values is determined by the order they occur + * in the array. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to inspect. + * @returns {Array} Returns the new duplicate free array. + * @example + * + * _.uniq([2, 1, 2]); + * // => [2, 1] + */ + function uniq(array) { + return (array && array.length) ? baseUniq(array) : []; + } + + /** + * This method is like `_.uniq` except that it accepts `iteratee` which is + * invoked for each element in `array` to generate the criterion by which + * uniqueness is computed. The order of result values is determined by the + * order they occur in the array. The iteratee is invoked with one argument: + * (value). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Array} Returns the new duplicate free array. + * @example + * + * _.uniqBy([2.1, 1.2, 2.3], Math.floor); + * // => [2.1, 1.2] + * + * // The `_.property` iteratee shorthand. + * _.uniqBy([{ 'x': 1 }, { 'x': 2 }, { 'x': 1 }], 'x'); + * // => [{ 'x': 1 }, { 'x': 2 }] + */ + function uniqBy(array, iteratee) { + return (array && array.length) ? baseUniq(array, getIteratee(iteratee, 2)) : []; + } + + /** + * This method is like `_.uniq` except that it accepts `comparator` which + * is invoked to compare elements of `array`. The order of result values is + * determined by the order they occur in the array.The comparator is invoked + * with two arguments: (arrVal, othVal). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new duplicate free array. + * @example + * + * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 2 }]; + * + * _.uniqWith(objects, _.isEqual); + * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }] + */ + function uniqWith(array, comparator) { + comparator = typeof comparator == 'function' ? comparator : undefined; + return (array && array.length) ? baseUniq(array, undefined, comparator) : []; + } + + /** + * This method is like `_.zip` except that it accepts an array of grouped + * elements and creates an array regrouping the elements to their pre-zip + * configuration. + * + * @static + * @memberOf _ + * @since 1.2.0 + * @category Array + * @param {Array} array The array of grouped elements to process. + * @returns {Array} Returns the new array of regrouped elements. + * @example + * + * var zipped = _.zip(['a', 'b'], [1, 2], [true, false]); + * // => [['a', 1, true], ['b', 2, false]] + * + * _.unzip(zipped); + * // => [['a', 'b'], [1, 2], [true, false]] + */ + function unzip(array) { + if (!(array && array.length)) { + return []; + } + var length = 0; + array = arrayFilter(array, function(group) { + if (isArrayLikeObject(group)) { + length = nativeMax(group.length, length); + return true; + } + }); + return baseTimes(length, function(index) { + return arrayMap(array, baseProperty(index)); + }); + } + + /** + * This method is like `_.unzip` except that it accepts `iteratee` to specify + * how regrouped values should be combined. The iteratee is invoked with the + * elements of each group: (...group). + * + * @static + * @memberOf _ + * @since 3.8.0 + * @category Array + * @param {Array} array The array of grouped elements to process. + * @param {Function} [iteratee=_.identity] The function to combine + * regrouped values. + * @returns {Array} Returns the new array of regrouped elements. + * @example + * + * var zipped = _.zip([1, 2], [10, 20], [100, 200]); + * // => [[1, 10, 100], [2, 20, 200]] + * + * _.unzipWith(zipped, _.add); + * // => [3, 30, 300] + */ + function unzipWith(array, iteratee) { + if (!(array && array.length)) { + return []; + } + var result = unzip(array); + if (iteratee == null) { + return result; + } + return arrayMap(result, function(group) { + return apply(iteratee, undefined, group); + }); + } + + /** + * Creates an array excluding all given values using + * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * for equality comparisons. + * + * **Note:** Unlike `_.pull`, this method returns a new array. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {Array} array The array to inspect. + * @param {...*} [values] The values to exclude. + * @returns {Array} Returns the new array of filtered values. + * @see _.difference, _.xor + * @example + * + * _.without([2, 1, 2, 3], 1, 2); + * // => [3] + */ + var without = baseRest(function(array, values) { + return isArrayLikeObject(array) + ? baseDifference(array, values) + : []; + }); + + /** + * Creates an array of unique values that is the + * [symmetric difference](https://en.wikipedia.org/wiki/Symmetric_difference) + * of the given arrays. The order of result values is determined by the order + * they occur in the arrays. + * + * @static + * @memberOf _ + * @since 2.4.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @returns {Array} Returns the new array of filtered values. + * @see _.difference, _.without + * @example + * + * _.xor([2, 1], [2, 3]); + * // => [1, 3] + */ + var xor = baseRest(function(arrays) { + return baseXor(arrayFilter(arrays, isArrayLikeObject)); + }); + + /** + * This method is like `_.xor` except that it accepts `iteratee` which is + * invoked for each element of each `arrays` to generate the criterion by + * which by which they're compared. The order of result values is determined + * by the order they occur in the arrays. The iteratee is invoked with one + * argument: (value). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Array} Returns the new array of filtered values. + * @example + * + * _.xorBy([2.1, 1.2], [2.3, 3.4], Math.floor); + * // => [1.2, 3.4] + * + * // The `_.property` iteratee shorthand. + * _.xorBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); + * // => [{ 'x': 2 }] + */ + var xorBy = baseRest(function(arrays) { + var iteratee = last(arrays); + if (isArrayLikeObject(iteratee)) { + iteratee = undefined; + } + return baseXor(arrayFilter(arrays, isArrayLikeObject), getIteratee(iteratee, 2)); + }); + + /** + * This method is like `_.xor` except that it accepts `comparator` which is + * invoked to compare elements of `arrays`. The order of result values is + * determined by the order they occur in the arrays. The comparator is invoked + * with two arguments: (arrVal, othVal). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @param {Function} [comparator] The comparator invoked per element. + * @returns {Array} Returns the new array of filtered values. + * @example + * + * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; + * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; + * + * _.xorWith(objects, others, _.isEqual); + * // => [{ 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }] + */ + var xorWith = baseRest(function(arrays) { + var comparator = last(arrays); + comparator = typeof comparator == 'function' ? comparator : undefined; + return baseXor(arrayFilter(arrays, isArrayLikeObject), undefined, comparator); + }); + + /** + * Creates an array of grouped elements, the first of which contains the + * first elements of the given arrays, the second of which contains the + * second elements of the given arrays, and so on. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Array + * @param {...Array} [arrays] The arrays to process. + * @returns {Array} Returns the new array of grouped elements. + * @example + * + * _.zip(['a', 'b'], [1, 2], [true, false]); + * // => [['a', 1, true], ['b', 2, false]] + */ + var zip = baseRest(unzip); + + /** + * This method is like `_.fromPairs` except that it accepts two arrays, + * one of property identifiers and one of corresponding values. + * + * @static + * @memberOf _ + * @since 0.4.0 + * @category Array + * @param {Array} [props=[]] The property identifiers. + * @param {Array} [values=[]] The property values. + * @returns {Object} Returns the new object. + * @example + * + * _.zipObject(['a', 'b'], [1, 2]); + * // => { 'a': 1, 'b': 2 } + */ + function zipObject(props, values) { + return baseZipObject(props || [], values || [], assignValue); + } + + /** + * This method is like `_.zipObject` except that it supports property paths. + * + * @static + * @memberOf _ + * @since 4.1.0 + * @category Array + * @param {Array} [props=[]] The property identifiers. + * @param {Array} [values=[]] The property values. + * @returns {Object} Returns the new object. + * @example + * + * _.zipObjectDeep(['a.b[0].c', 'a.b[1].d'], [1, 2]); + * // => { 'a': { 'b': [{ 'c': 1 }, { 'd': 2 }] } } + */ + function zipObjectDeep(props, values) { + return baseZipObject(props || [], values || [], baseSet); + } + + /** + * This method is like `_.zip` except that it accepts `iteratee` to specify + * how grouped values should be combined. The iteratee is invoked with the + * elements of each group: (...group). + * + * @static + * @memberOf _ + * @since 3.8.0 + * @category Array + * @param {...Array} [arrays] The arrays to process. + * @param {Function} [iteratee=_.identity] The function to combine + * grouped values. + * @returns {Array} Returns the new array of grouped elements. + * @example + * + * _.zipWith([1, 2], [10, 20], [100, 200], function(a, b, c) { + * return a + b + c; + * }); + * // => [111, 222] + */ + var zipWith = baseRest(function(arrays) { + var length = arrays.length, + iteratee = length > 1 ? arrays[length - 1] : undefined; + + iteratee = typeof iteratee == 'function' ? (arrays.pop(), iteratee) : undefined; + return unzipWith(arrays, iteratee); + }); + + /*------------------------------------------------------------------------*/ + + /** + * Creates a `lodash` wrapper instance that wraps `value` with explicit method + * chain sequences enabled. The result of such sequences must be unwrapped + * with `_#value`. + * + * @static + * @memberOf _ + * @since 1.3.0 + * @category Seq + * @param {*} value The value to wrap. + * @returns {Object} Returns the new `lodash` wrapper instance. + * @example + * + * var users = [ + * { 'user': 'barney', 'age': 36 }, + * { 'user': 'fred', 'age': 40 }, + * { 'user': 'pebbles', 'age': 1 } + * ]; + * + * var youngest = _ + * .chain(users) + * .sortBy('age') + * .map(function(o) { + * return o.user + ' is ' + o.age; + * }) + * .head() + * .value(); + * // => 'pebbles is 1' + */ + function chain(value) { + var result = lodash(value); + result.__chain__ = true; + return result; + } + + /** + * This method invokes `interceptor` and returns `value`. The interceptor + * is invoked with one argument; (value). The purpose of this method is to + * "tap into" a method chain sequence in order to modify intermediate results. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Seq + * @param {*} value The value to provide to `interceptor`. + * @param {Function} interceptor The function to invoke. + * @returns {*} Returns `value`. + * @example + * + * _([1, 2, 3]) + * .tap(function(array) { + * // Mutate input array. + * array.pop(); + * }) + * .reverse() + * .value(); + * // => [2, 1] + */ + function tap(value, interceptor) { + interceptor(value); + return value; + } + + /** + * This method is like `_.tap` except that it returns the result of `interceptor`. + * The purpose of this method is to "pass thru" values replacing intermediate + * results in a method chain sequence. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Seq + * @param {*} value The value to provide to `interceptor`. + * @param {Function} interceptor The function to invoke. + * @returns {*} Returns the result of `interceptor`. + * @example + * + * _(' abc ') + * .chain() + * .trim() + * .thru(function(value) { + * return [value]; + * }) + * .value(); + * // => ['abc'] + */ + function thru(value, interceptor) { + return interceptor(value); + } + + /** + * This method is the wrapper version of `_.at`. + * + * @name at + * @memberOf _ + * @since 1.0.0 + * @category Seq + * @param {...(string|string[])} [paths] The property paths to pick. + * @returns {Object} Returns the new `lodash` wrapper instance. + * @example + * + * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] }; + * + * _(object).at(['a[0].b.c', 'a[1]']).value(); + * // => [3, 4] + */ + var wrapperAt = flatRest(function(paths) { + var length = paths.length, + start = length ? paths[0] : 0, + value = this.__wrapped__, + interceptor = function(object) { return baseAt(object, paths); }; + + if (length > 1 || this.__actions__.length || + !(value instanceof LazyWrapper) || !isIndex(start)) { + return this.thru(interceptor); + } + value = value.slice(start, +start + (length ? 1 : 0)); + value.__actions__.push({ + 'func': thru, + 'args': [interceptor], + 'thisArg': undefined + }); + return new LodashWrapper(value, this.__chain__).thru(function(array) { + if (length && !array.length) { + array.push(undefined); + } + return array; + }); + }); + + /** + * Creates a `lodash` wrapper instance with explicit method chain sequences enabled. + * + * @name chain + * @memberOf _ + * @since 0.1.0 + * @category Seq + * @returns {Object} Returns the new `lodash` wrapper instance. + * @example + * + * var users = [ + * { 'user': 'barney', 'age': 36 }, + * { 'user': 'fred', 'age': 40 } + * ]; + * + * // A sequence without explicit chaining. + * _(users).head(); + * // => { 'user': 'barney', 'age': 36 } + * + * // A sequence with explicit chaining. + * _(users) + * .chain() + * .head() + * .pick('user') + * .value(); + * // => { 'user': 'barney' } + */ + function wrapperChain() { + return chain(this); + } + + /** + * Executes the chain sequence and returns the wrapped result. + * + * @name commit + * @memberOf _ + * @since 3.2.0 + * @category Seq + * @returns {Object} Returns the new `lodash` wrapper instance. + * @example + * + * var array = [1, 2]; + * var wrapped = _(array).push(3); + * + * console.log(array); + * // => [1, 2] + * + * wrapped = wrapped.commit(); + * console.log(array); + * // => [1, 2, 3] + * + * wrapped.last(); + * // => 3 + * + * console.log(array); + * // => [1, 2, 3] + */ + function wrapperCommit() { + return new LodashWrapper(this.value(), this.__chain__); + } + + /** + * Gets the next value on a wrapped object following the + * [iterator protocol](https://mdn.io/iteration_protocols#iterator). + * + * @name next + * @memberOf _ + * @since 4.0.0 + * @category Seq + * @returns {Object} Returns the next iterator value. + * @example + * + * var wrapped = _([1, 2]); + * + * wrapped.next(); + * // => { 'done': false, 'value': 1 } + * + * wrapped.next(); + * // => { 'done': false, 'value': 2 } + * + * wrapped.next(); + * // => { 'done': true, 'value': undefined } + */ + function wrapperNext() { + if (this.__values__ === undefined) { + this.__values__ = toArray(this.value()); + } + var done = this.__index__ >= this.__values__.length, + value = done ? undefined : this.__values__[this.__index__++]; + + return { 'done': done, 'value': value }; + } + + /** + * Enables the wrapper to be iterable. + * + * @name Symbol.iterator + * @memberOf _ + * @since 4.0.0 + * @category Seq + * @returns {Object} Returns the wrapper object. + * @example + * + * var wrapped = _([1, 2]); + * + * wrapped[Symbol.iterator]() === wrapped; + * // => true + * + * Array.from(wrapped); + * // => [1, 2] + */ + function wrapperToIterator() { + return this; + } + + /** + * Creates a clone of the chain sequence planting `value` as the wrapped value. + * + * @name plant + * @memberOf _ + * @since 3.2.0 + * @category Seq + * @param {*} value The value to plant. + * @returns {Object} Returns the new `lodash` wrapper instance. + * @example + * + * function square(n) { + * return n * n; + * } + * + * var wrapped = _([1, 2]).map(square); + * var other = wrapped.plant([3, 4]); + * + * other.value(); + * // => [9, 16] + * + * wrapped.value(); + * // => [1, 4] + */ + function wrapperPlant(value) { + var result, + parent = this; + + while (parent instanceof baseLodash) { + var clone = wrapperClone(parent); + clone.__index__ = 0; + clone.__values__ = undefined; + if (result) { + previous.__wrapped__ = clone; + } else { + result = clone; + } + var previous = clone; + parent = parent.__wrapped__; + } + previous.__wrapped__ = value; + return result; + } + + /** + * This method is the wrapper version of `_.reverse`. + * + * **Note:** This method mutates the wrapped array. + * + * @name reverse + * @memberOf _ + * @since 0.1.0 + * @category Seq + * @returns {Object} Returns the new `lodash` wrapper instance. + * @example + * + * var array = [1, 2, 3]; + * + * _(array).reverse().value() + * // => [3, 2, 1] + * + * console.log(array); + * // => [3, 2, 1] + */ + function wrapperReverse() { + var value = this.__wrapped__; + if (value instanceof LazyWrapper) { + var wrapped = value; + if (this.__actions__.length) { + wrapped = new LazyWrapper(this); + } + wrapped = wrapped.reverse(); + wrapped.__actions__.push({ + 'func': thru, + 'args': [reverse], + 'thisArg': undefined + }); + return new LodashWrapper(wrapped, this.__chain__); + } + return this.thru(reverse); + } + + /** + * Executes the chain sequence to resolve the unwrapped value. + * + * @name value + * @memberOf _ + * @since 0.1.0 + * @alias toJSON, valueOf + * @category Seq + * @returns {*} Returns the resolved unwrapped value. + * @example + * + * _([1, 2, 3]).value(); + * // => [1, 2, 3] + */ + function wrapperValue() { + return baseWrapperValue(this.__wrapped__, this.__actions__); + } + + /*------------------------------------------------------------------------*/ + + /** + * Creates an object composed of keys generated from the results of running + * each element of `collection` thru `iteratee`. The corresponding value of + * each key is the number of times the key was returned by `iteratee`. The + * iteratee is invoked with one argument: (value). + * + * @static + * @memberOf _ + * @since 0.5.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The iteratee to transform keys. + * @returns {Object} Returns the composed aggregate object. + * @example + * + * _.countBy([6.1, 4.2, 6.3], Math.floor); + * // => { '4': 1, '6': 2 } + * + * // The `_.property` iteratee shorthand. + * _.countBy(['one', 'two', 'three'], 'length'); + * // => { '3': 2, '5': 1 } + */ + var countBy = createAggregator(function(result, value, key) { + if (hasOwnProperty.call(result, key)) { + ++result[key]; + } else { + baseAssignValue(result, key, 1); + } + }); + + /** + * Checks if `predicate` returns truthy for **all** elements of `collection`. + * Iteration is stopped once `predicate` returns falsey. The predicate is + * invoked with three arguments: (value, index|key, collection). + * + * **Note:** This method returns `true` for + * [empty collections](https://en.wikipedia.org/wiki/Empty_set) because + * [everything is true](https://en.wikipedia.org/wiki/Vacuous_truth) of + * elements of empty collections. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {boolean} Returns `true` if all elements pass the predicate check, + * else `false`. + * @example + * + * _.every([true, 1, null, 'yes'], Boolean); + * // => false + * + * var users = [ + * { 'user': 'barney', 'age': 36, 'active': false }, + * { 'user': 'fred', 'age': 40, 'active': false } + * ]; + * + * // The `_.matches` iteratee shorthand. + * _.every(users, { 'user': 'barney', 'active': false }); + * // => false + * + * // The `_.matchesProperty` iteratee shorthand. + * _.every(users, ['active', false]); + * // => true + * + * // The `_.property` iteratee shorthand. + * _.every(users, 'active'); + * // => false + */ + function every(collection, predicate, guard) { + var func = isArray(collection) ? arrayEvery : baseEvery; + if (guard && isIterateeCall(collection, predicate, guard)) { + predicate = undefined; + } + return func(collection, getIteratee(predicate, 3)); + } + + /** + * Iterates over elements of `collection`, returning an array of all elements + * `predicate` returns truthy for. The predicate is invoked with three + * arguments: (value, index|key, collection). + * + * **Note:** Unlike `_.remove`, this method returns a new array. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the new filtered array. + * @see _.reject + * @example + * + * var users = [ + * { 'user': 'barney', 'age': 36, 'active': true }, + * { 'user': 'fred', 'age': 40, 'active': false } + * ]; + * + * _.filter(users, function(o) { return !o.active; }); + * // => objects for ['fred'] + * + * // The `_.matches` iteratee shorthand. + * _.filter(users, { 'age': 36, 'active': true }); + * // => objects for ['barney'] + * + * // The `_.matchesProperty` iteratee shorthand. + * _.filter(users, ['active', false]); + * // => objects for ['fred'] + * + * // The `_.property` iteratee shorthand. + * _.filter(users, 'active'); + * // => objects for ['barney'] + */ + function filter(collection, predicate) { + var func = isArray(collection) ? arrayFilter : baseFilter; + return func(collection, getIteratee(predicate, 3)); + } + + /** + * Iterates over elements of `collection`, returning the first element + * `predicate` returns truthy for. The predicate is invoked with three + * arguments: (value, index|key, collection). + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to inspect. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @param {number} [fromIndex=0] The index to search from. + * @returns {*} Returns the matched element, else `undefined`. + * @example + * + * var users = [ + * { 'user': 'barney', 'age': 36, 'active': true }, + * { 'user': 'fred', 'age': 40, 'active': false }, + * { 'user': 'pebbles', 'age': 1, 'active': true } + * ]; + * + * _.find(users, function(o) { return o.age < 40; }); + * // => object for 'barney' + * + * // The `_.matches` iteratee shorthand. + * _.find(users, { 'age': 1, 'active': true }); + * // => object for 'pebbles' + * + * // The `_.matchesProperty` iteratee shorthand. + * _.find(users, ['active', false]); + * // => object for 'fred' + * + * // The `_.property` iteratee shorthand. + * _.find(users, 'active'); + * // => object for 'barney' + */ + var find = createFind(findIndex); + + /** + * This method is like `_.find` except that it iterates over elements of + * `collection` from right to left. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @category Collection + * @param {Array|Object} collection The collection to inspect. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @param {number} [fromIndex=collection.length-1] The index to search from. + * @returns {*} Returns the matched element, else `undefined`. + * @example + * + * _.findLast([1, 2, 3, 4], function(n) { + * return n % 2 == 1; + * }); + * // => 3 + */ + var findLast = createFind(findLastIndex); + + /** + * Creates a flattened array of values by running each element in `collection` + * thru `iteratee` and flattening the mapped results. The iteratee is invoked + * with three arguments: (value, index|key, collection). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Array} Returns the new flattened array. + * @example + * + * function duplicate(n) { + * return [n, n]; + * } + * + * _.flatMap([1, 2], duplicate); + * // => [1, 1, 2, 2] + */ + function flatMap(collection, iteratee) { + return baseFlatten(map(collection, iteratee), 1); + } + + /** + * This method is like `_.flatMap` except that it recursively flattens the + * mapped results. + * + * @static + * @memberOf _ + * @since 4.7.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Array} Returns the new flattened array. + * @example + * + * function duplicate(n) { + * return [[[n, n]]]; + * } + * + * _.flatMapDeep([1, 2], duplicate); + * // => [1, 1, 2, 2] + */ + function flatMapDeep(collection, iteratee) { + return baseFlatten(map(collection, iteratee), INFINITY); + } + + /** + * This method is like `_.flatMap` except that it recursively flattens the + * mapped results up to `depth` times. + * + * @static + * @memberOf _ + * @since 4.7.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @param {number} [depth=1] The maximum recursion depth. + * @returns {Array} Returns the new flattened array. + * @example + * + * function duplicate(n) { + * return [[[n, n]]]; + * } + * + * _.flatMapDepth([1, 2], duplicate, 2); + * // => [[1, 1], [2, 2]] + */ + function flatMapDepth(collection, iteratee, depth) { + depth = depth === undefined ? 1 : toInteger(depth); + return baseFlatten(map(collection, iteratee), depth); + } + + /** + * Iterates over elements of `collection` and invokes `iteratee` for each element. + * The iteratee is invoked with three arguments: (value, index|key, collection). + * Iteratee functions may exit iteration early by explicitly returning `false`. + * + * **Note:** As with other "Collections" methods, objects with a "length" + * property are iterated like arrays. To avoid this behavior use `_.forIn` + * or `_.forOwn` for object iteration. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @alias each + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Array|Object} Returns `collection`. + * @see _.forEachRight + * @example + * + * _.forEach([1, 2], function(value) { + * console.log(value); + * }); + * // => Logs `1` then `2`. + * + * _.forEach({ 'a': 1, 'b': 2 }, function(value, key) { + * console.log(key); + * }); + * // => Logs 'a' then 'b' (iteration order is not guaranteed). + */ + function forEach(collection, iteratee) { + var func = isArray(collection) ? arrayEach : baseEach; + return func(collection, getIteratee(iteratee, 3)); + } + + /** + * This method is like `_.forEach` except that it iterates over elements of + * `collection` from right to left. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @alias eachRight + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Array|Object} Returns `collection`. + * @see _.forEach + * @example + * + * _.forEachRight([1, 2], function(value) { + * console.log(value); + * }); + * // => Logs `2` then `1`. + */ + function forEachRight(collection, iteratee) { + var func = isArray(collection) ? arrayEachRight : baseEachRight; + return func(collection, getIteratee(iteratee, 3)); + } + + /** + * Creates an object composed of keys generated from the results of running + * each element of `collection` thru `iteratee`. The order of grouped values + * is determined by the order they occur in `collection`. The corresponding + * value of each key is an array of elements responsible for generating the + * key. The iteratee is invoked with one argument: (value). + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The iteratee to transform keys. + * @returns {Object} Returns the composed aggregate object. + * @example + * + * _.groupBy([6.1, 4.2, 6.3], Math.floor); + * // => { '4': [4.2], '6': [6.1, 6.3] } + * + * // The `_.property` iteratee shorthand. + * _.groupBy(['one', 'two', 'three'], 'length'); + * // => { '3': ['one', 'two'], '5': ['three'] } + */ + var groupBy = createAggregator(function(result, value, key) { + if (hasOwnProperty.call(result, key)) { + result[key].push(value); + } else { + baseAssignValue(result, key, [value]); + } + }); + + /** + * Checks if `value` is in `collection`. If `collection` is a string, it's + * checked for a substring of `value`, otherwise + * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * is used for equality comparisons. If `fromIndex` is negative, it's used as + * the offset from the end of `collection`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object|string} collection The collection to inspect. + * @param {*} value The value to search for. + * @param {number} [fromIndex=0] The index to search from. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`. + * @returns {boolean} Returns `true` if `value` is found, else `false`. + * @example + * + * _.includes([1, 2, 3], 1); + * // => true + * + * _.includes([1, 2, 3], 1, 2); + * // => false + * + * _.includes({ 'a': 1, 'b': 2 }, 1); + * // => true + * + * _.includes('abcd', 'bc'); + * // => true + */ + function includes(collection, value, fromIndex, guard) { + collection = isArrayLike(collection) ? collection : values(collection); + fromIndex = (fromIndex && !guard) ? toInteger(fromIndex) : 0; + + var length = collection.length; + if (fromIndex < 0) { + fromIndex = nativeMax(length + fromIndex, 0); + } + return isString(collection) + ? (fromIndex <= length && collection.indexOf(value, fromIndex) > -1) + : (!!length && baseIndexOf(collection, value, fromIndex) > -1); + } + + /** + * Invokes the method at `path` of each element in `collection`, returning + * an array of the results of each invoked method. Any additional arguments + * are provided to each invoked method. If `path` is a function, it's invoked + * for, and `this` bound to, each element in `collection`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Array|Function|string} path The path of the method to invoke or + * the function invoked per iteration. + * @param {...*} [args] The arguments to invoke each method with. + * @returns {Array} Returns the array of results. + * @example + * + * _.invokeMap([[5, 1, 7], [3, 2, 1]], 'sort'); + * // => [[1, 5, 7], [1, 2, 3]] + * + * _.invokeMap([123, 456], String.prototype.split, ''); + * // => [['1', '2', '3'], ['4', '5', '6']] + */ + var invokeMap = baseRest(function(collection, path, args) { + var index = -1, + isFunc = typeof path == 'function', + result = isArrayLike(collection) ? Array(collection.length) : []; + + baseEach(collection, function(value) { + result[++index] = isFunc ? apply(path, value, args) : baseInvoke(value, path, args); + }); + return result; + }); + + /** + * Creates an object composed of keys generated from the results of running + * each element of `collection` thru `iteratee`. The corresponding value of + * each key is the last element responsible for generating the key. The + * iteratee is invoked with one argument: (value). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The iteratee to transform keys. + * @returns {Object} Returns the composed aggregate object. + * @example + * + * var array = [ + * { 'dir': 'left', 'code': 97 }, + * { 'dir': 'right', 'code': 100 } + * ]; + * + * _.keyBy(array, function(o) { + * return String.fromCharCode(o.code); + * }); + * // => { 'a': { 'dir': 'left', 'code': 97 }, 'd': { 'dir': 'right', 'code': 100 } } + * + * _.keyBy(array, 'dir'); + * // => { 'left': { 'dir': 'left', 'code': 97 }, 'right': { 'dir': 'right', 'code': 100 } } + */ + var keyBy = createAggregator(function(result, value, key) { + baseAssignValue(result, key, value); + }); + + /** + * Creates an array of values by running each element in `collection` thru + * `iteratee`. The iteratee is invoked with three arguments: + * (value, index|key, collection). + * + * Many lodash methods are guarded to work as iteratees for methods like + * `_.every`, `_.filter`, `_.map`, `_.mapValues`, `_.reject`, and `_.some`. + * + * The guarded methods are: + * `ary`, `chunk`, `curry`, `curryRight`, `drop`, `dropRight`, `every`, + * `fill`, `invert`, `parseInt`, `random`, `range`, `rangeRight`, `repeat`, + * `sampleSize`, `slice`, `some`, `sortBy`, `split`, `take`, `takeRight`, + * `template`, `trim`, `trimEnd`, `trimStart`, and `words` + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Array} Returns the new mapped array. + * @example + * + * function square(n) { + * return n * n; + * } + * + * _.map([4, 8], square); + * // => [16, 64] + * + * _.map({ 'a': 4, 'b': 8 }, square); + * // => [16, 64] (iteration order is not guaranteed) + * + * var users = [ + * { 'user': 'barney' }, + * { 'user': 'fred' } + * ]; + * + * // The `_.property` iteratee shorthand. + * _.map(users, 'user'); + * // => ['barney', 'fred'] + */ + function map(collection, iteratee) { + var func = isArray(collection) ? arrayMap : baseMap; + return func(collection, getIteratee(iteratee, 3)); + } + + /** + * This method is like `_.sortBy` except that it allows specifying the sort + * orders of the iteratees to sort by. If `orders` is unspecified, all values + * are sorted in ascending order. Otherwise, specify an order of "desc" for + * descending or "asc" for ascending sort order of corresponding values. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Array[]|Function[]|Object[]|string[]} [iteratees=[_.identity]] + * The iteratees to sort by. + * @param {string[]} [orders] The sort orders of `iteratees`. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`. + * @returns {Array} Returns the new sorted array. + * @example + * + * var users = [ + * { 'user': 'fred', 'age': 48 }, + * { 'user': 'barney', 'age': 34 }, + * { 'user': 'fred', 'age': 40 }, + * { 'user': 'barney', 'age': 36 } + * ]; + * + * // Sort by `user` in ascending order and by `age` in descending order. + * _.orderBy(users, ['user', 'age'], ['asc', 'desc']); + * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]] + */ + function orderBy(collection, iteratees, orders, guard) { + if (collection == null) { + return []; + } + if (!isArray(iteratees)) { + iteratees = iteratees == null ? [] : [iteratees]; + } + orders = guard ? undefined : orders; + if (!isArray(orders)) { + orders = orders == null ? [] : [orders]; + } + return baseOrderBy(collection, iteratees, orders); + } + + /** + * Creates an array of elements split into two groups, the first of which + * contains elements `predicate` returns truthy for, the second of which + * contains elements `predicate` returns falsey for. The predicate is + * invoked with one argument: (value). + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the array of grouped elements. + * @example + * + * var users = [ + * { 'user': 'barney', 'age': 36, 'active': false }, + * { 'user': 'fred', 'age': 40, 'active': true }, + * { 'user': 'pebbles', 'age': 1, 'active': false } + * ]; + * + * _.partition(users, function(o) { return o.active; }); + * // => objects for [['fred'], ['barney', 'pebbles']] + * + * // The `_.matches` iteratee shorthand. + * _.partition(users, { 'age': 1, 'active': false }); + * // => objects for [['pebbles'], ['barney', 'fred']] + * + * // The `_.matchesProperty` iteratee shorthand. + * _.partition(users, ['active', false]); + * // => objects for [['barney', 'pebbles'], ['fred']] + * + * // The `_.property` iteratee shorthand. + * _.partition(users, 'active'); + * // => objects for [['fred'], ['barney', 'pebbles']] + */ + var partition = createAggregator(function(result, value, key) { + result[key ? 0 : 1].push(value); + }, function() { return [[], []]; }); + + /** + * Reduces `collection` to a value which is the accumulated result of running + * each element in `collection` thru `iteratee`, where each successive + * invocation is supplied the return value of the previous. If `accumulator` + * is not given, the first element of `collection` is used as the initial + * value. The iteratee is invoked with four arguments: + * (accumulator, value, index|key, collection). + * + * Many lodash methods are guarded to work as iteratees for methods like + * `_.reduce`, `_.reduceRight`, and `_.transform`. + * + * The guarded methods are: + * `assign`, `defaults`, `defaultsDeep`, `includes`, `merge`, `orderBy`, + * and `sortBy` + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @param {*} [accumulator] The initial value. + * @returns {*} Returns the accumulated value. + * @see _.reduceRight + * @example + * + * _.reduce([1, 2], function(sum, n) { + * return sum + n; + * }, 0); + * // => 3 + * + * _.reduce({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) { + * (result[value] || (result[value] = [])).push(key); + * return result; + * }, {}); + * // => { '1': ['a', 'c'], '2': ['b'] } (iteration order is not guaranteed) + */ + function reduce(collection, iteratee, accumulator) { + var func = isArray(collection) ? arrayReduce : baseReduce, + initAccum = arguments.length < 3; + + return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEach); + } + + /** + * This method is like `_.reduce` except that it iterates over elements of + * `collection` from right to left. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @param {*} [accumulator] The initial value. + * @returns {*} Returns the accumulated value. + * @see _.reduce + * @example + * + * var array = [[0, 1], [2, 3], [4, 5]]; + * + * _.reduceRight(array, function(flattened, other) { + * return flattened.concat(other); + * }, []); + * // => [4, 5, 2, 3, 0, 1] + */ + function reduceRight(collection, iteratee, accumulator) { + var func = isArray(collection) ? arrayReduceRight : baseReduce, + initAccum = arguments.length < 3; + + return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEachRight); + } + + /** + * The opposite of `_.filter`; this method returns the elements of `collection` + * that `predicate` does **not** return truthy for. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {Array} Returns the new filtered array. + * @see _.filter + * @example + * + * var users = [ + * { 'user': 'barney', 'age': 36, 'active': false }, + * { 'user': 'fred', 'age': 40, 'active': true } + * ]; + * + * _.reject(users, function(o) { return !o.active; }); + * // => objects for ['fred'] + * + * // The `_.matches` iteratee shorthand. + * _.reject(users, { 'age': 40, 'active': true }); + * // => objects for ['barney'] + * + * // The `_.matchesProperty` iteratee shorthand. + * _.reject(users, ['active', false]); + * // => objects for ['fred'] + * + * // The `_.property` iteratee shorthand. + * _.reject(users, 'active'); + * // => objects for ['barney'] + */ + function reject(collection, predicate) { + var func = isArray(collection) ? arrayFilter : baseFilter; + return func(collection, negate(getIteratee(predicate, 3))); + } + + /** + * Gets a random element from `collection`. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @category Collection + * @param {Array|Object} collection The collection to sample. + * @returns {*} Returns the random element. + * @example + * + * _.sample([1, 2, 3, 4]); + * // => 2 + */ + function sample(collection) { + var func = isArray(collection) ? arraySample : baseSample; + return func(collection); + } + + /** + * Gets `n` random elements at unique keys from `collection` up to the + * size of `collection`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Collection + * @param {Array|Object} collection The collection to sample. + * @param {number} [n=1] The number of elements to sample. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Array} Returns the random elements. + * @example + * + * _.sampleSize([1, 2, 3], 2); + * // => [3, 1] + * + * _.sampleSize([1, 2, 3], 4); + * // => [2, 3, 1] + */ + function sampleSize(collection, n, guard) { + if ((guard ? isIterateeCall(collection, n, guard) : n === undefined)) { + n = 1; + } else { + n = toInteger(n); + } + var func = isArray(collection) ? arraySampleSize : baseSampleSize; + return func(collection, n); + } + + /** + * Creates an array of shuffled values, using a version of the + * [Fisher-Yates shuffle](https://en.wikipedia.org/wiki/Fisher-Yates_shuffle). + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to shuffle. + * @returns {Array} Returns the new shuffled array. + * @example + * + * _.shuffle([1, 2, 3, 4]); + * // => [4, 1, 3, 2] + */ + function shuffle(collection) { + var func = isArray(collection) ? arrayShuffle : baseShuffle; + return func(collection); + } + + /** + * Gets the size of `collection` by returning its length for array-like + * values or the number of own enumerable string keyed properties for objects. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object|string} collection The collection to inspect. + * @returns {number} Returns the collection size. + * @example + * + * _.size([1, 2, 3]); + * // => 3 + * + * _.size({ 'a': 1, 'b': 2 }); + * // => 2 + * + * _.size('pebbles'); + * // => 7 + */ + function size(collection) { + if (collection == null) { + return 0; + } + if (isArrayLike(collection)) { + return isString(collection) ? stringSize(collection) : collection.length; + } + var tag = getTag(collection); + if (tag == mapTag || tag == setTag) { + return collection.size; + } + return baseKeys(collection).length; + } + + /** + * Checks if `predicate` returns truthy for **any** element of `collection`. + * Iteration is stopped once `predicate` returns truthy. The predicate is + * invoked with three arguments: (value, index|key, collection). + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {boolean} Returns `true` if any element passes the predicate check, + * else `false`. + * @example + * + * _.some([null, 0, 'yes', false], Boolean); + * // => true + * + * var users = [ + * { 'user': 'barney', 'active': true }, + * { 'user': 'fred', 'active': false } + * ]; + * + * // The `_.matches` iteratee shorthand. + * _.some(users, { 'user': 'barney', 'active': false }); + * // => false + * + * // The `_.matchesProperty` iteratee shorthand. + * _.some(users, ['active', false]); + * // => true + * + * // The `_.property` iteratee shorthand. + * _.some(users, 'active'); + * // => true + */ + function some(collection, predicate, guard) { + var func = isArray(collection) ? arraySome : baseSome; + if (guard && isIterateeCall(collection, predicate, guard)) { + predicate = undefined; + } + return func(collection, getIteratee(predicate, 3)); + } + + /** + * Creates an array of elements, sorted in ascending order by the results of + * running each element in a collection thru each iteratee. This method + * performs a stable sort, that is, it preserves the original sort order of + * equal elements. The iteratees are invoked with one argument: (value). + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Collection + * @param {Array|Object} collection The collection to iterate over. + * @param {...(Function|Function[])} [iteratees=[_.identity]] + * The iteratees to sort by. + * @returns {Array} Returns the new sorted array. + * @example + * + * var users = [ + * { 'user': 'fred', 'age': 48 }, + * { 'user': 'barney', 'age': 36 }, + * { 'user': 'fred', 'age': 40 }, + * { 'user': 'barney', 'age': 34 } + * ]; + * + * _.sortBy(users, [function(o) { return o.user; }]); + * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]] + * + * _.sortBy(users, ['user', 'age']); + * // => objects for [['barney', 34], ['barney', 36], ['fred', 40], ['fred', 48]] + */ + var sortBy = baseRest(function(collection, iteratees) { + if (collection == null) { + return []; + } + var length = iteratees.length; + if (length > 1 && isIterateeCall(collection, iteratees[0], iteratees[1])) { + iteratees = []; + } else if (length > 2 && isIterateeCall(iteratees[0], iteratees[1], iteratees[2])) { + iteratees = [iteratees[0]]; + } + return baseOrderBy(collection, baseFlatten(iteratees, 1), []); + }); + + /*------------------------------------------------------------------------*/ + + /** + * Gets the timestamp of the number of milliseconds that have elapsed since + * the Unix epoch (1 January 1970 00:00:00 UTC). + * + * @static + * @memberOf _ + * @since 2.4.0 + * @category Date + * @returns {number} Returns the timestamp. + * @example + * + * _.defer(function(stamp) { + * console.log(_.now() - stamp); + * }, _.now()); + * // => Logs the number of milliseconds it took for the deferred invocation. + */ + var now = ctxNow || function() { + return root.Date.now(); + }; + + /*------------------------------------------------------------------------*/ + + /** + * The opposite of `_.before`; this method creates a function that invokes + * `func` once it's called `n` or more times. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {number} n The number of calls before `func` is invoked. + * @param {Function} func The function to restrict. + * @returns {Function} Returns the new restricted function. + * @example + * + * var saves = ['profile', 'settings']; + * + * var done = _.after(saves.length, function() { + * console.log('done saving!'); + * }); + * + * _.forEach(saves, function(type) { + * asyncSave({ 'type': type, 'complete': done }); + * }); + * // => Logs 'done saving!' after the two async saves have completed. + */ + function after(n, func) { + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + n = toInteger(n); + return function() { + if (--n < 1) { + return func.apply(this, arguments); + } + }; + } + + /** + * Creates a function that invokes `func`, with up to `n` arguments, + * ignoring any additional arguments. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Function + * @param {Function} func The function to cap arguments for. + * @param {number} [n=func.length] The arity cap. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Function} Returns the new capped function. + * @example + * + * _.map(['6', '8', '10'], _.ary(parseInt, 1)); + * // => [6, 8, 10] + */ + function ary(func, n, guard) { + n = guard ? undefined : n; + n = (func && n == null) ? func.length : n; + return createWrap(func, WRAP_ARY_FLAG, undefined, undefined, undefined, undefined, n); + } + + /** + * Creates a function that invokes `func`, with the `this` binding and arguments + * of the created function, while it's called less than `n` times. Subsequent + * calls to the created function return the result of the last `func` invocation. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Function + * @param {number} n The number of calls at which `func` is no longer invoked. + * @param {Function} func The function to restrict. + * @returns {Function} Returns the new restricted function. + * @example + * + * jQuery(element).on('click', _.before(5, addContactToList)); + * // => Allows adding up to 4 contacts to the list. + */ + function before(n, func) { + var result; + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + n = toInteger(n); + return function() { + if (--n > 0) { + result = func.apply(this, arguments); + } + if (n <= 1) { + func = undefined; + } + return result; + }; + } + + /** + * Creates a function that invokes `func` with the `this` binding of `thisArg` + * and `partials` prepended to the arguments it receives. + * + * The `_.bind.placeholder` value, which defaults to `_` in monolithic builds, + * may be used as a placeholder for partially applied arguments. + * + * **Note:** Unlike native `Function#bind`, this method doesn't set the "length" + * property of bound functions. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {Function} func The function to bind. + * @param {*} thisArg The `this` binding of `func`. + * @param {...*} [partials] The arguments to be partially applied. + * @returns {Function} Returns the new bound function. + * @example + * + * function greet(greeting, punctuation) { + * return greeting + ' ' + this.user + punctuation; + * } + * + * var object = { 'user': 'fred' }; + * + * var bound = _.bind(greet, object, 'hi'); + * bound('!'); + * // => 'hi fred!' + * + * // Bound with placeholders. + * var bound = _.bind(greet, object, _, '!'); + * bound('hi'); + * // => 'hi fred!' + */ + var bind = baseRest(function(func, thisArg, partials) { + var bitmask = WRAP_BIND_FLAG; + if (partials.length) { + var holders = replaceHolders(partials, getHolder(bind)); + bitmask |= WRAP_PARTIAL_FLAG; + } + return createWrap(func, bitmask, thisArg, partials, holders); + }); + + /** + * Creates a function that invokes the method at `object[key]` with `partials` + * prepended to the arguments it receives. + * + * This method differs from `_.bind` by allowing bound functions to reference + * methods that may be redefined or don't yet exist. See + * [Peter Michaux's article](http://peter.michaux.ca/articles/lazy-function-definition-pattern) + * for more details. + * + * The `_.bindKey.placeholder` value, which defaults to `_` in monolithic + * builds, may be used as a placeholder for partially applied arguments. + * + * @static + * @memberOf _ + * @since 0.10.0 + * @category Function + * @param {Object} object The object to invoke the method on. + * @param {string} key The key of the method. + * @param {...*} [partials] The arguments to be partially applied. + * @returns {Function} Returns the new bound function. + * @example + * + * var object = { + * 'user': 'fred', + * 'greet': function(greeting, punctuation) { + * return greeting + ' ' + this.user + punctuation; + * } + * }; + * + * var bound = _.bindKey(object, 'greet', 'hi'); + * bound('!'); + * // => 'hi fred!' + * + * object.greet = function(greeting, punctuation) { + * return greeting + 'ya ' + this.user + punctuation; + * }; + * + * bound('!'); + * // => 'hiya fred!' + * + * // Bound with placeholders. + * var bound = _.bindKey(object, 'greet', _, '!'); + * bound('hi'); + * // => 'hiya fred!' + */ + var bindKey = baseRest(function(object, key, partials) { + var bitmask = WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG; + if (partials.length) { + var holders = replaceHolders(partials, getHolder(bindKey)); + bitmask |= WRAP_PARTIAL_FLAG; + } + return createWrap(key, bitmask, object, partials, holders); + }); + + /** + * Creates a function that accepts arguments of `func` and either invokes + * `func` returning its result, if at least `arity` number of arguments have + * been provided, or returns a function that accepts the remaining `func` + * arguments, and so on. The arity of `func` may be specified if `func.length` + * is not sufficient. + * + * The `_.curry.placeholder` value, which defaults to `_` in monolithic builds, + * may be used as a placeholder for provided arguments. + * + * **Note:** This method doesn't set the "length" property of curried functions. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @category Function + * @param {Function} func The function to curry. + * @param {number} [arity=func.length] The arity of `func`. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Function} Returns the new curried function. + * @example + * + * var abc = function(a, b, c) { + * return [a, b, c]; + * }; + * + * var curried = _.curry(abc); + * + * curried(1)(2)(3); + * // => [1, 2, 3] + * + * curried(1, 2)(3); + * // => [1, 2, 3] + * + * curried(1, 2, 3); + * // => [1, 2, 3] + * + * // Curried with placeholders. + * curried(1)(_, 3)(2); + * // => [1, 2, 3] + */ + function curry(func, arity, guard) { + arity = guard ? undefined : arity; + var result = createWrap(func, WRAP_CURRY_FLAG, undefined, undefined, undefined, undefined, undefined, arity); + result.placeholder = curry.placeholder; + return result; + } + + /** + * This method is like `_.curry` except that arguments are applied to `func` + * in the manner of `_.partialRight` instead of `_.partial`. + * + * The `_.curryRight.placeholder` value, which defaults to `_` in monolithic + * builds, may be used as a placeholder for provided arguments. + * + * **Note:** This method doesn't set the "length" property of curried functions. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Function + * @param {Function} func The function to curry. + * @param {number} [arity=func.length] The arity of `func`. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Function} Returns the new curried function. + * @example + * + * var abc = function(a, b, c) { + * return [a, b, c]; + * }; + * + * var curried = _.curryRight(abc); + * + * curried(3)(2)(1); + * // => [1, 2, 3] + * + * curried(2, 3)(1); + * // => [1, 2, 3] + * + * curried(1, 2, 3); + * // => [1, 2, 3] + * + * // Curried with placeholders. + * curried(3)(1, _)(2); + * // => [1, 2, 3] + */ + function curryRight(func, arity, guard) { + arity = guard ? undefined : arity; + var result = createWrap(func, WRAP_CURRY_RIGHT_FLAG, undefined, undefined, undefined, undefined, undefined, arity); + result.placeholder = curryRight.placeholder; + return result; + } + + /** + * Creates a debounced function that delays invoking `func` until after `wait` + * milliseconds have elapsed since the last time the debounced function was + * invoked. The debounced function comes with a `cancel` method to cancel + * delayed `func` invocations and a `flush` method to immediately invoke them. + * Provide `options` to indicate whether `func` should be invoked on the + * leading and/or trailing edge of the `wait` timeout. The `func` is invoked + * with the last arguments provided to the debounced function. Subsequent + * calls to the debounced function return the result of the last `func` + * invocation. + * + * **Note:** If `leading` and `trailing` options are `true`, `func` is + * invoked on the trailing edge of the timeout only if the debounced function + * is invoked more than once during the `wait` timeout. + * + * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred + * until to the next tick, similar to `setTimeout` with a timeout of `0`. + * + * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/) + * for details over the differences between `_.debounce` and `_.throttle`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {Function} func The function to debounce. + * @param {number} [wait=0] The number of milliseconds to delay. + * @param {Object} [options={}] The options object. + * @param {boolean} [options.leading=false] + * Specify invoking on the leading edge of the timeout. + * @param {number} [options.maxWait] + * The maximum time `func` is allowed to be delayed before it's invoked. + * @param {boolean} [options.trailing=true] + * Specify invoking on the trailing edge of the timeout. + * @returns {Function} Returns the new debounced function. + * @example + * + * // Avoid costly calculations while the window size is in flux. + * jQuery(window).on('resize', _.debounce(calculateLayout, 150)); + * + * // Invoke `sendMail` when clicked, debouncing subsequent calls. + * jQuery(element).on('click', _.debounce(sendMail, 300, { + * 'leading': true, + * 'trailing': false + * })); + * + * // Ensure `batchLog` is invoked once after 1 second of debounced calls. + * var debounced = _.debounce(batchLog, 250, { 'maxWait': 1000 }); + * var source = new EventSource('/stream'); + * jQuery(source).on('message', debounced); + * + * // Cancel the trailing debounced invocation. + * jQuery(window).on('popstate', debounced.cancel); + */ + function debounce(func, wait, options) { + var lastArgs, + lastThis, + maxWait, + result, + timerId, + lastCallTime, + lastInvokeTime = 0, + leading = false, + maxing = false, + trailing = true; + + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + wait = toNumber(wait) || 0; + if (isObject(options)) { + leading = !!options.leading; + maxing = 'maxWait' in options; + maxWait = maxing ? nativeMax(toNumber(options.maxWait) || 0, wait) : maxWait; + trailing = 'trailing' in options ? !!options.trailing : trailing; + } + + function invokeFunc(time) { + var args = lastArgs, + thisArg = lastThis; + + lastArgs = lastThis = undefined; + lastInvokeTime = time; + result = func.apply(thisArg, args); + return result; + } + + function leadingEdge(time) { + // Reset any `maxWait` timer. + lastInvokeTime = time; + // Start the timer for the trailing edge. + timerId = setTimeout(timerExpired, wait); + // Invoke the leading edge. + return leading ? invokeFunc(time) : result; + } + + function remainingWait(time) { + var timeSinceLastCall = time - lastCallTime, + timeSinceLastInvoke = time - lastInvokeTime, + result = wait - timeSinceLastCall; + + return maxing ? nativeMin(result, maxWait - timeSinceLastInvoke) : result; + } + + function shouldInvoke(time) { + var timeSinceLastCall = time - lastCallTime, + timeSinceLastInvoke = time - lastInvokeTime; + + // Either this is the first call, activity has stopped and we're at the + // trailing edge, the system time has gone backwards and we're treating + // it as the trailing edge, or we've hit the `maxWait` limit. + return (lastCallTime === undefined || (timeSinceLastCall >= wait) || + (timeSinceLastCall < 0) || (maxing && timeSinceLastInvoke >= maxWait)); + } + + function timerExpired() { + var time = now(); + if (shouldInvoke(time)) { + return trailingEdge(time); + } + // Restart the timer. + timerId = setTimeout(timerExpired, remainingWait(time)); + } + + function trailingEdge(time) { + timerId = undefined; + + // Only invoke if we have `lastArgs` which means `func` has been + // debounced at least once. + if (trailing && lastArgs) { + return invokeFunc(time); + } + lastArgs = lastThis = undefined; + return result; + } + + function cancel() { + if (timerId !== undefined) { + clearTimeout(timerId); + } + lastInvokeTime = 0; + lastArgs = lastCallTime = lastThis = timerId = undefined; + } + + function flush() { + return timerId === undefined ? result : trailingEdge(now()); + } + + function debounced() { + var time = now(), + isInvoking = shouldInvoke(time); + + lastArgs = arguments; + lastThis = this; + lastCallTime = time; + + if (isInvoking) { + if (timerId === undefined) { + return leadingEdge(lastCallTime); + } + if (maxing) { + // Handle invocations in a tight loop. + timerId = setTimeout(timerExpired, wait); + return invokeFunc(lastCallTime); + } + } + if (timerId === undefined) { + timerId = setTimeout(timerExpired, wait); + } + return result; + } + debounced.cancel = cancel; + debounced.flush = flush; + return debounced; + } + + /** + * Defers invoking the `func` until the current call stack has cleared. Any + * additional arguments are provided to `func` when it's invoked. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {Function} func The function to defer. + * @param {...*} [args] The arguments to invoke `func` with. + * @returns {number} Returns the timer id. + * @example + * + * _.defer(function(text) { + * console.log(text); + * }, 'deferred'); + * // => Logs 'deferred' after one millisecond. + */ + var defer = baseRest(function(func, args) { + return baseDelay(func, 1, args); + }); + + /** + * Invokes `func` after `wait` milliseconds. Any additional arguments are + * provided to `func` when it's invoked. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {Function} func The function to delay. + * @param {number} wait The number of milliseconds to delay invocation. + * @param {...*} [args] The arguments to invoke `func` with. + * @returns {number} Returns the timer id. + * @example + * + * _.delay(function(text) { + * console.log(text); + * }, 1000, 'later'); + * // => Logs 'later' after one second. + */ + var delay = baseRest(function(func, wait, args) { + return baseDelay(func, toNumber(wait) || 0, args); + }); + + /** + * Creates a function that invokes `func` with arguments reversed. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Function + * @param {Function} func The function to flip arguments for. + * @returns {Function} Returns the new flipped function. + * @example + * + * var flipped = _.flip(function() { + * return _.toArray(arguments); + * }); + * + * flipped('a', 'b', 'c', 'd'); + * // => ['d', 'c', 'b', 'a'] + */ + function flip(func) { + return createWrap(func, WRAP_FLIP_FLAG); + } + + /** + * Creates a function that memoizes the result of `func`. If `resolver` is + * provided, it determines the cache key for storing the result based on the + * arguments provided to the memoized function. By default, the first argument + * provided to the memoized function is used as the map cache key. The `func` + * is invoked with the `this` binding of the memoized function. + * + * **Note:** The cache is exposed as the `cache` property on the memoized + * function. Its creation may be customized by replacing the `_.memoize.Cache` + * constructor with one whose instances implement the + * [`Map`](http://ecma-international.org/ecma-262/7.0/#sec-properties-of-the-map-prototype-object) + * method interface of `clear`, `delete`, `get`, `has`, and `set`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {Function} func The function to have its output memoized. + * @param {Function} [resolver] The function to resolve the cache key. + * @returns {Function} Returns the new memoized function. + * @example + * + * var object = { 'a': 1, 'b': 2 }; + * var other = { 'c': 3, 'd': 4 }; + * + * var values = _.memoize(_.values); + * values(object); + * // => [1, 2] + * + * values(other); + * // => [3, 4] + * + * object.a = 2; + * values(object); + * // => [1, 2] + * + * // Modify the result cache. + * values.cache.set(object, ['a', 'b']); + * values(object); + * // => ['a', 'b'] + * + * // Replace `_.memoize.Cache`. + * _.memoize.Cache = WeakMap; + */ + function memoize(func, resolver) { + if (typeof func != 'function' || (resolver != null && typeof resolver != 'function')) { + throw new TypeError(FUNC_ERROR_TEXT); + } + var memoized = function() { + var args = arguments, + key = resolver ? resolver.apply(this, args) : args[0], + cache = memoized.cache; + + if (cache.has(key)) { + return cache.get(key); + } + var result = func.apply(this, args); + memoized.cache = cache.set(key, result) || cache; + return result; + }; + memoized.cache = new (memoize.Cache || MapCache); + return memoized; + } + + // Expose `MapCache`. + memoize.Cache = MapCache; + + /** + * Creates a function that negates the result of the predicate `func`. The + * `func` predicate is invoked with the `this` binding and arguments of the + * created function. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Function + * @param {Function} predicate The predicate to negate. + * @returns {Function} Returns the new negated function. + * @example + * + * function isEven(n) { + * return n % 2 == 0; + * } + * + * _.filter([1, 2, 3, 4, 5, 6], _.negate(isEven)); + * // => [1, 3, 5] + */ + function negate(predicate) { + if (typeof predicate != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + return function() { + var args = arguments; + switch (args.length) { + case 0: return !predicate.call(this); + case 1: return !predicate.call(this, args[0]); + case 2: return !predicate.call(this, args[0], args[1]); + case 3: return !predicate.call(this, args[0], args[1], args[2]); + } + return !predicate.apply(this, args); + }; + } + + /** + * Creates a function that is restricted to invoking `func` once. Repeat calls + * to the function return the value of the first invocation. The `func` is + * invoked with the `this` binding and arguments of the created function. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {Function} func The function to restrict. + * @returns {Function} Returns the new restricted function. + * @example + * + * var initialize = _.once(createApplication); + * initialize(); + * initialize(); + * // => `createApplication` is invoked once + */ + function once(func) { + return before(2, func); + } + + /** + * Creates a function that invokes `func` with its arguments transformed. + * + * @static + * @since 4.0.0 + * @memberOf _ + * @category Function + * @param {Function} func The function to wrap. + * @param {...(Function|Function[])} [transforms=[_.identity]] + * The argument transforms. + * @returns {Function} Returns the new function. + * @example + * + * function doubled(n) { + * return n * 2; + * } + * + * function square(n) { + * return n * n; + * } + * + * var func = _.overArgs(function(x, y) { + * return [x, y]; + * }, [square, doubled]); + * + * func(9, 3); + * // => [81, 6] + * + * func(10, 5); + * // => [100, 10] + */ + var overArgs = castRest(function(func, transforms) { + transforms = (transforms.length == 1 && isArray(transforms[0])) + ? arrayMap(transforms[0], baseUnary(getIteratee())) + : arrayMap(baseFlatten(transforms, 1), baseUnary(getIteratee())); + + var funcsLength = transforms.length; + return baseRest(function(args) { + var index = -1, + length = nativeMin(args.length, funcsLength); + + while (++index < length) { + args[index] = transforms[index].call(this, args[index]); + } + return apply(func, this, args); + }); + }); + + /** + * Creates a function that invokes `func` with `partials` prepended to the + * arguments it receives. This method is like `_.bind` except it does **not** + * alter the `this` binding. + * + * The `_.partial.placeholder` value, which defaults to `_` in monolithic + * builds, may be used as a placeholder for partially applied arguments. + * + * **Note:** This method doesn't set the "length" property of partially + * applied functions. + * + * @static + * @memberOf _ + * @since 0.2.0 + * @category Function + * @param {Function} func The function to partially apply arguments to. + * @param {...*} [partials] The arguments to be partially applied. + * @returns {Function} Returns the new partially applied function. + * @example + * + * function greet(greeting, name) { + * return greeting + ' ' + name; + * } + * + * var sayHelloTo = _.partial(greet, 'hello'); + * sayHelloTo('fred'); + * // => 'hello fred' + * + * // Partially applied with placeholders. + * var greetFred = _.partial(greet, _, 'fred'); + * greetFred('hi'); + * // => 'hi fred' + */ + var partial = baseRest(function(func, partials) { + var holders = replaceHolders(partials, getHolder(partial)); + return createWrap(func, WRAP_PARTIAL_FLAG, undefined, partials, holders); + }); + + /** + * This method is like `_.partial` except that partially applied arguments + * are appended to the arguments it receives. + * + * The `_.partialRight.placeholder` value, which defaults to `_` in monolithic + * builds, may be used as a placeholder for partially applied arguments. + * + * **Note:** This method doesn't set the "length" property of partially + * applied functions. + * + * @static + * @memberOf _ + * @since 1.0.0 + * @category Function + * @param {Function} func The function to partially apply arguments to. + * @param {...*} [partials] The arguments to be partially applied. + * @returns {Function} Returns the new partially applied function. + * @example + * + * function greet(greeting, name) { + * return greeting + ' ' + name; + * } + * + * var greetFred = _.partialRight(greet, 'fred'); + * greetFred('hi'); + * // => 'hi fred' + * + * // Partially applied with placeholders. + * var sayHelloTo = _.partialRight(greet, 'hello', _); + * sayHelloTo('fred'); + * // => 'hello fred' + */ + var partialRight = baseRest(function(func, partials) { + var holders = replaceHolders(partials, getHolder(partialRight)); + return createWrap(func, WRAP_PARTIAL_RIGHT_FLAG, undefined, partials, holders); + }); + + /** + * Creates a function that invokes `func` with arguments arranged according + * to the specified `indexes` where the argument value at the first index is + * provided as the first argument, the argument value at the second index is + * provided as the second argument, and so on. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Function + * @param {Function} func The function to rearrange arguments for. + * @param {...(number|number[])} indexes The arranged argument indexes. + * @returns {Function} Returns the new function. + * @example + * + * var rearged = _.rearg(function(a, b, c) { + * return [a, b, c]; + * }, [2, 0, 1]); + * + * rearged('b', 'c', 'a') + * // => ['a', 'b', 'c'] + */ + var rearg = flatRest(function(func, indexes) { + return createWrap(func, WRAP_REARG_FLAG, undefined, undefined, undefined, indexes); + }); + + /** + * Creates a function that invokes `func` with the `this` binding of the + * created function and arguments from `start` and beyond provided as + * an array. + * + * **Note:** This method is based on the + * [rest parameter](https://mdn.io/rest_parameters). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Function + * @param {Function} func The function to apply a rest parameter to. + * @param {number} [start=func.length-1] The start position of the rest parameter. + * @returns {Function} Returns the new function. + * @example + * + * var say = _.rest(function(what, names) { + * return what + ' ' + _.initial(names).join(', ') + + * (_.size(names) > 1 ? ', & ' : '') + _.last(names); + * }); + * + * say('hello', 'fred', 'barney', 'pebbles'); + * // => 'hello fred, barney, & pebbles' + */ + function rest(func, start) { + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + start = start === undefined ? start : toInteger(start); + return baseRest(func, start); + } + + /** + * Creates a function that invokes `func` with the `this` binding of the + * create function and an array of arguments much like + * [`Function#apply`](http://www.ecma-international.org/ecma-262/7.0/#sec-function.prototype.apply). + * + * **Note:** This method is based on the + * [spread operator](https://mdn.io/spread_operator). + * + * @static + * @memberOf _ + * @since 3.2.0 + * @category Function + * @param {Function} func The function to spread arguments over. + * @param {number} [start=0] The start position of the spread. + * @returns {Function} Returns the new function. + * @example + * + * var say = _.spread(function(who, what) { + * return who + ' says ' + what; + * }); + * + * say(['fred', 'hello']); + * // => 'fred says hello' + * + * var numbers = Promise.all([ + * Promise.resolve(40), + * Promise.resolve(36) + * ]); + * + * numbers.then(_.spread(function(x, y) { + * return x + y; + * })); + * // => a Promise of 76 + */ + function spread(func, start) { + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + start = start == null ? 0 : nativeMax(toInteger(start), 0); + return baseRest(function(args) { + var array = args[start], + otherArgs = castSlice(args, 0, start); + + if (array) { + arrayPush(otherArgs, array); + } + return apply(func, this, otherArgs); + }); + } + + /** + * Creates a throttled function that only invokes `func` at most once per + * every `wait` milliseconds. The throttled function comes with a `cancel` + * method to cancel delayed `func` invocations and a `flush` method to + * immediately invoke them. Provide `options` to indicate whether `func` + * should be invoked on the leading and/or trailing edge of the `wait` + * timeout. The `func` is invoked with the last arguments provided to the + * throttled function. Subsequent calls to the throttled function return the + * result of the last `func` invocation. + * + * **Note:** If `leading` and `trailing` options are `true`, `func` is + * invoked on the trailing edge of the timeout only if the throttled function + * is invoked more than once during the `wait` timeout. + * + * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred + * until to the next tick, similar to `setTimeout` with a timeout of `0`. + * + * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/) + * for details over the differences between `_.throttle` and `_.debounce`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {Function} func The function to throttle. + * @param {number} [wait=0] The number of milliseconds to throttle invocations to. + * @param {Object} [options={}] The options object. + * @param {boolean} [options.leading=true] + * Specify invoking on the leading edge of the timeout. + * @param {boolean} [options.trailing=true] + * Specify invoking on the trailing edge of the timeout. + * @returns {Function} Returns the new throttled function. + * @example + * + * // Avoid excessively updating the position while scrolling. + * jQuery(window).on('scroll', _.throttle(updatePosition, 100)); + * + * // Invoke `renewToken` when the click event is fired, but not more than once every 5 minutes. + * var throttled = _.throttle(renewToken, 300000, { 'trailing': false }); + * jQuery(element).on('click', throttled); + * + * // Cancel the trailing throttled invocation. + * jQuery(window).on('popstate', throttled.cancel); + */ + function throttle(func, wait, options) { + var leading = true, + trailing = true; + + if (typeof func != 'function') { + throw new TypeError(FUNC_ERROR_TEXT); + } + if (isObject(options)) { + leading = 'leading' in options ? !!options.leading : leading; + trailing = 'trailing' in options ? !!options.trailing : trailing; + } + return debounce(func, wait, { + 'leading': leading, + 'maxWait': wait, + 'trailing': trailing + }); + } + + /** + * Creates a function that accepts up to one argument, ignoring any + * additional arguments. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Function + * @param {Function} func The function to cap arguments for. + * @returns {Function} Returns the new capped function. + * @example + * + * _.map(['6', '8', '10'], _.unary(parseInt)); + * // => [6, 8, 10] + */ + function unary(func) { + return ary(func, 1); + } + + /** + * Creates a function that provides `value` to `wrapper` as its first + * argument. Any additional arguments provided to the function are appended + * to those provided to the `wrapper`. The wrapper is invoked with the `this` + * binding of the created function. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Function + * @param {*} value The value to wrap. + * @param {Function} [wrapper=identity] The wrapper function. + * @returns {Function} Returns the new function. + * @example + * + * var p = _.wrap(_.escape, function(func, text) { + * return '

' + func(text) + '

'; + * }); + * + * p('fred, barney, & pebbles'); + * // => '

fred, barney, & pebbles

' + */ + function wrap(value, wrapper) { + return partial(castFunction(wrapper), value); + } + + /*------------------------------------------------------------------------*/ + + /** + * Casts `value` as an array if it's not one. + * + * @static + * @memberOf _ + * @since 4.4.0 + * @category Lang + * @param {*} value The value to inspect. + * @returns {Array} Returns the cast array. + * @example + * + * _.castArray(1); + * // => [1] + * + * _.castArray({ 'a': 1 }); + * // => [{ 'a': 1 }] + * + * _.castArray('abc'); + * // => ['abc'] + * + * _.castArray(null); + * // => [null] + * + * _.castArray(undefined); + * // => [undefined] + * + * _.castArray(); + * // => [] + * + * var array = [1, 2, 3]; + * console.log(_.castArray(array) === array); + * // => true + */ + function castArray() { + if (!arguments.length) { + return []; + } + var value = arguments[0]; + return isArray(value) ? value : [value]; + } + + /** + * Creates a shallow clone of `value`. + * + * **Note:** This method is loosely based on the + * [structured clone algorithm](https://mdn.io/Structured_clone_algorithm) + * and supports cloning arrays, array buffers, booleans, date objects, maps, + * numbers, `Object` objects, regexes, sets, strings, symbols, and typed + * arrays. The own enumerable properties of `arguments` objects are cloned + * as plain objects. An empty object is returned for uncloneable values such + * as error objects, functions, DOM nodes, and WeakMaps. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to clone. + * @returns {*} Returns the cloned value. + * @see _.cloneDeep + * @example + * + * var objects = [{ 'a': 1 }, { 'b': 2 }]; + * + * var shallow = _.clone(objects); + * console.log(shallow[0] === objects[0]); + * // => true + */ + function clone(value) { + return baseClone(value, CLONE_SYMBOLS_FLAG); + } + + /** + * This method is like `_.clone` except that it accepts `customizer` which + * is invoked to produce the cloned value. If `customizer` returns `undefined`, + * cloning is handled by the method instead. The `customizer` is invoked with + * up to four arguments; (value [, index|key, object, stack]). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to clone. + * @param {Function} [customizer] The function to customize cloning. + * @returns {*} Returns the cloned value. + * @see _.cloneDeepWith + * @example + * + * function customizer(value) { + * if (_.isElement(value)) { + * return value.cloneNode(false); + * } + * } + * + * var el = _.cloneWith(document.body, customizer); + * + * console.log(el === document.body); + * // => false + * console.log(el.nodeName); + * // => 'BODY' + * console.log(el.childNodes.length); + * // => 0 + */ + function cloneWith(value, customizer) { + customizer = typeof customizer == 'function' ? customizer : undefined; + return baseClone(value, CLONE_SYMBOLS_FLAG, customizer); + } + + /** + * This method is like `_.clone` except that it recursively clones `value`. + * + * @static + * @memberOf _ + * @since 1.0.0 + * @category Lang + * @param {*} value The value to recursively clone. + * @returns {*} Returns the deep cloned value. + * @see _.clone + * @example + * + * var objects = [{ 'a': 1 }, { 'b': 2 }]; + * + * var deep = _.cloneDeep(objects); + * console.log(deep[0] === objects[0]); + * // => false + */ + function cloneDeep(value) { + return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG); + } + + /** + * This method is like `_.cloneWith` except that it recursively clones `value`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to recursively clone. + * @param {Function} [customizer] The function to customize cloning. + * @returns {*} Returns the deep cloned value. + * @see _.cloneWith + * @example + * + * function customizer(value) { + * if (_.isElement(value)) { + * return value.cloneNode(true); + * } + * } + * + * var el = _.cloneDeepWith(document.body, customizer); + * + * console.log(el === document.body); + * // => false + * console.log(el.nodeName); + * // => 'BODY' + * console.log(el.childNodes.length); + * // => 20 + */ + function cloneDeepWith(value, customizer) { + customizer = typeof customizer == 'function' ? customizer : undefined; + return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG, customizer); + } + + /** + * Checks if `object` conforms to `source` by invoking the predicate + * properties of `source` with the corresponding property values of `object`. + * + * **Note:** This method is equivalent to `_.conforms` when `source` is + * partially applied. + * + * @static + * @memberOf _ + * @since 4.14.0 + * @category Lang + * @param {Object} object The object to inspect. + * @param {Object} source The object of property predicates to conform to. + * @returns {boolean} Returns `true` if `object` conforms, else `false`. + * @example + * + * var object = { 'a': 1, 'b': 2 }; + * + * _.conformsTo(object, { 'b': function(n) { return n > 1; } }); + * // => true + * + * _.conformsTo(object, { 'b': function(n) { return n > 2; } }); + * // => false + */ + function conformsTo(object, source) { + return source == null || baseConformsTo(object, source, keys(source)); + } + + /** + * Performs a + * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) + * comparison between two values to determine if they are equivalent. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if the values are equivalent, else `false`. + * @example + * + * var object = { 'a': 1 }; + * var other = { 'a': 1 }; + * + * _.eq(object, object); + * // => true + * + * _.eq(object, other); + * // => false + * + * _.eq('a', 'a'); + * // => true + * + * _.eq('a', Object('a')); + * // => false + * + * _.eq(NaN, NaN); + * // => true + */ + function eq(value, other) { + return value === other || (value !== value && other !== other); + } + + /** + * Checks if `value` is greater than `other`. + * + * @static + * @memberOf _ + * @since 3.9.0 + * @category Lang + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if `value` is greater than `other`, + * else `false`. + * @see _.lt + * @example + * + * _.gt(3, 1); + * // => true + * + * _.gt(3, 3); + * // => false + * + * _.gt(1, 3); + * // => false + */ + var gt = createRelationalOperation(baseGt); + + /** + * Checks if `value` is greater than or equal to `other`. + * + * @static + * @memberOf _ + * @since 3.9.0 + * @category Lang + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if `value` is greater than or equal to + * `other`, else `false`. + * @see _.lte + * @example + * + * _.gte(3, 1); + * // => true + * + * _.gte(3, 3); + * // => true + * + * _.gte(1, 3); + * // => false + */ + var gte = createRelationalOperation(function(value, other) { + return value >= other; + }); + + /** + * Checks if `value` is likely an `arguments` object. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an `arguments` object, + * else `false`. + * @example + * + * _.isArguments(function() { return arguments; }()); + * // => true + * + * _.isArguments([1, 2, 3]); + * // => false + */ + var isArguments = baseIsArguments(function() { return arguments; }()) ? baseIsArguments : function(value) { + return isObjectLike(value) && hasOwnProperty.call(value, 'callee') && + !propertyIsEnumerable.call(value, 'callee'); + }; + + /** + * Checks if `value` is classified as an `Array` object. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an array, else `false`. + * @example + * + * _.isArray([1, 2, 3]); + * // => true + * + * _.isArray(document.body.children); + * // => false + * + * _.isArray('abc'); + * // => false + * + * _.isArray(_.noop); + * // => false + */ + var isArray = Array.isArray; + + /** + * Checks if `value` is classified as an `ArrayBuffer` object. + * + * @static + * @memberOf _ + * @since 4.3.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`. + * @example + * + * _.isArrayBuffer(new ArrayBuffer(2)); + * // => true + * + * _.isArrayBuffer(new Array(2)); + * // => false + */ + var isArrayBuffer = nodeIsArrayBuffer ? baseUnary(nodeIsArrayBuffer) : baseIsArrayBuffer; + + /** + * Checks if `value` is array-like. A value is considered array-like if it's + * not a function and has a `value.length` that's an integer greater than or + * equal to `0` and less than or equal to `Number.MAX_SAFE_INTEGER`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is array-like, else `false`. + * @example + * + * _.isArrayLike([1, 2, 3]); + * // => true + * + * _.isArrayLike(document.body.children); + * // => true + * + * _.isArrayLike('abc'); + * // => true + * + * _.isArrayLike(_.noop); + * // => false + */ + function isArrayLike(value) { + return value != null && isLength(value.length) && !isFunction(value); + } + + /** + * This method is like `_.isArrayLike` except that it also checks if `value` + * is an object. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an array-like object, + * else `false`. + * @example + * + * _.isArrayLikeObject([1, 2, 3]); + * // => true + * + * _.isArrayLikeObject(document.body.children); + * // => true + * + * _.isArrayLikeObject('abc'); + * // => false + * + * _.isArrayLikeObject(_.noop); + * // => false + */ + function isArrayLikeObject(value) { + return isObjectLike(value) && isArrayLike(value); + } + + /** + * Checks if `value` is classified as a boolean primitive or object. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a boolean, else `false`. + * @example + * + * _.isBoolean(false); + * // => true + * + * _.isBoolean(null); + * // => false + */ + function isBoolean(value) { + return value === true || value === false || + (isObjectLike(value) && baseGetTag(value) == boolTag); + } + + /** + * Checks if `value` is a buffer. + * + * @static + * @memberOf _ + * @since 4.3.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a buffer, else `false`. + * @example + * + * _.isBuffer(new Buffer(2)); + * // => true + * + * _.isBuffer(new Uint8Array(2)); + * // => false + */ + var isBuffer = nativeIsBuffer || stubFalse; + + /** + * Checks if `value` is classified as a `Date` object. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a date object, else `false`. + * @example + * + * _.isDate(new Date); + * // => true + * + * _.isDate('Mon April 23 2012'); + * // => false + */ + var isDate = nodeIsDate ? baseUnary(nodeIsDate) : baseIsDate; + + /** + * Checks if `value` is likely a DOM element. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a DOM element, else `false`. + * @example + * + * _.isElement(document.body); + * // => true + * + * _.isElement(''); + * // => false + */ + function isElement(value) { + return isObjectLike(value) && value.nodeType === 1 && !isPlainObject(value); + } + + /** + * Checks if `value` is an empty object, collection, map, or set. + * + * Objects are considered empty if they have no own enumerable string keyed + * properties. + * + * Array-like values such as `arguments` objects, arrays, buffers, strings, or + * jQuery-like collections are considered empty if they have a `length` of `0`. + * Similarly, maps and sets are considered empty if they have a `size` of `0`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is empty, else `false`. + * @example + * + * _.isEmpty(null); + * // => true + * + * _.isEmpty(true); + * // => true + * + * _.isEmpty(1); + * // => true + * + * _.isEmpty([1, 2, 3]); + * // => false + * + * _.isEmpty({ 'a': 1 }); + * // => false + */ + function isEmpty(value) { + if (value == null) { + return true; + } + if (isArrayLike(value) && + (isArray(value) || typeof value == 'string' || typeof value.splice == 'function' || + isBuffer(value) || isTypedArray(value) || isArguments(value))) { + return !value.length; + } + var tag = getTag(value); + if (tag == mapTag || tag == setTag) { + return !value.size; + } + if (isPrototype(value)) { + return !baseKeys(value).length; + } + for (var key in value) { + if (hasOwnProperty.call(value, key)) { + return false; + } + } + return true; + } + + /** + * Performs a deep comparison between two values to determine if they are + * equivalent. + * + * **Note:** This method supports comparing arrays, array buffers, booleans, + * date objects, error objects, maps, numbers, `Object` objects, regexes, + * sets, strings, symbols, and typed arrays. `Object` objects are compared + * by their own, not inherited, enumerable properties. Functions and DOM + * nodes are compared by strict equality, i.e. `===`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if the values are equivalent, else `false`. + * @example + * + * var object = { 'a': 1 }; + * var other = { 'a': 1 }; + * + * _.isEqual(object, other); + * // => true + * + * object === other; + * // => false + */ + function isEqual(value, other) { + return baseIsEqual(value, other); + } + + /** + * This method is like `_.isEqual` except that it accepts `customizer` which + * is invoked to compare values. If `customizer` returns `undefined`, comparisons + * are handled by the method instead. The `customizer` is invoked with up to + * six arguments: (objValue, othValue [, index|key, object, other, stack]). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @param {Function} [customizer] The function to customize comparisons. + * @returns {boolean} Returns `true` if the values are equivalent, else `false`. + * @example + * + * function isGreeting(value) { + * return /^h(?:i|ello)$/.test(value); + * } + * + * function customizer(objValue, othValue) { + * if (isGreeting(objValue) && isGreeting(othValue)) { + * return true; + * } + * } + * + * var array = ['hello', 'goodbye']; + * var other = ['hi', 'goodbye']; + * + * _.isEqualWith(array, other, customizer); + * // => true + */ + function isEqualWith(value, other, customizer) { + customizer = typeof customizer == 'function' ? customizer : undefined; + var result = customizer ? customizer(value, other) : undefined; + return result === undefined ? baseIsEqual(value, other, undefined, customizer) : !!result; + } + + /** + * Checks if `value` is an `Error`, `EvalError`, `RangeError`, `ReferenceError`, + * `SyntaxError`, `TypeError`, or `URIError` object. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an error object, else `false`. + * @example + * + * _.isError(new Error); + * // => true + * + * _.isError(Error); + * // => false + */ + function isError(value) { + if (!isObjectLike(value)) { + return false; + } + var tag = baseGetTag(value); + return tag == errorTag || tag == domExcTag || + (typeof value.message == 'string' && typeof value.name == 'string' && !isPlainObject(value)); + } + + /** + * Checks if `value` is a finite primitive number. + * + * **Note:** This method is based on + * [`Number.isFinite`](https://mdn.io/Number/isFinite). + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a finite number, else `false`. + * @example + * + * _.isFinite(3); + * // => true + * + * _.isFinite(Number.MIN_VALUE); + * // => true + * + * _.isFinite(Infinity); + * // => false + * + * _.isFinite('3'); + * // => false + */ + function isFinite(value) { + return typeof value == 'number' && nativeIsFinite(value); + } + + /** + * Checks if `value` is classified as a `Function` object. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a function, else `false`. + * @example + * + * _.isFunction(_); + * // => true + * + * _.isFunction(/abc/); + * // => false + */ + function isFunction(value) { + if (!isObject(value)) { + return false; + } + // The use of `Object#toString` avoids issues with the `typeof` operator + // in Safari 9 which returns 'object' for typed arrays and other constructors. + var tag = baseGetTag(value); + return tag == funcTag || tag == genTag || tag == asyncTag || tag == proxyTag; + } + + /** + * Checks if `value` is an integer. + * + * **Note:** This method is based on + * [`Number.isInteger`](https://mdn.io/Number/isInteger). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an integer, else `false`. + * @example + * + * _.isInteger(3); + * // => true + * + * _.isInteger(Number.MIN_VALUE); + * // => false + * + * _.isInteger(Infinity); + * // => false + * + * _.isInteger('3'); + * // => false + */ + function isInteger(value) { + return typeof value == 'number' && value == toInteger(value); + } + + /** + * Checks if `value` is a valid array-like length. + * + * **Note:** This method is loosely based on + * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a valid length, else `false`. + * @example + * + * _.isLength(3); + * // => true + * + * _.isLength(Number.MIN_VALUE); + * // => false + * + * _.isLength(Infinity); + * // => false + * + * _.isLength('3'); + * // => false + */ + function isLength(value) { + return typeof value == 'number' && + value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER; + } + + /** + * Checks if `value` is the + * [language type](http://www.ecma-international.org/ecma-262/7.0/#sec-ecmascript-language-types) + * of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`) + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an object, else `false`. + * @example + * + * _.isObject({}); + * // => true + * + * _.isObject([1, 2, 3]); + * // => true + * + * _.isObject(_.noop); + * // => true + * + * _.isObject(null); + * // => false + */ + function isObject(value) { + var type = typeof value; + return value != null && (type == 'object' || type == 'function'); + } + + /** + * Checks if `value` is object-like. A value is object-like if it's not `null` + * and has a `typeof` result of "object". + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is object-like, else `false`. + * @example + * + * _.isObjectLike({}); + * // => true + * + * _.isObjectLike([1, 2, 3]); + * // => true + * + * _.isObjectLike(_.noop); + * // => false + * + * _.isObjectLike(null); + * // => false + */ + function isObjectLike(value) { + return value != null && typeof value == 'object'; + } + + /** + * Checks if `value` is classified as a `Map` object. + * + * @static + * @memberOf _ + * @since 4.3.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a map, else `false`. + * @example + * + * _.isMap(new Map); + * // => true + * + * _.isMap(new WeakMap); + * // => false + */ + var isMap = nodeIsMap ? baseUnary(nodeIsMap) : baseIsMap; + + /** + * Performs a partial deep comparison between `object` and `source` to + * determine if `object` contains equivalent property values. + * + * **Note:** This method is equivalent to `_.matches` when `source` is + * partially applied. + * + * Partial comparisons will match empty array and empty object `source` + * values against any array or object value, respectively. See `_.isEqual` + * for a list of supported value comparisons. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Lang + * @param {Object} object The object to inspect. + * @param {Object} source The object of property values to match. + * @returns {boolean} Returns `true` if `object` is a match, else `false`. + * @example + * + * var object = { 'a': 1, 'b': 2 }; + * + * _.isMatch(object, { 'b': 2 }); + * // => true + * + * _.isMatch(object, { 'b': 1 }); + * // => false + */ + function isMatch(object, source) { + return object === source || baseIsMatch(object, source, getMatchData(source)); + } + + /** + * This method is like `_.isMatch` except that it accepts `customizer` which + * is invoked to compare values. If `customizer` returns `undefined`, comparisons + * are handled by the method instead. The `customizer` is invoked with five + * arguments: (objValue, srcValue, index|key, object, source). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {Object} object The object to inspect. + * @param {Object} source The object of property values to match. + * @param {Function} [customizer] The function to customize comparisons. + * @returns {boolean} Returns `true` if `object` is a match, else `false`. + * @example + * + * function isGreeting(value) { + * return /^h(?:i|ello)$/.test(value); + * } + * + * function customizer(objValue, srcValue) { + * if (isGreeting(objValue) && isGreeting(srcValue)) { + * return true; + * } + * } + * + * var object = { 'greeting': 'hello' }; + * var source = { 'greeting': 'hi' }; + * + * _.isMatchWith(object, source, customizer); + * // => true + */ + function isMatchWith(object, source, customizer) { + customizer = typeof customizer == 'function' ? customizer : undefined; + return baseIsMatch(object, source, getMatchData(source), customizer); + } + + /** + * Checks if `value` is `NaN`. + * + * **Note:** This method is based on + * [`Number.isNaN`](https://mdn.io/Number/isNaN) and is not the same as + * global [`isNaN`](https://mdn.io/isNaN) which returns `true` for + * `undefined` and other non-number values. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`. + * @example + * + * _.isNaN(NaN); + * // => true + * + * _.isNaN(new Number(NaN)); + * // => true + * + * isNaN(undefined); + * // => true + * + * _.isNaN(undefined); + * // => false + */ + function isNaN(value) { + // An `NaN` primitive is the only value that is not equal to itself. + // Perform the `toStringTag` check first to avoid errors with some + // ActiveX objects in IE. + return isNumber(value) && value != +value; + } + + /** + * Checks if `value` is a pristine native function. + * + * **Note:** This method can't reliably detect native functions in the presence + * of the core-js package because core-js circumvents this kind of detection. + * Despite multiple requests, the core-js maintainer has made it clear: any + * attempt to fix the detection will be obstructed. As a result, we're left + * with little choice but to throw an error. Unfortunately, this also affects + * packages, like [babel-polyfill](https://www.npmjs.com/package/babel-polyfill), + * which rely on core-js. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a native function, + * else `false`. + * @example + * + * _.isNative(Array.prototype.push); + * // => true + * + * _.isNative(_); + * // => false + */ + function isNative(value) { + if (isMaskable(value)) { + throw new Error(CORE_ERROR_TEXT); + } + return baseIsNative(value); + } + + /** + * Checks if `value` is `null`. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is `null`, else `false`. + * @example + * + * _.isNull(null); + * // => true + * + * _.isNull(void 0); + * // => false + */ + function isNull(value) { + return value === null; + } + + /** + * Checks if `value` is `null` or `undefined`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is nullish, else `false`. + * @example + * + * _.isNil(null); + * // => true + * + * _.isNil(void 0); + * // => true + * + * _.isNil(NaN); + * // => false + */ + function isNil(value) { + return value == null; + } + + /** + * Checks if `value` is classified as a `Number` primitive or object. + * + * **Note:** To exclude `Infinity`, `-Infinity`, and `NaN`, which are + * classified as numbers, use the `_.isFinite` method. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a number, else `false`. + * @example + * + * _.isNumber(3); + * // => true + * + * _.isNumber(Number.MIN_VALUE); + * // => true + * + * _.isNumber(Infinity); + * // => true + * + * _.isNumber('3'); + * // => false + */ + function isNumber(value) { + return typeof value == 'number' || + (isObjectLike(value) && baseGetTag(value) == numberTag); + } + + /** + * Checks if `value` is a plain object, that is, an object created by the + * `Object` constructor or one with a `[[Prototype]]` of `null`. + * + * @static + * @memberOf _ + * @since 0.8.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a plain object, else `false`. + * @example + * + * function Foo() { + * this.a = 1; + * } + * + * _.isPlainObject(new Foo); + * // => false + * + * _.isPlainObject([1, 2, 3]); + * // => false + * + * _.isPlainObject({ 'x': 0, 'y': 0 }); + * // => true + * + * _.isPlainObject(Object.create(null)); + * // => true + */ + function isPlainObject(value) { + if (!isObjectLike(value) || baseGetTag(value) != objectTag) { + return false; + } + var proto = getPrototype(value); + if (proto === null) { + return true; + } + var Ctor = hasOwnProperty.call(proto, 'constructor') && proto.constructor; + return typeof Ctor == 'function' && Ctor instanceof Ctor && + funcToString.call(Ctor) == objectCtorString; + } + + /** + * Checks if `value` is classified as a `RegExp` object. + * + * @static + * @memberOf _ + * @since 0.1.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a regexp, else `false`. + * @example + * + * _.isRegExp(/abc/); + * // => true + * + * _.isRegExp('/abc/'); + * // => false + */ + var isRegExp = nodeIsRegExp ? baseUnary(nodeIsRegExp) : baseIsRegExp; + + /** + * Checks if `value` is a safe integer. An integer is safe if it's an IEEE-754 + * double precision number which isn't the result of a rounded unsafe integer. + * + * **Note:** This method is based on + * [`Number.isSafeInteger`](https://mdn.io/Number/isSafeInteger). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a safe integer, else `false`. + * @example + * + * _.isSafeInteger(3); + * // => true + * + * _.isSafeInteger(Number.MIN_VALUE); + * // => false + * + * _.isSafeInteger(Infinity); + * // => false + * + * _.isSafeInteger('3'); + * // => false + */ + function isSafeInteger(value) { + return isInteger(value) && value >= -MAX_SAFE_INTEGER && value <= MAX_SAFE_INTEGER; + } + + /** + * Checks if `value` is classified as a `Set` object. + * + * @static + * @memberOf _ + * @since 4.3.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a set, else `false`. + * @example + * + * _.isSet(new Set); + * // => true + * + * _.isSet(new WeakSet); + * // => false + */ + var isSet = nodeIsSet ? baseUnary(nodeIsSet) : baseIsSet; + + /** + * Checks if `value` is classified as a `String` primitive or object. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a string, else `false`. + * @example + * + * _.isString('abc'); + * // => true + * + * _.isString(1); + * // => false + */ + function isString(value) { + return typeof value == 'string' || + (!isArray(value) && isObjectLike(value) && baseGetTag(value) == stringTag); + } + + /** + * Checks if `value` is classified as a `Symbol` primitive or object. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a symbol, else `false`. + * @example + * + * _.isSymbol(Symbol.iterator); + * // => true + * + * _.isSymbol('abc'); + * // => false + */ + function isSymbol(value) { + return typeof value == 'symbol' || + (isObjectLike(value) && baseGetTag(value) == symbolTag); + } + + /** + * Checks if `value` is classified as a typed array. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a typed array, else `false`. + * @example + * + * _.isTypedArray(new Uint8Array); + * // => true + * + * _.isTypedArray([]); + * // => false + */ + var isTypedArray = nodeIsTypedArray ? baseUnary(nodeIsTypedArray) : baseIsTypedArray; + + /** + * Checks if `value` is `undefined`. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is `undefined`, else `false`. + * @example + * + * _.isUndefined(void 0); + * // => true + * + * _.isUndefined(null); + * // => false + */ + function isUndefined(value) { + return value === undefined; + } + + /** + * Checks if `value` is classified as a `WeakMap` object. + * + * @static + * @memberOf _ + * @since 4.3.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a weak map, else `false`. + * @example + * + * _.isWeakMap(new WeakMap); + * // => true + * + * _.isWeakMap(new Map); + * // => false + */ + function isWeakMap(value) { + return isObjectLike(value) && getTag(value) == weakMapTag; + } + + /** + * Checks if `value` is classified as a `WeakSet` object. + * + * @static + * @memberOf _ + * @since 4.3.0 + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a weak set, else `false`. + * @example + * + * _.isWeakSet(new WeakSet); + * // => true + * + * _.isWeakSet(new Set); + * // => false + */ + function isWeakSet(value) { + return isObjectLike(value) && baseGetTag(value) == weakSetTag; + } + + /** + * Checks if `value` is less than `other`. + * + * @static + * @memberOf _ + * @since 3.9.0 + * @category Lang + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if `value` is less than `other`, + * else `false`. + * @see _.gt + * @example + * + * _.lt(1, 3); + * // => true + * + * _.lt(3, 3); + * // => false + * + * _.lt(3, 1); + * // => false + */ + var lt = createRelationalOperation(baseLt); + + /** + * Checks if `value` is less than or equal to `other`. + * + * @static + * @memberOf _ + * @since 3.9.0 + * @category Lang + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @returns {boolean} Returns `true` if `value` is less than or equal to + * `other`, else `false`. + * @see _.gte + * @example + * + * _.lte(1, 3); + * // => true + * + * _.lte(3, 3); + * // => true + * + * _.lte(3, 1); + * // => false + */ + var lte = createRelationalOperation(function(value, other) { + return value <= other; + }); + + /** + * Converts `value` to an array. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Lang + * @param {*} value The value to convert. + * @returns {Array} Returns the converted array. + * @example + * + * _.toArray({ 'a': 1, 'b': 2 }); + * // => [1, 2] + * + * _.toArray('abc'); + * // => ['a', 'b', 'c'] + * + * _.toArray(1); + * // => [] + * + * _.toArray(null); + * // => [] + */ + function toArray(value) { + if (!value) { + return []; + } + if (isArrayLike(value)) { + return isString(value) ? stringToArray(value) : copyArray(value); + } + if (symIterator && value[symIterator]) { + return iteratorToArray(value[symIterator]()); + } + var tag = getTag(value), + func = tag == mapTag ? mapToArray : (tag == setTag ? setToArray : values); + + return func(value); + } + + /** + * Converts `value` to a finite number. + * + * @static + * @memberOf _ + * @since 4.12.0 + * @category Lang + * @param {*} value The value to convert. + * @returns {number} Returns the converted number. + * @example + * + * _.toFinite(3.2); + * // => 3.2 + * + * _.toFinite(Number.MIN_VALUE); + * // => 5e-324 + * + * _.toFinite(Infinity); + * // => 1.7976931348623157e+308 + * + * _.toFinite('3.2'); + * // => 3.2 + */ + function toFinite(value) { + if (!value) { + return value === 0 ? value : 0; + } + value = toNumber(value); + if (value === INFINITY || value === -INFINITY) { + var sign = (value < 0 ? -1 : 1); + return sign * MAX_INTEGER; + } + return value === value ? value : 0; + } + + /** + * Converts `value` to an integer. + * + * **Note:** This method is loosely based on + * [`ToInteger`](http://www.ecma-international.org/ecma-262/7.0/#sec-tointeger). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to convert. + * @returns {number} Returns the converted integer. + * @example + * + * _.toInteger(3.2); + * // => 3 + * + * _.toInteger(Number.MIN_VALUE); + * // => 0 + * + * _.toInteger(Infinity); + * // => 1.7976931348623157e+308 + * + * _.toInteger('3.2'); + * // => 3 + */ + function toInteger(value) { + var result = toFinite(value), + remainder = result % 1; + + return result === result ? (remainder ? result - remainder : result) : 0; + } + + /** + * Converts `value` to an integer suitable for use as the length of an + * array-like object. + * + * **Note:** This method is based on + * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to convert. + * @returns {number} Returns the converted integer. + * @example + * + * _.toLength(3.2); + * // => 3 + * + * _.toLength(Number.MIN_VALUE); + * // => 0 + * + * _.toLength(Infinity); + * // => 4294967295 + * + * _.toLength('3.2'); + * // => 3 + */ + function toLength(value) { + return value ? baseClamp(toInteger(value), 0, MAX_ARRAY_LENGTH) : 0; + } + + /** + * Converts `value` to a number. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to process. + * @returns {number} Returns the number. + * @example + * + * _.toNumber(3.2); + * // => 3.2 + * + * _.toNumber(Number.MIN_VALUE); + * // => 5e-324 + * + * _.toNumber(Infinity); + * // => Infinity + * + * _.toNumber('3.2'); + * // => 3.2 + */ + function toNumber(value) { + if (typeof value == 'number') { + return value; + } + if (isSymbol(value)) { + return NAN; + } + if (isObject(value)) { + var other = typeof value.valueOf == 'function' ? value.valueOf() : value; + value = isObject(other) ? (other + '') : other; + } + if (typeof value != 'string') { + return value === 0 ? value : +value; + } + value = value.replace(reTrim, ''); + var isBinary = reIsBinary.test(value); + return (isBinary || reIsOctal.test(value)) + ? freeParseInt(value.slice(2), isBinary ? 2 : 8) + : (reIsBadHex.test(value) ? NAN : +value); + } + + /** + * Converts `value` to a plain object flattening inherited enumerable string + * keyed properties of `value` to own properties of the plain object. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Lang + * @param {*} value The value to convert. + * @returns {Object} Returns the converted plain object. + * @example + * + * function Foo() { + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.assign({ 'a': 1 }, new Foo); + * // => { 'a': 1, 'b': 2 } + * + * _.assign({ 'a': 1 }, _.toPlainObject(new Foo)); + * // => { 'a': 1, 'b': 2, 'c': 3 } + */ + function toPlainObject(value) { + return copyObject(value, keysIn(value)); + } + + /** + * Converts `value` to a safe integer. A safe integer can be compared and + * represented correctly. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to convert. + * @returns {number} Returns the converted integer. + * @example + * + * _.toSafeInteger(3.2); + * // => 3 + * + * _.toSafeInteger(Number.MIN_VALUE); + * // => 0 + * + * _.toSafeInteger(Infinity); + * // => 9007199254740991 + * + * _.toSafeInteger('3.2'); + * // => 3 + */ + function toSafeInteger(value) { + return value + ? baseClamp(toInteger(value), -MAX_SAFE_INTEGER, MAX_SAFE_INTEGER) + : (value === 0 ? value : 0); + } + + /** + * Converts `value` to a string. An empty string is returned for `null` + * and `undefined` values. The sign of `-0` is preserved. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Lang + * @param {*} value The value to convert. + * @returns {string} Returns the converted string. + * @example + * + * _.toString(null); + * // => '' + * + * _.toString(-0); + * // => '-0' + * + * _.toString([1, 2, 3]); + * // => '1,2,3' + */ + function toString(value) { + return value == null ? '' : baseToString(value); + } + + /*------------------------------------------------------------------------*/ + + /** + * Assigns own enumerable string keyed properties of source objects to the + * destination object. Source objects are applied from left to right. + * Subsequent sources overwrite property assignments of previous sources. + * + * **Note:** This method mutates `object` and is loosely based on + * [`Object.assign`](https://mdn.io/Object/assign). + * + * @static + * @memberOf _ + * @since 0.10.0 + * @category Object + * @param {Object} object The destination object. + * @param {...Object} [sources] The source objects. + * @returns {Object} Returns `object`. + * @see _.assignIn + * @example + * + * function Foo() { + * this.a = 1; + * } + * + * function Bar() { + * this.c = 3; + * } + * + * Foo.prototype.b = 2; + * Bar.prototype.d = 4; + * + * _.assign({ 'a': 0 }, new Foo, new Bar); + * // => { 'a': 1, 'c': 3 } + */ + var assign = createAssigner(function(object, source) { + if (isPrototype(source) || isArrayLike(source)) { + copyObject(source, keys(source), object); + return; + } + for (var key in source) { + if (hasOwnProperty.call(source, key)) { + assignValue(object, key, source[key]); + } + } + }); + + /** + * This method is like `_.assign` except that it iterates over own and + * inherited source properties. + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @alias extend + * @category Object + * @param {Object} object The destination object. + * @param {...Object} [sources] The source objects. + * @returns {Object} Returns `object`. + * @see _.assign + * @example + * + * function Foo() { + * this.a = 1; + * } + * + * function Bar() { + * this.c = 3; + * } + * + * Foo.prototype.b = 2; + * Bar.prototype.d = 4; + * + * _.assignIn({ 'a': 0 }, new Foo, new Bar); + * // => { 'a': 1, 'b': 2, 'c': 3, 'd': 4 } + */ + var assignIn = createAssigner(function(object, source) { + copyObject(source, keysIn(source), object); + }); + + /** + * This method is like `_.assignIn` except that it accepts `customizer` + * which is invoked to produce the assigned values. If `customizer` returns + * `undefined`, assignment is handled by the method instead. The `customizer` + * is invoked with five arguments: (objValue, srcValue, key, object, source). + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @alias extendWith + * @category Object + * @param {Object} object The destination object. + * @param {...Object} sources The source objects. + * @param {Function} [customizer] The function to customize assigned values. + * @returns {Object} Returns `object`. + * @see _.assignWith + * @example + * + * function customizer(objValue, srcValue) { + * return _.isUndefined(objValue) ? srcValue : objValue; + * } + * + * var defaults = _.partialRight(_.assignInWith, customizer); + * + * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 }); + * // => { 'a': 1, 'b': 2 } + */ + var assignInWith = createAssigner(function(object, source, srcIndex, customizer) { + copyObject(source, keysIn(source), object, customizer); + }); + + /** + * This method is like `_.assign` except that it accepts `customizer` + * which is invoked to produce the assigned values. If `customizer` returns + * `undefined`, assignment is handled by the method instead. The `customizer` + * is invoked with five arguments: (objValue, srcValue, key, object, source). + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Object + * @param {Object} object The destination object. + * @param {...Object} sources The source objects. + * @param {Function} [customizer] The function to customize assigned values. + * @returns {Object} Returns `object`. + * @see _.assignInWith + * @example + * + * function customizer(objValue, srcValue) { + * return _.isUndefined(objValue) ? srcValue : objValue; + * } + * + * var defaults = _.partialRight(_.assignWith, customizer); + * + * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 }); + * // => { 'a': 1, 'b': 2 } + */ + var assignWith = createAssigner(function(object, source, srcIndex, customizer) { + copyObject(source, keys(source), object, customizer); + }); + + /** + * Creates an array of values corresponding to `paths` of `object`. + * + * @static + * @memberOf _ + * @since 1.0.0 + * @category Object + * @param {Object} object The object to iterate over. + * @param {...(string|string[])} [paths] The property paths to pick. + * @returns {Array} Returns the picked values. + * @example + * + * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] }; + * + * _.at(object, ['a[0].b.c', 'a[1]']); + * // => [3, 4] + */ + var at = flatRest(baseAt); + + /** + * Creates an object that inherits from the `prototype` object. If a + * `properties` object is given, its own enumerable string keyed properties + * are assigned to the created object. + * + * @static + * @memberOf _ + * @since 2.3.0 + * @category Object + * @param {Object} prototype The object to inherit from. + * @param {Object} [properties] The properties to assign to the object. + * @returns {Object} Returns the new object. + * @example + * + * function Shape() { + * this.x = 0; + * this.y = 0; + * } + * + * function Circle() { + * Shape.call(this); + * } + * + * Circle.prototype = _.create(Shape.prototype, { + * 'constructor': Circle + * }); + * + * var circle = new Circle; + * circle instanceof Circle; + * // => true + * + * circle instanceof Shape; + * // => true + */ + function create(prototype, properties) { + var result = baseCreate(prototype); + return properties == null ? result : baseAssign(result, properties); + } + + /** + * Assigns own and inherited enumerable string keyed properties of source + * objects to the destination object for all destination properties that + * resolve to `undefined`. Source objects are applied from left to right. + * Once a property is set, additional values of the same property are ignored. + * + * **Note:** This method mutates `object`. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Object + * @param {Object} object The destination object. + * @param {...Object} [sources] The source objects. + * @returns {Object} Returns `object`. + * @see _.defaultsDeep + * @example + * + * _.defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 }); + * // => { 'a': 1, 'b': 2 } + */ + var defaults = baseRest(function(args) { + args.push(undefined, customDefaultsAssignIn); + return apply(assignInWith, undefined, args); + }); + + /** + * This method is like `_.defaults` except that it recursively assigns + * default properties. + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 3.10.0 + * @category Object + * @param {Object} object The destination object. + * @param {...Object} [sources] The source objects. + * @returns {Object} Returns `object`. + * @see _.defaults + * @example + * + * _.defaultsDeep({ 'a': { 'b': 2 } }, { 'a': { 'b': 1, 'c': 3 } }); + * // => { 'a': { 'b': 2, 'c': 3 } } + */ + var defaultsDeep = baseRest(function(args) { + args.push(undefined, customDefaultsMerge); + return apply(mergeWith, undefined, args); + }); + + /** + * This method is like `_.find` except that it returns the key of the first + * element `predicate` returns truthy for instead of the element itself. + * + * @static + * @memberOf _ + * @since 1.1.0 + * @category Object + * @param {Object} object The object to inspect. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {string|undefined} Returns the key of the matched element, + * else `undefined`. + * @example + * + * var users = { + * 'barney': { 'age': 36, 'active': true }, + * 'fred': { 'age': 40, 'active': false }, + * 'pebbles': { 'age': 1, 'active': true } + * }; + * + * _.findKey(users, function(o) { return o.age < 40; }); + * // => 'barney' (iteration order is not guaranteed) + * + * // The `_.matches` iteratee shorthand. + * _.findKey(users, { 'age': 1, 'active': true }); + * // => 'pebbles' + * + * // The `_.matchesProperty` iteratee shorthand. + * _.findKey(users, ['active', false]); + * // => 'fred' + * + * // The `_.property` iteratee shorthand. + * _.findKey(users, 'active'); + * // => 'barney' + */ + function findKey(object, predicate) { + return baseFindKey(object, getIteratee(predicate, 3), baseForOwn); + } + + /** + * This method is like `_.findKey` except that it iterates over elements of + * a collection in the opposite order. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @category Object + * @param {Object} object The object to inspect. + * @param {Function} [predicate=_.identity] The function invoked per iteration. + * @returns {string|undefined} Returns the key of the matched element, + * else `undefined`. + * @example + * + * var users = { + * 'barney': { 'age': 36, 'active': true }, + * 'fred': { 'age': 40, 'active': false }, + * 'pebbles': { 'age': 1, 'active': true } + * }; + * + * _.findLastKey(users, function(o) { return o.age < 40; }); + * // => returns 'pebbles' assuming `_.findKey` returns 'barney' + * + * // The `_.matches` iteratee shorthand. + * _.findLastKey(users, { 'age': 36, 'active': true }); + * // => 'barney' + * + * // The `_.matchesProperty` iteratee shorthand. + * _.findLastKey(users, ['active', false]); + * // => 'fred' + * + * // The `_.property` iteratee shorthand. + * _.findLastKey(users, 'active'); + * // => 'pebbles' + */ + function findLastKey(object, predicate) { + return baseFindKey(object, getIteratee(predicate, 3), baseForOwnRight); + } + + /** + * Iterates over own and inherited enumerable string keyed properties of an + * object and invokes `iteratee` for each property. The iteratee is invoked + * with three arguments: (value, key, object). Iteratee functions may exit + * iteration early by explicitly returning `false`. + * + * @static + * @memberOf _ + * @since 0.3.0 + * @category Object + * @param {Object} object The object to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Object} Returns `object`. + * @see _.forInRight + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.forIn(new Foo, function(value, key) { + * console.log(key); + * }); + * // => Logs 'a', 'b', then 'c' (iteration order is not guaranteed). + */ + function forIn(object, iteratee) { + return object == null + ? object + : baseFor(object, getIteratee(iteratee, 3), keysIn); + } + + /** + * This method is like `_.forIn` except that it iterates over properties of + * `object` in the opposite order. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @category Object + * @param {Object} object The object to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Object} Returns `object`. + * @see _.forIn + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.forInRight(new Foo, function(value, key) { + * console.log(key); + * }); + * // => Logs 'c', 'b', then 'a' assuming `_.forIn` logs 'a', 'b', then 'c'. + */ + function forInRight(object, iteratee) { + return object == null + ? object + : baseForRight(object, getIteratee(iteratee, 3), keysIn); + } + + /** + * Iterates over own enumerable string keyed properties of an object and + * invokes `iteratee` for each property. The iteratee is invoked with three + * arguments: (value, key, object). Iteratee functions may exit iteration + * early by explicitly returning `false`. + * + * @static + * @memberOf _ + * @since 0.3.0 + * @category Object + * @param {Object} object The object to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Object} Returns `object`. + * @see _.forOwnRight + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.forOwn(new Foo, function(value, key) { + * console.log(key); + * }); + * // => Logs 'a' then 'b' (iteration order is not guaranteed). + */ + function forOwn(object, iteratee) { + return object && baseForOwn(object, getIteratee(iteratee, 3)); + } + + /** + * This method is like `_.forOwn` except that it iterates over properties of + * `object` in the opposite order. + * + * @static + * @memberOf _ + * @since 2.0.0 + * @category Object + * @param {Object} object The object to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Object} Returns `object`. + * @see _.forOwn + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.forOwnRight(new Foo, function(value, key) { + * console.log(key); + * }); + * // => Logs 'b' then 'a' assuming `_.forOwn` logs 'a' then 'b'. + */ + function forOwnRight(object, iteratee) { + return object && baseForOwnRight(object, getIteratee(iteratee, 3)); + } + + /** + * Creates an array of function property names from own enumerable properties + * of `object`. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Object + * @param {Object} object The object to inspect. + * @returns {Array} Returns the function names. + * @see _.functionsIn + * @example + * + * function Foo() { + * this.a = _.constant('a'); + * this.b = _.constant('b'); + * } + * + * Foo.prototype.c = _.constant('c'); + * + * _.functions(new Foo); + * // => ['a', 'b'] + */ + function functions(object) { + return object == null ? [] : baseFunctions(object, keys(object)); + } + + /** + * Creates an array of function property names from own and inherited + * enumerable properties of `object`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Object + * @param {Object} object The object to inspect. + * @returns {Array} Returns the function names. + * @see _.functions + * @example + * + * function Foo() { + * this.a = _.constant('a'); + * this.b = _.constant('b'); + * } + * + * Foo.prototype.c = _.constant('c'); + * + * _.functionsIn(new Foo); + * // => ['a', 'b', 'c'] + */ + function functionsIn(object) { + return object == null ? [] : baseFunctions(object, keysIn(object)); + } + + /** + * Gets the value at `path` of `object`. If the resolved value is + * `undefined`, the `defaultValue` is returned in its place. + * + * @static + * @memberOf _ + * @since 3.7.0 + * @category Object + * @param {Object} object The object to query. + * @param {Array|string} path The path of the property to get. + * @param {*} [defaultValue] The value returned for `undefined` resolved values. + * @returns {*} Returns the resolved value. + * @example + * + * var object = { 'a': [{ 'b': { 'c': 3 } }] }; + * + * _.get(object, 'a[0].b.c'); + * // => 3 + * + * _.get(object, ['a', '0', 'b', 'c']); + * // => 3 + * + * _.get(object, 'a.b.c', 'default'); + * // => 'default' + */ + function get(object, path, defaultValue) { + var result = object == null ? undefined : baseGet(object, path); + return result === undefined ? defaultValue : result; + } + + /** + * Checks if `path` is a direct property of `object`. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Object + * @param {Object} object The object to query. + * @param {Array|string} path The path to check. + * @returns {boolean} Returns `true` if `path` exists, else `false`. + * @example + * + * var object = { 'a': { 'b': 2 } }; + * var other = _.create({ 'a': _.create({ 'b': 2 }) }); + * + * _.has(object, 'a'); + * // => true + * + * _.has(object, 'a.b'); + * // => true + * + * _.has(object, ['a', 'b']); + * // => true + * + * _.has(other, 'a'); + * // => false + */ + function has(object, path) { + return object != null && hasPath(object, path, baseHas); + } + + /** + * Checks if `path` is a direct or inherited property of `object`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Object + * @param {Object} object The object to query. + * @param {Array|string} path The path to check. + * @returns {boolean} Returns `true` if `path` exists, else `false`. + * @example + * + * var object = _.create({ 'a': _.create({ 'b': 2 }) }); + * + * _.hasIn(object, 'a'); + * // => true + * + * _.hasIn(object, 'a.b'); + * // => true + * + * _.hasIn(object, ['a', 'b']); + * // => true + * + * _.hasIn(object, 'b'); + * // => false + */ + function hasIn(object, path) { + return object != null && hasPath(object, path, baseHasIn); + } + + /** + * Creates an object composed of the inverted keys and values of `object`. + * If `object` contains duplicate values, subsequent values overwrite + * property assignments of previous values. + * + * @static + * @memberOf _ + * @since 0.7.0 + * @category Object + * @param {Object} object The object to invert. + * @returns {Object} Returns the new inverted object. + * @example + * + * var object = { 'a': 1, 'b': 2, 'c': 1 }; + * + * _.invert(object); + * // => { '1': 'c', '2': 'b' } + */ + var invert = createInverter(function(result, value, key) { + result[value] = key; + }, constant(identity)); + + /** + * This method is like `_.invert` except that the inverted object is generated + * from the results of running each element of `object` thru `iteratee`. The + * corresponding inverted value of each inverted key is an array of keys + * responsible for generating the inverted value. The iteratee is invoked + * with one argument: (value). + * + * @static + * @memberOf _ + * @since 4.1.0 + * @category Object + * @param {Object} object The object to invert. + * @param {Function} [iteratee=_.identity] The iteratee invoked per element. + * @returns {Object} Returns the new inverted object. + * @example + * + * var object = { 'a': 1, 'b': 2, 'c': 1 }; + * + * _.invertBy(object); + * // => { '1': ['a', 'c'], '2': ['b'] } + * + * _.invertBy(object, function(value) { + * return 'group' + value; + * }); + * // => { 'group1': ['a', 'c'], 'group2': ['b'] } + */ + var invertBy = createInverter(function(result, value, key) { + if (hasOwnProperty.call(result, value)) { + result[value].push(key); + } else { + result[value] = [key]; + } + }, getIteratee); + + /** + * Invokes the method at `path` of `object`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Object + * @param {Object} object The object to query. + * @param {Array|string} path The path of the method to invoke. + * @param {...*} [args] The arguments to invoke the method with. + * @returns {*} Returns the result of the invoked method. + * @example + * + * var object = { 'a': [{ 'b': { 'c': [1, 2, 3, 4] } }] }; + * + * _.invoke(object, 'a[0].b.c.slice', 1, 3); + * // => [2, 3] + */ + var invoke = baseRest(baseInvoke); + + /** + * Creates an array of the own enumerable property names of `object`. + * + * **Note:** Non-object values are coerced to objects. See the + * [ES spec](http://ecma-international.org/ecma-262/7.0/#sec-object.keys) + * for more details. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Object + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names. + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.keys(new Foo); + * // => ['a', 'b'] (iteration order is not guaranteed) + * + * _.keys('hi'); + * // => ['0', '1'] + */ + function keys(object) { + return isArrayLike(object) ? arrayLikeKeys(object) : baseKeys(object); + } + + /** + * Creates an array of the own and inherited enumerable property names of `object`. + * + * **Note:** Non-object values are coerced to objects. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Object + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property names. + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.keysIn(new Foo); + * // => ['a', 'b', 'c'] (iteration order is not guaranteed) + */ + function keysIn(object) { + return isArrayLike(object) ? arrayLikeKeys(object, true) : baseKeysIn(object); + } + + /** + * The opposite of `_.mapValues`; this method creates an object with the + * same values as `object` and keys generated by running each own enumerable + * string keyed property of `object` thru `iteratee`. The iteratee is invoked + * with three arguments: (value, key, object). + * + * @static + * @memberOf _ + * @since 3.8.0 + * @category Object + * @param {Object} object The object to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Object} Returns the new mapped object. + * @see _.mapValues + * @example + * + * _.mapKeys({ 'a': 1, 'b': 2 }, function(value, key) { + * return key + value; + * }); + * // => { 'a1': 1, 'b2': 2 } + */ + function mapKeys(object, iteratee) { + var result = {}; + iteratee = getIteratee(iteratee, 3); + + baseForOwn(object, function(value, key, object) { + baseAssignValue(result, iteratee(value, key, object), value); + }); + return result; + } + + /** + * Creates an object with the same keys as `object` and values generated + * by running each own enumerable string keyed property of `object` thru + * `iteratee`. The iteratee is invoked with three arguments: + * (value, key, object). + * + * @static + * @memberOf _ + * @since 2.4.0 + * @category Object + * @param {Object} object The object to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @returns {Object} Returns the new mapped object. + * @see _.mapKeys + * @example + * + * var users = { + * 'fred': { 'user': 'fred', 'age': 40 }, + * 'pebbles': { 'user': 'pebbles', 'age': 1 } + * }; + * + * _.mapValues(users, function(o) { return o.age; }); + * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed) + * + * // The `_.property` iteratee shorthand. + * _.mapValues(users, 'age'); + * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed) + */ + function mapValues(object, iteratee) { + var result = {}; + iteratee = getIteratee(iteratee, 3); + + baseForOwn(object, function(value, key, object) { + baseAssignValue(result, key, iteratee(value, key, object)); + }); + return result; + } + + /** + * This method is like `_.assign` except that it recursively merges own and + * inherited enumerable string keyed properties of source objects into the + * destination object. Source properties that resolve to `undefined` are + * skipped if a destination value exists. Array and plain object properties + * are merged recursively. Other objects and value types are overridden by + * assignment. Source objects are applied from left to right. Subsequent + * sources overwrite property assignments of previous sources. + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 0.5.0 + * @category Object + * @param {Object} object The destination object. + * @param {...Object} [sources] The source objects. + * @returns {Object} Returns `object`. + * @example + * + * var object = { + * 'a': [{ 'b': 2 }, { 'd': 4 }] + * }; + * + * var other = { + * 'a': [{ 'c': 3 }, { 'e': 5 }] + * }; + * + * _.merge(object, other); + * // => { 'a': [{ 'b': 2, 'c': 3 }, { 'd': 4, 'e': 5 }] } + */ + var merge = createAssigner(function(object, source, srcIndex) { + baseMerge(object, source, srcIndex); + }); + + /** + * This method is like `_.merge` except that it accepts `customizer` which + * is invoked to produce the merged values of the destination and source + * properties. If `customizer` returns `undefined`, merging is handled by the + * method instead. The `customizer` is invoked with six arguments: + * (objValue, srcValue, key, object, source, stack). + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Object + * @param {Object} object The destination object. + * @param {...Object} sources The source objects. + * @param {Function} customizer The function to customize assigned values. + * @returns {Object} Returns `object`. + * @example + * + * function customizer(objValue, srcValue) { + * if (_.isArray(objValue)) { + * return objValue.concat(srcValue); + * } + * } + * + * var object = { 'a': [1], 'b': [2] }; + * var other = { 'a': [3], 'b': [4] }; + * + * _.mergeWith(object, other, customizer); + * // => { 'a': [1, 3], 'b': [2, 4] } + */ + var mergeWith = createAssigner(function(object, source, srcIndex, customizer) { + baseMerge(object, source, srcIndex, customizer); + }); + + /** + * The opposite of `_.pick`; this method creates an object composed of the + * own and inherited enumerable property paths of `object` that are not omitted. + * + * **Note:** This method is considerably slower than `_.pick`. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Object + * @param {Object} object The source object. + * @param {...(string|string[])} [paths] The property paths to omit. + * @returns {Object} Returns the new object. + * @example + * + * var object = { 'a': 1, 'b': '2', 'c': 3 }; + * + * _.omit(object, ['a', 'c']); + * // => { 'b': '2' } + */ + var omit = flatRest(function(object, paths) { + var result = {}; + if (object == null) { + return result; + } + var isDeep = false; + paths = arrayMap(paths, function(path) { + path = castPath(path, object); + isDeep || (isDeep = path.length > 1); + return path; + }); + copyObject(object, getAllKeysIn(object), result); + if (isDeep) { + result = baseClone(result, CLONE_DEEP_FLAG | CLONE_FLAT_FLAG | CLONE_SYMBOLS_FLAG, customOmitClone); + } + var length = paths.length; + while (length--) { + baseUnset(result, paths[length]); + } + return result; + }); + + /** + * The opposite of `_.pickBy`; this method creates an object composed of + * the own and inherited enumerable string keyed properties of `object` that + * `predicate` doesn't return truthy for. The predicate is invoked with two + * arguments: (value, key). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Object + * @param {Object} object The source object. + * @param {Function} [predicate=_.identity] The function invoked per property. + * @returns {Object} Returns the new object. + * @example + * + * var object = { 'a': 1, 'b': '2', 'c': 3 }; + * + * _.omitBy(object, _.isNumber); + * // => { 'b': '2' } + */ + function omitBy(object, predicate) { + return pickBy(object, negate(getIteratee(predicate))); + } + + /** + * Creates an object composed of the picked `object` properties. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Object + * @param {Object} object The source object. + * @param {...(string|string[])} [paths] The property paths to pick. + * @returns {Object} Returns the new object. + * @example + * + * var object = { 'a': 1, 'b': '2', 'c': 3 }; + * + * _.pick(object, ['a', 'c']); + * // => { 'a': 1, 'c': 3 } + */ + var pick = flatRest(function(object, paths) { + return object == null ? {} : basePick(object, paths); + }); + + /** + * Creates an object composed of the `object` properties `predicate` returns + * truthy for. The predicate is invoked with two arguments: (value, key). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Object + * @param {Object} object The source object. + * @param {Function} [predicate=_.identity] The function invoked per property. + * @returns {Object} Returns the new object. + * @example + * + * var object = { 'a': 1, 'b': '2', 'c': 3 }; + * + * _.pickBy(object, _.isNumber); + * // => { 'a': 1, 'c': 3 } + */ + function pickBy(object, predicate) { + if (object == null) { + return {}; + } + var props = arrayMap(getAllKeysIn(object), function(prop) { + return [prop]; + }); + predicate = getIteratee(predicate); + return basePickBy(object, props, function(value, path) { + return predicate(value, path[0]); + }); + } + + /** + * This method is like `_.get` except that if the resolved value is a + * function it's invoked with the `this` binding of its parent object and + * its result is returned. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Object + * @param {Object} object The object to query. + * @param {Array|string} path The path of the property to resolve. + * @param {*} [defaultValue] The value returned for `undefined` resolved values. + * @returns {*} Returns the resolved value. + * @example + * + * var object = { 'a': [{ 'b': { 'c1': 3, 'c2': _.constant(4) } }] }; + * + * _.result(object, 'a[0].b.c1'); + * // => 3 + * + * _.result(object, 'a[0].b.c2'); + * // => 4 + * + * _.result(object, 'a[0].b.c3', 'default'); + * // => 'default' + * + * _.result(object, 'a[0].b.c3', _.constant('default')); + * // => 'default' + */ + function result(object, path, defaultValue) { + path = castPath(path, object); + + var index = -1, + length = path.length; + + // Ensure the loop is entered when path is empty. + if (!length) { + length = 1; + object = undefined; + } + while (++index < length) { + var value = object == null ? undefined : object[toKey(path[index])]; + if (value === undefined) { + index = length; + value = defaultValue; + } + object = isFunction(value) ? value.call(object) : value; + } + return object; + } + + /** + * Sets the value at `path` of `object`. If a portion of `path` doesn't exist, + * it's created. Arrays are created for missing index properties while objects + * are created for all other missing properties. Use `_.setWith` to customize + * `path` creation. + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 3.7.0 + * @category Object + * @param {Object} object The object to modify. + * @param {Array|string} path The path of the property to set. + * @param {*} value The value to set. + * @returns {Object} Returns `object`. + * @example + * + * var object = { 'a': [{ 'b': { 'c': 3 } }] }; + * + * _.set(object, 'a[0].b.c', 4); + * console.log(object.a[0].b.c); + * // => 4 + * + * _.set(object, ['x', '0', 'y', 'z'], 5); + * console.log(object.x[0].y.z); + * // => 5 + */ + function set(object, path, value) { + return object == null ? object : baseSet(object, path, value); + } + + /** + * This method is like `_.set` except that it accepts `customizer` which is + * invoked to produce the objects of `path`. If `customizer` returns `undefined` + * path creation is handled by the method instead. The `customizer` is invoked + * with three arguments: (nsValue, key, nsObject). + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Object + * @param {Object} object The object to modify. + * @param {Array|string} path The path of the property to set. + * @param {*} value The value to set. + * @param {Function} [customizer] The function to customize assigned values. + * @returns {Object} Returns `object`. + * @example + * + * var object = {}; + * + * _.setWith(object, '[0][1]', 'a', Object); + * // => { '0': { '1': 'a' } } + */ + function setWith(object, path, value, customizer) { + customizer = typeof customizer == 'function' ? customizer : undefined; + return object == null ? object : baseSet(object, path, value, customizer); + } + + /** + * Creates an array of own enumerable string keyed-value pairs for `object` + * which can be consumed by `_.fromPairs`. If `object` is a map or set, its + * entries are returned. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @alias entries + * @category Object + * @param {Object} object The object to query. + * @returns {Array} Returns the key-value pairs. + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.toPairs(new Foo); + * // => [['a', 1], ['b', 2]] (iteration order is not guaranteed) + */ + var toPairs = createToPairs(keys); + + /** + * Creates an array of own and inherited enumerable string keyed-value pairs + * for `object` which can be consumed by `_.fromPairs`. If `object` is a map + * or set, its entries are returned. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @alias entriesIn + * @category Object + * @param {Object} object The object to query. + * @returns {Array} Returns the key-value pairs. + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.toPairsIn(new Foo); + * // => [['a', 1], ['b', 2], ['c', 3]] (iteration order is not guaranteed) + */ + var toPairsIn = createToPairs(keysIn); + + /** + * An alternative to `_.reduce`; this method transforms `object` to a new + * `accumulator` object which is the result of running each of its own + * enumerable string keyed properties thru `iteratee`, with each invocation + * potentially mutating the `accumulator` object. If `accumulator` is not + * provided, a new object with the same `[[Prototype]]` will be used. The + * iteratee is invoked with four arguments: (accumulator, value, key, object). + * Iteratee functions may exit iteration early by explicitly returning `false`. + * + * @static + * @memberOf _ + * @since 1.3.0 + * @category Object + * @param {Object} object The object to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @param {*} [accumulator] The custom accumulator value. + * @returns {*} Returns the accumulated value. + * @example + * + * _.transform([2, 3, 4], function(result, n) { + * result.push(n *= n); + * return n % 2 == 0; + * }, []); + * // => [4, 9] + * + * _.transform({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) { + * (result[value] || (result[value] = [])).push(key); + * }, {}); + * // => { '1': ['a', 'c'], '2': ['b'] } + */ + function transform(object, iteratee, accumulator) { + var isArr = isArray(object), + isArrLike = isArr || isBuffer(object) || isTypedArray(object); + + iteratee = getIteratee(iteratee, 4); + if (accumulator == null) { + var Ctor = object && object.constructor; + if (isArrLike) { + accumulator = isArr ? new Ctor : []; + } + else if (isObject(object)) { + accumulator = isFunction(Ctor) ? baseCreate(getPrototype(object)) : {}; + } + else { + accumulator = {}; + } + } + (isArrLike ? arrayEach : baseForOwn)(object, function(value, index, object) { + return iteratee(accumulator, value, index, object); + }); + return accumulator; + } + + /** + * Removes the property at `path` of `object`. + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Object + * @param {Object} object The object to modify. + * @param {Array|string} path The path of the property to unset. + * @returns {boolean} Returns `true` if the property is deleted, else `false`. + * @example + * + * var object = { 'a': [{ 'b': { 'c': 7 } }] }; + * _.unset(object, 'a[0].b.c'); + * // => true + * + * console.log(object); + * // => { 'a': [{ 'b': {} }] }; + * + * _.unset(object, ['a', '0', 'b', 'c']); + * // => true + * + * console.log(object); + * // => { 'a': [{ 'b': {} }] }; + */ + function unset(object, path) { + return object == null ? true : baseUnset(object, path); + } + + /** + * This method is like `_.set` except that accepts `updater` to produce the + * value to set. Use `_.updateWith` to customize `path` creation. The `updater` + * is invoked with one argument: (value). + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 4.6.0 + * @category Object + * @param {Object} object The object to modify. + * @param {Array|string} path The path of the property to set. + * @param {Function} updater The function to produce the updated value. + * @returns {Object} Returns `object`. + * @example + * + * var object = { 'a': [{ 'b': { 'c': 3 } }] }; + * + * _.update(object, 'a[0].b.c', function(n) { return n * n; }); + * console.log(object.a[0].b.c); + * // => 9 + * + * _.update(object, 'x[0].y.z', function(n) { return n ? n + 1 : 0; }); + * console.log(object.x[0].y.z); + * // => 0 + */ + function update(object, path, updater) { + return object == null ? object : baseUpdate(object, path, castFunction(updater)); + } + + /** + * This method is like `_.update` except that it accepts `customizer` which is + * invoked to produce the objects of `path`. If `customizer` returns `undefined` + * path creation is handled by the method instead. The `customizer` is invoked + * with three arguments: (nsValue, key, nsObject). + * + * **Note:** This method mutates `object`. + * + * @static + * @memberOf _ + * @since 4.6.0 + * @category Object + * @param {Object} object The object to modify. + * @param {Array|string} path The path of the property to set. + * @param {Function} updater The function to produce the updated value. + * @param {Function} [customizer] The function to customize assigned values. + * @returns {Object} Returns `object`. + * @example + * + * var object = {}; + * + * _.updateWith(object, '[0][1]', _.constant('a'), Object); + * // => { '0': { '1': 'a' } } + */ + function updateWith(object, path, updater, customizer) { + customizer = typeof customizer == 'function' ? customizer : undefined; + return object == null ? object : baseUpdate(object, path, castFunction(updater), customizer); + } + + /** + * Creates an array of the own enumerable string keyed property values of `object`. + * + * **Note:** Non-object values are coerced to objects. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category Object + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property values. + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.values(new Foo); + * // => [1, 2] (iteration order is not guaranteed) + * + * _.values('hi'); + * // => ['h', 'i'] + */ + function values(object) { + return object == null ? [] : baseValues(object, keys(object)); + } + + /** + * Creates an array of the own and inherited enumerable string keyed property + * values of `object`. + * + * **Note:** Non-object values are coerced to objects. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category Object + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property values. + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.valuesIn(new Foo); + * // => [1, 2, 3] (iteration order is not guaranteed) + */ + function valuesIn(object) { + return object == null ? [] : baseValues(object, keysIn(object)); + } + + /*------------------------------------------------------------------------*/ + + /** + * Clamps `number` within the inclusive `lower` and `upper` bounds. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category Number + * @param {number} number The number to clamp. + * @param {number} [lower] The lower bound. + * @param {number} upper The upper bound. + * @returns {number} Returns the clamped number. + * @example + * + * _.clamp(-10, -5, 5); + * // => -5 + * + * _.clamp(10, -5, 5); + * // => 5 + */ + function clamp(number, lower, upper) { + if (upper === undefined) { + upper = lower; + lower = undefined; + } + if (upper !== undefined) { + upper = toNumber(upper); + upper = upper === upper ? upper : 0; + } + if (lower !== undefined) { + lower = toNumber(lower); + lower = lower === lower ? lower : 0; + } + return baseClamp(toNumber(number), lower, upper); + } + + /** + * Checks if `n` is between `start` and up to, but not including, `end`. If + * `end` is not specified, it's set to `start` with `start` then set to `0`. + * If `start` is greater than `end` the params are swapped to support + * negative ranges. + * + * @static + * @memberOf _ + * @since 3.3.0 + * @category Number + * @param {number} number The number to check. + * @param {number} [start=0] The start of the range. + * @param {number} end The end of the range. + * @returns {boolean} Returns `true` if `number` is in the range, else `false`. + * @see _.range, _.rangeRight + * @example + * + * _.inRange(3, 2, 4); + * // => true + * + * _.inRange(4, 8); + * // => true + * + * _.inRange(4, 2); + * // => false + * + * _.inRange(2, 2); + * // => false + * + * _.inRange(1.2, 2); + * // => true + * + * _.inRange(5.2, 4); + * // => false + * + * _.inRange(-3, -2, -6); + * // => true + */ + function inRange(number, start, end) { + start = toFinite(start); + if (end === undefined) { + end = start; + start = 0; + } else { + end = toFinite(end); + } + number = toNumber(number); + return baseInRange(number, start, end); + } + + /** + * Produces a random number between the inclusive `lower` and `upper` bounds. + * If only one argument is provided a number between `0` and the given number + * is returned. If `floating` is `true`, or either `lower` or `upper` are + * floats, a floating-point number is returned instead of an integer. + * + * **Note:** JavaScript follows the IEEE-754 standard for resolving + * floating-point values which can produce unexpected results. + * + * @static + * @memberOf _ + * @since 0.7.0 + * @category Number + * @param {number} [lower=0] The lower bound. + * @param {number} [upper=1] The upper bound. + * @param {boolean} [floating] Specify returning a floating-point number. + * @returns {number} Returns the random number. + * @example + * + * _.random(0, 5); + * // => an integer between 0 and 5 + * + * _.random(5); + * // => also an integer between 0 and 5 + * + * _.random(5, true); + * // => a floating-point number between 0 and 5 + * + * _.random(1.2, 5.2); + * // => a floating-point number between 1.2 and 5.2 + */ + function random(lower, upper, floating) { + if (floating && typeof floating != 'boolean' && isIterateeCall(lower, upper, floating)) { + upper = floating = undefined; + } + if (floating === undefined) { + if (typeof upper == 'boolean') { + floating = upper; + upper = undefined; + } + else if (typeof lower == 'boolean') { + floating = lower; + lower = undefined; + } + } + if (lower === undefined && upper === undefined) { + lower = 0; + upper = 1; + } + else { + lower = toFinite(lower); + if (upper === undefined) { + upper = lower; + lower = 0; + } else { + upper = toFinite(upper); + } + } + if (lower > upper) { + var temp = lower; + lower = upper; + upper = temp; + } + if (floating || lower % 1 || upper % 1) { + var rand = nativeRandom(); + return nativeMin(lower + (rand * (upper - lower + freeParseFloat('1e-' + ((rand + '').length - 1)))), upper); + } + return baseRandom(lower, upper); + } + + /*------------------------------------------------------------------------*/ + + /** + * Converts `string` to [camel case](https://en.wikipedia.org/wiki/CamelCase). + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to convert. + * @returns {string} Returns the camel cased string. + * @example + * + * _.camelCase('Foo Bar'); + * // => 'fooBar' + * + * _.camelCase('--foo-bar--'); + * // => 'fooBar' + * + * _.camelCase('__FOO_BAR__'); + * // => 'fooBar' + */ + var camelCase = createCompounder(function(result, word, index) { + word = word.toLowerCase(); + return result + (index ? capitalize(word) : word); + }); + + /** + * Converts the first character of `string` to upper case and the remaining + * to lower case. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to capitalize. + * @returns {string} Returns the capitalized string. + * @example + * + * _.capitalize('FRED'); + * // => 'Fred' + */ + function capitalize(string) { + return upperFirst(toString(string).toLowerCase()); + } + + /** + * Deburrs `string` by converting + * [Latin-1 Supplement](https://en.wikipedia.org/wiki/Latin-1_Supplement_(Unicode_block)#Character_table) + * and [Latin Extended-A](https://en.wikipedia.org/wiki/Latin_Extended-A) + * letters to basic Latin letters and removing + * [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks). + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to deburr. + * @returns {string} Returns the deburred string. + * @example + * + * _.deburr('déjà vu'); + * // => 'deja vu' + */ + function deburr(string) { + string = toString(string); + return string && string.replace(reLatin, deburrLetter).replace(reComboMark, ''); + } + + /** + * Checks if `string` ends with the given target string. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to inspect. + * @param {string} [target] The string to search for. + * @param {number} [position=string.length] The position to search up to. + * @returns {boolean} Returns `true` if `string` ends with `target`, + * else `false`. + * @example + * + * _.endsWith('abc', 'c'); + * // => true + * + * _.endsWith('abc', 'b'); + * // => false + * + * _.endsWith('abc', 'b', 2); + * // => true + */ + function endsWith(string, target, position) { + string = toString(string); + target = baseToString(target); + + var length = string.length; + position = position === undefined + ? length + : baseClamp(toInteger(position), 0, length); + + var end = position; + position -= target.length; + return position >= 0 && string.slice(position, end) == target; + } + + /** + * Converts the characters "&", "<", ">", '"', and "'" in `string` to their + * corresponding HTML entities. + * + * **Note:** No other characters are escaped. To escape additional + * characters use a third-party library like [_he_](https://mths.be/he). + * + * Though the ">" character is escaped for symmetry, characters like + * ">" and "/" don't need escaping in HTML and have no special meaning + * unless they're part of a tag or unquoted attribute value. See + * [Mathias Bynens's article](https://mathiasbynens.be/notes/ambiguous-ampersands) + * (under "semi-related fun fact") for more details. + * + * When working with HTML you should always + * [quote attribute values](http://wonko.com/post/html-escaping) to reduce + * XSS vectors. + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category String + * @param {string} [string=''] The string to escape. + * @returns {string} Returns the escaped string. + * @example + * + * _.escape('fred, barney, & pebbles'); + * // => 'fred, barney, & pebbles' + */ + function escape(string) { + string = toString(string); + return (string && reHasUnescapedHtml.test(string)) + ? string.replace(reUnescapedHtml, escapeHtmlChar) + : string; + } + + /** + * Escapes the `RegExp` special characters "^", "$", "\", ".", "*", "+", + * "?", "(", ")", "[", "]", "{", "}", and "|" in `string`. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to escape. + * @returns {string} Returns the escaped string. + * @example + * + * _.escapeRegExp('[lodash](https://lodash.com/)'); + * // => '\[lodash\]\(https://lodash\.com/\)' + */ + function escapeRegExp(string) { + string = toString(string); + return (string && reHasRegExpChar.test(string)) + ? string.replace(reRegExpChar, '\\$&') + : string; + } + + /** + * Converts `string` to + * [kebab case](https://en.wikipedia.org/wiki/Letter_case#Special_case_styles). + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to convert. + * @returns {string} Returns the kebab cased string. + * @example + * + * _.kebabCase('Foo Bar'); + * // => 'foo-bar' + * + * _.kebabCase('fooBar'); + * // => 'foo-bar' + * + * _.kebabCase('__FOO_BAR__'); + * // => 'foo-bar' + */ + var kebabCase = createCompounder(function(result, word, index) { + return result + (index ? '-' : '') + word.toLowerCase(); + }); + + /** + * Converts `string`, as space separated words, to lower case. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category String + * @param {string} [string=''] The string to convert. + * @returns {string} Returns the lower cased string. + * @example + * + * _.lowerCase('--Foo-Bar--'); + * // => 'foo bar' + * + * _.lowerCase('fooBar'); + * // => 'foo bar' + * + * _.lowerCase('__FOO_BAR__'); + * // => 'foo bar' + */ + var lowerCase = createCompounder(function(result, word, index) { + return result + (index ? ' ' : '') + word.toLowerCase(); + }); + + /** + * Converts the first character of `string` to lower case. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category String + * @param {string} [string=''] The string to convert. + * @returns {string} Returns the converted string. + * @example + * + * _.lowerFirst('Fred'); + * // => 'fred' + * + * _.lowerFirst('FRED'); + * // => 'fRED' + */ + var lowerFirst = createCaseFirst('toLowerCase'); + + /** + * Pads `string` on the left and right sides if it's shorter than `length`. + * Padding characters are truncated if they can't be evenly divided by `length`. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to pad. + * @param {number} [length=0] The padding length. + * @param {string} [chars=' '] The string used as padding. + * @returns {string} Returns the padded string. + * @example + * + * _.pad('abc', 8); + * // => ' abc ' + * + * _.pad('abc', 8, '_-'); + * // => '_-abc_-_' + * + * _.pad('abc', 3); + * // => 'abc' + */ + function pad(string, length, chars) { + string = toString(string); + length = toInteger(length); + + var strLength = length ? stringSize(string) : 0; + if (!length || strLength >= length) { + return string; + } + var mid = (length - strLength) / 2; + return ( + createPadding(nativeFloor(mid), chars) + + string + + createPadding(nativeCeil(mid), chars) + ); + } + + /** + * Pads `string` on the right side if it's shorter than `length`. Padding + * characters are truncated if they exceed `length`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category String + * @param {string} [string=''] The string to pad. + * @param {number} [length=0] The padding length. + * @param {string} [chars=' '] The string used as padding. + * @returns {string} Returns the padded string. + * @example + * + * _.padEnd('abc', 6); + * // => 'abc ' + * + * _.padEnd('abc', 6, '_-'); + * // => 'abc_-_' + * + * _.padEnd('abc', 3); + * // => 'abc' + */ + function padEnd(string, length, chars) { + string = toString(string); + length = toInteger(length); + + var strLength = length ? stringSize(string) : 0; + return (length && strLength < length) + ? (string + createPadding(length - strLength, chars)) + : string; + } + + /** + * Pads `string` on the left side if it's shorter than `length`. Padding + * characters are truncated if they exceed `length`. + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category String + * @param {string} [string=''] The string to pad. + * @param {number} [length=0] The padding length. + * @param {string} [chars=' '] The string used as padding. + * @returns {string} Returns the padded string. + * @example + * + * _.padStart('abc', 6); + * // => ' abc' + * + * _.padStart('abc', 6, '_-'); + * // => '_-_abc' + * + * _.padStart('abc', 3); + * // => 'abc' + */ + function padStart(string, length, chars) { + string = toString(string); + length = toInteger(length); + + var strLength = length ? stringSize(string) : 0; + return (length && strLength < length) + ? (createPadding(length - strLength, chars) + string) + : string; + } + + /** + * Converts `string` to an integer of the specified radix. If `radix` is + * `undefined` or `0`, a `radix` of `10` is used unless `value` is a + * hexadecimal, in which case a `radix` of `16` is used. + * + * **Note:** This method aligns with the + * [ES5 implementation](https://es5.github.io/#x15.1.2.2) of `parseInt`. + * + * @static + * @memberOf _ + * @since 1.1.0 + * @category String + * @param {string} string The string to convert. + * @param {number} [radix=10] The radix to interpret `value` by. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {number} Returns the converted integer. + * @example + * + * _.parseInt('08'); + * // => 8 + * + * _.map(['6', '08', '10'], _.parseInt); + * // => [6, 8, 10] + */ + function parseInt(string, radix, guard) { + if (guard || radix == null) { + radix = 0; + } else if (radix) { + radix = +radix; + } + return nativeParseInt(toString(string).replace(reTrimStart, ''), radix || 0); + } + + /** + * Repeats the given string `n` times. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to repeat. + * @param {number} [n=1] The number of times to repeat the string. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {string} Returns the repeated string. + * @example + * + * _.repeat('*', 3); + * // => '***' + * + * _.repeat('abc', 2); + * // => 'abcabc' + * + * _.repeat('abc', 0); + * // => '' + */ + function repeat(string, n, guard) { + if ((guard ? isIterateeCall(string, n, guard) : n === undefined)) { + n = 1; + } else { + n = toInteger(n); + } + return baseRepeat(toString(string), n); + } + + /** + * Replaces matches for `pattern` in `string` with `replacement`. + * + * **Note:** This method is based on + * [`String#replace`](https://mdn.io/String/replace). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category String + * @param {string} [string=''] The string to modify. + * @param {RegExp|string} pattern The pattern to replace. + * @param {Function|string} replacement The match replacement. + * @returns {string} Returns the modified string. + * @example + * + * _.replace('Hi Fred', 'Fred', 'Barney'); + * // => 'Hi Barney' + */ + function replace() { + var args = arguments, + string = toString(args[0]); + + return args.length < 3 ? string : string.replace(args[1], args[2]); + } + + /** + * Converts `string` to + * [snake case](https://en.wikipedia.org/wiki/Snake_case). + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to convert. + * @returns {string} Returns the snake cased string. + * @example + * + * _.snakeCase('Foo Bar'); + * // => 'foo_bar' + * + * _.snakeCase('fooBar'); + * // => 'foo_bar' + * + * _.snakeCase('--FOO-BAR--'); + * // => 'foo_bar' + */ + var snakeCase = createCompounder(function(result, word, index) { + return result + (index ? '_' : '') + word.toLowerCase(); + }); + + /** + * Splits `string` by `separator`. + * + * **Note:** This method is based on + * [`String#split`](https://mdn.io/String/split). + * + * @static + * @memberOf _ + * @since 4.0.0 + * @category String + * @param {string} [string=''] The string to split. + * @param {RegExp|string} separator The separator pattern to split by. + * @param {number} [limit] The length to truncate results to. + * @returns {Array} Returns the string segments. + * @example + * + * _.split('a-b-c', '-', 2); + * // => ['a', 'b'] + */ + function split(string, separator, limit) { + if (limit && typeof limit != 'number' && isIterateeCall(string, separator, limit)) { + separator = limit = undefined; + } + limit = limit === undefined ? MAX_ARRAY_LENGTH : limit >>> 0; + if (!limit) { + return []; + } + string = toString(string); + if (string && ( + typeof separator == 'string' || + (separator != null && !isRegExp(separator)) + )) { + separator = baseToString(separator); + if (!separator && hasUnicode(string)) { + return castSlice(stringToArray(string), 0, limit); + } + } + return string.split(separator, limit); + } + + /** + * Converts `string` to + * [start case](https://en.wikipedia.org/wiki/Letter_case#Stylistic_or_specialised_usage). + * + * @static + * @memberOf _ + * @since 3.1.0 + * @category String + * @param {string} [string=''] The string to convert. + * @returns {string} Returns the start cased string. + * @example + * + * _.startCase('--foo-bar--'); + * // => 'Foo Bar' + * + * _.startCase('fooBar'); + * // => 'Foo Bar' + * + * _.startCase('__FOO_BAR__'); + * // => 'FOO BAR' + */ + var startCase = createCompounder(function(result, word, index) { + return result + (index ? ' ' : '') + upperFirst(word); + }); + + /** + * Checks if `string` starts with the given target string. + * + * @static + * @memberOf _ + * @since 3.0.0 + * @category String + * @param {string} [string=''] The string to inspect. + * @param {string} [target] The string to search for. + * @param {number} [position=0] The position to search from. + * @returns {boolean} Returns `true` if `string` starts with `target`, + * else `false`. + * @example + * + * _.startsWith('abc', 'a'); + * // => true + * + * _.startsWith('abc', 'b'); + * // => false + * + * _.startsWith('abc', 'b', 1); + * // => true + */ + function startsWith(string, target, position) { + string = toString(string); + position = position == null + ? 0 + : baseClamp(toInteger(position), 0, string.length); + + target = baseToString(target); + return string.slice(position, position + target.length) == target; + } + + /** + * Creates a compiled template function that can interpolate data properties + * in "interpolate" delimiters, HTML-escape interpolated data properties in + * "escape" delimiters, and execute JavaScript in "evaluate" delimiters. Data + * properties may be accessed as free variables in the template. If a setting + * object is given, it takes precedence over `_.templateSettings` values. + * + * **Note:** In the development build `_.template` utilizes + * [sourceURLs](http://www.html5rocks.com/en/tutorials/developertools/sourcemaps/#toc-sourceurl) + * for easier debugging. + * + * For more information on precompiling templates see + * [lodash's custom builds documentation](https://lodash.com/custom-builds). + * + * For more information on Chrome extension sandboxes see + * [Chrome's extensions documentation](https://developer.chrome.com/extensions/sandboxingEval). + * + * @static + * @since 0.1.0 + * @memberOf _ + * @category String + * @param {string} [string=''] The template string. + * @param {Object} [options={}] The options object. + * @param {RegExp} [options.escape=_.templateSettings.escape] + * The HTML "escape" delimiter. + * @param {RegExp} [options.evaluate=_.templateSettings.evaluate] + * The "evaluate" delimiter. + * @param {Object} [options.imports=_.templateSettings.imports] + * An object to import into the template as free variables. + * @param {RegExp} [options.interpolate=_.templateSettings.interpolate] + * The "interpolate" delimiter. + * @param {string} [options.sourceURL='lodash.templateSources[n]'] + * The sourceURL of the compiled template. + * @param {string} [options.variable='obj'] + * The data object variable name. + * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. + * @returns {Function} Returns the compiled template function. + * @example + * + * // Use the "interpolate" delimiter to create a compiled template. + * var compiled = _.template('hello <%= user %>!'); + * compiled({ 'user': 'fred' }); + * // => 'hello fred!' + * + * // Use the HTML "escape" delimiter to escape data property values. + * var compiled = _.template('<%- value %>'); + * compiled({ 'value': '